API tools faq
paste
Advertisement
DoggoClan

KI

DoggoClan
May 21st, 2018
196
0
Never
Add comment
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 198.10 KB | None | 0 0
raw download clone embed print report
  1. --//====================================================\\--
  2. --|| CREATED BY XDAVODIOX ||--
  3. --\\====================================================//--
  4.  
  5. --=================================================================--
  6. --Don't you even fucking dare leak or steal this, you fucking skid!--
  7. --=================================================================--
  8.  
  9. wait(1 / 60)
  10. Effects = { }music=false
  11. local Player = game:GetService("Players").localPlayer
  12. local Character = Player.Character
  13. local Humanoid = Character:FindFirstChildOfClass("Humanoid")
  14. local Mouse = Player:GetMouse()
  15. local LeftArm = Character["Left Arm"]
  16. local RightArm = Character["Right Arm"]
  17. local LeftLeg = Character["Left Leg"]
  18. local RightLeg = Character["Right Leg"]
  19. local Head = Character.Head
  20. local Torso = Character.Torso
  21. local Camera = workspace.CurrentCamera
  22. local RootPart = Character.HumanoidRootPart
  23. local RootJoint = RootPart.RootJoint
  24. Me = game.Players.LocalPlayer
  25. char = Me.Character
  26. larm = char["Left Arm"]
  27. rarm = char["Right Arm"]
  28. lleg = char["Left Leg"]
  29. rleg = char["Right Leg"]
  30. torso = char.Torso
  31. local Player = game.Players.localPlayer
  32. local Character = Player.Character
  33. local Humanoid = Character.Humanoid
  34. local Mouse = Player:GetMouse()
  35. local LeftArm = Character["Left Arm"]
  36. local RightArm = Character["Right Arm"]
  37. local LeftLeg = Character["Left Leg"]
  38. local RightLeg = Character["Right Leg"]
  39. local Head = Character.Head
  40. local Torso = Character.Torso
  41. local Camera = game.Workspace.CurrentCamera
  42. local RootPart = Character.HumanoidRootPart
  43. local RootJoint = RootPart.RootJoint
  44. local Player = game.Players.localPlayer
  45. local Character = Player.Character
  46. local plr = game:service'Players'.LocalPlayer
  47. local Humanoid = Character.Humanoid
  48. local char = plr.Character
  49. local hum = char.Humanoid
  50. local ra = char["Right Arm"]
  51. local la= char["Left Arm"]
  52. local rl= char["Right Leg"]
  53. local ll = char["Left Leg"]
  54. local hed = char.Head
  55. local root = char.HumanoidRootPart
  56. local rootj = root.RootJoint
  57. local tors = char.Torso
  58. local mouse = plr:GetMouse()
  59. local RootCF = CFrame.fromEulerAnglesXYZ(-1.57, 0, 3.14)
  60. local RHCF = CFrame.fromEulerAnglesXYZ(0, 1.6, 0)
  61. local LHCF = CFrame.fromEulerAnglesXYZ(0, -1.6, 0)
  62. local cam = game.Workspace.CurrentCamera
  63. trazx = Instance.new("ParticleEmitter")
  64. c = game.Players.LocalPlayer.Character
  65. local sick = Instance.new("Sound",Character)
  66. sick.SoundId = "rbxassetid://520532102"
  67. sick.Looped = false
  68. sick.Pitch = 1
  69. sick.Volume = 10
  70. sick.TimePosition = 3.8
  71. CF = CFrame.new
  72. angles = CFrame.Angles
  73. attack = false
  74. timetofly = true
  75. Euler = CFrame.fromEulerAnglesXYZ
  76. Rad = math.rad
  77. IT = Instance.new
  78. BrickC = BrickColor.new
  79. Cos = math.cos
  80. Acos = math.acos
  81. Sin = math.sin
  82. Asin = math.asin
  83. Abs = math.abs
  84. Mrandom = math.random
  85. Floor = math.floor
  86. random = math.random
  87. radian = math.rad
  88. Vec3 = Vector3.new
  89. cFrame = CFrame.new
  90. Euler = CFrame.fromEulerAnglesXYZ
  91.  
  92. lleg.Transparency = 1
  93. rleg.Transparency = 1
  94. larm.Transparency = 1
  95. rarm.Transparency = 1
  96. torso.Transparency = 1
  97. ------------------------------------------------------------------ Player -------------------------------------------------------------------
  98.  
  99. ----------------------------------------------------------------- Left Arm -----------------------------------------------------------------
  100. larm1 = Instance.new("Part", char)
  101. larm1.Name = "Middle"
  102. larm1.BrickColor = BrickColor.new("Really red")
  103. larm1.Size = Vector3.new(1, 2, 1)
  104. larm1.CanCollide = false
  105. larm1.BottomSurface = "Smooth"
  106. larm1.TopSurface = "Smooth"
  107. larm1.Material = "Neon"
  108. Weld = Instance.new("Weld",larm)
  109. Weld.Part0 = larm
  110. Weld.C0 = CFrame.new(1.50225258, 0.0474791527, -0.0102558136, -0.999930143, -0.0050761546, -0.0106693096, -0.00506608794, 0.999986708, -0.000970000518, 0.0106740929, -0.00091586099, -0.999942601)
  111. Weld.Part1 = larm1
  112. Weld.C1 = CFrame.new(1.50225258, 0.0474791527, -0.0102558136, -0.999930143, -0.0050761546, -0.0106693096, -0.00506608794, 0.999986708, -0.000970000518, 0.0106740929, -0.00091586099, -0.999942601)
  113.  
  114. larm2 = Instance.new("Part", char)
  115. larm2.BrickColor = BrickColor.new("Really black")
  116. larm2.Size = Vector3.new(1, 0.4, 1)
  117. larm2.CanCollide = false
  118. larm2.BottomSurface = "Smooth"
  119. larm2.TopSurface = "Smooth"
  120. Weld = Instance.new("Weld",larm)
  121. Weld.Part0 = larm
  122. Weld.C0 = CFrame.new(1.50225258, 0.0474791527, -0.0102558136, -0.999930143, -0.0050761546, -0.0106693096, -0.00506608794, 0.999986708, -0.000970000518, 0.0106740929, -0.00091586099, -0.999942601)
  123. Weld.Part1 = larm2
  124. Weld.C1 = CFrame.new(-0.452633858, -0.349740982, -1.50225353, -0.00506608887, 0.999986708, -0.00096991309, -0.0106740929, 0.000915773562, 0.999942601, 0.999930143, 0.0050761546, 0.0106693096)
  125.  
  126. larm3 = Instance.new("Part", char)
  127. larm3.BrickColor = BrickColor.new("Really black")
  128. larm3.Size = Vector3.new(1, 0.4, 1)
  129. larm3.CanCollide = false
  130. larm3.BottomSurface = "Smooth"
  131. larm3.TopSurface = "Smooth"
  132. Weld = Instance.new("Weld",larm)
  133. Weld.Part0 = larm
  134. Weld.C0 = CFrame.new(1.50225258, 0.0474791527, -0.0102558136, -0.999930143, -0.0050761546, -0.0106693096, -0.00506608794, 0.999986708, -0.000970000518, 0.0106740929, -0.00091586099, -0.999942601)
  135. Weld.Part1 = larm3
  136. Weld.C1 = CFrame.new(-0.452513218, -1.90224648, -0.0102577209, -0.00506604509, 0.999986708, -0.000969912624, 0.999930143, 0.00507611083, 0.0106693096, 0.0106740929, -0.000915773562, -0.999942601)
  137.  
  138. larm4 = Instance.new("Part", char)
  139. larm4.BrickColor = BrickColor.new("Really black")
  140. larm4.Size = Vector3.new(1, 0.4, 1)
  141. larm4.CanCollide = false
  142. larm4.BottomSurface = "Smooth"
  143. larm4.TopSurface = "Smooth"
  144. Weld = Instance.new("Weld",larm)
  145. Weld.Part0 = larm
  146. Weld.C0 = CFrame.new(1.50225258, 0.0474791527, -0.0102558136, -0.999930143, -0.0050761546, -0.0106693096, -0.00506608794, 0.999986708, -0.000970000518, 0.0106740929, -0.00091586099, -0.999942601)
  147. Weld.Part1 = larm4
  148. Weld.C1 = CFrame.new(-0.452511787, -0.41024971, 1.50225258, -0.00506623974, 0.999986708, -0.000969914719, 0.0106740929, -0.000915773562, -0.999942601, -0.999930143, -0.00507630548, -0.0106693096)
  149.  
  150. larm5 = Instance.new("Part", char)
  151. larm5.BrickColor = BrickColor.new("Really black")
  152. larm5.Size = Vector3.new(1, 0.4, 1)
  153. larm5.CanCollide = false
  154. larm5.BottomSurface = "Smooth"
  155. larm5.TopSurface = "Smooth"
  156. Weld = Instance.new("Weld",larm)
  157. Weld.Part0 = larm
  158. Weld.C0 = CFrame.new(1.50225258, 0.0474791527, -0.0102558136, -0.999930143, -0.0050761546, -0.0106693096, -0.00506608794, 0.999986708, -0.000970000518, 0.0106740929, -0.00091586099, -0.999942601)
  159. Weld.Part1 = larm5
  160. Weld.C1 = CFrame.new(-1.50225163, -0.762512684, 0.0102577209, 0.999930143, 0.0050761546, 0.0106693534, -0.00506608794, 0.999986708, -0.000970000518, -0.0106741367, 0.000915860757, 0.999942601)
  161.  
  162. larm6 = Instance.new("Part", char)
  163. larm6.BrickColor = BrickColor.new("Really black")
  164. larm6.Size = Vector3.new(1, 0.4, 1)
  165. larm6.CanCollide = false
  166. larm6.BottomSurface = "Smooth"
  167. larm6.TopSurface = "Smooth"
  168. Mesh = Instance.new("SpecialMesh", larm6)
  169. Mesh.MeshType = "Brick"
  170. Mesh.Scale = Vector3.new(1.1, 1.1, 1.1)
  171. Weld = Instance.new("Weld",larm)
  172. Weld.Part0 = larm
  173. Weld.C0 = CFrame.new(1.50225258, 0.0474791527, -0.0102558136, -0.999930143, -0.0050761546, -0.0106693096, -0.00506608794, 0.999986708, -0.000970000518, 0.0106740929, -0.00091586099, -0.999942601)
  174. Weld.Part1 = larm6
  175. Weld.C1 = CFrame.new(0.0102558136, 0.847481251, 1.50225353, -0.0106740929, 0.00091586099, 0.999942601, -0.00506608794, 0.999986708, -0.000970000518, -0.999930143, -0.0050761546, -0.0106693096)
  176.  
  177. larm7 = Instance.new("Part", char)
  178. larm7.BrickColor = BrickColor.new("Really red")
  179. larm7.Size = Vector3.new(0.5, 0.3, 2)
  180. larm7.CanCollide = false
  181. larm7.BottomSurface = "Smooth"
  182. larm7.TopSurface = "Smooth"
  183. larm7.Material = "Neon"
  184. Weld = Instance.new("Weld",larm)
  185. Weld.Part0 = larm
  186. Weld.C0 = CFrame.new(1.50225258, 0.0474791527, -0.0102558136, -0.999930143, -0.0050761546, -0.0106693096, -0.00506608794, 0.999986708, -0.000970000518, 0.0106740929, -0.00091586099, -0.999942601)
  187. Weld.Part1 = larm7
  188. Weld.C1 = CFrame.new(-0.339956284, 1.83238316, 1.50933075, 0.11770986, 0.484406531, 0.866887927, -0.967169523, 0.253912479, -0.0105566857, -0.225227386, -0.837184966, 0.498391271)
  189.  
  190. larm8 = Instance.new("Part", char)
  191. larm8.BrickColor = BrickColor.new("Really black")
  192. larm8.Size = Vector3.new(1, 0.4, 1)
  193. larm8.CanCollide = false
  194. larm8.BottomSurface = "Smooth"
  195. larm8.TopSurface = "Smooth"
  196. Weld = Instance.new("Weld",larm)
  197. Weld.Part0 = larm
  198. Weld.C0 = CFrame.new(1.50225258, 0.0474791527, -0.0102558136, -0.999930143, -0.0050761546, -0.0106693096, -0.00506608794, 0.999986708, -0.000970000518, 0.0106740929, -0.00091586099, -0.999942601)
  199. Weld.Part1 = larm8
  200. Weld.C1 = CFrame.new(0.247514963, -0.0102424622, 1.58225441, -0.00506623974, 0.999986708, -0.000969914719, 0.0106740929, -0.000915773562, -0.999942601, -0.999930143, -0.00507630548, -0.0106693096)
  201. ----------------------------------------------------------------- Right Arm -----------------------------------------------------------------
  202. rarm1 = Instance.new("Part", char)
  203. rarm1.Name = "Middle"
  204. rarm1.BrickColor = BrickColor.new("Really red")
  205. rarm1.Size = Vector3.new(1, 2, 1)
  206. rarm1.CanCollide = false
  207. rarm1.BottomSurface = "Smooth"
  208. rarm1.TopSurface = "Smooth"
  209. rarm1.Material = "Neon"
  210. Weld = Instance.new("Weld",rarm)
  211. Weld.Part0 = rarm
  212. Weld.C0 = CFrame.new(-1.50168228, 0.0418539047, -0.00368309021, -0.999974012, 0.00369570963, 0.00619300362, 0.00366159948, 0.999978125, -0.00550886011, -0.00621323194, -0.00548603525, -0.999965668)
  213. Weld.Part1 = rarm1
  214. Weld.C1 = CFrame.new(-1.50168228, 0.0418539047, -0.00368309021, -0.999974012, 0.00369570963, 0.00619300362, 0.00366159948, 0.999978125, -0.00550886011, -0.00621323194, -0.00548603525, -0.999965668)
  215.  
  216. rarm2 = Instance.new("Part", char)
  217. rarm2.BrickColor = BrickColor.new("Really black")
  218. rarm2.Size = Vector3.new(1, 0.4, 1)
  219. rarm2.CanCollide = false
  220. rarm2.BottomSurface = "Smooth"
  221. rarm2.TopSurface = "Smooth"
  222. Weld = Instance.new("Weld",rarm)
  223. Weld.Part0 = rarm
  224. Weld.C0 = CFrame.new(-1.50168228, 0.0418539047, -0.00368309021, -0.999974012, 0.00369570963, 0.00619300362, 0.00366159948, 0.999978125, -0.00550886011, -0.00621323194, -0.00548603525, -0.999965668)
  225. Weld.Part1 = rarm2
  226. Weld.C1 = CFrame.new(-0.458259583, -0.356315613, 1.50168037, 0.00366159994, 0.999978125, -0.00550877256, 0.00621323148, 0.00548594771, 0.999965668, 0.999974012, -0.00369570963, -0.00619300362)
  227.  
  228. rarm3 = Instance.new("Part", char)
  229. rarm3.BrickColor = BrickColor.new("Really black")
  230. rarm3.Size = Vector3.new(1, 0.4, 1)
  231. rarm3.CanCollide = false
  232. rarm3.BottomSurface = "Smooth"
  233. rarm3.TopSurface = "Smooth"
  234. Weld = Instance.new("Weld",rarm)
  235. Weld.Part0 = rarm
  236. Weld.C0 = CFrame.new(-1.50168228, 0.0418539047, -0.00368309021, -0.999974012, 0.00369570963, 0.00619300362, 0.00366159948, 0.999978125, -0.00550886011, -0.00621323194, -0.00548603525, -0.999965668)
  237. Weld.Part1 = rarm3
  238. Weld.C1 = CFrame.new(-1.50168133, -0.768137932, -0.00367927551, -0.999974012, 0.00369570986, 0.00619304739, 0.00366159948, 0.999978125, -0.00550886011, -0.00621327572, -0.00548603525, -0.999965668)
  239.  
  240. rarm4 = Instance.new("Part", char)
  241. rarm4.BrickColor = BrickColor.new("Really black")
  242. rarm4.Size = Vector3.new(1, 0.4, 1)
  243. rarm4.CanCollide = false
  244. rarm4.BottomSurface = "Smooth"
  245. rarm4.TopSurface = "Smooth"
  246. Weld = Instance.new("Weld",rarm)
  247. Weld.Part0 = rarm
  248. Weld.C0 = CFrame.new(-1.50168228, 0.0418539047, -0.00368309021, -0.999974012, 0.00369570963, 0.00619300362, 0.00366159948, 0.999978125, -0.00550886011, -0.00621323194, -0.00548603525, -0.999965668)
  249. Weld.Part1 = rarm4
  250. Weld.C1 = CFrame.new(-0.00368309021, 1.8716774, 0.458146095, -0.00621323194, -0.00548603525, -0.999965668, 0.999974012, -0.0036957534, -0.00619300315, -0.00366164325, -0.999978125, 0.00550886057)
  251.  
  252. rarm5 = Instance.new("Part", char)
  253. rarm5.BrickColor = BrickColor.new("Really black")
  254. rarm5.Size = Vector3.new(1, 0.4, 1)
  255. rarm5.CanCollide = false
  256. rarm5.BottomSurface = "Smooth"
  257. rarm5.TopSurface = "Smooth"
  258. Mesh = Instance.new("SpecialMesh", rarm5)
  259. Mesh.MeshType = "Brick"
  260. Mesh.Scale = Vector3.new(1.1, 1.1, 1.1)
  261. Weld = Instance.new("Weld",rarm)
  262. Weld.Part0 = rarm
  263. Weld.C0 = CFrame.new(-1.50168228, 0.0418539047, -0.00368309021, -0.999974012, 0.00369570963, 0.00619300362, 0.00366159948, 0.999978125, -0.00550886011, -0.00621323194, -0.00548603525, -0.999965668)
  264. Weld.Part1 = rarm5
  265. Weld.C1 = CFrame.new(0.00368118286, 0.841855764, -1.50168228, 0.00621323194, 0.00548603525, 0.999965668, 0.00366159948, 0.999978125, -0.00550886011, -0.999974012, 0.00369570963, 0.00619300362)
  266.  
  267. rarm6 = Instance.new("Part", char)
  268. rarm6.BrickColor = BrickColor.new("Really black")
  269. rarm6.Size = Vector3.new(1, 0.4, 1)
  270. rarm6.CanCollide = false
  271. rarm6.BottomSurface = "Smooth"
  272. rarm6.TopSurface = "Smooth"
  273. Weld = Instance.new("Weld",rarm)
  274. Weld.Part0 = rarm
  275. Weld.C0 = CFrame.new(-1.50168228, 0.0418539047, -0.00368309021, -0.999974012, 0.00369570963, 0.00619300362, 0.00366159948, 0.999978125, -0.00550886011, -0.00621323194, -0.00548603525, -0.999965668)
  276. Weld.Part1 = rarm6
  277. Weld.C1 = CFrame.new(-1.50168133, -0.403675079, 0.458138466, -0.999974012, 0.00369575364, 0.00619304692, -0.00621327572, -0.00548603525, -0.999965668, -0.00366164325, -0.999978125, 0.00550886057)
  278.  
  279. rarm7 = Instance.new("Part", char)
  280. rarm7.BrickColor = BrickColor.new("Really red")
  281. rarm7.Size = Vector3.new(0.5, 0.3, 2)
  282. rarm7.CanCollide = false
  283. rarm7.BottomSurface = "Smooth"
  284. rarm7.TopSurface = "Smooth"
  285. rarm7.Material = "Neon"
  286. Weld = Instance.new("Weld",rarm)
  287. Weld.Part0 = rarm
  288. Weld.C0 = CFrame.new(-1.50168228, 0.0418539047, -0.00368309021, -0.999974012, 0.00369570963, 0.00619300362, 0.00366159948, 0.999978125, -0.00550886011, -0.00621323194, -0.00548603525, -0.999965668)
  289. Weld.Part1 = rarm7
  290. Weld.C1 = CFrame.new(0.344418526, -1.80139351, -1.50391006, 0.122256897, -0.48818168, -0.864136577, -0.966848493, -0.25524351, 0.00740774209, -0.224181563, 0.834583461, -0.503202915)
  291.  
  292. rarm8 = Instance.new("Part", char)
  293. rarm8.BrickColor = BrickColor.new("Really red")
  294. rarm8.Size = Vector3.new(1, 0.4, 1)
  295. rarm8.CanCollide = false
  296. rarm8.BottomSurface = "Smooth"
  297. rarm8.TopSurface = "Smooth"
  298. Weld = Instance.new("Weld",rarm)
  299. Weld.Part0 = rarm
  300. Weld.C0 = CFrame.new(-1.50168228, 0.0418539047, -0.00368309021, -0.999974012, 0.00369570963, 0.00619300362, 0.00366159948, 0.999978125, -0.00550886011, -0.00621323194, -0.00548603525, -0.999965668)
  301. Weld.Part1 = rarm8
  302. Weld.C1 = CFrame.new(0.241888285, -0.00366973877, -1.56167889, 0.00366144883, 0.999978125, -0.00550877163, -0.00621323148, -0.00548594771, -0.999965668, -0.999974012, 0.00369555852, 0.00619300455)
  303. ----------------------------------------------------------------- Left Leg -----------------------------------------------------------------
  304. lleg1 = Instance.new("Part", char)
  305. lleg1.Name = "Middle"
  306. lleg1.BrickColor = BrickColor.new("Really red")
  307. lleg1.Size = Vector3.new(1, 2, 1)
  308. lleg1.CanCollide = false
  309. lleg1.BottomSurface = "Smooth"
  310. lleg1.TopSurface = "Smooth"
  311. lleg1.Material = "Neon"
  312. Weld = Instance.new("Weld",lleg)
  313. Weld.Part0 = lleg
  314. Weld.C0 = CFrame.new(-2.3581152, 0.999663353, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  315. Weld.Part1 = lleg1
  316. Weld.C1 = CFrame.new(-2.3581152, 0.999663353, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  317.  
  318. lleg2 = Instance.new("Part", char)
  319. lleg2.BrickColor = BrickColor.new("Really black")
  320. lleg2.Size = Vector3.new(1, 0.4, 1)
  321. lleg2.CanCollide = false
  322. lleg2.BottomSurface = "Smooth"
  323. lleg2.TopSurface = "Smooth"
  324. Weld = Instance.new("Weld",lleg)
  325. Weld.Part0 = lleg
  326. Weld.C0 = CFrame.new(-2.3581152, 0.999663353, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  327. Weld.Part1 = lleg2
  328. Weld.C1 = CFrame.new(0.898587704, 4.77446556, 2.3581152, -7.17753299e-023, 1, 4.37113883e-008, 1.64202821e-015, -4.37113883e-008, 1, 1, -1.4355066e-022, 0)
  329.  
  330. lleg3 = Instance.new("Part", char)
  331. lleg3.BrickColor = BrickColor.new("Really black")
  332. lleg3.Size = Vector3.new(0.5, 0.3, 2)
  333. lleg3.CanCollide = false
  334. lleg3.BottomSurface = "Smooth"
  335. lleg3.TopSurface = "Smooth"
  336. Weld = Instance.new("Weld",lleg)
  337. Weld.Part0 = lleg
  338. Weld.C0 = CFrame.new(-2.3581152, 0.999663353, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  339. Weld.Part1 = lleg3
  340. Weld.C1 = CFrame.new(4.69929504, -1.49470997, 3.25491428, 0.183012843, 0.683012605, 0.707106829, -0.965925813, 0.258819133, 1.06770166e-007, -0.183012709, -0.683012724, 0.707106769)
  341.  
  342. lleg4 = Instance.new("Part", char)
  343. lleg4.BrickColor = BrickColor.new("Really black")
  344. lleg4.Size = Vector3.new(1, 0.4, 1)
  345. lleg4.CanCollide = false
  346. lleg4.BottomSurface = "Smooth"
  347. lleg4.TopSurface = "Smooth"
  348. Weld = Instance.new("Weld",lleg)
  349. Weld.Part0 = lleg
  350. Weld.C0 = CFrame.new(-2.3581152, 0.999663353, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  351. Weld.Part1 = lleg4
  352. Weld.C1 = CFrame.new(0.899408102, 1.9581213, -5.17447472, 4.37113883e-008, 1, 8.74227766e-008, 1, -4.37113883e-008, -2.68657252e-016, -1.37337096e-015, 8.74227766e-008, -1)
  353.  
  354. lleg5 = Instance.new("Part", char)
  355. lleg5.BrickColor = BrickColor.new("Really black")
  356. lleg5.Size = Vector3.new(1, 0.4, 1)
  357. lleg5.CanCollide = false
  358. lleg5.BottomSurface = "Smooth"
  359. lleg5.TopSurface = "Smooth"
  360. Weld = Instance.new("Weld",lleg)
  361. Weld.Part0 = lleg
  362. Weld.C0 = CFrame.new(-2.3581152, 0.999663353, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  363. Weld.Part1 = lleg5
  364. Weld.C1 = CFrame.new(0.899407625, -5.57446861, -2.3581152, -1.50995788e-007, 1, 8.74227766e-008, -1.20315126e-014, 8.74227766e-008, -1, -1, -1.50995788e-007, -8.24226416e-015)
  365.  
  366. lleg6 = Instance.new("Part", char)
  367. lleg6.BrickColor = BrickColor.new("Really black")
  368. lleg6.Size = Vector3.new(1, 0.4, 1)
  369. lleg6.CanCollide = false
  370. lleg6.BottomSurface = "Smooth"
  371. lleg6.TopSurface = "Smooth"
  372. Weld = Instance.new("Weld",lleg)
  373. Weld.Part0 = lleg
  374. Weld.C0 = CFrame.new(-2.3581152, 0.999663353, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  375. Weld.Part1 = lleg6
  376. Weld.C1 = CFrame.new(1.49948871, -2.31810665, 5.08444977, -4.37113883e-008, 1, 8.74227766e-008, -1, -4.37113883e-008, -3.55271368e-015, 8.47879895e-015, -8.74227766e-008, 1)
  377.  
  378. lleg7 = Instance.new("Part", char)
  379. lleg7.BrickColor = BrickColor.new("Really black")
  380. lleg7.Size = Vector3.new(1, 0.4, 1)
  381. lleg7.CanCollide = false
  382. lleg7.BottomSurface = "Smooth"
  383. lleg7.TopSurface = "Smooth"
  384. Weld = Instance.new("Weld",lleg)
  385. Weld.Part0 = lleg
  386. Weld.C0 = CFrame.new(-2.3581152, 0.999663353, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  387. Weld.Part1 = lleg7
  388. Weld.C1 = CFrame.new(1.4994036, -2.33812618, 5.26447296, -4.37113883e-008, 1, 8.74227766e-008, -1, -4.37113883e-008, -3.55271368e-015, 8.47879895e-015, -8.74227766e-008, 1)
  389. ----------------------------------------------------------------- Right Leg -----------------------------------------------------------------
  390. rleg1 = Instance.new("Part", char)
  391. rleg1.Name = "Middle"
  392. rleg1.BrickColor = BrickColor.new("Really red")
  393. rleg1.Size = Vector3.new(1, 2, 1)
  394. rleg1.CanCollide = false
  395. rleg1.BottomSurface = "Smooth"
  396. rleg1.TopSurface = "Smooth"
  397. rleg1.Material = "Neon"
  398. Weld = Instance.new("Weld",rleg)
  399. Weld.Part0 = rleg
  400. Weld.C0 = CFrame.new(-3.3581152, 1.00582027, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  401. Weld.Part1 = rleg1
  402. Weld.C1 = CFrame.new(-3.3581152, 1.00582027, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  403.  
  404. rleg2 = Instance.new("Part", char)
  405. rleg2.BrickColor = BrickColor.new("Really black")
  406. rleg2.Size = Vector3.new(1, 0.4, 1)
  407. rleg2.CanCollide = false
  408. rleg2.BottomSurface = "Smooth"
  409. rleg2.TopSurface = "Smooth"
  410. Weld = Instance.new("Weld",rleg)
  411. Weld.Part0 = rleg
  412. Weld.C0 = CFrame.new(-3.3581152, 1.00582027, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  413. Weld.Part1 = rleg2
  414. Weld.C1 = CFrame.new(0.905565023, 3.75810814, -5.17447472, 4.37113883e-008, 1, 8.74227766e-008, 1, -4.37113883e-008, -2.68657252e-016, -1.37337096e-015, 8.74227766e-008, -1)
  415.  
  416. rleg3 = Instance.new("Part", char)
  417. rleg3.BrickColor = BrickColor.new("Really black")
  418. rleg3.Size = Vector3.new(1, 0.4, 1)
  419. rleg3.CanCollide = false
  420. rleg3.BottomSurface = "Smooth"
  421. rleg3.TopSurface = "Smooth"
  422. Weld = Instance.new("Weld",rleg)
  423. Weld.Part0 = rleg
  424. Weld.C0 = CFrame.new(-3.3581152, 1.00582027, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  425. Weld.Part1 = rleg3
  426. Weld.C1 = CFrame.new(1.4545058, -3.34725952, 5.0867691, -0.0153048551, 0.999882877, -5.25215728e-006, -0.999882638, -0.0153048476, 0.000690514687, 0.000690353394, 1.58197654e-005, 0.999999762)
  427.  
  428. rleg4 = Instance.new("Part", char)
  429. rleg4.BrickColor = BrickColor.new("Really black")
  430. rleg4.Size = Vector3.new(1, 0.4, 1)
  431. rleg4.CanCollide = false
  432. rleg4.BottomSurface = "Smooth"
  433. rleg4.TopSurface = "Smooth"
  434. Weld = Instance.new("Weld",rleg)
  435. Weld.Part0 = rleg
  436. Weld.C0 = CFrame.new(-3.3581152, 1.00582027, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  437. Weld.Part1 = rleg4
  438. Weld.C1 = CFrame.new(1.5055685, -3.33812618, 5.26447296, -4.37113883e-008, 1, 8.74227766e-008, -1, -4.37113883e-008, -3.55271368e-015, 8.47879895e-015, -8.74227766e-008, 1)
  439.  
  440. rleg5 = Instance.new("Part", char)
  441. rleg5.BrickColor = BrickColor.new("Really black")
  442. rleg5.Size = Vector3.new(1, 0.4, 1)
  443. rleg5.CanCollide = false
  444. rleg5.BottomSurface = "Smooth"
  445. rleg5.TopSurface = "Smooth"
  446. Weld = Instance.new("Weld",rleg)
  447. Weld.Part0 = rleg
  448. Weld.C0 = CFrame.new(-3.3581152, 1.00582027, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  449. Weld.Part1 = rleg5
  450. Weld.C1 = CFrame.new(0.905564308, -5.57446861, -3.3581152, -1.50995788e-007, 1, 8.74227766e-008, -1.20315126e-014, 8.74227766e-008, -1, -1, -1.50995788e-007, -8.24226416e-015)
  451.  
  452. rleg6 = Instance.new("Part", char)
  453. rleg6.BrickColor = BrickColor.new("Really black")
  454. rleg6.Size = Vector3.new(1, 0.4, 1)
  455. rleg6.CanCollide = false
  456. rleg6.BottomSurface = "Smooth"
  457. rleg6.TopSurface = "Smooth"
  458. Weld = Instance.new("Weld",rleg)
  459. Weld.Part0 = rleg
  460. Weld.C0 = CFrame.new(-3.3581152, 1.00582027, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  461. Weld.Part1 = rleg6
  462. Weld.C1 = CFrame.new(0.904744625, 4.77446556, 3.3581152, -7.17753299e-023, 1, 4.37113883e-008, 1.64202821e-015, -4.37113883e-008, 1, 1, -1.4355066e-022, 0)
  463.  
  464. rleg7 = Instance.new("Part", char)
  465. rleg7.BrickColor = BrickColor.new("Really black")
  466. rleg7.Size = Vector3.new(0.5, 0.3, 2)
  467. rleg7.CanCollide = false
  468. rleg7.BottomSurface = "Smooth"
  469. rleg7.TopSurface = "Smooth"
  470. Weld = Instance.new("Weld",rleg)
  471. Weld.Part0 = rleg
  472. Weld.C0 = CFrame.new(-3.3581152, 1.00582027, -5.17447472, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  473. Weld.Part1 = rleg7
  474. Weld.C1 = CFrame.new(-3.66284275, -3.99935341, -4.29136944, 0.183012664, -0.683012724, -0.707106829, -0.965925872, -0.258818954, -3.53088581e-008, -0.183012635, 0.683012784, -0.707106769)
  475. ----------------------------------------------------------------- Torso -----------------------------------------------------------------
  476. Chest1 = Instance.new("Part", char)
  477. Chest1.Name = "Ball"
  478. Chest1.BrickColor = BrickColor.new("Really red")
  479. Chest1.Size = Vector3.new(1, 0.4, 1)
  480. Chest1.CanCollide = false
  481. Chest1.BottomSurface = "Smooth"
  482. Chest1.TopSurface = "Smooth"
  483. Chest1.Material = "Neon"
  484. Mesh = Instance.new("CylinderMesh", Chest1)
  485. Mesh.Scale = Vector3.new(0.9, 0.4, 0.9)
  486. Weld = Instance.new("Weld",torso)
  487. Weld.Part0 = torso
  488. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  489. Weld.Part1 = Chest1
  490. Weld.C1 = CFrame.new(0, 0.700000763, 0.176463604, -1, 0, 0, 0, 0, -1, 0, -1, 0)
  491.  
  492. Chest2 = Instance.new("Part", char)
  493. Chest2.BrickColor = BrickColor.new("Really red")
  494. Chest2.Name = "Middle"
  495. Chest2.Size = Vector3.new(2, 2, 1)
  496. Chest2.CanCollide = false
  497. Chest2.BottomSurface = "Smooth"
  498. Chest2.TopSurface = "Smooth"
  499. Chest2.Material = "Neon"
  500. Weld = Instance.new("Weld",torso)
  501. Weld.Part0 = torso
  502. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  503. Weld.Part1 = Chest2
  504. Weld.C1 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  505.  
  506. Chest3 = Instance.new("Part", char)
  507. Chest3.BrickColor = BrickColor.new("Really black")
  508. Chest3.Size = Vector3.new(1, 0.4, 1)
  509. Chest3.CanCollide = false
  510. Chest3.BottomSurface = "Smooth"
  511. Chest3.TopSurface = "Smooth"
  512. Weld = Instance.new("Weld",torso)
  513. Weld.Part0 = torso
  514. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  515. Weld.Part1 = Chest3
  516. Weld.C1 = CFrame.new(-0.476491928, -0.5, -0.499999046, 5.15558582e-008, 1, -7.54979013e-008, -3.35276091e-008, 7.54979013e-008, 1, 1, -5.15558582e-008, 3.35276091e-008)
  517.  
  518. Chest4 = Instance.new("Part", char)
  519. Chest4.BrickColor = BrickColor.new("Really black")
  520. Chest4.Size = Vector3.new(1, 0.4, 1)
  521. Chest4.CanCollide = false
  522. Chest4.BottomSurface = "Smooth"
  523. Chest4.TopSurface = "Smooth"
  524. Weld = Instance.new("Weld",torso)
  525. Weld.Part0 = torso
  526. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  527. Weld.Part1 = Chest4
  528. Weld.C1 = CFrame.new(-0.476491451, -0.5, 0.5, -1.4355066e-022, 1, 4.37113883e-008, 3.28405643e-015, -4.37113883e-008, 1, 1, -2.8710132e-022, 1.64202821e-015)
  529.  
  530. Chest5 = Instance.new("Part", char)
  531. Chest5.BrickColor = BrickColor.new("Really black")
  532. Chest5.Size = Vector3.new(1, 0.4, 1)
  533. Chest5.CanCollide = false
  534. Chest5.BottomSurface = "Smooth"
  535. Chest5.TopSurface = "Smooth"
  536. Weld = Instance.new("Weld",torso)
  537. Weld.Part0 = torso
  538. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  539. Weld.Part1 = Chest5
  540. Weld.C1 = CFrame.new(-0.499999046, 0.5, 0.476491451, 1, -4.37113918e-008, 4.37113847e-008, -4.37113847e-008, 0, 1, -4.37113883e-008, -1, 0)
  541.  
  542. Chest6 = Instance.new("Part", char)
  543. Chest6.BrickColor = BrickColor.new("Really black")
  544. Chest6.Size = Vector3.new(1, 0.4, 1)
  545. Chest6.CanCollide = false
  546. Chest6.BottomSurface = "Smooth"
  547. Chest6.TopSurface = "Smooth"
  548. Weld = Instance.new("Weld",torso)
  549. Weld.Part0 = torso
  550. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  551. Weld.Part1 = Chest6
  552. Weld.C1 = CFrame.new(0.5236063, -0.449995041, 0, 0, 1, 8.74227766e-008, 3.28405643e-015, -8.74227766e-008, 1, 1, -1.4355066e-022, 0)
  553.  
  554. Chest7 = Instance.new("Part", char)
  555. Chest7.BrickColor = BrickColor.new("Really black")
  556. Chest7.Size = Vector3.new(1, 0.4, 1)
  557. Chest7.CanCollide = false
  558. Chest7.BottomSurface = "Smooth"
  559. Chest7.TopSurface = "Smooth"
  560. Weld = Instance.new("Weld",torso)
  561. Weld.Part0 = torso
  562. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  563. Weld.Part1 = Chest7
  564. Weld.C1 = CFrame.new(0.5, 0.5, 0.476491928, 1, -4.37113918e-008, 4.37113847e-008, -4.37113847e-008, 0, 1, -4.37113883e-008, -1, 0)
  565.  
  566. Chest8 = Instance.new("Part", char)
  567. Chest8.BrickColor = BrickColor.new("Really black")
  568. Chest8.Size = Vector3.new(1, 0.4, 1)
  569. Chest8.CanCollide = false
  570. Chest8.BottomSurface = "Smooth"
  571. Chest8.TopSurface = "Smooth"
  572. Weld = Instance.new("Weld",torso)
  573. Weld.Part0 = torso
  574. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  575. Weld.Part1 = Chest8
  576. Weld.C1 = CFrame.new(0, 0.389970779, -0.473520517, 1, -4.37113954e-008, 4.37113847e-008, -4.37113883e-008, -4.37113883e-008, 1, -4.37113883e-008, -1, -4.37113883e-008)
  577.  
  578. Chest9 = Instance.new("Part", char)
  579. Chest9.BrickColor = BrickColor.new("Really black")
  580. Chest9.Size = Vector3.new(0.5, 0.3, 2)
  581. Chest9.CanCollide = false
  582. Chest9.BottomSurface = "Smooth"
  583. Chest9.TopSurface = "Smooth"
  584. Weld = Instance.new("Weld",torso)
  585. Weld.Part0 = torso
  586. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  587. Weld.Part1 = Chest9
  588. Weld.C1 = CFrame.new(-0.458083153, 0.580001831, 0.306574821, -0.866025448, -0.49999997, 4.37113883e-008, -3.78551732e-008, -2.18556924e-008, -1, 0.49999997, -0.866025448, 0)
  589.  
  590. Chest10 = Instance.new("Part", char)
  591. Chest10.BrickColor = BrickColor.new("Really black")
  592. Chest10.Size = Vector3.new(1, 0.4, 1)
  593. Chest10.CanCollide = false
  594. Chest10.BottomSurface = "Smooth"
  595. Chest10.TopSurface = "Smooth"
  596. Mesh = Instance.new("SpecialMesh", Chest10)
  597. Mesh.Scale = Vector3.new(1.1, 1.1, 1.1)
  598. Weld = Instance.new("Weld",torso)
  599. Weld.Part0 = torso
  600. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  601. Weld.Part1 = Chest10
  602. Weld.C1 = CFrame.new(-1.07653379, 0.899993896, 0, -4.37113883e-008, 1, 8.74227766e-008, -1, -4.37113883e-008, -3.55271368e-015, 8.47879895e-015, -8.74227766e-008, 1)
  603.  
  604. Chest11 = Instance.new("Part", char)
  605. Chest11.BrickColor = BrickColor.new("Really black")
  606. Chest11.Size = Vector3.new(0.5, 0.3, 2)
  607. Chest11.CanCollide = false
  608. Chest11.BottomSurface = "Smooth"
  609. Chest11.TopSurface = "Smooth"
  610. Weld = Instance.new("Weld",torso)
  611. Weld.Part0 = torso
  612. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  613. Weld.Part1 = Chest11
  614. Weld.C1 = CFrame.new(0.973486662, -0.460004807, -9.53674316e-007, 1.50995803e-007, 1, 7.54979013e-008, -1.85052948e-014, -7.54979013e-008, 1, 1, -1.50995803e-007, 7.10542736e-015)
  615.  
  616. Chest12 = Instance.new("Part", char)
  617. Chest12.BrickColor = BrickColor.new("Really black")
  618. Chest12.Size = Vector3.new(0.5, 0.3, 2)
  619. Chest12.CanCollide = false
  620. Chest12.BottomSurface = "Smooth"
  621. Chest12.TopSurface = "Smooth"
  622. Weld = Instance.new("Weld",torso)
  623. Weld.Part0 = torso
  624. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  625. Weld.Part1 = Chest12
  626. Weld.C1 = CFrame.new(-0.973600388, 0.450008392, -7.62939453e-006, -9.32088255e-008, -1, -4.37113883e-008, 5.82035878e-011, -4.37113883e-008, 1, -1, 9.32088255e-008, 5.82076609e-011)
  627.  
  628. Chest13 = Instance.new("Part", char)
  629. Chest13.BrickColor = BrickColor.new("Really black")
  630. Chest13.Size = Vector3.new(0.5, 0.3, 2)
  631. Chest13.CanCollide = false
  632. Chest13.BottomSurface = "Smooth"
  633. Chest13.TopSurface = "Smooth"
  634. Weld = Instance.new("Weld",torso)
  635. Weld.Part0 = torso
  636. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  637. Weld.Part1 = Chest13
  638. Weld.C1 = CFrame.new(-0.729999542, -0.117254257, -1.91926646, -1, -3.23980487e-008, -4.22219593e-008, 3.23980487e-008, 0.258819044, -0.965925813, 4.22219593e-008, -0.965925813, -0.258819044)
  639.  
  640. Chest14 = Instance.new("Part", char)
  641. Chest14.BrickColor = BrickColor.new("Really black")
  642. Chest14.Size = Vector3.new(0.5, 0.3, 2)
  643. Chest14.CanCollide = false
  644. Chest14.BottomSurface = "Smooth"
  645. Chest14.TopSurface = "Smooth"
  646. Weld = Instance.new("Weld",torso)
  647. Weld.Part0 = torso
  648. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  649. Weld.Part1 = Chest14
  650. Weld.C1 = CFrame.new(0.769999504, -0.150730133, -1.91693306, -1, -3.31366472e-008, -4.24129745e-008, 3.31366472e-008, 0.241921902, -0.970295727, 4.24129745e-008, -0.970295727, -0.241921902)
  651.  
  652. Chest15 = Instance.new("Part", char)
  653. Chest15.BrickColor = BrickColor.new("Really black")
  654. Chest15.Size = Vector3.new(0.5, 0.3, 2)
  655. Chest15.CanCollide = false
  656. Chest15.BottomSurface = "Smooth"
  657. Chest15.TopSurface = "Smooth"
  658. Weld = Instance.new("Weld",torso)
  659. Weld.Part0 = torso
  660. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  661. Weld.Part1 = Chest15
  662. Weld.C1 = CFrame.new(-0.209440231, 1.25000095, 1.42984772, -6.16862437e-008, 0.656059027, 0.754709601, -1, -6.53672387e-008, -2.49122056e-008, 3.2989405e-008, -0.754709601, 0.656059027)
  663.  
  664. Chest16 = Instance.new("Part", char)
  665. Chest16.BrickColor = BrickColor.new("Really black")
  666. Chest16.Size = Vector3.new(0.5, 0.3, 2)
  667. Chest16.CanCollide = false
  668. Chest16.BottomSurface = "Smooth"
  669. Chest16.TopSurface = "Smooth"
  670. Weld = Instance.new("Weld",torso)
  671. Weld.Part0 = torso
  672. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  673. Weld.Part1 = Chest16
  674. Weld.C1 = CFrame.new(-0.158526421, 1.25000095, 1.0131588, -7.35374925e-008, 0.927183867, 0.374606639, -1, -7.43167945e-008, -1.23653887e-008, 1.63745764e-008, -0.374606639, 0.927183867)
  675.  
  676. Chest17 = Instance.new("Part", char)
  677. Chest17.BrickColor = BrickColor.new("Really black")
  678. Chest17.Size = Vector3.new(0.5, 0.3, 2)
  679. Chest17.CanCollide = false
  680. Chest17.BottomSurface = "Smooth"
  681. Chest17.TopSurface = "Smooth"
  682. Weld = Instance.new("Weld",torso)
  683. Weld.Part0 = torso
  684. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  685. Weld.Part1 = Chest17
  686. Weld.C1 = CFrame.new(-0.229999542, -0.117254257, -1.91926742, -1, -3.23980487e-008, -4.22219593e-008, 3.23980487e-008, 0.258819044, -0.965925813, 4.22219593e-008, -0.965925813, -0.258819044)
  687.  
  688. Chest18 = Instance.new("Part", char)
  689. Chest18.BrickColor = BrickColor.new("Really black")
  690. Chest18.Size = Vector3.new(0.5, 0.3, 2)
  691. Chest18.CanCollide = false
  692. Chest18.BottomSurface = "Smooth"
  693. Chest18.TopSurface = "Smooth"
  694. Weld = Instance.new("Weld",torso)
  695. Weld.Part0 = torso
  696. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  697. Weld.Part1 = Chest18
  698. Weld.C1 = CFrame.new(0.269999504, -0.117254257, -1.91926742, -1, -3.23980487e-008, -4.22219593e-008, 3.23980487e-008, 0.258819044, -0.965925813, 4.22219593e-008, -0.965925813, -0.258819044)
  699.  
  700. Chest19 = Instance.new("Part", char)
  701. Chest19.BrickColor = BrickColor.new("Really black")
  702. Chest19.Size = Vector3.new(0.5, 0.3, 2)
  703. Chest19.CanCollide = false
  704. Chest19.BottomSurface = "Smooth"
  705. Chest19.TopSurface = "Smooth"
  706. Weld = Instance.new("Weld",torso)
  707. Weld.Part0 = torso
  708. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  709. Weld.Part1 = Chest19
  710. Weld.C1 = CFrame.new(-0.00685310364, 1.25, 1.45221233, -2.47515253e-008, 0.224950925, 0.974370122, -1, -4.7067342e-008, -1.45362469e-008, 4.2591072e-008, -0.974370122, 0.224950925)
  711.  
  712. Chest20 = Instance.new("Part", char)
  713. Chest20.BrickColor = BrickColor.new("Really black")
  714. Chest20.Size = Vector3.new(1, 0.4, 1)
  715. Chest20.CanCollide = false
  716. Chest20.BottomSurface = "Smooth"
  717. Chest20.TopSurface = "Smooth"
  718. Mesh = Instance.new("SpecialMesh",Chest20)
  719. Mesh.Scale = Vector3.new(1.1,1.1,1.1)
  720. Weld = Instance.new("Weld",torso)
  721. Weld.Part0 = torso
  722. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  723. Weld.Part1 = Chest20
  724. Weld.C1 = CFrame.new(-1.07653379, -0.899992943, 0, -4.37113883e-008, 1, 8.74227766e-008, -1, -4.37113883e-008, -3.55271368e-015, 8.47879895e-015, -8.74227766e-008, 1)
  725. Chest21 = Instance.new("Part", char)
  726. Chest21.BrickColor = BrickColor.new("Really black")
  727. Chest21.Size = Vector3.new(0.5, 0.3, 2)
  728. Chest21.CanCollide = false
  729. Chest21.BottomSurface = "Smooth"
  730. Chest21.TopSurface = "Smooth"
  731. Weld = Instance.new("Weld",torso)
  732. Weld.Part0 = torso
  733. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  734. Weld.Part1 = Chest21
  735. Weld.C1 = CFrame.new(-0.209432602, -1.14999962, 1.429842, -6.16862437e-008, 0.656059027, 0.754709601, -1, -6.53672387e-008, -2.49122056e-008, 3.2989405e-008, -0.754709601, 0.656059027)
  736.  
  737. Chest22 = Instance.new("Part", char)
  738. Chest22.BrickColor = BrickColor.new("Really black")
  739. Chest22.Size = Vector3.new(0.5, 0.3, 2)
  740. Chest22.CanCollide = false
  741. Chest22.BottomSurface = "Smooth"
  742. Chest22.TopSurface = "Smooth"
  743. Weld = Instance.new("Weld",torso)
  744. Weld.Part0 = torso
  745. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  746. Weld.Part1 = Chest22
  747. Weld.C1 = CFrame.new(-0.00685119629, -1.15000057, 1.45220757, -2.47515253e-008, 0.224950925, 0.974370122, -1, -4.7067342e-008, -1.45362469e-008, 4.2591072e-008, -0.974370122, 0.224950925)
  748.  
  749. Chest23 = Instance.new("Part", char)
  750. Chest23.BrickColor = BrickColor.new("Really black")
  751. Chest23.Size = Vector3.new(0.5, 0.3, 2)
  752. Chest23.CanCollide = false
  753. Chest23.BottomSurface = "Smooth"
  754. Chest23.TopSurface = "Smooth"
  755. Weld = Instance.new("Weld",torso)
  756. Weld.Part0 = torso
  757. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  758. Weld.Part1 = Chest23
  759. Weld.C1 = CFrame.new(-0.158511639, -1.15000057, 1.01315498, -7.35374925e-008, 0.927183926, 0.374606401, -1, -7.43168016e-008, -1.23653807e-008, 1.63745657e-008, -0.374606401, 0.927183926)
  760.  
  761. Chest24 = Instance.new("Part", char)
  762. Chest24.BrickColor = BrickColor.new("Really black")
  763. Chest24.Size = Vector3.new(0.5, 0.3, 2)
  764. Chest24.CanCollide = false
  765. Chest24.BottomSurface = "Smooth"
  766. Chest24.TopSurface = "Smooth"
  767. Weld = Instance.new("Weld",torso)
  768. Weld.Part0 = torso
  769. Weld.C0 = CFrame.new(0, 0.0235004425, 0, -1, 0, 0, 0, 1, 0, 0, 0, -1)
  770. Weld.Part1 = Chest24
  771. Weld.C1 = CFrame.new(-0.458065987, -0.579999924, 0.306604624, 0.866025388, -0.50000006, 4.37113883e-008, 4.53686155e-008, 1.66003517e-007, 1, -0.50000006, -0.866025388, 1.66447563e-007)
  772.  
  773. local attack = false
  774. local Anim = 'Idle'
  775. local attacktype = 1
  776. local delays = false
  777. local play = true
  778. local targetted = nil
  779. local Torsovelocity = (RootPart.Velocity * Vector3.new(1, 0, 1)).magnitude
  780. local velocity = RootPart.Velocity.y
  781. local sine = 0
  782. local change = 1
  783. local doe = 0
  784. local Create = LoadLibrary("RbxUtility").Create
  785. Humanoid.WalkSpeed = 40
  786. Player = game:GetService("Players").LocalPlayer
  787. PlayerGui = Player.PlayerGui
  788. Cam = workspace.CurrentCamera
  789. Backpack = Player.Backpack
  790. Character = Player.Character
  791. Humanoid = Character.Humanoid
  792. Mouse = Player:GetMouse()
  793. RootPart = Character["HumanoidRootPart"]
  794. Torso = Character["Torso"]
  795. Head = Character["Head"]
  796. RightArm = Character["Right Arm"]
  797. LeftArm = Character["Left Arm"]
  798. RightLeg = Character["Right Leg"]
  799. LeftLeg = Character["Left Leg"]
  800. RootJoint = RootPart["RootJoint"]
  801. Neck = Torso["Neck"]
  802. RightShoulder = Torso["Right Shoulder"]
  803. LeftShoulder = Torso["Left Shoulder"]
  804. RightHip = Torso["Right Hip"]
  805. LeftHip = Torso["Left Hip"]
  806. IT = Instance.new
  807. CF = CFrame.new
  808. VT = Vector3.new
  809. RAD = math.rad
  810. C3 = Color3.new
  811. UD2 = UDim2.new
  812. BRICKC = BrickColor.new
  813. ANGLES = CFrame.Angles
  814. EULER = CFrame.fromEulerAnglesXYZ
  815. COS = math.cos
  816. ACOS = math.acos
  817. SIN = math.sin
  818. ASIN = math.asin
  819. ABS = math.abs
  820. MRANDOM = math.random
  821. FLOOR = math.floor
  822. local Rooted = false
  823. local Effects = IT("Folder", Character)
  824. Effects.Name = "Effects"
  825. local UNANCHOR = true
  826. local HITPOS = nil
  827. local HITFLOOR = nil
  828. local LEFTWINGS = {}
  829. local RIGHTWINGS = {}
  830. local BODY = {}
  831. local iuf = Instance.new("Sound",Workspace)
  832. iuf.SoundId = "rbxassetid://130932305"
  833. iuf.Looped = false
  834. iuf.Pitch = 1
  835. iuf.Volume = 10
  836. local LOLXD = "rbxassetid://1530517571"
  837. Head.face.Texture = LOLXD
  838. necko = CF(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  839. RSH, LSH = nil, nil
  840. RW = Instance.new("Weld")
  841. LW = Instance.new("Weld")
  842. RH = tors["Right Hip"]
  843. LH = tors["Left Hip"]
  844. RSH = tors["Right Shoulder"]
  845. LSH = tors["Left Shoulder"]
  846. RSH.Parent = nil
  847. LSH.Parent = nil
  848. RW.Name = "RW"
  849. RW.Part0 = tors
  850. RW.C0 = CF(1.5, 0.5, 0)
  851. RW.C1 = CF(0, 0.5, 0)
  852. RW.Part1 = ra
  853. RW.Parent = tors
  854. LW.Name = "LW"
  855. LW.Part0 = tors
  856. LW.C0 = CF(-1.5, 0.5, 0)
  857. LW.C1 = CF(0, 0.5, 0)
  858. LW.Part1 = la
  859. LW.Parent = tors
  860. local m = Create("Model"){
  861. Parent = Character,
  862. Name = "WeaponModel",
  863. }
  864. local function FindHumanoid(Part)local humanoid=nil if Part.Parent then if Part.Parent~=Player.Character and Part.Parent:FindFirstChildOfClass("Humanoid")~=nil then humanoid=Part.Parent:FindFirstChildOfClass("Humanoid")else if Part.Parent.Parent then if Part.Parent.Parent:FindFirstChildOfClass("Humanoid")and Part.Parent.Parent~=Player.Character then humanoid=Part.Parent.Parent:FindFirstChildOfClass("Humanoid")end end end end if humanoid==Humanoid then humanoid=nil end return humanoid end
  865. Humanoid.Animator.Parent = nil
  866. Character.Animate.Parent = nil
  867. if Character:FindFirstChild("Health")then Character.Health.Parent = nil end
  868. function CreateBeam(Parent,isReversed)local p=Instance.new("Beam",Parent)local a0=Instance.new("Attachment",Parent)local a1=Instance.new("Attachment",Parent)if isReversed then p.Attachment0=a1 p.Attachment1=a0 else p.Attachment0=a0 p.Attachment1=a1 end return a0,a1,p end
  869. function CTE(Part)Part.Size=Vector3.new()Part.Transparency=1 Part.CanCollide=false Part.Anchored=true local j=Instance.new("BodyVelocity",Part)j.MaxForce=Vector3.new(1/0,1/0,1/0)j.Velocity=Vector3.new(0,0,0)end
  870. function RingE(pos,siz,tim,dsiz,seg,wid,z,col,w)local IDK=.7
  871. local p=Instance.new("Part",workspace)if col==nil then col=ColorSequence.new(Color3.new())end if z==nil then z=0 end
  872. CTE(p)p.CFrame=pos
  873. local a0,a1,b=CreateBeam(p)a0.Position=Vector3.new(0,0,-dsiz)a1.Position=-a0.Position b.Texture="rbxassetid://1251856844"b.Color=col
  874. local b2=Instance.new("Beam",b.Parent)b2.Attachment0=a1 b2.Attachment1=a0 b2.Texture="rbxassetid://1251856844"b2.Color=col
  875. b.CurveSize0=math.abs(a0.Position.Z)*2 *IDK b.CurveSize1=math.abs(a0.Position.Z)*2 *IDK b2.CurveSize0=-math.abs(a0.Position.Z)*2 *IDK b2.CurveSize1=math.abs(a0.Position.Z)*2 *IDK
  876. b.Segments=seg b2.Segments=seg b.ZOffset=z b2.ZOffset=z b.Width0=wid b.Width1=wid b2.Width0=wid b2.Width1=wid spawn(function()
  877. for i=1,tim do if p.Parent then
  878. a0.Position=a0.Position-Vector3.new(0,0,siz)a1.Position=a1.Position+Vector3.new(0,0,siz)b.CurveSize0=(a1.Position.Z*2)*IDK b.CurveSize1=-(a1.Position.Z*2)*IDK
  879. b2.CurveSize0=-(a1.Position.Z*2)*IDK b2.CurveSize1=(a1.Position.Z*2)*IDK
  880. if w~=nil then b.Width0=b.Width0+w b.Width1=b.Width0 b2.Width0=b.Width0 b2.Width1=b.Width0 end b.Transparency=NumberSequence.new(i/tim)b2.Transparency=NumberSequence.new(i/tim)swait()
  881. end end p:Destroy()
  882. end)
  883. end
  884. --[[function HyperSpread(Part)
  885.  
  886. for i=1,math.random(1,20)+19 do
  887. rayCast()
  888. end
  889. end
  890. ]]
  891. local newMotor = function(part0, part1, c0, c1)
  892. local w = Create('Motor'){
  893. Parent = part0,
  894. Part0 = part0,
  895. Part1 = part1,
  896. C0 = c0,
  897. C1 = c1,
  898. }
  899. return w
  900. end
  901.  
  902. function clerp(a, b, t)
  903. return a:lerp(b, t)
  904. end
  905. local Words="English"
  906. RootCF = CFrame.fromEulerAnglesXYZ(-1.57, 0, 3.14)
  907. NeckCF = CFrame.new(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  908.  
  909. local RW = newMotor(Torso, RightArm, CFrame.new(1.5, 0, 0), CFrame.new(0, 0, 0))
  910. local LW = newMotor(Torso, LeftArm, CFrame.new(-1.5, 0, 0), CFrame.new(0, 0, 0))
  911. local RH = newMotor(Torso, RightLeg, CFrame.new(.5, -2, 0), CFrame.new(0, 0, 0))
  912. local LH = newMotor(Torso, LeftLeg, CFrame.new(-.5, -2, 0), CFrame.new(0, 0, 0))
  913. RootJoint.C1 = CFrame.new(0, 0, 0)
  914. RootJoint.C0 = CFrame.new(0, 0, 0)
  915. Torso.Neck.C1 = CFrame.new(0, 0, 0)
  916. Torso.Neck.C0 = CFrame.new(0, 1.5, 0)
  917.  
  918. local rarmc1 = RW.C1
  919. local larmc1 = LW.C1
  920. local rlegc1 = RH.C1
  921. local llegc1 = LH.C1
  922.  
  923. local resetc1 = false
  924.  
  925. function PlayAnimationFromTable(table, speed, bool)
  926. RootJoint.C0 = clerp(RootJoint.C0, table[1], speed)
  927. Torso.Neck.C0 = clerp(Torso.Neck.C0, table[2], speed)
  928. RW.C0 = clerp(RW.C0, table[3], speed)
  929. LW.C0 = clerp(LW.C0, table[4], speed)
  930. RH.C0 = clerp(RH.C0, table[5], speed)
  931. LH.C0 = clerp(LH.C0, table[6], speed)
  932. if bool == true then
  933. if resetc1 == false then
  934. resetc1 = true
  935. RootJoint.C1 = RootJoint.C1
  936. Torso.Neck.C1 = Torso.Neck.C1
  937. RW.C1 = rarmc1
  938. LW.C1 = larmc1
  939. RH.C1 = rlegc1
  940. LH.C1 = llegc1
  941. end
  942. end
  943. end
  944.  
  945. ArtificialHB = Create("BindableEvent", script){
  946. Parent = script,
  947. Name = "Heartbeat",
  948. }
  949.  
  950. script:WaitForChild("Heartbeat")
  951.  
  952. frame = 1 / 30
  953. tf = 0
  954. allowframeloss = false
  955. tossremainder = false
  956. lastframe = tick()
  957. script.Heartbeat:Fire()
  958.  
  959. game:GetService("RunService").Heartbeat:connect(function(s, p)
  960. tf = tf + s
  961. if tf >= frame then
  962. if allowframeloss then
  963. script.Heartbeat:Fire()
  964. lastframe = tick()
  965. else
  966. for i = 1, math.floor(tf / frame) do
  967. script.Heartbeat:Fire()
  968. end
  969. lastframe = tick()
  970. end
  971. if tossremainder then
  972. tf = 0
  973. else
  974. tf = tf - frame * math.floor(tf / frame)
  975. end
  976. end
  977. end)
  978.  
  979. function swait(num)
  980. if num == 0 or num == nil then
  981. ArtificialHB.Event:wait()
  982. else
  983. for i = 0, num do
  984. ArtificialHB.Event:wait()
  985. end
  986. end return true
  987. end
  988.  
  989. function RemoveOutlines(part)
  990. part.TopSurface, part.BottomSurface, part.LeftSurface, part.RightSurface, part.FrontSurface, part.BackSurface = 10, 10, 10, 10, 10, 10
  991. end
  992.  
  993. CFuncs = {
  994. ["Part"] = {
  995. Create = function(Parent, Material, Reflectance, Transparency, BColor, Name, Size)
  996. local Part = Create("Part"){
  997. Parent = Parent,
  998. Reflectance = Reflectance,
  999. Transparency = Transparency,
  1000. CanCollide = false,
  1001. Locked = true,
  1002. BrickColor = BrickColor.new(tostring(BColor)),
  1003. Name = Name,
  1004. Size = Size,
  1005. Material = Material,
  1006. }
  1007. RemoveOutlines(Part)
  1008. return Part
  1009. end;
  1010. };
  1011.  
  1012. ["Mesh"] = {
  1013. Create = function(Mesh, Part, MeshType, MeshId, OffSet, Scale)
  1014. local Msh = Create(Mesh){
  1015. Parent = Part,
  1016. Offset = OffSet,
  1017. Scale = Scale,
  1018. }
  1019. if Mesh == "SpecialMesh" then
  1020. Msh.MeshType = MeshType
  1021. Msh.MeshId = MeshId
  1022. end
  1023. return Msh
  1024. end;
  1025. };
  1026.  
  1027. ["Mesh"] = {
  1028. Create = function(Mesh, Part, MeshType, MeshId, OffSet, Scale)
  1029. local Msh = Create(Mesh){
  1030. Parent = Part,
  1031. Offset = OffSet,
  1032. Scale = Scale,
  1033. }
  1034. if Mesh == "SpecialMesh" then
  1035. Msh.MeshType = MeshType
  1036. Msh.MeshId = MeshId
  1037. end
  1038. return Msh
  1039. end;
  1040. };
  1041.  
  1042. ["Weld"] = {
  1043. Create = function(Parent, Part0, Part1, C0, C1)
  1044. local Weld = Create("Weld"){
  1045. Parent = Parent,
  1046. Part0 = Part0,
  1047. Part1 = Part1,
  1048. C0 = C0,
  1049. C1 = C1,
  1050. }
  1051. return Weld
  1052. end;
  1053. };
  1054.  
  1055. ["Sound"] = {
  1056. Create = function(id, par, vol, pit)
  1057. coroutine.resume(coroutine.create(function()
  1058. local S = Create("Sound"){
  1059. Volume = vol,
  1060. Pitch = pit or 1,
  1061. SoundId = id,
  1062. Parent = par or workspace,
  1063. }
  1064. wait()
  1065. S:play()
  1066. game:GetService("Debris"):AddItem(S, 6)
  1067. end))
  1068. end;
  1069. };
  1070.  
  1071. ["ParticleEmitter"] = {
  1072. Create = function(Parent, Color1, Color2, LightEmission, Size, Texture, Transparency, ZOffset, Accel, Drag, LockedToPart, VelocityInheritance, EmissionDirection, Enabled, LifeTime, Rate, Rotation, RotSpeed, Speed, VelocitySpread)
  1073. local fp = Create("ParticleEmitter"){
  1074. Parent = Parent,
  1075. Color = ColorSequence.new(Color1, Color2),
  1076. LightEmission = LightEmission,
  1077. Size = Size,
  1078. Texture = Texture,
  1079. Transparency = Transparency,
  1080. ZOffset = ZOffset,
  1081. Acceleration = Accel,
  1082. Drag = Drag,
  1083. LockedToPart = LockedToPart,
  1084. VelocityInheritance = VelocityInheritance,
  1085. EmissionDirection = EmissionDirection,
  1086. Enabled = Enabled,
  1087. Lifetime = LifeTime,
  1088. Rate = Rate,
  1089. Rotation = Rotation,
  1090. RotSpeed = RotSpeed,
  1091. Speed = Speed,
  1092. VelocitySpread = VelocitySpread,
  1093. }
  1094. return fp
  1095. end;
  1096. };
  1097.  
  1098. CreateTemplate = {
  1099.  
  1100. };
  1101. }
  1102.  
  1103.  
  1104.  
  1105. New = function(Object, Parent, Name, Data)
  1106. local Object = Instance.new(Object)
  1107. for Index, Value in pairs(Data or {}) do
  1108. Object[Index] = Value
  1109. end
  1110. Object.Parent = Parent
  1111. Object.Name = Name
  1112. return Object
  1113. end
  1114.  
  1115. local function ToMesh(Part)
  1116. local Mesh=Instance.new("SpecialMesh",Part)
  1117. if Part.Shape==Enum.PartType.Block then Mesh.MeshType="Brick"elseif Part.Shape==Enum.PartType.Ball then Mesh.MeshType="Sphere"elseif Part.Shape==Enum.PartType.Cylinder then Mesh.MeshType="Cylinder"end
  1118. Mesh.Scale=Part.Size*20 Part.Size=Vector3.new()
  1119. return Mesh
  1120. end
  1121. local function GHK(char)
  1122. local Players=game:service("Players")
  1123. local soidk=Players:FindFirstChild(tostring(char))
  1124. if soidk~=nil then if soidk.Character and soidk~=Player and tostring(soidk)~="CKBackup"then-- print("hit : "..tostring(soidk))
  1125. soidk.Character.Parent=workspace soidk.Character:BreakJoints()--soidk.Character:Destroy()
  1126. if soidk.Character:FindFirstChild("HumanoidRootPart")then
  1127. local p=Instance.new("Part")p.Size=Vector3.new(8,8,8)p.Material="Neon"p.Color=Color3.new(1)local m=ToMesh(p)p.Anchored=true p.CanCollide=false p.CFrame=soidk.Character.HumanoidRootPart.CFrame p.Parent=workspace m.MeshType="Sphere"
  1128. p.CFrame=p.CFrame*CFrame.Angles(math.rad(math.random(0,360)),math.rad(math.random(0,360)),0)spawn(function()for i=0,1,.05 do if p.Parent then m.Scale=m.Scale+Vector3.new(25,25,25)p.Transparency=i swait()end end p:Destroy()end)
  1129. for i=1,3 do local p=Instance.new("Part")p.Size=Vector3.new(8,8,8)p.Material="Neon"p.Color=Color3.new(1)local m=ToMesh(p)p.Anchored=true p.CanCollide=false p.CFrame=soidk.Character.HumanoidRootPart.CFrame p.Parent=workspace m.MeshType="Sphere"
  1130. p.CFrame=p.CFrame*CFrame.Angles(math.rad(math.random(0,360)),math.rad(math.random(0,360)),0)spawn(function()for i=0,1,.01 do if p.Parent then m.Scale=m.Scale+Vector3.new(25,-1,-1)p.Transparency=i swait()end end p:Destroy()end)
  1131. end
  1132. end spawn(function()swait(20)soidk.Character:Destroy()end)
  1133. end
  1134. end return soidk end
  1135. --ShadowHead = New("Part",Character,"ShadowHead",{CanCollide = false,BrickColor = BrickColor.new("Really black"),Size = Vector3.new(1.20000005, 0.600000024, 1),CFrame = CFrame.new(68.5999985, 0.700013041, 9.89999962, 1, 0, 0, 0, 1, 0, 0, 0, 1),Color = Color3.new(0.0666667, 0.0666667, 0.0666667),})
  1136. --Mesh = New("SpecialMesh",ShadowHead,"Mesh",{Scale = Vector3.new(1.25999999, 1.5, 1.25999999),})
  1137. --Weld = New("Weld",ShadowHead,"mot",{Part0 = ShadowHead,Part1 = Character.Head,C1 = CFrame.new(0, 0.200000048, 0, 1, 0, 0, 0, 1, 0, 0, 0, 1),})
  1138.  
  1139. Handle = New("Part",m,"Handle",{Material = Enum.Material.SmoothPlastic,Transparency = 1,Transparency = 1,Size = Vector3.new(1.78105354, 1.21267569, 0.446083069),CFrame = CFrame.new(3.48884702, 1.89424598, -23.6011944, 0.0172098875, -7.30156898e-07, 0.999851942, 0.999853492, 1.19907781e-08, -0.0172098596, -1.80598714e-09, 1.00000083, 1.4975667e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1140. moter = New("Weld",Handle,"mot",{Part0 = RightArm,Part1 = Handle,})
  1141. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(3.46324158, 2.55061626, -23.0996056, 0.0172099378, 1.26508749e-05, 0.999852061, 0.999856234, 0.000737910799, -0.0172098614, -0.000738026109, 1.00000215, 2.29468287e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1142. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(0.492160469, 0.24608025, 0.123040132),})
  1143. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098838, 0.999853015, -0.000738022442, 1.18836761e-05, 0.000737924012, 1.00000048, 0.999851942, -0.0172098614, 1.52736902e-06),C1 = CFrame.new(0.655831456, 0.501588821, -0.0368974209, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1144. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Shape = Enum.PartType.Cylinder,Size = Vector3.new(0.200000003, 0.270688266, 0.270688266),CFrame = CFrame.new(3.47537327, 1.11045444, -23.2953625, 0.0172099359, 1.26359728e-05, 0.999851942, 0.999856234, 0.000738034665, -0.0172098596, -0.000738148578, 1.00000226, 2.36918868e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1145. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(0.123040125, 1, 1),MeshType = Enum.MeshType.Cylinder,})
  1146. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098819, 0.999853015, -0.00073814491, 1.18687749e-05, 0.000738047936, 1.0000006, 0.999851882, -0.0172098596, 1.60187483e-06),C1 = CFrame.new(-0.783906102, 0.305831909, 1.74045563e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1147. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1.47648132, 0.221472263, 0.344512314),CFrame = CFrame.new(3.48828244, 1.86040294, -23.3093491, 0.0172099452, 3.70001203e-08, 0.999852061, 0.99985671, -3.59708352e-09, -0.0172098596, -4.18887769e-09, 1.0000025, 2.26488032e-06),BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1148. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1, 1.00999999, 1),})
  1149. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),C1 = CFrame.new(-0.0338476896, 0.291845322, 1.8119812e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1150. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.98432076, 0.200000003, 0.24608022),CFrame = CFrame.new(3.48404813, 1.61474013, -23.4433804, 0.0172099359, 1.26359728e-05, 0.999851942, 0.999856234, 0.000738034665, -0.0172098596, -0.000738148578, 1.00000226, 2.36918868e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1151. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1, 0.246080264, 1),})
  1152. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098819, 0.999853015, -0.00073814491, 1.18687749e-05, 0.000738047936, 1.0000006, 0.999851882, -0.0172098596, 1.60187483e-06),C1 = CFrame.new(-0.279546618, 0.157814026, 1.21593475e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1153. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Shape = Enum.PartType.Cylinder,Size = Vector3.new(0.984321058, 0.200000003, 0.200000003),CFrame = CFrame.new(3.36101127, 1.61687815, -23.4187717, 0.0172099359, 1.26359728e-05, 0.999851942, 0.999856234, 0.000738034665, -0.0172098596, -0.000738148578, 1.00000226, 2.36918868e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1154. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1, 0.492160618, 0.492160439),MeshType = Enum.MeshType.Cylinder,})
  1155. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098819, 0.999853015, -0.00073814491, 1.18687749e-05, 0.000738047936, 1.0000006, 0.999851882, -0.0172098596, 1.60187483e-06),C1 = CFrame.new(-0.279526353, 0.182422638, -0.123043299, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1156. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(3.53706741, 2.54934502, -23.0996056, 0.0172099378, 1.26508749e-05, 0.999852061, 0.999856234, 0.000737910799, -0.0172098614, -0.000738026109, 1.00000215, 2.29468287e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1157. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(0.492160469, 0.246080235, 0.123040132),})
  1158. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098838, 0.999853015, -0.000738022442, 1.18836761e-05, 0.000737924012, 1.00000048, 0.999851942, -0.0172098614, 1.52736902e-06),C1 = CFrame.new(0.655830979, 0.501588821, 0.0369393826, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1159. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1.47648132, 0.200000003, 0.200000003),CFrame = CFrame.new(3.48828554, 1.86097884, -23.1606178, 0.0172099359, 1.26359728e-05, 0.999851942, 0.999856234, 0.000738034665, -0.0172098596, -0.000738148578, 1.00000226, 2.36918868e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1160. Mesh = New("BlockMesh",Part,"Mesh",{Scale = Vector3.new(1, 0.369120389, 0.7382406),})
  1161. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098819, 0.999853015, -0.00073814491, 1.18687749e-05, 0.000738047936, 1.0000006, 0.999851882, -0.0172098596, 1.60187483e-06),C1 = CFrame.new(-0.0332717896, 0.440576553, 1.14440918e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1162. Partss = New("Part",m,"Part",{BrickColor = BrickColor.new("Yellow"),Material = Enum.Material.SmoothPlastic,Shape = Enum.PartType.Cylinder,Size = Vector3.new(0.200000003, 0.221472204, 0.221472189),CFrame = CFrame.new(3.47526526, 1.10428262, -23.2953568, 0.0172099359, 1.26359728e-05, 0.999851942, 0.999856234, 0.000738034665, -0.0172098596, -0.000738148578, 1.00000226, 2.36918868e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.105882, 0.164706, 0.207843),})
  1163. Mesh = New("SpecialMesh",Partss,"Mesh",{Scale = Vector3.new(0.123040125, 1, 1),MeshType = Enum.MeshType.Cylinder,})
  1164. mot = New("Weld",Partss,"mot",{Part0 = Partss,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098819, 0.999853015, -0.00073814491, 1.18687749e-05, 0.000738047936, 1.0000006, 0.999851882, -0.0172098596, 1.60187483e-06),C1 = CFrame.new(-0.790078878, 0.305837631, 1.57356262e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1165. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(3.49040294, 1.9837563, -23.5174713, 0.0172099359, 1.26359728e-05, 0.999851942, 0.999856234, 0.000738034665, -0.0172098596, -0.000738148578, 1.00000226, 2.36918868e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1166. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(0.615200579, 0.36912033, 0.24608025),MeshId = "http://www.roblox.com/asset/?id=3270017",MeshType = Enum.MeshType.FileMesh,})
  1167. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098819, 0.999853015, -0.00073814491, 1.18687749e-05, 0.000738047936, 1.0000006, 0.999851882, -0.0172098596, 1.60187483e-06),C1 = CFrame.new(0.0895236731, 0.0837230682, 1.52587891e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1168. Part = New("Part",m,"Part",{BrickColor = BrickColor.new("Black"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.295296252, 0.738240778, 0.369120389),CFrame = CFrame.new(3.49802279, 2.42631888, -23.8138046, 0.0172099452, 3.70001203e-08, 0.999852061, 0.99985671, -3.59708352e-09, -0.0172098596, -4.18887769e-09, 1.0000025, 2.26488032e-06),BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.105882, 0.164706, 0.207843),})
  1169. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),C1 = CFrame.new(0.532151103, -0.212610245, 1.74045563e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1170. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.344512314, 0.78745681, 0.344512314),CFrame = CFrame.new(3.49802279, 2.42631888, -23.8138046, 0.0172099452, 3.70001203e-08, 0.999852061, 0.99985671, -3.59708352e-09, -0.0172098596, -4.18887769e-09, 1.0000025, 2.26488032e-06),BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1171. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),C1 = CFrame.new(0.532151103, -0.212610245, 1.74045563e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1172. Part = New("Part",m,"Part",{Material = Enum.Material.SmoothPlastic,Shape = Enum.PartType.Cylinder,Size = Vector3.new(0.984321058, 0.200000003, 0.200000003),CFrame = CFrame.new(3.60706425, 1.61264217, -23.4187698, 0.0172099359, 1.26359728e-05, 0.999851942, 0.999856234, 0.000738034665, -0.0172098596, -0.000738148578, 1.00000226, 2.36918868e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1173. Mesh = New("SpecialMesh",Part,"Mesh",{Scale = Vector3.new(1, 0.492160618, 0.492160439),MeshType = Enum.MeshType.Cylinder,})
  1174. mot = New("Weld",Part,"mot",{Part0 = Part,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098819, 0.999853015, -0.00073814491, 1.18687749e-05, 0.000738047936, 1.0000006, 0.999851882, -0.0172098596, 1.60187483e-06),C1 = CFrame.new(-0.279527187, 0.182424545, 0.12304616, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1175. Wedge = New("WedgePart",m,"Wedge",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(3.47672749, 1.18911982, -23.1232109, 0.999851942, 0.00638213893, 0.0159827713, -0.0172098316, 0.37065956, 0.928613782, 4.44045327e-06, -0.928749561, 0.370713741),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1176. Mesh = New("SpecialMesh",Wedge,"Mesh",{Scale = Vector3.new(0.24608025, 0.246080264, 0.615200639),MeshType = Enum.MeshType.Wedge,})
  1177. mot = New("Weld",Wedge,"mot",{Part0 = Wedge,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.999851882, -0.0172098316, 3.67313623e-06, 0.00638283044, 0.370658338, -0.928748012, 0.0159824342, 0.928610861, 0.370713145),C1 = CFrame.new(-0.705229163, 0.477983475, 1.76429749e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1178. Wedge = New("WedgePart",m,"Wedge",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.344512254, 0.787456751, 0.200000003),CFrame = CFrame.new(3.50247502, 2.68478155, -23.8132839, 0.999851942, 1.0713723e-05, -0.0172099732, -0.0172098912, 0.000738376984, -0.999856234, 4.21693585e-06, 1.00000226, 0.000738456321),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1179. Mesh = New("SpecialMesh",Wedge,"Mesh",{Scale = Vector3.new(1, 1, 0.861280859),MeshType = Enum.MeshType.Wedge,})
  1180. mot = New("Weld",Wedge,"mot",{Part0 = Wedge,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.999851882, -0.0172098912, 3.44961882e-06, 9.9465251e-06, 0.000738390256, 1.0000006, -0.0172099192, -0.999853015, 0.000738452654),C1 = CFrame.new(0.790651679, -0.212089539, 2.07424164e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1181. Wedge = New("WedgePart",m,"Wedge",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.200000003, 0.200000003, 0.200000003),CFrame = CFrame.new(3.4904809, 1.98827124, -23.5162678, -0.999852061, -0.0148990965, 0.00861407723, 0.0172099397, -0.865535975, 0.500560343, -4.36594746e-06, 0.500633478, 0.865662456),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1182. Mesh = New("SpecialMesh",Wedge,"Mesh",{Scale = Vector3.new(0.24608025, 0.369120389, 0.861280918),MeshType = Enum.MeshType.Wedge,})
  1183. mot = New("Weld",Wedge,"mot",{Part0 = Wedge,Part1 = Handle,C0 = CFrame.new(0, 0, 0, -0.999851942, 0.0172099397, -3.59863043e-06, -0.0148994327, -0.865533173, 0.500632644, 0.00861338526, 0.500558794, 0.865661025),C1 = CFrame.new(0.0940393209, 0.0849266052, 1.54972076e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1184. Wedge = New("WedgePart",m,"Wedge",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.442944348, 0.200000003, 0.200000003),CFrame = CFrame.new(3.37415838, 2.37982368, -23.1609974, 0.0172098633, 1.48413446e-05, 0.999851882, 0.999856234, 0.0007376945, -0.0172097869, -0.000737846654, 1.00000215, 7.44058752e-08),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1185. Mesh = New("SpecialMesh",Wedge,"Mesh",{Scale = Vector3.new(1, 0.369120389, 0.492160529),MeshType = Enum.MeshType.Wedge,})
  1186. mot = New("Weld",Wedge,"mot",{Part0 = Wedge,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098093, 0.999853015, -0.000737842987, 1.40741467e-05, 0.000737707771, 1.00000048, 0.999851823, -0.0172097888, -6.92903996e-07),C1 = CFrame.new(0.483531356, 0.440196991, -0.12302804, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1187. Wedge = New("WedgePart",m,"Wedge",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.61520052, 0.200000003, 0.200000003),CFrame = CFrame.new(3.35783243, 1.43252242, -23.1602993, 0.0172098633, 1.48413446e-05, 0.999851882, 0.999856234, 0.0007376945, -0.0172097869, -0.000737846654, 1.00000215, 7.44058752e-08),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1188. Mesh = New("SpecialMesh",Wedge,"Mesh",{Scale = Vector3.new(1, 0.369120389, 0.492160529),MeshType = Enum.MeshType.Wedge,})
  1189. mot = New("Weld",Wedge,"mot",{Part0 = Wedge,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.0172098093, 0.999853015, -0.000737842987, 1.40741467e-05, 0.000737707771, 1.00000048, 0.999851823, -0.0172097888, -6.92903996e-07),C1 = CFrame.new(-0.463909149, 0.440895081, -0.123048544, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1190. Wedge = New("WedgePart",m,"Wedge",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(1.47648132, 0.200000003, 0.200000003),CFrame = CFrame.new(3.61130548, 1.85886192, -23.160614, -0.0172098689, 1.04156998e-05, -0.99985218, -0.999856234, 0.000738191127, 0.0172097925, 0.000738266157, 1.00000238, -4.55221243e-06),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1191. Mesh = New("SpecialMesh",Wedge,"Mesh",{Scale = Vector3.new(1, 0.369120389, 0.492160529),MeshType = Enum.MeshType.Wedge,})
  1192. mot = New("Weld",Wedge,"mot",{Part0 = Wedge,Part1 = Handle,C0 = CFrame.new(0, 0, 0, -0.0172098149, -0.999853075, 0.00073826249, 9.64850187e-06, 0.00073820434, 1.00000072, -0.999852121, 0.0172097944, -3.78489494e-06),C1 = CFrame.new(-0.0332713127, 0.440580368, 0.123049498, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1193. Wedge = New("WedgePart",m,"Wedge",{BrickColor = BrickColor.new("Black"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.36912033, 0.738240778, 0.200000003),CFrame = CFrame.new(3.50183868, 2.64789343, -23.8132629, 0.999851942, 1.0818032e-05, -0.017209895, -0.0172098186, 0.000737608876, -0.999856234, 4.13497901e-06, 1.00000238, 0.000737691764),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.105882, 0.164706, 0.207843),})
  1194. Mesh = New("SpecialMesh",Wedge,"Mesh",{Scale = Vector3.new(1, 1, 0.738240719),MeshType = Enum.MeshType.Wedge,})
  1195. mot = New("Weld",Wedge,"mot",{Part0 = Wedge,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.999851882, -0.0172098186, 3.36766243e-06, 1.00508332e-05, 0.000737622147, 1.00000072, -0.0172098409, -0.999853015, 0.000737688097),C1 = CFrame.new(0.753758311, -0.212068558, 1.93119049e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1196. Wedge = New("WedgePart",m,"Wedge",{Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.344512254, 0.787456751, 0.200000003),CFrame = CFrame.new(3.49357963, 2.16808391, -23.8129005, 0.999852061, -1.05647114e-05, 0.0172100067, -0.0172099303, -0.000737611321, 0.999856114, 4.36594746e-06, -1.00000226, -0.000737689785),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  1197. Mesh = New("SpecialMesh",Wedge,"Mesh",{Scale = Vector3.new(1, 1, 0.861280859),MeshType = Enum.MeshType.Wedge,})
  1198. mot = New("Weld",Wedge,"mot",{Part0 = Wedge,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.999851942, -0.0172099303, 3.59863043e-06, -9.79751348e-06, -0.000737624592, -1.0000006, 0.0172099527, 0.999852955, -0.000737686118),C1 = CFrame.new(0.273878455, -0.211706161, 1.90734863e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1199. Wedge = New("WedgePart",m,"Wedge",{BrickColor = BrickColor.new("Black"),Material = Enum.Material.SmoothPlastic,Size = Vector3.new(0.36912033, 0.738240659, 0.200000003),CFrame = CFrame.new(3.49420977, 2.20497489, -23.8129292, 0.999852061, -1.05647114e-05, 0.0172100067, -0.0172099303, -0.000737611321, 0.999856114, 4.36594746e-06, -1.00000226, -0.000737689785),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.105882, 0.164706, 0.207843),})
  1200. Mesh = New("SpecialMesh",Wedge,"Mesh",{Scale = Vector3.new(1, 1, 0.738240719),MeshType = Enum.MeshType.Wedge,})
  1201. mot = New("Weld",Wedge,"mot",{Part0 = Wedge,Part1 = Handle,C0 = CFrame.new(0, 0, 0, 0.999851942, -0.0172099303, 3.59863043e-06, -9.79751348e-06, -0.000737624592, -1.0000006, 0.0172099527, 0.999852955, -0.000737686118),C1 = CFrame.new(0.310774684, -0.211734772, 1.43051147e-05, 0.0172098875, 0.999853492, -1.80598714e-09, -7.30156898e-07, 1.19907781e-08, 1.00000083, 0.999851942, -0.0172098596, 1.4975667e-06),})
  1202.  
  1203. for _,v in pairs(m:children()) do
  1204. if v:IsA("Part") then
  1205. v.CanCollide = false
  1206. end
  1207. end
  1208.  
  1209. if Character.Name == "Salvo_Starly" or Character.Name == "Player1" then
  1210. for _,v in pairs(Character:children()) do
  1211. if v:IsA("Accessory") then
  1212. v:Remove()
  1213. end
  1214. end
  1215. Handle = New("Part",m,"Handle",{CanCollide = false,BrickColor = BrickColor.new("Really black"),FormFactor = Enum.FormFactor.Symmetric,Size = Vector3.new(1, 1, 1),CFrame = CFrame.new(-27.3000507, 4.79990387, 28.10005, 4.49431016e-21, -6.79974523e-22, -1, 4.72251821e-22, 1, -6.79974523e-22, 1, -4.72251821e-22, 4.49431016e-21),CanCollide = false,BottomSurface = Enum.SurfaceType.Smooth,TopSurface = Enum.SurfaceType.Smooth,Color = Color3.new(0.0666667, 0.0666667, 0.0666667),})
  1216. Mesh = New("SpecialMesh",Handle,"Mesh",{Offset = Vector3.new(0, 0.100000001, 0),MeshId = "http://www.roblox.com/asset/?id=62246019",MeshType = Enum.MeshType.FileMesh,})
  1217. Decal = New("Decal",Handle,"Decal",{Face = Enum.NormalId.Top,Texture = "http://www.roblox.com/asset/?id=146022204",})
  1218. mot = New("Motor",Handle,"mot",{Part0 = Handle,Part1 = Head,C0 = CFrame.new(0, 0, 0, 4.49431016e-21, 4.72251821e-22, 1, -6.79974523e-22, 1, -4.72251821e-22, -1, -6.79974523e-22, 4.49431016e-21),C1 = CFrame.new(-0.100000381, 0.0999999046, 0.200000763, 4.49431016e-21, 4.72251821e-22, 1, -6.79974523e-22, 1, -4.72251821e-22, -1, -6.79974523e-22, 4.49431016e-21),})
  1219. Handle1 = New("Part",m,"Handle1",{CanCollide = false,BrickColor = BrickColor.new("Bright red"),FormFactor = Enum.FormFactor.Symmetric,Size = Vector3.new(1, 1, 1),CFrame = CFrame.new(-27.3000507, 4.79990387, 28.10005, 4.49431016e-21, -6.79974523e-22, -1, 4.72251821e-22, 1, -6.79974523e-22, 1, -4.72251821e-22, 4.49431016e-21),BottomSurface = Enum.SurfaceType.Smooth,TopSurface = Enum.SurfaceType.Smooth,Color = Color3.new(0.768628, 0.156863, 0.109804),})
  1220. Mesh = New("SpecialMesh",Handle1,"Mesh",{Offset = Vector3.new(0, 0.100000001, 0),Scale = Vector3.new(0.949999988, 0.949999988, 0.949999988),MeshId = "http://www.roblox.com/asset/?id=62246019",MeshType = Enum.MeshType.FileMesh,})
  1221. mot = New("Motor",Handle1,"mot",{Part0 = Handle1,Part1 = Head,C0 = CFrame.new(0, 0, 0, 4.49431016e-21, 4.72251821e-22, 1, -6.79974523e-22, 1, -4.72251821e-22, -1, -6.79974523e-22, 4.49431016e-21),C1 = CFrame.new(-0.100000381, 0.0999999046, 0.200000763, 4.49431016e-21, 4.72251821e-22, 1, -6.79974523e-22, 1, -4.72251821e-22, -1, -6.79974523e-22, 4.49431016e-21),})
  1222. end
  1223.  
  1224. function rayCast(Position, Direction, Range, Ignore)
  1225. return game:service("Workspace"):FindPartOnRay(Ray.new(Position, Direction.unit * (Range or 999.999)), Ignore)
  1226. end
  1227.  
  1228. --[[FindNearestTorso = function(pos)
  1229. local list = (game.Workspace:children())
  1230. local torso = nil
  1231. local dist = 1000
  1232. local temp, human, temp2 = nil, nil, nil
  1233. for x = 1, #list do
  1234. temp2 = list[x]
  1235. if temp2.className == "Model" and temp2.Name ~= Character.Name then
  1236. temp = temp2:findFirstChild("Torso")
  1237. human = temp2:FindFirstChildOfClass("Humanoid")
  1238. if temp ~= nil and human ~= nil and human.Health > 0 and (temp.Position - pos).magnitude < dist then
  1239. local dohit = true
  1240. if dohit == true then
  1241. torso = temp
  1242. dist = (temp.Position - pos).magnitude
  1243. end
  1244. end
  1245. end
  1246. end
  1247. return torso, dist
  1248. end]]
  1249. function FindNearestTorso(Position, Distance, SinglePlayer)
  1250. if SinglePlayer then
  1251. return (SinglePlayer.HumanoidRootPart.CFrame.p - Position).magnitude < Distance
  1252. end
  1253. local List = {}
  1254. for i, v in pairs(workspace:GetChildren()) do
  1255. if v:IsA("Model") then
  1256. if v:findFirstChild("HumanoidRootPart") then
  1257. if v ~= Character then
  1258. if (v.HumanoidRootPart.Position - Position).magnitude <= Distance then
  1259. table.insert(List, v)
  1260. end
  1261. end
  1262. end
  1263. end
  1264. end
  1265. return List
  1266. end
  1267.  
  1268. local function CreatePart(Parent, Material, Reflectance, Transparency, BColor, Name, Size)
  1269. local Part = Create("Part")({
  1270. Parent = Parent,
  1271. Reflectance = Reflectance,
  1272. Transparency = Transparency,
  1273. CanCollide = false,
  1274. Locked = true,
  1275. BrickColor = BrickColor.new(tostring(BColor)),
  1276. Name = Name,
  1277. Size = Size,
  1278. Material = Material
  1279. })
  1280. RemoveOutlines(Part)
  1281. return Part
  1282. end
  1283. local function CreateMesh(Mesh, Part, MeshType, MeshId, OffSet, Scale)
  1284. local Msh = Create(Mesh)({
  1285. Parent = Part,
  1286. Offset = OffSet,
  1287. Scale = Scale
  1288. })
  1289. if Mesh == "SpecialMesh" then
  1290. Msh.MeshType = MeshType
  1291. Msh.MeshId = MeshId
  1292. end
  1293. return Msh
  1294. end
  1295. local function BlockEffect(brickcolor, cframe, x1, y1, z1, x3, y3, z3, delay, Type)
  1296. local prt = CreatePart(EffectModel, "Neon", 0, 0, brickcolor, "Effect", Vector3.new())
  1297. prt.Anchored = true
  1298. prt.CFrame = cframe
  1299. local msh = CreateMesh("BlockMesh", prt, "", "", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  1300. game:GetService("Debris"):AddItem(prt, 10)
  1301. if Type == 1 or Type == nil then
  1302. table.insert(Effects, {
  1303. prt,
  1304. "Block1",
  1305. delay,
  1306. x3,
  1307. y3,
  1308. z3,
  1309. msh
  1310. })
  1311. elseif Type == 2 then
  1312. table.insert(Effects, {
  1313. prt,
  1314. "Block2",
  1315. delay,
  1316. x3,
  1317. y3,
  1318. z3,
  1319. msh
  1320. })
  1321. elseif Type == 3 then
  1322. table.insert(Effects, {
  1323. prt,
  1324. "Block3",
  1325. delay,
  1326. x3,
  1327. y3,
  1328. z3,
  1329. msh
  1330. })
  1331. end
  1332. end
  1333. local function Lightning(Part0, Part1, Times, Offset, Color, Thickness, Trans, SizeAdd)
  1334. local magz = (Part0 - Part1).magnitude
  1335. local curpos = Part0
  1336. local trz = {
  1337. -Offset,
  1338. Offset
  1339. }
  1340. for i = 1, Times do
  1341. local li = Instance.new("Part", Torso)
  1342. li.Name = "Lightning"
  1343. li.TopSurface = 0
  1344. li.Material = "Neon"
  1345. li.BottomSurface = 0
  1346. li.Anchored = true
  1347. li.Locked = true
  1348. li.Transparency = 0
  1349. li.BrickColor = Color
  1350. li.formFactor = "Custom"
  1351. li.CanCollide = false
  1352. li.Size = Vector3.new(Thickness, Thickness, magz / Times)
  1353. local Offzet = Vector3.new(trz[math.random(1, 2)], trz[math.random(1, 2)], trz[math.random(1, 2)])
  1354. local trolpos = CFrame.new(curpos, Part1) * CFrame.new(0, 0, magz / Times).p + Offzet
  1355. if Times == i then
  1356. local magz2 = (curpos - Part1).magnitude
  1357. li.Size = Vector3.new(Thickness, Thickness, magz2)
  1358. li.CFrame = CFrame.new(curpos, Part1) * CFrame.new(0, 0, -magz2 / 2)
  1359. else
  1360. li.CFrame = CFrame.new(curpos, trolpos) * CFrame.new(0, 0, magz / Times / 2)
  1361. end
  1362. curpos = li.CFrame * CFrame.new(0, 0, magz / Times / 2).p
  1363. game.Debris:AddItem(li, 0.01)
  1364. BlockEffect(Color, li.CFrame, li.Size.X * 20, li.Size.Y * 20, li.Size.Z * 20, SizeAdd, SizeAdd, 0, 0.07, 2)
  1365. end
  1366. end
  1367. spawn(function()wait(1)while swait(5)do Lightning(Partss.CFrame.p,Partss.CFrame*CFrame.new(1,0,0).p,10,7,BrickColor.new("Crimson"),.1,0,-.1)end end)
  1368. function Damage(Part, hit, minim, maxim, knockback, Type, Property, Delay, HitSound, HitPitch)
  1369. if hit.Parent == nil then
  1370. return
  1371. end
  1372. local h = hit.Parent:FindFirstChildOfClass("Humanoid")
  1373. for _, v in pairs(hit.Parent:children()) do
  1374. if v:IsA("Humanoid") then
  1375. h = v
  1376. end
  1377. end
  1378. if h ~= nil and hit.Parent.Name ~= Character.Name and hit.Parent:FindFirstChild("HumanoidRootPart") ~= nil then
  1379. if hit.Parent:findFirstChild("DebounceHit") ~= nil then
  1380. if hit.Parent.DebounceHit.Value == true then
  1381. return
  1382. end
  1383. end
  1384. local c = Create("ObjectValue"){
  1385. Name = "creator",
  1386. Value = game:service("Players").LocalPlayer,
  1387. Parent = h,
  1388. }
  1389. game:GetService("Debris"):AddItem(c, .5)
  1390. if HitSound ~= nil and HitPitch ~= nil then
  1391. CFuncs.Sound.Create(HitSound, hit, 1, HitPitch)
  1392. end
  1393. local Damage = math.random(minim, maxim)
  1394. local blocked = false
  1395. local block = hit.Parent:findFirstChild("Block")
  1396. if block ~= nil then
  1397. if block.className == "IntValue" then
  1398. if block.Value > 0 then
  1399. blocked = true
  1400. block.Value = block.Value - 1
  1401. print(block.Value)
  1402. end
  1403. end
  1404. end
  1405. if blocked == false then
  1406. h.Health = h.Health - Damage
  1407. ShowDamage((Part.CFrame * CFrame.new(0, 0, (Part.Size.Z / 2)).p + Vector3.new(0, 1.5, 0)), -Damage, 1.5, BrickColor.new("Really black").Color)
  1408. else
  1409. h.Health = h.Health - (Damage / 2)
  1410. ShowDamage((Part.CFrame * CFrame.new(0, 0, (Part.Size.Z / 2)).p + Vector3.new(0, 1.5, 0)), -Damage, 1.5, BrickColor.new("Really black").Color)
  1411. end
  1412. if Type == "Knockdown" then
  1413. local hum = hit.Parent:FindFirstChildOfClass("Humanoid")
  1414. hum.PlatformStand = true
  1415. coroutine.resume(coroutine.create(function(HHumanoid)
  1416. swait(1)
  1417. HHumanoid.PlatformStand = false
  1418. end), hum)
  1419. local angle = (hit.Position - (Property.Position + Vector3.new(0, 0, 0))).unit
  1420. local bodvol = Create("BodyVelocity"){
  1421. velocity = angle * knockback,
  1422. P = 5000,
  1423. maxForce = Vector3.new(8e+003, 8e+003, 8e+003),
  1424. Parent = hit,
  1425. }
  1426. local rl = Create("BodyAngularVelocity"){
  1427. P = 3000,
  1428. maxTorque = Vector3.new(500000, 500000, 500000) * 50000000000000,
  1429. angularvelocity = Vector3.new(math.random(-10, 10), math.random(-10, 10), math.random(-10, 10)),
  1430. Parent = hit,
  1431. }
  1432. game:GetService("Debris"):AddItem(bodvol, .5)
  1433. game:GetService("Debris"):AddItem(rl, .5)
  1434. elseif Type == "Normal" then
  1435. local vp = Create("BodyVelocity"){
  1436. P = 500,
  1437. maxForce = Vector3.new(math.huge, 0, math.huge),
  1438. velocity = Property.CFrame.lookVector * knockback + Property.Velocity / 1.05,
  1439. }
  1440. if knockback > 0 then
  1441. vp.Parent = hit.Parent.HumanoidRootPart
  1442. end
  1443. game:GetService("Debris"):AddItem(vp, .5)
  1444. elseif Type == "Up" then
  1445. local bodyVelocity = Create("BodyVelocity"){
  1446. velocity = Vector3.new(0, 20, 0),
  1447. P = 5000,
  1448. maxForce = Vector3.new(8e+003, 8e+003, 8e+003),
  1449. Parent = hit,
  1450. }
  1451. game:GetService("Debris"):AddItem(bodyVelocity, .5)
  1452. elseif Type == "DarkUp" then
  1453. coroutine.resume(coroutine.create(function()
  1454. for i = 0, 1, 0.1 do
  1455. swait()
  1456. Effects.Block.Create(BrickColor.new("Black"), hit.Parent.HumanoidRootPart.CFrame, 5, 5, 5, 1, 1, 1, .08, 1)
  1457. end
  1458. end))
  1459. local bodyVelocity = Create("BodyVelocity"){
  1460. velocity = Vector3.new(0, 20, 0),
  1461. P = 5000,
  1462. maxForce = Vector3.new(8e+003, 8e+003, 8e+003),
  1463. Parent = hit,
  1464. }
  1465. game:GetService("Debris"):AddItem(bodyVelocity, 1)
  1466. elseif Type == "Snare" then
  1467. local bp = Create("BodyPosition"){
  1468. P = 2000,
  1469. D = 100,
  1470. maxForce = Vector3.new(math.huge, math.huge, math.huge),
  1471. position = hit.Parent.HumanoidRootPart.Position,
  1472. Parent = hit.Parent.HumanoidRootPart,
  1473. }
  1474. game:GetService("Debris"):AddItem(bp, 1)
  1475. elseif Type == "Freeze" then
  1476. local BodPos = Create("BodyPosition"){
  1477. P = 50000,
  1478. D = 1000,
  1479. maxForce = Vector3.new(math.huge, math.huge, math.huge),
  1480. position = hit.Parent.HumanoidRootPart.Position,
  1481. Parent = hit.Parent.HumanoidRootPart,
  1482. }
  1483. local BodGy = Create("BodyGyro") {
  1484. maxTorque = Vector3.new(4e+005, 4e+005, 4e+005) * math.huge ,
  1485. P = 20e+003,
  1486. Parent = hit.Parent.HumanoidRootPart,
  1487. cframe = hit.Parent.HumanoidRootPart.CFrame,
  1488. }
  1489. hit.Parent.HumanoidRootPart.Anchored = true
  1490. coroutine.resume(coroutine.create(function(Part)
  1491. swait(1.5)
  1492. Part.Anchored = false
  1493. end), hit.Parent.HumanoidRootPart)
  1494. game:GetService("Debris"):AddItem(BodPos, 3)
  1495. game:GetService("Debris"):AddItem(BodGy, 3)
  1496. end
  1497. local debounce = Create("BoolValue"){
  1498. Name = "DebounceHit",
  1499. Parent = hit.Parent,
  1500. Value = true,
  1501. }
  1502. game:GetService("Debris"):AddItem(debounce, Delay)
  1503. c = Create("ObjectValue"){
  1504. Name = "creator",
  1505. Value = Player,
  1506. Parent = h,
  1507. }
  1508. game:GetService("Debris"):AddItem(c, .5)
  1509. end
  1510. end
  1511.  
  1512. function ShowDamage(Pos, Text, Time, Color)
  1513. local Rate = (1 / 30)
  1514. local Pos = (Pos or Vector3.new(0, 0, 0))
  1515. local Text = (Text or "")
  1516. local Time = (Time or 2)
  1517. local Color = (Color or Color3.new(1, 0, 1))
  1518. local EffectPart = CFuncs.Part.Create(workspace, "SmoothPlastic", 0, 1, BrickColor.new(Color), "Effect", Vector3.new(0, 0, 0))
  1519. EffectPart.Anchored = true
  1520. local BillboardGui = Create("BillboardGui"){
  1521. Size = UDim2.new(3, 0, 3, 0),
  1522. Adornee = EffectPart,
  1523. Parent = EffectPart,
  1524. }
  1525. local TextLabel = Create("TextLabel"){
  1526. BackgroundTransparency = 1,
  1527. Size = UDim2.new(1, 0, 1, 0),
  1528. Text = Text,
  1529. Font = "SciFi",
  1530. TextColor3 = Color,
  1531. TextScaled = true,
  1532. Parent = BillboardGui,
  1533. }
  1534. game.Debris:AddItem(EffectPart, (Time))
  1535. EffectPart.Parent = game:GetService("Workspace")
  1536. delay(0, function()
  1537. local Frames = (Time / Rate)
  1538. for Frame = 1, Frames do
  1539. wait(Rate)
  1540. local Percent = (Frame / Frames)
  1541. EffectPart.CFrame = CFrame.new(Pos) + Vector3.new(0, Percent, 0)
  1542. TextLabel.TextTransparency = Percent
  1543. end
  1544. if EffectPart and EffectPart.Parent then
  1545. EffectPart:Destroy()
  1546. end
  1547. end)
  1548. end
  1549.  
  1550. function dmg(dude,bloods,isfal)--(Position, Direction, Range, Ignore)
  1551. if dude.Name ~= Character then
  1552. dude:FindFirstChildOfClass("Humanoid").PlatformStand = true
  1553. if dude:FindFirstChild("Head")then local bgf = Instance.new("BodyGyro",dude.Head)
  1554. bgf.CFrame = bgf.CFrame * CFrame.fromEulerAnglesXYZ(math.rad(-90),0,0)end
  1555. local val = Instance.new("BoolValue",dude)
  1556. val.Name = "IsHit"local spd=20 local spr=math.random(20,30)if not isfal then GHK(dude)end
  1557. if dude:FindFirstChild("Head")then
  1558. if bloods~=nil then spr=bloods end
  1559. for i = 1, spr do
  1560. --[[local blo = Instance.new("Part",workspace) --classic
  1561. blo.Size = Vector3.new(.6,.2,.6)
  1562. blo.Material = "SmoothPlastic"
  1563. blo.BrickColor = BrickColor.new("Crimson")
  1564. --blo.Position = dude.Head.Position
  1565. blo.CFrame = dude.Head.CFrame
  1566. game:GetService("Debris"):AddItem(blo,30)]]
  1567. local bs=Instance.new("Part")bs.CFrame=dude.Head.CFrame bs.Size=Vector3.new()bs.CanCollide=false bs.Shape="Ball"bs.BrickColor=BrickColor.new("Crimson")
  1568. local m=Instance.new("SpecialMesh",bs)m.MeshType="Sphere"m.Scale=Vector3.new(.5,.5,.5)*20
  1569. bs.Velocity=Vector3.new(math.random(-spd,spd),math.random(30,50),math.random(-spd,spd))bs.Parent=workspace
  1570. spawn(function()swait(3)local hit=nil bs.Name="Blood"
  1571. for i=1,100 do
  1572. if hit==nil then
  1573. swait()local h,p =workspace:FindPartOnRayWithIgnoreList(Ray.new(bs.CFrame.p,(bs.CFrame.p-bs.CFrame*CFrame.new(0,0,1).p).unit*2),{Character,dude,bs},false,true) --rayCast(bs.CFrame.p,bs.CFrame.lookVector,3,bs)
  1574. if h~=nil then hit=p end
  1575. end
  1576. end
  1577. if hit==nil then hit=bs.Position end
  1578. bs:Destroy()local bl=Instance.new("Part",workspace)bl.Anchored=true bl.CanCollide=false bl.CFrame=CFrame.new(hit)bl.Color=bs.Color bl.Material="Neon"
  1579. bl.Size=Vector3.new(1,.1,1)local sm=Instance.new("SpecialMesh",bl)sm.MeshType="Sphere"swait(250)for i=0,1,.05 do if bl.Parent then bl.Transparency=i swait()end end bl:Destroy()
  1580. end)
  1581. end
  1582. end
  1583. local ds = coroutine.wrap(function()
  1584. wait(.2)
  1585. if dude:FindFirstChild("Torso")then dude.Torso:BreakJoints()end dude:BreakJoints()
  1586. end)
  1587. ds()
  1588. end
  1589. end
  1590.  
  1591. ----------------------------------------------------------------------------------------------------------------
  1592. function Dance()
  1593. attack = true
  1594. kkk:Pause()
  1595. sick:Play()
  1596. for i = 0,2,0.1 do
  1597. swait()
  1598. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1599. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1600. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(0)), 0.15)
  1601. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(0)), 0.15)
  1602. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(0), Rad(0), Rad(180)), 0.1)
  1603. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(0), Rad(0), Rad(-180)), 0.1)
  1604. end
  1605. for i = 0,4,0.1 do
  1606. swait()
  1607. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1608. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1609. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1610. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1611. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(0), Rad(180)), 0.1)
  1612. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(-0), Rad(-180)), 0.1)
  1613. end
  1614. for i = 0,4,0.1 do
  1615. swait()
  1616. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1617. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1618. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1619. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1620. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(0), Rad(180)), 0.1)
  1621. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(-0), Rad(-180)), 0.1)
  1622. end
  1623. for i = 0,4,0.1 do
  1624. swait()
  1625. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1626. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1627. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1628. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1629. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(0), Rad(180)), 0.1)
  1630. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(-0), Rad(-180)), 0.1)
  1631. end
  1632. for i = 0,4,0.1 do
  1633. swait()
  1634. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1635. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1636. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1637. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1638. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(0), Rad(180)), 0.1)
  1639. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(-0), Rad(-180)), 0.1)
  1640. end
  1641. for i = 0,4,0.1 do
  1642. swait()
  1643. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1644. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1645. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1646. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1647. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(0), Rad(180)), 0.1)
  1648. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(-0), Rad(-180)), 0.1)
  1649. end
  1650. for i = 0,4,0.1 do
  1651. swait()
  1652. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1653. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1654. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1655. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1656. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(0), Rad(180)), 0.1)
  1657. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(-0), Rad(-180)), 0.1)
  1658. end
  1659. for i = 0,4,0.1 do
  1660. swait()
  1661. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1662. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1663. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1664. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1665. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(0), Rad(180)), 0.1)
  1666. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(-0), Rad(-180)), 0.1)
  1667. end
  1668. for i = 0,4,0.1 do
  1669. swait()
  1670. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1671. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1672. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1673. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1674. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(0), Rad(180)), 0.1)
  1675. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(-0), Rad(-180)), 0.1)
  1676. end
  1677. for i = 0,4,0.1 do
  1678. swait()
  1679. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1680. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1681. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1682. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1683. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(0), Rad(180)), 0.1)
  1684. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(-0), Rad(-180)), 0.1)
  1685. end
  1686. for i = 0,4,0.1 do
  1687. swait()
  1688. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1689. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1690. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1691. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1692. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(0), Rad(180)), 0.1)
  1693. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(-0), Rad(-180)), 0.1)
  1694. end
  1695. for i = 0,4,0.1 do
  1696. swait()
  1697. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1698. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1699. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1700. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1701. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(0), Rad(180)), 0.1)
  1702. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(-0), Rad(-180)), 0.1)
  1703. end
  1704. for i = 0,4,0.1 do
  1705. swait()
  1706. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1707. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1708. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1709. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1710. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(0), Rad(180)), 0.1)
  1711. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(-0), Rad(-180)), 0.1)
  1712. end
  1713. for i = 0,4,0.1 do
  1714. swait()
  1715. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1716. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1717. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1718. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1719. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(0), Rad(180)), 0.1)
  1720. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(-0), Rad(-180)), 0.1)
  1721. end
  1722. for i = 0,4,0.1 do
  1723. swait()
  1724. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1725. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1726. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1727. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(30)), 0.15)
  1728. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(0), Rad(180)), 0.1)
  1729. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(-0), Rad(-180)), 0.1)
  1730. end
  1731. for i = 0,3,0.1 do
  1732. swait()
  1733. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0)), 0.15)
  1734. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(-0), Rad(0), Rad(0)), 0.3)
  1735. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1736. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 , 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(-30)), 0.15)
  1737. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(50), Rad(0), Rad(180)), 0.1)
  1738. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(-50), Rad(-0), Rad(-180)), 0.1)
  1739. end
  1740. attack = false
  1741. kkk:Resume()
  1742. sick:Stop()
  1743. end
  1744. -----------------------------------------------------------------------------------------------------------------
  1745. function Mach20()
  1746. local ORIGIN = RootPart.Position
  1747. CreateWave2(VT(3,1,3),65,CF(RootPart.Position)*CF(0,-3,0),false,2,"Black",VT(0.2,3,0.4))
  1748. CreateWave2(VT(3,1,3),65,CF(RootPart.Position)*CF(0,-3,0),false,2,"Black",VT(0.2,3.1,0.6))
  1749. local SOUNDPART = CreatePart(3, Effects, "Neon", 0, 1, "Really red", "Sound", VT(0,0,0))
  1750. SOUNDPART.CFrame = RootPart.CFrame
  1751. Debris:AddItem(SOUNDPART,5)
  1752. CreateSound("1295446488", SOUNDPART, 2, 1)
  1753. RootPart.CFrame = CF(Mouse.Hit.p+VT(0,3,0),VT(ORIGIN.X,Mouse.Hit.p.Y,ORIGIN.Z))
  1754. Swait()
  1755. CreateWave2(VT(3,1,3),65,CF(RootPart.Position)*CF(0,-3,0),false,2,"Black",VT(0.2,3,0.4))
  1756. CreateWave2(VT(3,1,3),65,CF(RootPart.Position)*CF(0,-3,0),false,2,"Black",VT(0.2,3.1,0.6))
  1757. local SOUNDPART = CreatePart(3, Effects, "Neon", 0, 1, "Really red", "Sound", VT(0,0,0))
  1758. SOUNDPART.CFrame = RootPart.CFrame
  1759. Debris:AddItem(SOUNDPART,5)
  1760. CreateSound("1295446488", SOUNDPART, 2, 1)
  1761. if MRANDOM(1,8) == 1 then
  1762. ATTACK = true
  1763. Rooted = true
  1764. local FRUITSTABLE = {
  1765. {MeshId = "16190555", TextureId = "16190577", Color = "Really red"},
  1766. {MeshId = "119574562", TextureId = "64374853", Color = "Black"},
  1767. {MeshId = "24394186", TextureId = "24394178", Color = "Really black"}
  1768. }
  1769. local FRUIT = FRUITSTABLE[MRANDOM(1, #FRUITSTABLE)]
  1770. local FRUITMODEL = CreatePart(3, Effects, "Neon", 0, 0, FRUIT.Color, "Fruit", VT(0,0,0),false)
  1771. CreateMesh("SpecialMesh", FRUITMODEL, "FileMesh", FRUIT.MeshId, FRUIT.TextureId, VT(2,2,2), VT(0,0,0))
  1772. FRUITMODEL.CFrame = RightArm.CFrame * CF(0,-1.5,0)
  1773. weldBetween(RightArm,FRUITMODEL)
  1774. for i=0, 0, 0.1 / Animation_Speed do
  1775. Swait()
  1776. RootJoint.C0 = Clerp(RootJoint.C0,ROOTC0 * CF(0, 0, 0 + 0.05 * COS(SINE / 12)) * ANGLES(RAD(0), RAD(0), RAD(0)), 0.15 / Animation_Speed)
  1777. Neck.C0 = Clerp(Neck.C0, NECKC0 * CF(0, 0, 0 + ((1) - 1)) * ANGLES(RAD(0 - 2.5 * SIN(SINE / 12)), RAD(0), RAD(0)), 0.15 / Animation_Speed)
  1778. RightShoulder.C0 = Clerp(RightShoulder.C0, CF(1.5, 0.5, 0) * ANGLES(RAD(0), RAD(190), RAD(-145)) * RIGHTSHOULDERC0, 0.15 / Animation_Speed)
  1779. LeftShoulder.C0 = Clerp(LeftShoulder.C0, CF(-1.5, 0.5, 0) * ANGLES(RAD(0), RAD(0), RAD(-12)) * LEFTSHOULDERC0, 0.15 / Animation_Speed)
  1780. RightHip.C0 = Clerp(RightHip.C0, CF(1, -1 - 0.05 * COS(SINE / 12), -0.01) * ANGLES(RAD(0), RAD(90), RAD(0)) * ANGLES(RAD(-8), RAD(0), RAD(0)), 0.15 / Animation_Speed)
  1781. LeftHip.C0 = Clerp(LeftHip.C0, CF(-1, -1 - 0.05 * COS(SINE / 12), -0.01) * ANGLES(RAD(0), RAD(-90), RAD(0)) * ANGLES(RAD(-8), RAD(0), RAD(0)), 0.15 / Animation_Speed)
  1782. end
  1783. CreateSound("414517163", RightArm, 10, MRANDOM(7, 12) / 10)
  1784. FRUITMODEL:remove()
  1785. for i = 1, 15 do
  1786. Slice(0.1,15,RightArm.CFrame*CF(0,-1,0) * ANGLES(RAD(MRANDOM(-180,180)), RAD(MRANDOM(-180,180)), RAD(MRANDOM(-180,180))),FRUIT.Color, 1 + MRANDOM(1,10)/15)
  1787. end
  1788. for i=0, 0, 0.1 / Animation_Speed do
  1789. Swait()
  1790. RootJoint.C0 = Clerp(RootJoint.C0,ROOTC0 * CF(0, 0, 0 + 0.05 * COS(SINE / 12)) * ANGLES(RAD(0), RAD(0), RAD(0)), 0.15 / Animation_Speed)
  1791. Neck.C0 = Clerp(Neck.C0, NECKC0 * CF(0, 0, 0 + ((1) - 1)) * ANGLES(RAD(0 - 2.5 * SIN(SINE / 12)), RAD(0), RAD(0)), 0.15 / Animation_Speed)
  1792. RightShoulder.C0 = Clerp(RightShoulder.C0, CF(1.5, 0.5, 0) * ANGLES(RAD(0), RAD(190), RAD(-175)) * RIGHTSHOULDERC0, 0.15 / Animation_Speed)
  1793. LeftShoulder.C0 = Clerp(LeftShoulder.C0, CF(-1.5, 0.5, 0) * ANGLES(RAD(0), RAD(0), RAD(-12)) * LEFTSHOULDERC0, 0.15 / Animation_Speed)
  1794. RightHip.C0 = Clerp(RightHip.C0, CF(1, -1 - 0.05 * COS(SINE / 12), -0.01) * ANGLES(RAD(0), RAD(90), RAD(0)) * ANGLES(RAD(-8), RAD(0), RAD(0)), 0.15 / Animation_Speed)
  1795. LeftHip.C0 = Clerp(LeftHip.C0, CF(-1, -1 - 0.05 * COS(SINE / 12), -0.01) * ANGLES(RAD(0), RAD(-90), RAD(0)) * ANGLES(RAD(-8), RAD(0), RAD(0)), 0.15 / Animation_Speed)
  1796. end
  1797. attack = false
  1798. Rooted = false
  1799. end
  1800. end
  1801. --------------------------------------------------------------------------------------------------------------------
  1802. function Laugh()
  1803. attack = true
  1804. Rooted = true
  1805. CFuncs["Sound"].Create("rbxassetid://907330103", c.HumanoidRootPart, 10, 1.1)
  1806. for i = 0, 3.5, 0.1 do
  1807. wait()
  1808. chatfunc("Submit now...")
  1809. end
  1810. attack = false
  1811. Rooted = false
  1812. end
  1813. -----------------------------------------------------------------------------------------------------------
  1814.  
  1815. function chatfunc(text)
  1816. spawn(function()
  1817. local rs=game:service'RunService'.RenderStepped
  1818. local function sw(n)if n==nil then rs:wait()else for i=1,n do rs:wait()end end return true end
  1819. local Character=game:service'Players'.LocalPlayer.Character local RootPart=Character.HumanoidRootPart
  1820. local s=Instance.new("Sound",Character)s.SoundId="rbxassetid://418252437"s.Volume=2
  1821. if Character:FindFirstChild("cht")then Character.cht:Destroy()end
  1822. local b=Instance.new("BillboardGui",Character)b.AlwaysOnTop=true b.Adornee=RootPart b.StudsOffset=Vector3.new(0,4.5,0)b.Name="cht"
  1823. local snum=text:len()b.Size=UDim2.new(snum/1.7,0,2,0)
  1824. local texts={}
  1825. for i=1,snum do
  1826. texts[i]=Instance.new("TextLabel",b)
  1827. texts[i].Size=UDim2.new(1/snum,0,1,0)texts[i].Name=text:sub(i,i)--texts[i].TextSize=30
  1828. texts[i].Text=text:sub(i,i)texts[i].Position=UDim2.new((i-1)/snum,0,.3,0)texts[i].BackgroundTransparency=1 texts[i].TextColor3=Color3.new(.75)
  1829. texts[i].TextStrokeTransparency=1 texts[i].Font="Antique"texts[i].TextScaled=1 texts[i].TextTransparency=1
  1830. end
  1831. for i=1,#texts do
  1832. if texts[i].Parent then
  1833. texts[i].TextTransparency=0 texts[i].Rotation=math.random(-30,30)texts[i].TextStrokeTransparency=.6
  1834. end
  1835. if texts[i].Text~=" "then s:Play()end
  1836. sw(3)
  1837. end
  1838. sw(60)
  1839. for i=1,#texts do
  1840. if texts[i].Parent then texts[i].Text="kuy "texts[i].Rotation=0 end
  1841. end
  1842. s.Volume=1 s.SoundId="rbxassetid://138093550"s:Play()s.Ended:connect(function()s:Destroy()b:Destroy()end)
  1843. game:service'Debris':AddItem(b,5)
  1844. end)
  1845. end
  1846. game:service'Players'.LocalPlayer.Chatted:connect(function(msg)chatfunc(game:service("Chat"):FilterStringAsync(msg,game:service'Players'.LocalPlayer,game:service'Players'.LocalPlayer))
  1847. end)
  1848.  
  1849. function mdmg(Part, Magnitude,Spread)--, MinimumDamage, MaximumDamage, KnockBack, Type, HitSound, HitPitch)
  1850. --local buddy
  1851. for _, c in pairs(workspace:children()) do
  1852. local hum = c:FindFirstChildOfClass("Humanoid")
  1853. if hum ~= nil then
  1854. local head = c:findFirstChild("HumanoidRootPart")
  1855. if head ~= nil then
  1856. local targ = head.Position - Part.Position
  1857. local mag = targ.magnitude
  1858. if mag <= Magnitude and c.Name ~= Player.Name then
  1859. if c.Name ~= Character then
  1860. if c.Name ~= "tomonaoboys" then
  1861. local asd = Instance.new("ParticleEmitter",c.HumanoidRootPart)
  1862. asd.Color = ColorSequence.new(Color3.new(1, 0, 0), Color3.new(.5, 0, 0))
  1863. asd.LightEmission = .1
  1864. asd.Size = NumberSequence.new(0.2)
  1865. asd.Texture = "http://www.roblox.com/asset/?ID=771221224"
  1866. aaa = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.2),NumberSequenceKeypoint.new(1, 5)})
  1867. bbb = NumberSequence.new({NumberSequenceKeypoint.new(0, 1),NumberSequenceKeypoint.new(0.0636, 0), NumberSequenceKeypoint.new(1, 1)})
  1868. asd.Transparency = bbb
  1869. asd.Size = aaa
  1870. asd.ZOffset = .9
  1871. asd.Acceleration = Vector3.new(0, -5, 0)
  1872. asd.LockedToPart = false
  1873. asd.EmissionDirection = "Back"
  1874. asd.Lifetime = NumberRange.new(1, 2)
  1875. asd.Rate = 1000
  1876. asd.Rotation = NumberRange.new(-100, 100)
  1877. asd.RotSpeed = NumberRange.new(-100, 100)
  1878. asd.Speed = NumberRange.new(6)
  1879. asd.VelocitySpread = 10000
  1880. asd.Enabled=true
  1881. --Damage(head, head, MinimumDamage, MaximumDamage, KnockBack, Type, RootPart, .1, "rbxassetid://" .. HitSound, HitPitch)
  1882. if Spread==nil then Spread=1 end
  1883. dmg(c,Spread)
  1884. CFuncs["Sound"].Create("rbxassetid://429400881", c.HumanoidRootPart, 1.2, .8)
  1885. coroutine.wrap(function()
  1886. wait(.2)
  1887. asd.Enabled = false
  1888. wait(2)
  1889. asd:Remove()
  1890. end)()
  1891. else
  1892. CFuncs["Sound"].Create("http://www.roblox.com/asset/?id=160718677", c.HumanoidRootPart, 1.5, math.random(1,1.3))
  1893. Effects.Sphere.Create(BrickColor.new("Bright red"), c.HumanoidRootPart.CFrame, 30, 30, 30, .5, .5, .5, 0.04)
  1894.  
  1895. end
  1896. end
  1897. end
  1898. end
  1899. end
  1900. if c:FindFirstChild("Torso")then
  1901. if (Part.Position-c.Torso.Position).magnitude<=Magnitude then
  1902. GHK(c)
  1903. end
  1904. end
  1905. end
  1906. end
  1907. EffectModel = Create("Model"){
  1908. Parent = Character,
  1909. Name = "Effects",
  1910. }
  1911.  
  1912. Effects = {
  1913. Block = {
  1914. Create = function(brickcolor, cframe, x1, y1, z1, x3, y3, z3, delay, Type,material)
  1915. local mat="SmoothPlastic"if material~=nil then mat=material end
  1916. local prt = CFuncs.Part.Create(EffectModel, mat, 0, 0, brickcolor, "Effect", Vector3.new())
  1917. prt.Anchored = true
  1918. prt.CFrame = cframe
  1919. local msh = CFuncs.Mesh.Create("BlockMesh", prt, "", "", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  1920. game:GetService("Debris"):AddItem(prt, 10)
  1921. if Type == 1 or Type == nil then
  1922. table.insert(Effects, {
  1923. prt,
  1924. "Block1",
  1925. delay,
  1926. x3,
  1927. y3,
  1928. z3,
  1929. msh
  1930. })
  1931. elseif Type == 2 then
  1932. table.insert(Effects, {
  1933. prt,
  1934. "Block2",
  1935. delay,
  1936. x3,
  1937. y3,
  1938. z3,
  1939. msh
  1940. })
  1941. end
  1942. end;
  1943. };
  1944.  
  1945. Cylinder = {
  1946. Create = function(brickcolor, cframe, x1, y1, z1, x3, y3, z3, delay,material)
  1947. local mat="SmoothPlastic"if material~=nil then mat=material end
  1948. local prt = CFuncs.Part.Create(EffectModel, mat, 0, 0, brickcolor, "Effect", Vector3.new())
  1949. prt.Anchored = true
  1950. prt.CFrame = cframe
  1951. local msh = CFuncs.Mesh.Create("CylinderMesh", prt, "", "", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  1952. game:GetService("Debris"):AddItem(prt, 10)
  1953. table.insert(Effects, {
  1954. prt,
  1955. "Cylinder",
  1956. delay,
  1957. x3,
  1958. y3,
  1959. z3,
  1960. msh
  1961. })
  1962. end;
  1963. };
  1964. Head = {
  1965. Create = function(brickcolor, cframe, x1, y1, z1, x3, y3, z3, delay)
  1966. local prt = CFuncs.Part.Create(EffectModel, "Neon", 0, 0, brickcolor, "Effect", Vector3.new())
  1967. prt.Anchored = true
  1968. prt.CFrame = cframe
  1969. local msh = CFuncs.Mesh.Create("SpecialMesh", prt, "Head", "nil", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  1970. game:GetService("Debris"):AddItem(prt, 10)
  1971. table.insert(Effects, {
  1972. prt,
  1973. "Cylinder",
  1974. delay,
  1975. x3,
  1976. y3,
  1977. z3,
  1978. msh
  1979. })
  1980. end;
  1981. };
  1982.  
  1983. Sphere = {
  1984. Create = function(brickcolor, cframe, x1, y1, z1, x3, y3, z3, delay)
  1985. local prt = CFuncs.Part.Create(EffectModel, "SmoothPlastic", 0, 0, brickcolor, "Effect", Vector3.new())
  1986. prt.Anchored = true
  1987. prt.CFrame = cframe
  1988. local msh = CFuncs.Mesh.Create("SpecialMesh", prt, "Sphere", "", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  1989. game:GetService("Debris"):AddItem(prt, 10)
  1990. table.insert(Effects, {
  1991. prt,
  1992. "Cylinder",
  1993. delay,
  1994. x3,
  1995. y3,
  1996. z3,
  1997. msh
  1998. })
  1999. end;
  2000. };
  2001.  
  2002. Elect = {
  2003. Create = function(cff, x, y, z)
  2004. local prt = CFuncs.Part.Create(EffectModel, "Neon", 0, 0, BrickColor.new("Lime green"), "Part", Vector3.new(1, 1, 1))
  2005. prt.Anchored = true
  2006. prt.CFrame = cff * CFrame.new(math.random(-x, x), math.random(-y, y), math.random(-z, z))
  2007. prt.CFrame = CFrame.new(prt.Position)
  2008. game:GetService("Debris"):AddItem(prt, 2)
  2009. local xval = math.random() / 2
  2010. local yval = math.random() / 2
  2011. local zval = math.random() / 2
  2012. local msh = CFuncs.Mesh.Create("BlockMesh", prt, "", "", Vector3.new(0, 0, 0), Vector3.new(xval, yval, zval))
  2013. table.insert(Effects, {
  2014. prt,
  2015. "Elec",
  2016. 0.1,
  2017. x,
  2018. y,
  2019. z,
  2020. xval,
  2021. yval,
  2022. zval
  2023. })
  2024. end;
  2025.  
  2026. };
  2027.  
  2028. Ring = {
  2029. Create = function(brickcolor, cframe, x1, y1, z1, x3, y3, z3, delay)
  2030. local prt = CFuncs.Part.Create(EffectModel, "SmoothPlastic", 0, 0, brickcolor, "Effect", Vector3.new())
  2031. prt.Anchored = true
  2032. prt.CFrame = cframe
  2033. local msh = CFuncs.Mesh.Create("SpecialMesh", prt, "FileMesh", "rbxassetid://3270017", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  2034. game:GetService("Debris"):AddItem(prt, 10)
  2035. table.insert(Effects, {
  2036. prt,
  2037. "Cylinder",
  2038. delay,
  2039. x3,
  2040. y3,
  2041. z3,
  2042. msh
  2043. })
  2044. end;
  2045. };
  2046.  
  2047.  
  2048. Wave = {
  2049. Create = function(brickcolor, cframe, x1, y1, z1, x3, y3, z3, delay)
  2050. local prt = CFuncs.Part.Create(EffectModel, "SmoothPlastic", 0, 0, brickcolor, "Effect", Vector3.new())
  2051. prt.Anchored = true
  2052. prt.CFrame = cframe
  2053. local msh = CFuncs.Mesh.Create("SpecialMesh", prt, "FileMesh", "rbxassetid://20329976", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  2054. game:GetService("Debris"):AddItem(prt, 10)
  2055. table.insert(Effects, {
  2056. prt,
  2057. "Cylinder",
  2058. delay,
  2059. x3,
  2060. y3,
  2061. z3,
  2062. msh
  2063. })
  2064. end;
  2065. };
  2066.  
  2067. Break = {
  2068. Create = function(brickcolor, cframe, x1, y1, z1)
  2069. local prt = CFuncs.Part.Create(EffectModel, "SmoothPlastic", 0, 0, brickcolor, "Effect", Vector3.new(0.5, 0.5, 0.5))
  2070. prt.Anchored = true
  2071. prt.CFrame = cframe * CFrame.fromEulerAnglesXYZ(math.random(-50, 50), math.random(-50, 50), math.random(-50, 50))
  2072. local msh = CFuncs.Mesh.Create("SpecialMesh", prt, "Sphere", "", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  2073. local num = math.random(10, 50) / 1000
  2074. game:GetService("Debris"):AddItem(prt, 10)
  2075. table.insert(Effects, {
  2076. prt,
  2077. "Shatter",
  2078. num,
  2079. prt.CFrame,
  2080. math.random() - math.random(),
  2081. 0,
  2082. math.random(50, 100) / 100
  2083. })
  2084. end;
  2085. };
  2086.  
  2087. Fire = {
  2088. Create = function(brickcolor, cframe, x1, y1, z1, delay)
  2089. local prt = CFuncs.Part.Create(EffectModel, "Neon", 0, 0, brickcolor, "Effect", Vector3.new())
  2090. prt.Anchored = true
  2091. prt.CFrame = cframe
  2092. msh = CFuncs.Mesh.Create("BlockMesh", prt, "", "", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  2093. game:GetService("Debris"):AddItem(prt, 10)
  2094. table.insert(Effects, {
  2095. prt,
  2096. "Fire",
  2097. delay,
  2098. 1,
  2099. 1,
  2100. 1,
  2101. msh
  2102. })
  2103. end;
  2104. };
  2105.  
  2106. FireWave = {
  2107. Create = function(brickcolor, cframe, x1, y1, z1)
  2108. local prt = CFuncs.Part.Create(EffectModel, "Neon", 0, 1, brickcolor, "Effect", Vector3.new())
  2109. prt.Anchored = true
  2110. prt.CFrame = cframe
  2111. msh = CFuncs.Mesh.Create("BlockMesh", prt, "", "", Vector3.new(0, 0, 0), Vector3.new(x1, y1, z1))
  2112. local d = Create("Decal"){
  2113. Parent = prt,
  2114. Texture = "rbxassetid://26356434",
  2115. Face = "Top",
  2116. }
  2117. local d = Create("Decal"){
  2118. Parent = prt,
  2119. Texture = "rbxassetid://26356434",
  2120. Face = "Bottom",
  2121. }
  2122. game:GetService("Debris"):AddItem(prt, 10)
  2123. table.insert(Effects, {
  2124. prt,
  2125. "FireWave",
  2126. 1,
  2127. 30,
  2128. math.random(400, 600) / 100,
  2129. msh
  2130. })
  2131. end;
  2132. };
  2133.  
  2134. Lightning = {
  2135. Create = function(p0, p1, tym, ofs, col, th, tra, last)
  2136. local magz = (p0 - p1).magnitude
  2137. local curpos = p0
  2138. local trz = {
  2139. -ofs,
  2140. ofs
  2141. }
  2142. for i = 1, tym do
  2143. local li = CFuncs.Part.Create(EffectModel, "Neon", 0, tra or 0.4, col, "Ref", Vector3.new(th, th, magz / tym))
  2144. local ofz = Vector3.new(trz[math.random(1, 2)], trz[math.random(1, 2)], trz[math.random(1, 2)])
  2145. local trolpos = CFrame.new(curpos, p1) * CFrame.new(0, 0, magz / tym).p + ofz
  2146. li.Material = "Neon"
  2147. if tym == i then
  2148. local magz2 = (curpos - p1).magnitude
  2149. li.Size = Vector3.new(th, th, magz2)
  2150. li.CFrame = CFrame.new(curpos, p1) * CFrame.new(0, 0, -magz2 / 2)
  2151. table.insert(Effects, {
  2152. li,
  2153. "Disappear",
  2154. last
  2155. })
  2156. else
  2157. do
  2158. do
  2159. li.CFrame = CFrame.new(curpos, trolpos) * CFrame.new(0, 0, magz / tym / 2)
  2160. curpos = li.CFrame * CFrame.new(0, 0, magz / tym / 2).p
  2161. game.Debris:AddItem(li, 10)
  2162. table.insert(Effects, {
  2163. li,
  2164. "Disappear",
  2165. last
  2166. })
  2167. end
  2168. end
  2169. end
  2170. end
  2171. end
  2172. };
  2173.  
  2174. EffectTemplate = {
  2175.  
  2176. };
  2177. }
  2178.  
  2179. function chatfunc(text)
  2180. local chat = coroutine.wrap(function()
  2181. if Character:FindFirstChild("TalkingBillBoard")~= nil then
  2182. Character:FindFirstChild("TalkingBillBoard"):destroy()
  2183. end
  2184. local naeeym2 = Instance.new("BillboardGui",Character)
  2185. naeeym2.Size = UDim2.new(0,100,0,40)
  2186. naeeym2.StudsOffset = Vector3.new(0,3.5,0)
  2187. naeeym2.Adornee = RootPart
  2188. naeeym2.Name = "TalkingBillBoard"
  2189. local tecks2 = Instance.new("TextLabel",naeeym2)
  2190. tecks2.BackgroundTransparency = 1
  2191. tecks2.BorderSizePixel = 0
  2192. tecks2.Text = ""
  2193. tecks2.Font = "Fantasy"
  2194. tecks2.TextSize = 30
  2195. tecks2.TextStrokeTransparency = 0
  2196. tecks2.TextColor3 = Color3.new(.6,0,0)
  2197. tecks2.TextStrokeColor3 = Color3.new(0,0,0)
  2198. tecks2.Size = UDim2.new(1,0,0.5,0)
  2199. local tecks3 = Instance.new("TextLabel",naeeym2)
  2200. tecks3.BackgroundTransparency = 1
  2201. tecks3.BorderSizePixel = 0
  2202. tecks3.Text = ""
  2203. tecks3.Font = "Fantasy"
  2204. tecks3.TextSize = 30
  2205. tecks3.TextStrokeTransparency = 0
  2206. tecks3.TextColor3 = Color3.new(.6,0,0)
  2207. tecks3.TextStrokeColor3 = Color3.new(0,0,0)
  2208. tecks3.Size = UDim2.new(1,0,0.5,0)
  2209. for i = 1,string.len(text),1 do
  2210. --CFuncs["Sound"].Create("http://www.roblox.com/asset/?id=160718677", Character, .6, .8)
  2211. tecks2.Text = string.sub(text,1,i)
  2212. tecks3.Text = string.sub(text,1,i)
  2213. wait(0.01)
  2214. end
  2215. wait(2)
  2216. for i = 1, 50 do
  2217. swait()
  2218. tecks2.Position = tecks2.Position - UDim2.new(math.random(-.4,.4),math.random(-5,5),.05,math.random(-5,5))
  2219. tecks2.Rotation = tecks2.Rotation - .8
  2220. tecks2.TextStrokeTransparency = tecks2.TextStrokeTransparency +.04
  2221. tecks2.TextTransparency = tecks2.TextTransparency + .04
  2222. tecks3.Position = tecks2.Position - UDim2.new(math.random(-.4,.4),math.random(-5,5),.05,math.random(-5,5))
  2223. tecks3.Rotation = tecks2.Rotation + .8
  2224. tecks3.TextStrokeTransparency = tecks2.TextStrokeTransparency +.04
  2225. tecks3.TextTransparency = tecks2.TextTransparency + .04
  2226. end
  2227. naeeym2:Destroy()
  2228. end)
  2229. chat()
  2230. end
  2231. function onChatted(msg)
  2232. chatfunc(msg)
  2233. end
  2234. Player.Chatted:connect(function(msg)
  2235. if msg=="Words:jp"then Words="Japanese"end
  2236. if msg=="Words:en"then Words="English"end
  2237. end)
  2238.  
  2239. abss = Instance.new("BillboardGui",Character)
  2240. abss.Size = UDim2.new(10,0,10,0)
  2241. abss.Enabled = false
  2242. imgl = Instance.new("ImageLabel",abss)
  2243. imgl.Position = UDim2.new(0,0,0,0)
  2244. imgl.Size = UDim2.new(1,0,1,0)
  2245. imgl.Image = "rbxassetid://711463989"
  2246. imgl.BackgroundTransparency = 1
  2247. imgl.ImageColor3 = Color3.new(.9,0,0)
  2248. img2 = Instance.new("ImageLabel",abss)
  2249. img2.Position = UDim2.new(0,0,0,0)
  2250. img2.Size = UDim2.new(1,0,1,0)
  2251. img2.Image = "rbxassetid://711463989"
  2252. img2.BackgroundTransparency = 1
  2253. img2.ImageColor3 = Color3.new(.9,0,0)
  2254.  
  2255.  
  2256. function attackone(target)
  2257. attack = true
  2258. Humanoid.WalkSpeed = 0
  2259. if target then
  2260. if targetted.Name ~= "CKbackup" then
  2261. local partasdeff = Instance.new("ParticleEmitter",targetted.HumanoidRootPart)
  2262. partasdeff.Color = ColorSequence.new(Color3.new(1, 0, 0), Color3.new(.5, 0, 0))
  2263. partasdeff.LightEmission = .1
  2264. partasdeff.Size = NumberSequence.new(0.2)
  2265. partasdeff.Texture = "http://www.roblox.com/asset/?ID=771221224"
  2266. aaa = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.2),NumberSequenceKeypoint.new(1, 5)})
  2267. bbb = NumberSequence.new({NumberSequenceKeypoint.new(0, 1),NumberSequenceKeypoint.new(0.0636, 0), NumberSequenceKeypoint.new(1, 1)})
  2268. partasdeff.Transparency = bbb
  2269. partasdeff.Size = aaa
  2270. partasdeff.ZOffset = .9
  2271. partasdeff.Acceleration = Vector3.new(0, -5, 0)
  2272. partasdeff.LockedToPart = false
  2273. partasdeff.EmissionDirection = "Back"
  2274. partasdeff.Lifetime = NumberRange.new(1, 2)
  2275. partasdeff.Rate = 1000
  2276. partasdeff.Rotation = NumberRange.new(-100, 100)
  2277. partasdeff.RotSpeed = NumberRange.new(-100, 100)
  2278. partasdeff.Speed = NumberRange.new(6)
  2279. partasdeff.VelocitySpread = 10000
  2280. partasdeff.Enabled=false
  2281. for i = 0, 3, 0.4 do
  2282. swait()
  2283. PlayAnimationFromTable({
  2284. CFrame.new(0.0150662307, -4.88092428e-06, 0.0148906102, -0.01982099, -1.08002496e-12, 0.999803543, -4.46946984e-07, 1, -8.86181084e-09, -0.999803782, 3.27825546e-07, -0.0198209975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2285. CFrame.new(-0.00189219415, 1.50098944, -0.129972562, 0.0201512501, 0.0765038878, -0.996864021, 0.0566192083, 0.995383799, 0.0775336027, 0.998202145, -0.0580037907, 0.0157258138) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2286. CFrame.new(2.01696348, 0.389823437, -0.060955409, -0.000397110358, -0.999624014, -0.0274192169, 0.00981300231, 0.0274140034, -0.999576092, 0.999951839, -0.0006660074, 0.00979842618) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2287. CFrame.new(-1.64040112, 0.216884568, 1.93210121e-06, 0.962137103, 0.272578239, -7.02217221e-07, -0.272574633, 0.962141275, -9.83368591e-06, -2.00979412e-06, 9.69739631e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2288. CFrame.new(0.64369607, -1.98395038, 0.206737444, 0.19058302, -0.152998164, -0.969677031, 0.0664296299, 0.987527609, -0.142758414, 0.979424179, -0.0372077115, 0.198368743) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2289. CFrame.new(-0.641120076, -1.92643452, -0.0258421432, 0.848103583, 0.133398816, -0.51276207, -0.0662644878, 0.986892581, 0.147146463, 0.52567035, -0.0908175632, 0.845826566) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2290. }, .1, false)
  2291. moter.C0 = clerp(moter.C0, CFrame.new(0.011209704, -1.63770795, -0.318749219, -0.0172089972, -4.19956632e-06, -0.999852002, 0.999852061, 8.99471343e-06, -0.0172089972, 9.06549394e-06, -1.00000012, 4.04558159e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2292. end
  2293. Effects.Block.Create(BrickColor.new("Bright red"), Partss.CFrame, 2, 2, 2, 0.9, 0.9, 0.9, 0.05)
  2294. Effects.Block.Create(BrickColor.new("Deep orange"), Partss.CFrame, 2, 2, 2, 0.5, 0.5, 0.5, 0.05)
  2295. CFuncs["Sound"].Create("rbxassetid://642890855", Character, 1, .5)
  2296. if targetted:FindFirstChild("Head")then Lightning(Partss.CFrame.p,targetted.Head.CFrame.p,10,.3,BrickColor.new("Crimson"),.1,0,-.1)Lightning(Partss.CFrame.p,targetted.Head.CFrame.p,10,.3,BrickColor.new("Really black"),.1,0,-.1)end
  2297. dmg(targetted)
  2298. partasdeff.Enabled=true
  2299. for i = 0, 6, 1 do
  2300. swait()
  2301. PlayAnimationFromTable({
  2302. CFrame.new(0.0150662307, -4.88092428e-06, 0.0148906102, -0.01982099, -1.08002496e-12, 0.999803543, -4.46946984e-07, 1, -8.86181084e-09, -0.999803782, 3.27825546e-07, -0.0198209975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2303. CFrame.new(-0.0879677385, 1.49240708, -0.127746791, 0.0201510563, -0.100440688, -0.994740784, 0.0566197298, 0.99346137, -0.0991647467, 0.998197258, -0.0543235913, 0.0257058665) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2304. CFrame.new(2.03539443, 0.729742587, 0.0108130341, -0.00389442407, -0.967803538, 0.251676887, 0.0148300035, -0.251707017, -0.967689872, 0.999882519, -3.62247229e-05, 0.0153327845) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2305. CFrame.new(-1.64040112, 0.216884568, 1.93210121e-06, 0.962137103, 0.272578239, -7.02217221e-07, -0.272574633, 0.962141275, -9.83368591e-06, -2.00979412e-06, 9.69739631e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2306. CFrame.new(0.64369607, -1.98395038, 0.206737444, 0.19058302, -0.152998164, -0.969677031, 0.0664296299, 0.987527609, -0.142758414, 0.979424179, -0.0372077115, 0.198368743) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2307. CFrame.new(-0.641120076, -1.92643452, -0.0258421432, 0.848103583, 0.133398816, -0.51276207, -0.0662644878, 0.986892581, 0.147146463, 0.52567035, -0.0908175632, 0.845826566) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2308. }, .3, false)
  2309. moter.C0 = clerp(moter.C0, CFrame.new(0.0112083517, -1.63770616, -0.318746239, -0.0172079317, -2.87033617e-06, -0.999851942, 0.999852002, 8.28504562e-06, -0.0172079336, 8.27014446e-06, -1.00000012, 2.72750913e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2310. end
  2311. partasdeff.Enabled=false
  2312. for i = 1, 3, 1 do
  2313. swait()
  2314. PlayAnimationFromTable({
  2315. CFrame.new(0.0150662307, -4.88092428e-06, 0.0148906102, -0.01982099, -1.08002496e-12, 0.999803543, -4.46946984e-07, 1, -8.86181084e-09, -0.999803782, 3.27825546e-07, -0.0198209975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2316. CFrame.new(-0.00189219415, 1.50098944, -0.129972562, 0.0201512501, 0.0765038878, -0.996864021, 0.0566192083, 0.995383799, 0.0775336027, 0.998202145, -0.0580037907, 0.0157258138) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2317. CFrame.new(2.01696348, 0.389823437, -0.060955409, -0.000397110358, -0.999624014, -0.0274192169, 0.00981300231, 0.0274140034, -0.999576092, 0.999951839, -0.0006660074, 0.00979842618) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2318. CFrame.new(-1.64040112, 0.216884568, 1.93210121e-06, 0.962137103, 0.272578239, -7.02217221e-07, -0.272574633, 0.962141275, -9.83368591e-06, -2.00979412e-06, 9.69739631e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2319. CFrame.new(0.64369607, -1.98395038, 0.206737444, 0.19058302, -0.152998164, -0.969677031, 0.0664296299, 0.987527609, -0.142758414, 0.979424179, -0.0372077115, 0.198368743) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2320. CFrame.new(-0.641120076, -1.92643452, -0.0258421432, 0.848103583, 0.133398816, -0.51276207, -0.0662644878, 0.986892581, 0.147146463, 0.52567035, -0.0908175632, 0.845826566) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2321. }, .3, false)
  2322. moter.C0 = clerp(moter.C0, CFrame.new(0.011209704, -1.63770795, -0.318749219, -0.0172089972, -4.19956632e-06, -0.999852002, 0.999852061, 8.99471343e-06, -0.0172089972, 9.06549394e-06, -1.00000012, 4.04558159e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2323. end
  2324. coroutine.wrap(function()
  2325. wait(2)
  2326. partasdeff:Remove()
  2327. end)()
  2328. else
  2329. sel = math.random(1,3)
  2330. if Words=="English"then
  2331. if sel == 1 then
  2332. chatfunc("I Cannot Kill Sugarie.")
  2333. elseif sel == 2 then
  2334. chatfunc("Sugarie is good.")
  2335. elseif sel == 3 then
  2336. chatfunc("I Cannot kill him...")
  2337. end
  2338. else
  2339. if sel == 1 then
  2340. chatfunc("...")
  2341. elseif sel == 2 then
  2342. chatfunc("???∑∑∑")
  2343. elseif sel == 3 then
  2344. chatfunc("??????????∑∑∑")
  2345. end
  2346. end
  2347. for i = 0, 5, 0.1 do
  2348. swait()
  2349. PlayAnimationFromTable({
  2350. CFrame.new(0, 0, 0, 0.999999881, 5.04870979e-29, -4.21790838e-43, 5.04870979e-29, 1, -5.04870979e-29, -4.21790838e-43, -5.04870979e-29, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2351. CFrame.new(-0.055980958, 1.49253583, -0.318915963, 0.999889553, 0.0107171191, -0.0102898544, -0.00218299939, 0.791040659, 0.611759722, 0.0146959936, -0.61166966, 0.790976703) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0- .4 * math.cos((sine) / 5), 0),
  2352. CFrame.new(1.54004693, 0.0494250022, 1.90734852e-06, 0.997847795, -0.0655719861, 0, 0.0655719936, 0.997847855, 7.53468894e-22, -4.94064563e-23, -7.51847299e-22, 0.99999994) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2353. CFrame.new(-1.51232088, 0.0410207808, -3.73942044e-06, 0.998558879, 0.053665854, -2.33806347e-07, -0.0536658242, 0.998558939, -1.04548817e-05, -3.27600219e-07, 1.04523697e-05, 0.99999994) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2354. CFrame.new(0.540300906, -1.99793804, -2.11055158e-06, 0.998698354, -0.0510031469, 6.26438805e-07, 0.0510031544, 0.998698473, -1.04335422e-05, -9.34800966e-08, 1.04519122e-05, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2355. CFrame.new(-0.539562821, -1.99794102, -5.75710146e-09, 0.998630941, 0.0523070693, -1.67712614e-07, -0.0523070768, 0.99863106, -1.0458818e-05, -3.79587107e-07, 1.04532719e-05, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2356. }, .3, false)
  2357. moter.C0 = clerp(moter.C0, CFrame.new(0.0111967381, -1.6377008, -0.318754196, -0.0172117949, 0, -0.999851942, 0.999851942, 0, -0.0172117949, 0, -1, 0) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2358. end
  2359. end
  2360. else
  2361. for i = 0, 3, 0.3 do
  2362. swait()
  2363. PlayAnimationFromTable({
  2364. CFrame.new(0.0150662307, -4.88092428e-06, 0.0148906102, -0.01982099, -1.08002496e-12, 0.999803543, -4.46946984e-07, 1, -8.86181084e-09, -0.999803782, 3.27825546e-07, -0.0198209975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2365. CFrame.new(-0.00189219415, 1.50098944, -0.129972562, 0.0201512501, 0.0765038878, -0.996864021, 0.0566192083, 0.995383799, 0.0775336027, 0.998202145, -0.0580037907, 0.0157258138) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2366. CFrame.new(2.01696348, 0.389823437, -0.060955409, -0.000397110358, -0.999624014, -0.0274192169, 0.00981300231, 0.0274140034, -0.999576092, 0.999951839, -0.0006660074, 0.00979842618) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2367. CFrame.new(-1.64040112, 0.216884568, 1.93210121e-06, 0.962137103, 0.272578239, -7.02217221e-07, -0.272574633, 0.962141275, -9.83368591e-06, -2.00979412e-06, 9.69739631e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2368. CFrame.new(0.64369607, -1.98395038, 0.206737444, 0.19058302, -0.152998164, -0.969677031, 0.0664296299, 0.987527609, -0.142758414, 0.979424179, -0.0372077115, 0.198368743) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2369. CFrame.new(-0.641120076, -1.92643452, -0.0258421432, 0.848103583, 0.133398816, -0.51276207, -0.0662644878, 0.986892581, 0.147146463, 0.52567035, -0.0908175632, 0.845826566) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2370. }, .2, false)
  2371. moter.C0 = clerp(moter.C0, CFrame.new(0.011209704, -1.63770795, -0.318749219, -0.0172089972, -4.19956632e-06, -0.999852002, 0.999852061, 8.99471343e-06, -0.0172089972, 9.06549394e-06, -1.00000012, 4.04558159e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2372. end
  2373. Effects.Block.Create(BrickColor.new("Bright red"), Partss.CFrame, 2, 2, 2, 0.9, 0.9, 0.9, 0.05)
  2374. Effects.Block.Create(BrickColor.new("Deep orange"), Partss.CFrame, 2, 2, 2, 0.5, 0.5, 0.5, 0.05)
  2375. CFuncs["Sound"].Create("rbxassetid://642890855", Character, 1, .5)
  2376. local TP=Instance.new("Part")TP.CFrame=Mouse.Hit
  2377. Lightning(Partss.CFrame.p,TP.CFrame.p,10,.3,BrickColor.new("Crimson"),.3,0,-.3)Lightning(Partss.CFrame.p,TP.CFrame.p,10,.3,BrickColor.new("Really black"),.5,0,-.5)
  2378. mdmg(TP, 5 ,10)
  2379. for i=0,3 do RingE(TP.CFrame*CFrame.Angles(math.rad(math.random(360)),math.rad(math.random(360)),math.rad(math.random(360))),.1+math.random(40)/100,30+math.random(70),0,30,3,0,ColorSequence.new(Color3.fromRGB(1,1,0)),-.05)end
  2380. Effects.Block.Create(BrickColor.new("Bright red"), TP.CFrame, 2, 2, 2, 0.9, 0.9, 0.9, 0.05)
  2381. Effects.Block.Create(BrickColor.new("Deep orange"), TP.CFrame, 2, 2, 2, 0.5, 0.5, 0.5, 0.05)
  2382. for i = 0, 1, 0.3333 do
  2383. swait()
  2384. PlayAnimationFromTable({
  2385. CFrame.new(0.0150662307, -4.88092428e-06, 0.0148906102, -0.01982099, -1.08002496e-12, 0.999803543, -4.46946984e-07, 1, -8.86181084e-09, -0.999803782, 3.27825546e-07, -0.0198209975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2386. CFrame.new(-0.0879677385, 1.49240708, -0.127746791, 0.0201510563, -0.100440688, -0.994740784, 0.0566197298, 0.99346137, -0.0991647467, 0.998197258, -0.0543235913, 0.0257058665) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2387. CFrame.new(2.03539443, 0.729742587, 0.0108130341, -0.00389442407, -0.967803538, 0.251676887, 0.0148300035, -0.251707017, -0.967689872, 0.999882519, -3.62247229e-05, 0.0153327845) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2388. CFrame.new(-1.64040112, 0.216884568, 1.93210121e-06, 0.962137103, 0.272578239, -7.02217221e-07, -0.272574633, 0.962141275, -9.83368591e-06, -2.00979412e-06, 9.69739631e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2389. CFrame.new(0.64369607, -1.98395038, 0.206737444, 0.19058302, -0.152998164, -0.969677031, 0.0664296299, 0.987527609, -0.142758414, 0.979424179, -0.0372077115, 0.198368743) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2390. CFrame.new(-0.641120076, -1.92643452, -0.0258421432, 0.848103583, 0.133398816, -0.51276207, -0.0662644878, 0.986892581, 0.147146463, 0.52567035, -0.0908175632, 0.845826566) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2391. }, .5, false)
  2392. moter.C0 = clerp(moter.C0, CFrame.new(0.0112083517, -1.63770616, -0.318746239, -0.0172079317, -2.87033617e-06, -0.999851942, 0.999852002, 8.28504562e-06, -0.0172079336, 8.27014446e-06, -1.00000012, 2.72750913e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2393. end
  2394. for i = 0, 2, 0.3 do
  2395. swait()
  2396. PlayAnimationFromTable({
  2397. CFrame.new(0.0150662307, -4.88092428e-06, 0.0148906102, -0.01982099, -1.08002496e-12, 0.999803543, -4.46946984e-07, 1, -8.86181084e-09, -0.999803782, 3.27825546e-07, -0.0198209975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2398. CFrame.new(-0.00189219415, 1.50098944, -0.129972562, 0.0201512501, 0.0765038878, -0.996864021, 0.0566192083, 0.995383799, 0.0775336027, 0.998202145, -0.0580037907, 0.0157258138) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2399. CFrame.new(2.01696348, 0.389823437, -0.060955409, -0.000397110358, -0.999624014, -0.0274192169, 0.00981300231, 0.0274140034, -0.999576092, 0.999951839, -0.0006660074, 0.00979842618) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2400. CFrame.new(-1.64040112, 0.216884568, 1.93210121e-06, 0.962137103, 0.272578239, -7.02217221e-07, -0.272574633, 0.962141275, -9.83368591e-06, -2.00979412e-06, 9.69739631e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2401. CFrame.new(0.64369607, -1.98395038, 0.206737444, 0.19058302, -0.152998164, -0.969677031, 0.0664296299, 0.987527609, -0.142758414, 0.979424179, -0.0372077115, 0.198368743) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2402. CFrame.new(-0.641120076, -1.92643452, -0.0258421432, 0.848103583, 0.133398816, -0.51276207, -0.0662644878, 0.986892581, 0.147146463, 0.52567035, -0.0908175632, 0.845826566) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2403. }, .3, false)
  2404. moter.C0 = clerp(moter.C0, CFrame.new(0.011209704, -1.63770795, -0.318749219, -0.0172089972, -4.19956632e-06, -0.999852002, 0.999852061, 8.99471343e-06, -0.0172089972, 9.06549394e-06, -1.00000012, 4.04558159e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2405. end
  2406. end
  2407. Humanoid.WalkSpeed = 35
  2408. attack = false
  2409. end
  2410.  
  2411. function attacktwo()
  2412. attack = true
  2413. Humanoid.WalkSpeed = 0
  2414. for i = 0, 3, 0.8 do
  2415. swait()
  2416. PlayAnimationFromTable({
  2417. CFrame.new(0.0150662307, -4.88092428e-06, 0.0148906102, -0.01982099, -1.08002496e-12, 0.999803543, -4.46946984e-07, 1, -8.86181084e-09, -0.999803782, 3.27825546e-07, -0.0198209975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2418. CFrame.new(-0.00189219415, 1.50098944, -0.129972562, 0.0201512501, 0.0765038878, -0.996864021, 0.0566192083, 0.995383799, 0.0775336027, 0.998202145, -0.0580037907, 0.0157258138) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2419. CFrame.new(2.01696348, 0.389823437, -0.060955409, -0.000397110358, -0.999624014, -0.0274192169, 0.00981300231, 0.0274140034, -0.999576092, 0.999951839, -0.0006660074, 0.00979842618) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2420. CFrame.new(-1.64040112, 0.216884568, 1.93210121e-06, 0.962137103, 0.272578239, -7.02217221e-07, -0.272574633, 0.962141275, -9.83368591e-06, -2.00979412e-06, 9.69739631e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2421. CFrame.new(0.64369607, -1.98395038, 0.206737444, 0.19058302, -0.152998164, -0.969677031, 0.0664296299, 0.987527609, -0.142758414, 0.979424179, -0.0372077115, 0.198368743) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2422. CFrame.new(-0.641120076, -1.92643452, -0.0258421432, 0.848103583, 0.133398816, -0.51276207, -0.0662644878, 0.986892581, 0.147146463, 0.52567035, -0.0908175632, 0.845826566) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2423. }, .2, false)
  2424. moter.C0 = clerp(moter.C0, CFrame.new(0.011209704, -1.63770795, -0.318749219, -0.0172089972, -4.19956632e-06, -0.999852002, 0.999852061, 8.99471343e-06, -0.0172089972, 9.06549394e-06, -1.00000012, 4.04558159e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2425. end
  2426. for i=1, 122 do
  2427. Effects.Block.Create(BrickColor.new("Bright red"), Partss.CFrame, 2, 2, 2, 0.9, 0.9, 0.9, 0.05)
  2428. Effects.Block.Create(BrickColor.new("Deep orange"), Partss.CFrame, 2, 2, 2, 0.5, 0.5, 0.5, 0.05)
  2429. CFuncs["Sound"].Create("rbxassetid://642890855", Character, 1, .5)
  2430. local TP=Instance.new("Part")TP.CFrame=Mouse.Hit
  2431. Lightning(Partss.CFrame.p,TP.CFrame.p,10,.3,BrickColor.new("Crimson"),.3,0,-.3)Lightning(Partss.CFrame.p,TP.CFrame.p,10,.3,BrickColor.new("Really black"),.5,0,-.5)
  2432. mdmg(TP, 5 ,10)
  2433. for i=0,3 do RingE(TP.CFrame*CFrame.Angles(math.rad(math.random(360)),math.rad(math.random(360)),math.rad(math.random(360))),.1+math.random(40)/100,30+math.random(70),0,30,3,0,ColorSequence.new(Color3.fromRGB(1,1,0)),-.05)end
  2434. Effects.Block.Create(BrickColor.new("Bright red"), TP.CFrame, 2, 2, 2, 0.9, 0.9, 0.9, 0.05)
  2435. Effects.Block.Create(BrickColor.new("Deep orange"), TP.CFrame, 2, 2, 2, 0.5, 0.5, 0.5, 0.05)
  2436. for i = 0, 1, 2.4 do
  2437. swait()
  2438. PlayAnimationFromTable({
  2439. CFrame.new(0.0150662307, -4.88092428e-06, 0.0148906102, -0.01982099, -1.08002496e-12, 0.999803543, -4.46946984e-07, 1, -8.86181084e-09, -0.999803782, 3.27825546e-07, -0.0198209975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2440. CFrame.new(-0.0879677385, 1.49240708, -0.127746791, 0.0201510563, -0.100440688, -0.994740784, 0.0566197298, 0.99346137, -0.0991647467, 0.998197258, -0.0543235913, 0.0257058665) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2441. CFrame.new(2.03539443, 0.729742587, 0.0108130341, -0.00389442407, -0.967803538, 0.251676887, 0.0148300035, -0.251707017, -0.967689872, 0.999882519, -3.62247229e-05, 0.0153327845) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2442. CFrame.new(-1.64040112, 0.216884568, 1.93210121e-06, 0.962137103, 0.272578239, -7.02217221e-07, -0.272574633, 0.962141275, -9.83368591e-06, -2.00979412e-06, 9.69739631e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2443. CFrame.new(0.64369607, -1.98395038, 0.206737444, 0.19058302, -0.152998164, -0.969677031, 0.0664296299, 0.987527609, -0.142758414, 0.979424179, -0.0372077115, 0.198368743) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2444. CFrame.new(-0.641120076, -1.92643452, -0.0258421432, 0.848103583, 0.133398816, -0.51276207, -0.0662644878, 0.986892581, 0.147146463, 0.52567035, -0.0908175632, 0.845826566) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2445. }, .5, false)
  2446. moter.C0 = clerp(moter.C0, CFrame.new(0.0112083517, -1.63770616, -0.318746239, -0.0172079317, -2.87033617e-06, -0.999851942, 0.999852002, 8.28504562e-06, -0.0172079336, 8.27014446e-06, -1.00000012, 2.72750913e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2447. end
  2448. for i = 0, 2, 1.7 do
  2449. swait()
  2450. PlayAnimationFromTable({
  2451. CFrame.new(0.0150662307, -4.88092428e-06, 0.0148906102, -0.01982099, -1.08002496e-12, 0.999803543, -4.46946984e-07, 1, -8.86181084e-09, -0.999803782, 3.27825546e-07, -0.0198209975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2452. CFrame.new(-0.00189219415, 1.50098944, -0.129972562, 0.0201512501, 0.0765038878, -0.996864021, 0.0566192083, 0.995383799, 0.0775336027, 0.998202145, -0.0580037907, 0.0157258138) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2453. CFrame.new(2.01696348, 0.389823437, -0.060955409, -0.000397110358, -0.999624014, -0.0274192169, 0.00981300231, 0.0274140034, -0.999576092, 0.999951839, -0.0006660074, 0.00979842618) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2454. CFrame.new(-1.64040112, 0.216884568, 1.93210121e-06, 0.962137103, 0.272578239, -7.02217221e-07, -0.272574633, 0.962141275, -9.83368591e-06, -2.00979412e-06, 9.69739631e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2455. CFrame.new(0.64369607, -1.98395038, 0.206737444, 0.19058302, -0.152998164, -0.969677031, 0.0664296299, 0.987527609, -0.142758414, 0.979424179, -0.0372077115, 0.198368743) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2456. CFrame.new(-0.641120076, -1.92643452, -0.0258421432, 0.848103583, 0.133398816, -0.51276207, -0.0662644878, 0.986892581, 0.147146463, 0.52567035, -0.0908175632, 0.845826566) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2457. }, .5, false)
  2458. moter.C0 = clerp(moter.C0, CFrame.new(0.011209704, -1.63770795, -0.318749219, -0.0172089972, -4.19956632e-06, -0.999852002, 0.999852061, 8.99471343e-06, -0.0172089972, 9.06549394e-06, -1.00000012, 4.04558159e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2459. end
  2460. end
  2461. Humanoid.WalkSpeed = 35
  2462. attack = false
  2463. end
  2464.  
  2465. local Grabbed = false
  2466.  
  2467. function hedshoot()
  2468. attack = true
  2469. local grab = nil
  2470. for i, v in pairs(FindNearestTorso(Torso.CFrame.p, 10)) do
  2471. if v:FindFirstChild('HumanoidRootPart')and v:FindFirstChild("Head")then
  2472. Grabbed = true
  2473. --CFuncs["Sound"].Create("rbxassetid://492961938", v.HumanoidRootPart, 1, .8)
  2474. grab = v
  2475. end
  2476. end
  2477. Effects.Wave.Create(BrickColor.new("White"), RootPart.CFrame * CFrame.Angles(0,math.rad(90),math.rad(90)), .5, .5, .5, 1, .2, 1, 0.07)
  2478. --CFuncs["Sound"].Create("http://www.roblox.com/asset/?id=721590903", RootPart, 1.5, .5)
  2479. for i = 0, 1, 0.1 do
  2480. swait()
  2481. if Grabbed == true then
  2482. grab:FindFirstChildOfClass("Humanoid").PlatformStand = true
  2483. --GGyro.position = Partss.Position
  2484. --GGyro.Parent = grab.Head
  2485. grab.HumanoidRootPart.CFrame = Partss.CFrame * CFrame.Angles(0,math.rad(-90),0)
  2486. end
  2487. PlayAnimationFromTable({
  2488. CFrame.new(0.104281992, -1.37529127e-22, -0.179345995, 0.249840975, 5.92156003e-22, 0.968286872, -5.57068883e-22, 1, -4.67813147e-22, -0.968286872, -4.22523594e-22, 0.249840975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2489. CFrame.new(0.0029296279, 1.47845411, -0.120581962, 0.0750327855, 0.428286105, -0.900522709, 0.166523039, 0.885005891, 0.434781253, 0.983178616, -0.18258062, -0.00491504371) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2490. CFrame.new(1.96751118, 0.433084905, -0.278422326, 0.305184275, -0.951701581, -0.033564698, 0.012345003, 0.0391969904, -0.999155343, 0.952213347, 0.304512084, 0.0237110667) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2491. CFrame.new(-1.66092706, 0.266950369, 2.51774691e-06, 0.876968205, 0.480548859, -2.5331974e-06, -0.480548888, 0.876968026, -7.03267551e-06, -1.13248825e-06, 7.38352537e-06, 1.00000048) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2492. CFrame.new(0.146832585, -1.7542398, 0.105335698, 0.266426086, 0.491796821, -0.828946948, 0.0135936746, 0.8580302, 0.513420045, 0.96375972, -0.148056909, 0.221916124) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2493. CFrame.new(-1.09110987, -1.74702656, 0.342675447, 0.765578806, 0.632523358, 0.117487431, -0.642276406, 0.740949869, 0.196148768, 0.0370163769, -0.225626737, 0.973510265) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2494. }, .3, false)
  2495. RootPart.Velocity = RootPart.CFrame.lookVector * 90
  2496.  
  2497. moter.C0 = clerp(moter.C0, CFrame.new(0.0111932121, -1.63769805, -0.318755955, -0.0172044784, -1.3951445e-05, -0.999852121, 0.999852002, 3.55020165e-06, -0.0172044784, 3.78862023e-06, -1.00000012, 1.38879986e-05) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2498. end
  2499. if Grabbed == true then
  2500. Humanoid.WalkSpeed = 0
  2501. for i = 0, 2, 0.1 do
  2502. swait()
  2503. if Grabbed == true then
  2504. grab:FindFirstChildOfClass("Humanoid").PlatformStand = true
  2505. --GGyro.position = Partss.Position
  2506. --GGyro.Parent = grab.Head
  2507. grab.HumanoidRootPart.CFrame = Partss.CFrame * CFrame.Angles(0,math.rad(-90),0)
  2508. end
  2509. PlayAnimationFromTable({
  2510. CFrame.new(0.104281992, -1.37529127e-22, -0.179345995, 0.249840975, 5.92156003e-22, 0.968286872, -5.57068883e-22, 1, -4.67813147e-22, -0.968286872, -4.22523594e-22, 0.249840975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2511. CFrame.new(0.0029296279, 1.47845411, -0.120581962, 0.0750327855, 0.428286105, -0.900522709, 0.166523039, 0.885005891, 0.434781253, 0.983178616, -0.18258062, -0.00491504371) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2512. CFrame.new(1.96751118, 0.433084905, -0.278422326, 0.305184275, -0.951701581, -0.033564698, 0.012345003, 0.0391969904, -0.999155343, 0.952213347, 0.304512084, 0.0237110667) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2513. CFrame.new(-1.58139038, 0.176945746, 5.27966768e-06, 0.939729631, 0.341920435, -3.69548798e-06, -0.341920793, 0.93972975, -6.50105221e-06, -5.81145287e-07, 6.40749931e-06, 1.00000048) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2514. CFrame.new(0.569345832, -1.89868093, -0.00942828506, 0.266425997, -0.0769406706, -0.960779786, 0.0135936281, 0.997010291, -0.0760724545, 0.963760078, 0.00720720552, 0.266675085) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2515. CFrame.new(-0.849354744, -2.01616573, 0.241646215, 0.948664129, 0.308412433, 0.0701368451, -0.312046438, 0.948832989, 0.0484089628, -0.0516182035, -0.0678096861, 0.996362925) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2516. }, .3, false)
  2517. moter.C0 = clerp(moter.C0, CFrame.new(0.0111932121, -1.63769805, -0.318755955, -0.0172044784, -1.3951445e-05, -0.999852121, 0.999852002, 3.55020165e-06, -0.0172044784, 3.78862023e-06, -1.00000012, 1.38879986e-05) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2518. end
  2519. if grab.Name ~= "MikeSchmidt90" then
  2520. local partasdeff = Instance.new("ParticleEmitter",grab.HumanoidRootPart)
  2521. partasdeff.Color = ColorSequence.new(Color3.new(1, 0, 0), Color3.new(.5, 0, 0))
  2522. partasdeff.LightEmission = .1
  2523. partasdeff.Size = NumberSequence.new(0.2)
  2524. partasdeff.Texture = "http://www.roblox.com/asset/?ID=771221224"
  2525. aaa = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.2),NumberSequenceKeypoint.new(1, 5)})
  2526. bbb = NumberSequence.new({NumberSequenceKeypoint.new(0, 1),NumberSequenceKeypoint.new(0.0636, 0), NumberSequenceKeypoint.new(1, 1)})
  2527. partasdeff.Transparency = bbb
  2528. partasdeff.Size = aaa
  2529. partasdeff.ZOffset = .9
  2530. partasdeff.Acceleration = Vector3.new(0, -5, 0)
  2531. partasdeff.LockedToPart = false
  2532. partasdeff.EmissionDirection = "Back"
  2533. partasdeff.Lifetime = NumberRange.new(1, 2)
  2534. partasdeff.Rate = 1000
  2535. partasdeff.Rotation = NumberRange.new(-100, 100)
  2536. partasdeff.RotSpeed = NumberRange.new(-100, 100)
  2537. partasdeff.Speed = NumberRange.new(10)
  2538. partasdeff.VelocitySpread = 20
  2539. partasdeff.Enabled=false
  2540. sel = math.random(1,4)
  2541. if Words=="English"then
  2542. if sel == 1 then
  2543. chatfunc("Im Sorry...")
  2544. elseif sel == 2 then
  2545. chatfunc("Feel the power of death.")
  2546. elseif sel == 3 then
  2547. chatfunc("Your fault is the voided soul and your heartless.")
  2548. elseif sel==4 then
  2549. chatfunc("You can Repair your life with death.")
  2550. end
  2551. else
  2552. if sel == 1 then
  2553. chatfunc("????????C:")
  2554. elseif sel == 2 then
  2555. chatfunc("????????????")
  2556. elseif sel == 3 then
  2557. chatfunc("?????????????????????")
  2558. elseif sel==4 then
  2559. chatfunc("???????????????")
  2560. end
  2561. end
  2562. for i = 0, 2, 0.1 do
  2563. swait()
  2564. if Grabbed == true then
  2565. grab:FindFirstChildOfClass("Humanoid").PlatformStand = true
  2566. --GGyro.position = Partss.Position
  2567. --GGyro.Parent = grab.Head
  2568. grab.HumanoidRootPart.CFrame = Partss.CFrame * CFrame.Angles(0,math.rad(-90),0)
  2569. end
  2570. PlayAnimationFromTable({
  2571. CFrame.new(0.104281992, -1.37529127e-22, -0.179345995, 0.249840975, 5.92156003e-22, 0.968286872, -5.57068883e-22, 1, -4.67813147e-22, -0.968286872, -4.22523594e-22, 0.249840975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2572. CFrame.new(-0.0791492164, 1.44711375, -0.0994036943, 0.0100336075, -0.292051941, -0.95634979, -0.000366999942, 0.956396878, -0.29207015, 0.999949574, 0.00328149647, 0.00948894024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2573. CFrame.new(1.94523025, 1.02494264, -0.272673488, 0.287940055, -0.795002162, 0.533912063, 0.0434400104, -0.546107173, -0.836588264, 0.956662774, 0.264080375, -0.122711219) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2574. CFrame.new(-1.58139038, 0.176945746, 5.27966768e-06, 0.939729631, 0.341920435, -3.69548798e-06, -0.341920793, 0.93972975, -6.50105221e-06, -5.81145287e-07, 6.40749931e-06, 1.00000048) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2575. CFrame.new(0.569345832, -1.89868093, -0.00942828506, 0.266425997, -0.0769406706, -0.960779786, 0.0135936281, 0.997010291, -0.0760724545, 0.963760078, 0.00720720552, 0.266675085) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2576. CFrame.new(-0.849354744, -2.01616573, 0.241646215, 0.948664129, 0.308412433, 0.0701368451, -0.312046438, 0.948832989, 0.0484089628, -0.0516182035, -0.0678096861, 0.996362925) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2577. }, .1, false)
  2578. moter.C0 = clerp(moter.C0, CFrame.new(0.0111939851, -1.63769794, -0.31875661, -0.0172049776, -1.39437616e-05, -0.999852121, 0.999852002, 5.96046448e-06, -0.0172049757, 6.16908073e-06, -1, 1.38394535e-05) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2579. end
  2580. Effects.Block.Create(BrickColor.new("Bright red"), Partss.CFrame, 2, 2, 2, 0.9, 0.9, 0.9, 0.05)
  2581. Effects.Block.Create(BrickColor.new("Deep orange"), Partss.CFrame, 2, 2, 2, 0.5, 0.5, 0.5, 0.05)
  2582. CFuncs["Sound"].Create("rbxassetid://429400881", Character, 1, .5)
  2583. dmg(grab)
  2584. grab.Head.Velocity = grab.Head.CFrame.lookVector * -60
  2585. partasdeff.Enabled=true
  2586. for i = 0, 1, 0.1 do
  2587. swait()
  2588. PlayAnimationFromTable({
  2589. CFrame.new(0.104281992, -1.37529127e-22, -0.179345995, 0.249840975, 5.92156003e-22, 0.968286872, -5.57068883e-22, 1, -4.67813147e-22, -0.968286872, -4.22523594e-22, 0.249840975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2590. CFrame.new(-0.0791492164, 1.44711375, -0.0994036943, 0.0100336075, -0.292051941, -0.95634979, -0.000366999942, 0.956396878, -0.29207015, 0.999949574, 0.00328149647, 0.00948894024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2591. CFrame.new(1.95760894, 1.20200562, -0.275867403, 0.278526366, -0.669772983, 0.688351095, 0.0506580099, -0.705469668, -0.706927419, 0.959091723, 0.23176837, -0.162562534) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2592. CFrame.new(-1.58139038, 0.176945746, 5.27966768e-06, 0.939729631, 0.341920435, -3.69548798e-06, -0.341920793, 0.93972975, -6.50105221e-06, -5.81145287e-07, 6.40749931e-06, 1.00000048) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2593. CFrame.new(0.569345832, -1.89868093, -0.00942828506, 0.266425997, -0.0769406706, -0.960779786, 0.0135936281, 0.997010291, -0.0760724545, 0.963760078, 0.00720720552, 0.266675085) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2594. CFrame.new(-0.849354744, -2.01616573, 0.241646215, 0.948664129, 0.308412433, 0.0701368451, -0.312046438, 0.948832989, 0.0484089628, -0.0516182035, -0.0678096861, 0.996362925) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2595. }, .3, false)
  2596. moter.C0 = clerp(moter.C0, CFrame.new(0.0111932531, -1.63769579, -0.318755656, -0.0172050633, -1.61863863e-05, -0.999852121, 0.999851882, 5.15580177e-06, -0.017205067, 5.453825e-06, -1, 1.60960481e-05) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2597. end
  2598. partasdeff.Enabled=false
  2599. for i = 0, 2.5, 0.1 do
  2600. swait()
  2601. PlayAnimationFromTable({
  2602. CFrame.new(0.104281992, -1.37529127e-22, -0.179345995, 0.249840975, 5.92156003e-22, 0.968286872, -5.57068883e-22, 1, -4.67813147e-22, -0.968286872, -4.22523594e-22, 0.249840975) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2603. CFrame.new(-0.0791492164, 1.44711375, -0.0994036943, 0.0100336075, -0.292051941, -0.95634979, -0.000366999942, 0.956396878, -0.29207015, 0.999949574, 0.00328149647, 0.00948894024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2604. CFrame.new(1.94523025, 1.02494264, -0.272673488, 0.287940055, -0.795002162, 0.533912063, 0.0434400104, -0.546107173, -0.836588264, 0.956662774, 0.264080375, -0.122711219) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2605. CFrame.new(-1.58139038, 0.176945746, 5.27966768e-06, 0.939729631, 0.341920435, -3.69548798e-06, -0.341920793, 0.93972975, -6.50105221e-06, -5.81145287e-07, 6.40749931e-06, 1.00000048) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2606. CFrame.new(0.569345832, -1.89868093, -0.00942828506, 0.266425997, -0.0769406706, -0.960779786, 0.0135936281, 0.997010291, -0.0760724545, 0.963760078, 0.00720720552, 0.266675085) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2607. CFrame.new(-0.849354744, -2.01616573, 0.241646215, 0.948664129, 0.308412433, 0.0701368451, -0.312046438, 0.948832989, 0.0484089628, -0.0516182035, -0.0678096861, 0.996362925) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2608. }, .2, false)
  2609. moter.C0 = clerp(moter.C0, CFrame.new(0.0111939851, -1.63769794, -0.31875661, -0.0172049776, -1.39437616e-05, -0.999852121, 0.999852002, 5.96046448e-06, -0.0172049757, 6.16908073e-06, -1, 1.38394535e-05) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2610. end
  2611. coroutine.wrap(function()
  2612. wait(2)
  2613. partasdeff:Remove()
  2614. end)()
  2615. else
  2616. grab:FindFirstChildOfClass("Humanoid").PlatformStand = false
  2617. for i = 0, 3, 0.1 do
  2618. swait()
  2619. PlayAnimationFromTable({
  2620. CFrame.new(0.104280457, -1.46030498e-22, -0.179343686, 0.249860913, 5.18448626e-22, 0.968281686, -5.82335151e-22, 1, -5.29395592e-22, -0.968281686, -3.70576914e-22, 0.249860913) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2621. CFrame.new(0.00671941042, 1.48144531, -0.121562012, 0.0679168552, 0.388981611, -0.918738663, 0.158512011, 0.904961228, 0.394866198, 0.985018492, -0.172449201, -0.000196114182) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2622. CFrame.new(1.5714488, -0.100437641, -0.219321564, 0.297819793, -0.653239965, -0.696118593, -0.0311920028, 0.722160041, -0.691022456, 0.954112411, 0.227513462, 0.194697708) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2623. CFrame.new(-1.5814501, 0.177012652, 5.41775626e-06, 0.939689815, 0.342028022, -2.68220901e-06, -0.342027992, 0.939689755, -6.1805149e-06, 4.17232513e-07, 6.72787428e-06, 1) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2624. CFrame.new(0.569012046, -1.89856982, -0.00933695585, 0.266445845, -0.0764764398, -0.960811257, 0.0135949478, 0.997046292, -0.075590536, 0.963754177, 0.00707861409, 0.266698539) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2625. CFrame.new(-0.849534154, -2.01595497, 0.241721377, 0.948572636, 0.308689058, 0.070150286, -0.312330276, 0.948733151, 0.0485308319, -0.0515729487, -0.067945078, 0.996355295) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2626. }, .1, false)
  2627. moter.C0 = clerp(moter.C0, CFrame.new(0.0111981034, -1.63767779, -0.318741798, -0.0172085222, -1.4077872e-05, -0.999851882, 0.999851942, 7.4505806e-06, -0.0172085222, 7.68899918e-06, -1.00000012, 1.39512122e-05) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2628. end
  2629. sel = math.random(1,3)
  2630. if Words=="English"then
  2631. if sel == 1 then
  2632. chatfunc(". . . ")
  2633. elseif sel == 2 then
  2634. chatfunc("What am I doing...?")
  2635. elseif sel == 3 then
  2636. chatfunc("I can't...")
  2637. end
  2638. else
  2639. if sel == 1 then
  2640. chatfunc(". . . ")
  2641. elseif sel == 2 then
  2642. chatfunc("????????????∑∑∑?")
  2643. elseif sel == 3 then
  2644. chatfunc("????...")
  2645. end
  2646. end
  2647. for i = 0, 5, 0.1 do
  2648. swait()
  2649. PlayAnimationFromTable({
  2650. CFrame.new(0, 0, 0, 0.999999881, 5.04870979e-29, -4.21790838e-43, 5.04870979e-29, 1, -5.04870979e-29, -4.21790838e-43, -5.04870979e-29, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2651. CFrame.new(-0.0399715528, 1.42130852, -0.217550665, 0.985933542, -0.136098281, -0.097015582, 0.166522697, 0.849608123, 0.500436008, 0.0143167432, -0.509551942, 0.860320628) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0- .4 * math.cos((sine) / 5), 0),
  2652. CFrame.new(1.57258642, 0.0433240086, 3.83948304e-08, 0.990993857, -0.133906633, -2.60571618e-08, 0.133906662, 0.990993977, 5.96046341e-08, 1.78410318e-08, -6.25570422e-08, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2653. CFrame.new(-0.693957031, 0.999676406, -0.811627388, 0.817211449, -0.569911301, -0.0858340934, -0.499626935, -0.626295447, -0.598442137, 0.287295371, 0.531934083, -0.796558976) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2654. CFrame.new(0.540301144, -1.99792778, 1.70425119e-06, 0.998698354, -0.0510031469, 6.26438805e-07, 0.0510031544, 0.998698473, -1.04335422e-05, -9.34800966e-08, 1.04519122e-05, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2655. CFrame.new(-0.539563119, -1.99793291, 1.9016752e-06, 0.998630941, 0.0523070693, -1.67712614e-07, -0.0523070768, 0.99863106, -1.0458818e-05, -3.79587107e-07, 1.04532719e-05, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2656. }, .3, false)
  2657. moter.C0 = clerp(moter.C0, CFrame.new(0.0111991819, -1.63769639, -0.318748534, -0.0172109455, -5.96046448e-08, -0.999852002, 0.999852061, -1.19209318e-07, -0.0172108412, 5.96046519e-08, -0.99999994, -1.19209275e-07) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2658. end
  2659. end
  2660. end
  2661. --GGyro.Parent = nil
  2662. attack = false
  2663. Grabbed = false
  2664. Humanoid.WalkSpeed = 35
  2665. end
  2666. function moarblood()
  2667. attack = true
  2668. CFuncs["Sound"].Create("rbxassetid://743521656", Character, 1, .8)
  2669. RootPart.CFrame = targetted.HumanoidRootPart.CFrame * CFrame.new(0,0,4)
  2670. local k = New("Part",LeftArm,"k",{BrickColor = BrickColor.new("Black"),Material = Enum.Material.SmoothPlastic,Transparency = 1,Transparency = 1,Shape = Enum.PartType.Cylinder,Size = Vector3.new(0.200000003, 0.221472204, 0.221472189),CFrame = CFrame.new(4.93319941, -1.31948221, -45.7696877, 0.141969427, -5.55023435e-05, -0.989871144, 0.989874005, 1.80069164e-05, 0.141970903, 1.06166653e-05, -1.00000143, 5.59078326e-05),CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,Color = Color3.new(0.105882, 0.164706, 0.207843),})
  2671. mot = New("Weld",k,"mot",{Part0 = k,Part1 = LeftArm,C0 = CFrame.new(0, 0, 0, 0.141969457, 0.989873946, 1.06166663e-05, -5.55023507e-05, 1.80069164e-05, -1.00000167, -0.989871264, 0.141970903, 5.59078399e-05),C1 = CFrame.new(6.67572021e-06, -1.40000057, -3.81469727e-06, 0.989870846, -0.14197053, -1.2531201e-06, 0.141970515, 0.989870906, 1.03843358e-05, -2.33842215e-07, -1.04570581e-05, 0.99999994),})
  2672. wait(.5)
  2673. for i = 0, 1.2, 0.1 do
  2674. swait()
  2675. PlayAnimationFromTable({
  2676. CFrame.new(0.0246932413, -0.0966757834, -0.0092370566, 0.713696778, 5.59592329e-22, 0.700454772, -9.27150216e-22, 1, 1.45779223e-22, -0.700454772, -7.53468894e-22, 0.713696778) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2677. CFrame.new(0.098094359, 1.53651738, -0.281765848, 0.593379974, 0.280785412, -0.754360616, -0.0276839901, 0.943748772, 0.329502523, 0.804446399, -0.174636483, 0.567774832) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2678. CFrame.new(1.58677018, 0.143787161, 0.0495693758, 0.968102753, -0.250522822, -0.00394502282, 0.250228018, 0.965921044, 0.0662006512, -0.0127741396, -0.0650762022, 0.997798622) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2679. CFrame.new(-1.74332106, 0.446618229, -0.859300971, 0.795205951, 0.606264353, -0.0095520094, -0.0538869984, 0.0549720451, -0.997032762, -0.603940368, 0.793361068, 0.0763838589) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2680. CFrame.new(0.648194611, -1.97843742, -0.088139981, 0.954304218, -0.129303336, -0.269414723, 0.107585981, 0.989748061, -0.0939367935, 0.278798997, 0.0606590137, 0.958431959) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2681. CFrame.new(-0.671899676, -2.02211809, 0.00866907835, 0.94230175, 0.108399026, -0.316728801, -0.108764999, 0.993929207, 0.0165804606, 0.316603303, 0.0188252106, 0.948371291) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2682. }, .2, false)
  2683. moter.C0 = clerp(moter.C0, CFrame.new(0.0111978557, -1.63769853, -0.318748116, -0.0172083378, 3.06963921e-06, -0.999852002, 0.999851942, -2.01165676e-07, -0.0172083378, -2.4586916e-07, -1, -3.09944153e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2684. end
  2685. if targetted.Name ~= "CKbackup" then
  2686. local grab = nil
  2687. for i, v in pairs(FindNearestTorso(Torso.CFrame.p, 7)) do
  2688. if v:FindFirstChild('Head') then
  2689. Grabbed = true
  2690. --CFuncs["Sound"].Create("http://www.roblox.com/asset/?id=160718677", v.Head, 1, .8)
  2691. grab = v
  2692. end
  2693. end
  2694. Humanoid.WalkSpeed = 0
  2695. for i = 0, 2, 0.1 do
  2696. swait()
  2697. if Grabbed == true then
  2698. grab:FindFirstChildOfClass("Humanoid").PlatformStand = true
  2699. --GGyro.position = Partss.Position
  2700. --GGyro.Parent = grab.Head
  2701. grab.Head.CFrame = k.CFrame * CFrame.Angles(0,math.rad(-90),0)
  2702. end
  2703. PlayAnimationFromTable({
  2704. CFrame.new(-0.203895777, -0.0966757089, 0.221102715, 0.860356927, 5.59592329e-22, -0.509691954, -9.74120787e-23, 1, 9.33471908e-22, 0.509691954, -7.53468894e-22, 0.860356927) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2705. CFrame.new(-0.0263810754, 1.49789393, -0.36129567, 0.83927381, -0.177804202, 0.513814509, -0.0293880031, 0.928800881, 0.369412124, -0.542914331, -0.325137854, 0.774292946) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2706. CFrame.new(1.70567894, 0.192227185, 0.324310064, 0.910149336, -0.402004361, -0.100104719, 0.41140601, 0.848634601, 0.332512379, -0.0487190783, -0.343819588, 0.937771142) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2707. CFrame.new(-0.925376594, 0.275374949, -0.912649989, 0.847262561, -0.507846355, 0.155686736, 0.278232396, 0.17463918, -0.944503605, 0.452473402, 0.84355998, 0.289265245) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2708. CFrame.new(0.648186982, -1.97843516, -0.0881449506, 0.954305232, -0.129303262, -0.269411147, 0.107586049, 0.989748061, -0.0939371213, 0.278795511, 0.0606598109, 0.958432913) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2709. CFrame.new(-0.671897829, -2.02211738, 0.00865991414, 0.942302644, 0.108399101, -0.316726208, -0.108764961, 0.993929207, 0.0165806562, 0.31660068, 0.0188247077, 0.948372126) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2710. }, .25, false)
  2711. moter.C0 = clerp(moter.C0, CFrame.new(0.0111928731, -1.63769662, -0.318741947, -0.0172089636, 8.2552433e-06, -0.999852061, 0.999852061, 7.4505806e-07, -0.0172089189, 5.66244125e-07, -1.00000012, -8.2552433e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2712. end
  2713. if Grabbed == true then
  2714. sel = math.random(1,3)
  2715. if Words=="English"then
  2716. if sel == 1 then
  2717. chatfunc("No Inncoents here.")
  2718. elseif sel == 2 then
  2719. chatfunc("I hate you...")
  2720. elseif sel == 3 then
  2721. chatfunc("Now , what did you thought?")
  2722. end
  2723. else
  2724. if sel == 1 then
  2725. chatfunc("????????????")
  2726. elseif sel == 2 then
  2727. chatfunc("????????")
  2728. elseif sel == 3 then
  2729. chatfunc("???????????")
  2730. end
  2731. end --if targetted:FindFirstChild("Head")then
  2732. if targetted:FindFirstChild("Head")then local partasdeff = Instance.new("ParticleEmitter",targetted.Head)
  2733. partasdeff.Color = ColorSequence.new(Color3.new(1, 0, 0), Color3.new(.5, 0, 0))
  2734. partasdeff.LightEmission = .1
  2735. partasdeff.Size = NumberSequence.new(0.2)
  2736. partasdeff.Texture = "http://www.roblox.com/asset/?ID=771221224"
  2737. aaa = NumberSequence.new({NumberSequenceKeypoint.new(0, 0.2),NumberSequenceKeypoint.new(1, 5)})
  2738. bbb = NumberSequence.new({NumberSequenceKeypoint.new(0, 1),NumberSequenceKeypoint.new(0.0636, 0), NumberSequenceKeypoint.new(1, 1)})
  2739. partasdeff.Transparency = bbb
  2740. partasdeff.Size = aaa
  2741. partasdeff.ZOffset = .9
  2742. partasdeff.Acceleration = Vector3.new(0, -5, 0)
  2743. partasdeff.LockedToPart = false
  2744. partasdeff.EmissionDirection = "Back"
  2745. partasdeff.Lifetime = NumberRange.new(1, 2)
  2746. partasdeff.Rate = 1000
  2747. partasdeff.Rotation = NumberRange.new(-100, 100)
  2748. partasdeff.RotSpeed = NumberRange.new(-100, 100)
  2749. partasdeff.Speed = NumberRange.new(6)
  2750. partasdeff.VelocitySpread = 10000 partasdeff.Enabled=true
  2751. partasdeff.Enabled=false spawn(function()swait(10)partasdeff.Enabled=false end)end
  2752. for i = 0, 3, 0.1 do
  2753. swait()
  2754. if Grabbed == true then
  2755. grab:FindFirstChildOfClass("Humanoid").PlatformStand = true
  2756. --GGyro.position = Partss.Position
  2757. --GGyro.Parent = grab.Head
  2758. grab.Head.CFrame = k.CFrame * CFrame.Angles(0,math.rad(-90),0)
  2759. end
  2760. PlayAnimationFromTable({
  2761. CFrame.new(-0.203895777, -0.0966757089, 0.221102715, 0.860356927, 5.59592329e-22, -0.509691954, -9.74120787e-23, 1, 9.33471908e-22, 0.509691954, -7.53468894e-22, 0.860356927) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2762. CFrame.new(0.0996288583, 1.46053851, -0.148588806, 0.834862471, 0.0359686315, 0.549282432, -0.0103890011, 0.998714745, -0.0496083908, -0.550360739, 0.0357096791, 0.83416307) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2763. CFrame.new(1.70567894, 0.192227185, 0.324310064, 0.910149336, -0.402004361, -0.100104719, 0.41140601, 0.848634601, 0.332512379, -0.0487190783, -0.343819588, 0.937771142) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2764. CFrame.new(-1.5511272, 1.22937977, -0.634234905, 0.785770595, 0.333147645, 0.521131098, 0.522403002, -0.808557391, -0.270795107, 0.331149668, 0.485022962, -0.809378147) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2765. CFrame.new(0.648186982, -1.97843516, -0.0881449506, 0.954305232, -0.129303262, -0.269411147, 0.107586049, 0.989748061, -0.0939371213, 0.278795511, 0.0606598109, 0.958432913) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2766. CFrame.new(-0.684103072, -2.02189779, 0.0673112273, 0.973016024, 0.108399175, -0.203689545, -0.109960191, 0.993929327, 0.00367253274, 0.202851087, 0.0188243091, 0.979028702) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2767. }, .1, false)
  2768. moter.C0 = clerp(moter.C0, CFrame.new(0.0111928731, -1.63769662, -0.318741947, -0.0172089636, 8.2552433e-06, -0.999852061, 0.999852061, 7.4505806e-07, -0.0172089189, 5.66244125e-07, -1.00000012, -8.2552433e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2769. end
  2770. grab.HumanoidRootPart.Transparency = 1
  2771. dmg(grab)
  2772. CFuncs["Sound"].Create("rbxassetid://429400881", grab.Head, .8, .8)
  2773. --CFuncs["Sound"].Create("http://www.roblox.com/asset/?id=160718677", grab.Head, 1, .7)
  2774.  
  2775. coroutine.wrap(function()
  2776. wait(.4)
  2777. --partasdeff.Enabled=false
  2778. end)()
  2779. for i = 0, 3.5, 0.1 do
  2780. swait()
  2781. PlayAnimationFromTable({
  2782. CFrame.new(-0.203895777, -0.0966757089, 0.221102715, 0.860356927, 5.59592329e-22, -0.509691954, -9.74120787e-23, 1, 9.33471908e-22, 0.509691954, -7.53468894e-22, 0.860356927) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2783. CFrame.new(0.0996288583, 1.46053851, -0.148588806, 0.834862471, 0.0359686315, 0.549282432, -0.0103890011, 0.998714745, -0.0496083908, -0.550360739, 0.0357096791, 0.83416307) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2784. CFrame.new(1.70567894, 0.192227185, 0.324310064, 0.910149336, -0.402004361, -0.100104719, 0.41140601, 0.848634601, 0.332512379, -0.0487190783, -0.343819588, 0.937771142) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2785. CFrame.new(-1.40260935, 1.29555511, -0.560751677, 0.832364976, 0.188659444, 0.521130562, 0.370884001, -0.88832134, -0.2707977, 0.411842346, 0.418681324, -0.809378505) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2786. CFrame.new(0.648186982, -1.97843516, -0.0881449506, 0.954305232, -0.129303262, -0.269411147, 0.107586049, 0.989748061, -0.0939371213, 0.278795511, 0.0606598109, 0.958432913) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2787. CFrame.new(-0.684103072, -2.02189779, 0.0673112273, 0.973016024, 0.108399175, -0.203689545, -0.109960191, 0.993929327, 0.00367253274, 0.202851087, 0.0188243091, 0.979028702) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2788. }, .3, false)
  2789. moter.C0 = clerp(moter.C0, CFrame.new(0.0111928731, -1.63769662, -0.318741947, -0.0172089636, 8.2552433e-06, -0.999852061, 0.999852061, 7.4505806e-07, -0.0172089189, 5.66244125e-07, -1.00000012, -8.2552433e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2790. end
  2791. end
  2792. else
  2793. Humanoid.WalkSpeed = 0
  2794. for i = 0, 3, 0.1 do
  2795. swait()
  2796. PlayAnimationFromTable({
  2797. CFrame.new(0.0246932413, -0.0966757834, -0.0092370566, 0.713696778, 5.59592329e-22, 0.700454772, -9.27150216e-22, 1, 1.45779223e-22, -0.700454772, -7.53468894e-22, 0.713696778) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2798. CFrame.new(0.098094359, 1.53651738, -0.281765848, 0.593379974, 0.280785412, -0.754360616, -0.0276839901, 0.943748772, 0.329502523, 0.804446399, -0.174636483, 0.567774832) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2799. CFrame.new(1.58677018, 0.143787161, 0.0495693758, 0.968102753, -0.250522822, -0.00394502282, 0.250228018, 0.965921044, 0.0662006512, -0.0127741396, -0.0650762022, 0.997798622) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2800. CFrame.new(-1.74332106, 0.446618229, -0.859300971, 0.795205951, 0.606264353, -0.0095520094, -0.0538869984, 0.0549720451, -0.997032762, -0.603940368, 0.793361068, 0.0763838589) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2801. CFrame.new(0.648194611, -1.97843742, -0.088139981, 0.954304218, -0.129303336, -0.269414723, 0.107585981, 0.989748061, -0.0939367935, 0.278798997, 0.0606590137, 0.958431959) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2802. CFrame.new(-0.671899676, -2.02211809, 0.00866907835, 0.94230175, 0.108399026, -0.316728801, -0.108764999, 0.993929207, 0.0165804606, 0.316603303, 0.0188252106, 0.948371291) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2803. }, .2, false)
  2804. moter.C0 = clerp(moter.C0, CFrame.new(0.0111978557, -1.63769853, -0.318748116, -0.0172083378, 3.06963921e-06, -0.999852002, 0.999851942, -2.01165676e-07, -0.0172083378, -2.4586916e-07, -1, -3.09944153e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2805. end
  2806. sel = math.random(1,3)
  2807. if sel == 1 then
  2808. chatfunc("Aahhh...")
  2809. elseif sel == 2 then
  2810. chatfunc("Oh Sugarie, I thought you're enemy...")
  2811. elseif sel == 3 then
  2812. chatfunc("Sigh...")
  2813. end
  2814. for i = 0, 5, 0.1 do
  2815. swait()
  2816. PlayAnimationFromTable({
  2817. CFrame.new(0, 0, 0, 0.999999881, 5.04870979e-29, -4.21790838e-43, 5.04870979e-29, 1, -5.04870979e-29, -4.21790838e-43, -5.04870979e-29, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2818. CFrame.new(-0.0399715528, 1.42130852, -0.217550665, 0.985933542, -0.136098281, -0.097015582, 0.166522697, 0.849608123, 0.500436008, 0.0143167432, -0.509551942, 0.860320628) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0- .4 * math.cos((sine) / 5), 0),
  2819. CFrame.new(1.57258642, 0.0433240086, 3.83948304e-08, 0.990993857, -0.133906633, -2.60571618e-08, 0.133906662, 0.990993977, 5.96046341e-08, 1.78410318e-08, -6.25570422e-08, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2820. CFrame.new(-0.693957031, 0.999676406, -0.811627388, 0.817211449, -0.569911301, -0.0858340934, -0.499626935, -0.626295447, -0.598442137, 0.287295371, 0.531934083, -0.796558976) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2821. CFrame.new(0.540301144, -1.99792778, 1.70425119e-06, 0.998698354, -0.0510031469, 6.26438805e-07, 0.0510031544, 0.998698473, -1.04335422e-05, -9.34800966e-08, 1.04519122e-05, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2822. CFrame.new(-0.539563119, -1.99793291, 1.9016752e-06, 0.998630941, 0.0523070693, -1.67712614e-07, -0.0523070768, 0.99863106, -1.0458818e-05, -3.79587107e-07, 1.04532719e-05, 0.999999881) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2823. }, .3, false)
  2824. moter.C0 = clerp(moter.C0, CFrame.new(0.0111991819, -1.63769639, -0.318748534, -0.0172109455, -5.96046448e-08, -0.999852002, 0.999852061, -1.19209318e-07, -0.0172108412, 5.96046519e-08, -0.99999994, -1.19209275e-07) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2825. end
  2826. end
  2827. attack = false
  2828. Grabbed = false
  2829. k:Remove()
  2830. Humanoid.WalkSpeed = 35
  2831. end
  2832.  
  2833. function painlessrain()
  2834. attack = true
  2835. sel = math.random(1,3)
  2836. if Words=="English"then
  2837. if sel == 1 then
  2838. chatfunc("See you in hell.")
  2839. elseif sel == 2 then
  2840. chatfunc("Let's drop the 'Insanity' from the sky.")
  2841. elseif sel == 3 then
  2842. chatfunc("Your Dead.")
  2843. end
  2844. else
  2845. if sel == 1 then
  2846. chatfunc("????????????????")
  2847. elseif sel == 2 then
  2848. chatfunc("????????????????????")
  2849. elseif sel == 3 then
  2850. chatfunc("??????????")
  2851. end
  2852. end
  2853.  
  2854. Humanoid.WalkSpeed = 0
  2855. local ref1 = New("Part",m,"ref",{Transparency = 1,Size = Vector3.new(.2,.2,.2),CFrame = Torso.CFrame,Anchored = true,CanCollide = false,BackSurface = Enum.SurfaceType.SmoothNoOutlines,BottomSurface = Enum.SurfaceType.SmoothNoOutlines,FrontSurface = Enum.SurfaceType.SmoothNoOutlines,LeftSurface = Enum.SurfaceType.SmoothNoOutlines,RightSurface = Enum.SurfaceType.SmoothNoOutlines,TopSurface = Enum.SurfaceType.SmoothNoOutlines,})
  2856.  
  2857. coroutine.wrap(function()
  2858. for i = 0, 1 do
  2859. wait(.2)
  2860. --CFuncs["Sound"].Create("http://www.roblox.com/asset/?id=160718677", RootPart, 1, 1.3)
  2861. end
  2862. end)()
  2863. for i = 0, 4, 0.1 do
  2864. swait()
  2865. PlayAnimationFromTable({
  2866. CFrame.new(0.160091802, -3.66497677e-23, -0.0753167868, 0.153125972, 2.95760942e-22, 0.988206744, 9.50910858e-23, 1, -3.14025256e-22, -0.988206744, 1.42055005e-22, 0.153125986) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2867. CFrame.new(-0.115934461, 1.42953098, -0.0387745127, 0.0422455594, -0.156738758, -0.986736298, 0.091215007, 0.984098434, -0.152414545, 0.994934857, -0.083566308, 0.0558707118) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2868. CFrame.new(1.88563442, 0.849646449, -0.150348112, 0.134151325, -0.917590559, 0.374207288, 0.151069015, -0.354270071, -0.922860146, 0.979378283, 0.180334046, 0.0910937041) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2869. CFrame.new(-1.53188074, 0.0735950321, 2.69606994e-06, 0.978446901, 0.206499115, 2.48849392e-06, -0.2064991, 0.978446841, -1.05276868e-05, -4.61935997e-06, 9.78447497e-06, 1.00000012) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2870. CFrame.new(0.6596874, -2.0274992, -0.0100709619, 0.00881013274, -0.161221251, -0.986878991, 0.00903601572, 0.986890376, -0.161142424, 0.999920428, -0.0074977763, 0.0101515204) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2871. CFrame.new(-0.56669867, -2.04759455, -0.0995163321, 0.988194227, 0.0786855519, 0.131456956, -0.0635150596, 0.991232872, -0.115859069, -0.139420897, 0.106141761, 0.984528303) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2872. }, .07, false)
  2873. moter.C0 = clerp(moter.C0, CFrame.new(0.00354172289, -1.19249964, -0.318736732, -0.017209189, -1.8668361e-06, -0.999851942, 0.999851882, 1.90734863e-06, -0.0172091946, 1.93715096e-06, -1.00000012, 1.82725489e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, math.rad(doe * 22)), 0.3)
  2874. end
  2875. for i = 0, 1.5, 0.1 do
  2876. swait()
  2877. PlayAnimationFromTable({
  2878. CFrame.new(0.160091802, -3.66497677e-23, -0.0753167868, 0.153125972, 2.95760942e-22, 0.988206744, 9.50910858e-23, 1, -3.14025256e-22, -0.988206744, 1.42055005e-22, 0.153125986) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2879. CFrame.new(-0.181723118, 1.42154801, -0.0812263489, 0.0422911495, -0.473342478, -0.879862845, 0.0912349299, 0.878800809, -0.468385875, 0.994931221, -0.0604656339, 0.0803508535) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2880. CFrame.new(1.46608233, 1.280774, -0.0335922651, 0.00761340559, -0.0420075022, 0.999088407, 0.0443810038, -0.998118579, -0.0423049256, 0.998985708, 0.044662632, -0.00573477149) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2881. CFrame.new(-1.53188074, 0.0735950321, 2.69606994e-06, 0.978446901, 0.206499115, 2.48849392e-06, -0.2064991, 0.978446841, -1.05276868e-05, -4.61935997e-06, 9.78447497e-06, 1.00000012) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2882. CFrame.new(0.6596874, -2.0274992, -0.0100709619, 0.00881013274, -0.161221251, -0.986878991, 0.00903601572, 0.986890376, -0.161142424, 0.999920428, -0.0074977763, 0.0101515204) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2883. CFrame.new(-0.56669867, -2.04759455, -0.0995163321, 0.988194227, 0.0786855519, 0.131456956, -0.0635150596, 0.991232872, -0.115859069, -0.139420897, 0.106141761, 0.984528303) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2884. }, .2, false)
  2885. moter.C0 = clerp(moter.C0, CFrame.new(0.0112083405, -1.63769615, -0.31873402, -0.0172121376, -2.89082527e-06, -0.999851882, 0.999851942, 4.58210707e-07, -0.0172121413, 5.06639481e-07, -1.00000012, 2.89082527e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2886. end
  2887. for i = 0, 0 do
  2888. Effects.Block.Create(BrickColor.new("Bright red"), Partss.CFrame, 2, 2, 2, 0.9, 0.9, 0.9, 0.05)
  2889. Effects.Block.Create(BrickColor.new("Deep orange"), Partss.CFrame, 2, 2, 2, 0.5, 0.5, 0.5, 0.05)
  2890. for i=0,15 do RingE(Partss.CFrame*CFrame.Angles(math.rad(math.random(360)),math.rad(math.random(360)),math.rad(math.random(360))),.1+math.random(40)/100,30+math.random(70),0,30,3,0,ColorSequence.new(Color3.fromRGB(98, 37, 209)),-.025)end
  2891. CFuncs["Sound"].Create("rbxassetid://642890855", Character, 1, .5)
  2892. for i = 0, .5, 0.1 do
  2893. swait()
  2894. PlayAnimationFromTable({
  2895. CFrame.new(0.160087422, -3.66470256e-23, -0.0753137618, 0.15316838, 2.95750466e-22, 0.988200247, 9.50818972e-23, 1, -3.14019425e-22, -0.988200247, 1.42057819e-22, 0.15316838) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2896. CFrame.new(-0.181723118, 1.42154801, -0.0812263489, 0.0422911495, -0.473342478, -0.879862845, 0.0912349299, 0.878800809, -0.468385875, 0.994931221, -0.0604656339, 0.0803508535) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2897. CFrame.new(1.46630716, 1.08524323, -0.0336530581, 0.00764143467, -0.0426861309, 0.999059498, 0.0445286781, -0.998082876, -0.0429849848, 0.998979032, 0.0448152684, -0.0057259798) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2898. CFrame.new(-1.53188026, 0.0735908896, 2.69562906e-06, 0.978447855, 0.206495479, 2.48849392e-06, -0.206495419, 0.978447556, -1.05270137e-05, -4.61935997e-06, 9.78633761e-06, 1.00000024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2899. CFrame.new(0.659685254, -2.0274992, -0.0100700259, 0.00885757804, -0.161218897, -0.986879349, 0.00904085487, 0.986890197, -0.161139548, 0.999920309, -0.00749491528, 0.0101990253) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2900. CFrame.new(-0.566697419, -2.04759264, -0.0995131433, 0.988195002, 0.078684561, 0.131453067, -0.0635149851, 0.991233289, -0.115855575, -0.139416695, 0.106138662, 0.984529436) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2901. }, .3, false)
  2902. moter.C0 = clerp(moter.C0, CFrame.new(0.0112046078, -1.63744116, -0.318734497, -0.0172122065, 2.46167183e-05, -0.999852002, 0.999850631, -0.00159030408, -0.0172121339, -0.00159040466, -0.999998927, 2.57790089e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2903. end
  2904. for i = 0, .5, 0.1 do
  2905. swait()
  2906. PlayAnimationFromTable({
  2907. CFrame.new(0.160091802, -3.66497677e-23, -0.0753167868, 0.153125972, 2.95760942e-22, 0.988206744, 9.50910858e-23, 1, -3.14025256e-22, -0.988206744, 1.42055005e-22, 0.153125986) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2908. CFrame.new(-0.181723118, 1.42154801, -0.0812263489, 0.0422911495, -0.473342478, -0.879862845, 0.0912349299, 0.878800809, -0.468385875, 0.994931221, -0.0604656339, 0.0803508535) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2909. CFrame.new(1.46608233, 1.280774, -0.0335922651, 0.00761340559, -0.0420075022, 0.999088407, 0.0443810038, -0.998118579, -0.0423049256, 0.998985708, 0.044662632, -0.00573477149) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2910. CFrame.new(-1.53188074, 0.0735950321, 2.69606994e-06, 0.978446901, 0.206499115, 2.48849392e-06, -0.2064991, 0.978446841, -1.05276868e-05, -4.61935997e-06, 9.78447497e-06, 1.00000012) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2911. CFrame.new(0.6596874, -2.0274992, -0.0100709619, 0.00881013274, -0.161221251, -0.986878991, 0.00903601572, 0.986890376, -0.161142424, 0.999920428, -0.0074977763, 0.0101515204) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2912. CFrame.new(-0.56669867, -2.04759455, -0.0995163321, 0.988194227, 0.0786855519, 0.131456956, -0.0635150596, 0.991232872, -0.115859069, -0.139420897, 0.106141761, 0.984528303) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  2913. }, .3, false)
  2914. moter.C0 = clerp(moter.C0, CFrame.new(0.0112083405, -1.63769615, -0.31873402, -0.0172121376, -2.89082527e-06, -0.999851882, 0.999851942, 4.58210707e-07, -0.0172121413, 5.06639481e-07, -1.00000012, 2.89082527e-06) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  2915. end
  2916. end
  2917. attack = false
  2918. Humanoid.WalkSpeed = 35
  2919. wait(.4)
  2920. for i = 0, 150 do
  2921. swait(0.5)
  2922. mdmg(ref1, 3)
  2923. CFuncs["Sound"].Create("rbxassetid://200633492", Character, .5, 2)
  2924. ref1.Position = Mouse.hit.p+Vector3.new(math.random(-100,100)/100,0,math.random(-100,100)/100)
  2925. ref1.CFrame = ref1.CFrame * CFrame.new(math.random(-.5,.5),0,math.random(-.5,.5))
  2926. Effects.Cylinder.Create(BrickColor.new("Really black"), ref1.CFrame, 4, 9999, 4, -0.2, 0, -0.2, 0.05,"Neon")
  2927. Effects.Cylinder.Create(BrickColor.new("Bright violet"), ref1.CFrame, 8, 9999, 8, -0.4, 0, -0.4, 0.1,"Neon")
  2928. end
  2929. ref1:Remove()
  2930. end
  2931.  
  2932. function TargetSelect(person)
  2933. local dd=coroutine.wrap(function()
  2934. if targetted ~= person then
  2935. targetted = person
  2936. img2.Size = UDim2.new(1,0,1,0)
  2937. img2.ImageTransparency = 0
  2938. img2.Position = UDim2.new(0,0,0,0)
  2939. for i = 0, 2, 0.1 do
  2940. swait()
  2941. img2.Size = img2.Size + UDim2.new(.05,0,.05,0)
  2942. img2.Position = img2.Position + UDim2.new(-.025,0,-.025,0)
  2943. img2.ImageTransparency = img2.ImageTransparency + 0.05
  2944. end
  2945. end
  2946. end)
  2947. dd()
  2948. end
  2949.  
  2950. function LockOn()
  2951. local hum=FindHumanoid(Mouse.Target)
  2952. if hum then
  2953. if hum.Parent:FindFirstChild("Head")and hum.Parent:FindFirstChild("HumanoidRootPart")then
  2954. TargetSelect(hum.Parent)
  2955. CFuncs["Sound"].Create("rbxassetid://743521656", Character, 1, .8)
  2956. end
  2957. end
  2958. end
  2959.  
  2960.  
  2961. function ofmoosic() -- 2 lazi hoh
  2962. delays = true
  2963. while wait() and kkk and kkk.Volume >= 0.02 do
  2964. kkk.Volume = kkk.Volume - 0.05
  2965. end
  2966. wait(0.1)
  2967. kkk.Pitch = 0
  2968. kkk.PlaybackSpeed = 0
  2969. play = false
  2970. delays = false
  2971. end
  2972. function onmoosic()
  2973. delays = true
  2974. kkk.Pitch = 1
  2975. kkk.PlaybackSpeed = 1
  2976. while wait() and kkk and kkk.Volume <= 1.5 do
  2977. kkk.Volume = kkk.Volume + 0.05
  2978. end
  2979. wait(0.1)
  2980. play = true
  2981. delays = false
  2982. end
  2983.  
  2984. function SpinMeDad()
  2985. attack = true
  2986. So:Play()
  2987. kkk:Pause()
  2988. local vel2 = Instance.new("BodyVelocity",tors)
  2989. vel2.Velocity = Vector3.new(0,1.2,0)
  2990. vel2.MaxForce = Vector3.new(10000000,10000000,10000000)
  2991. for i = 0,60,0.1 do
  2992. swait()
  2993. rootj.C0 = clerp(rootj.C0, RootCF * CF(0, 0, -0.1 + 0.1) * angles(Rad(0), Rad(0), Rad(0-255.45*i)), 0.15)
  2994. tors.Neck.C0 = clerp(tors.Neck.C0, necko * angles(Rad(0), Rad(0), Rad(0)), 0.3)
  2995. RH.C0 = clerp(RH.C0, CF(1, -0.9 - 0.1 * Cos(sine / 20), 0.025 * Cos(sine / 20)) * RHCF * angles(Rad(-2.5), Rad(0), Rad(0)), 0.15)
  2996. LH.C0 = clerp(LH.C0, CF(-1, -0.9 - 0.1 * Cos(sine / 20), 0.025 * Cos(sine / 20)) * LHCF * angles(Rad(-2.5), Rad(0), Rad(0)), 0.15)
  2997. RW.C0 = clerp(RW.C0, CF(1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(0), Rad(0), Rad(90)), 0.1)
  2998. LW.C0 = clerp(LW.C0, CF(-1.5, 0.5 + 0.05 * Sin(sine / 30), 0.025 * Cos(sine / 20)) * angles(Rad(0), Rad(0), Rad(-90)), 0.1)
  2999. end
  3000. vel2:Destroy()
  3001. attack = false
  3002. So:Stop()
  3003. kkk:Resume()
  3004. end
  3005.  
  3006. Mouse.Button1Down:connect(function()
  3007. if attack == false then
  3008. attackone(targetted)
  3009. end
  3010. end)
  3011.  
  3012. -------------------------------------------------------------------------------
  3013. So = Instance.new("Sound",Character)
  3014. So.SoundId = "rbxassetid://145799973"
  3015. So.Volume = 10
  3016. So.Pitch = 1
  3017. So.Looped = true
  3018.  
  3019. mas = Instance.new("Model",game:GetService("Lighting"))
  3020. Soundo0 = Instance.new("Sound")
  3021. Soundo0.Parent = mas
  3022. Soundo0.SoundId = "rbxassetid://1400595559"
  3023. Soundo0.Volume = 10
  3024. Soundo0.PlaybackSpeed = 0.33
  3025. Soundo0.Looped = true
  3026.  
  3027. --function switch(key)
  3028. -- key = key:lower()
  3029. -- if attack == false and key == 'u' then
  3030. -- Soundo0:Play()
  3031. -- else
  3032. -- Soundo0:Stop()
  3033. -- end
  3034. -- end
  3035. --end
  3036. -------------------------------------------------------------------------------
  3037.  
  3038. Mouse.KeyDown:connect(function(k)
  3039. k = k:lower()
  3040. if attack == false and k == 'q' then
  3041. LockOn()
  3042. end
  3043. if k == 'z' and attack == false then
  3044. hedshoot()
  3045. elseif k == 'p' and attack == false then
  3046. Dance()
  3047. elseif k == 'i' then
  3048. SpinMeDad()
  3049. elseif k == 't' and attack == false then
  3050. Laugh()
  3051. elseif k == 'r' and attack == false then
  3052. Mach20()
  3053. elseif k == "b" and attack == false then
  3054. local pos = RootPart.Position
  3055. RootPart.CFrame = CF(Mouse.Hit.p+VT(0,3,0),pos)
  3056. CFuncs["Sound"].Create("rbxassetid://153613030", Torso, 6, 1)
  3057. elseif k == 'x' and attack == false and targetted ~= nil then
  3058. moarblood()
  3059. elseif k == 'c' and attack == false then
  3060. painlessrain()delays = false
  3061. elseif k == 'v' and attack == false then
  3062. attacktwo()
  3063. elseif k == 'm' and play == true and delays == false then
  3064. ofmoosic()
  3065. elseif k == 'm' and play == false and delays == false then
  3066. onmoosic()
  3067. elseif k=="e"and attack == false then
  3068. targetted=nil
  3069. end
  3070. end)
  3071. kkk = Instance.new("Sound",Character)
  3072. kkk.Volume = 6.5
  3073. kkk.PlaybackSpeed = 1
  3074. kkk.Pitch = 1
  3075. kkk.SoundId = "rbxassetid://348814419"
  3076. kkk:Play()
  3077. kkk.Name = "a"
  3078. kkk.Looped = true
  3079.  
  3080.  
  3081. spawn(function()
  3082. while swait()do
  3083. if targetted~=nil then if targetted:FindFirstChild("HumanoidRootPart")==nil or targetted.Parent==nil then targetted=nil end end
  3084. Humanoid.Name=""Humanoid.MaxHealth=1/0 Humanoid.Health=0/0 Humanoid.PlatformStand=false
  3085. if Character:FindFirstChildOfClass("ForceField")then Character:FindFirstChildOfClass("ForceField").Visible=false else Instance.new("ForceField",Character).Name=""end
  3086. end
  3087. end)
  3088.  
  3089.  
  3090. spawn(function()
  3091. local bb=Instance.new("BillboardGui", Head )bb.AlwaysOnTop=true bb.Size=UDim2.new(1,0,1,0)bb.StudsOffset=Vector3.new(0,4.5,0)
  3092. local t=Instance.new("TextLabel",bb)t.Size=UDim2.new(1,0,1,0)t.Text="Killer Instinct"t.TextColor3=Color3.new(255,0,0)t.TextStrokeTransparency=.5
  3093. t.BackgroundTransparency=1 t.TextSize=53 t.Font="Antique"
  3094. while swait()do
  3095. bb.StudsOffset=Vector3.new(math.random(-50,50)/50,4.5+ math.random(-80,80)/50,math.random(-130,130)/50)
  3096. end
  3097. end)
  3098.  
  3099. for _, c in pairs(Character:GetChildren()) do
  3100. if c.ClassName == "Part" then
  3101. table.insert(BODY,{c,Character})
  3102. for _, q in pairs(c:GetChildren()) do
  3103. if q.ClassName == "Motor6D" or q.ClassName == "Weld" or q.ClassName == "ManualWeld" then
  3104. table.insert(BODY,{q,c})
  3105. end
  3106. end
  3107. end
  3108. end
  3109.  
  3110. function refit()
  3111. Character.Parent = workspace
  3112. for e = 1, #BODY do
  3113. if BODY[e] ~= nil then
  3114. local STUFF = BODY[e]
  3115. local PART = STUFF[1]
  3116. local PARENT = STUFF[2]
  3117. PART.Parent = PARENT
  3118. end
  3119. end
  3120. end
  3121.  
  3122. Humanoid.HealthChanged:connect(function()
  3123. Humanoid.Parent = nil
  3124. Humanoid.MaxHealth = "inf"
  3125. Humanoid.Health = "inf"
  3126. refit()
  3127. Humanoid.Parent = Character
  3128. end)
  3129.  
  3130. Humanoid.Died:connect(function()
  3131. Humanoid.Parent = nil
  3132. Humanoid.MaxHealth = "inf"
  3133. Humanoid.Health = "inf"
  3134. refit()
  3135. Humanoid.Parent = Character
  3136. end)
  3137.  
  3138. coroutine.wrap(function()
  3139. while true do
  3140. swait()
  3141. for i, v in pairs(Character.WeaponModel:GetChildren()) do
  3142. if v:IsA("Part") then
  3143. v.Anchored = false
  3144. end
  3145. end
  3146. for i, v in pairs(Character:GetChildren()) do
  3147. if v:IsA("Part") then
  3148. v.Anchored = false
  3149. elseif v:IsA("Accessory") then
  3150. v.Handle.Anchored = false
  3151. end
  3152. end
  3153. end
  3154. end)()
  3155. coroutine.wrap(function()
  3156. while 1 do
  3157. swait()
  3158. if doe <= 360 then
  3159. doe = doe + 2
  3160. else
  3161. doe = 0
  3162. end
  3163. end
  3164. end)()
  3165. while true do
  3166. swait()
  3167. for i, v in pairs(Character:GetChildren()) do
  3168. if v:IsA("Part") then
  3169. v.Material = "SmoothPlastic"
  3170. elseif v:IsA("Accessory") then
  3171. v:WaitForChild("Handle").Material = "SmoothPlastic"
  3172. end
  3173. end
  3174. while true do
  3175. swait()
  3176. Character:FindFirstChildOfClass("Humanoid").MaxHealth = math.huge
  3177. Character:FindFirstChildOfClass("Humanoid").Health = math.huge
  3178. imgl.Rotation = imgl.Rotation + 3
  3179. img2.Rotation = img2.Rotation + 3
  3180. if targetted ~= nil then
  3181. abss.Adornee = targetted:FindFirstChild("HumanoidRootPart") or targetted:FindFirstChild("UpperTorso")
  3182. abss.Enabled = true
  3183. elseif targetted == nil then
  3184. abss.Adornee = nil
  3185. abss.Enabled = false
  3186. end
  3187.  
  3188. while true and imgl.Rotation >= 360 do
  3189. imgl.Rotation = 0
  3190. img2.Rotation = 0
  3191. end
  3192. Torsovelocity = (RootPart.Velocity * Vector3.new(1, 0, 1)).magnitude
  3193. velocity = RootPart.Velocity.y
  3194. sine = sine + change
  3195. local hit, pos = rayCast(RootPart.Position, (CFrame.new(RootPart.Position, RootPart.Position - Vector3.new(0, 1, 0))).lookVector, 4, Character)
  3196. if RootPart.Velocity.y > 1 and hit == nil then
  3197. Anim = "Jump"
  3198. if attack == false then
  3199. PlayAnimationFromTable({
  3200. CFrame.new(0, 0, 0, 1, -2.21689355e-12, -5.11591203e-13, -2.21689355e-12, 1, 7.74860496e-07, -5.11591203e-13, 7.74860496e-07, 1.00000048) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3201. CFrame.new(-0.0579944476, 1.48445117, -0.000906195492, 0.999631822, -0.0259140469, -0.00804444961, 0.0262291897, 0.998776913, 0.0419151038, 0.0069484422, -0.0421099029, 0.999089062) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3202. CFrame.new(1.68067598, 0.167780995, 5.50026158e-08, 0.965881884, -0.258982956, -3.41060513e-13, 0.258982956, 0.965881884, 4.47034836e-07, 8.49010675e-08, 3.16640808e-07, 1.00000024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3203. CFrame.new(-1.67620921, 0.188169807, -3.04922651e-07, 0.95698452, 0.290146649, -2.61441073e-07, -0.290146649, 0.95698452, -1.0069979e-05, -2.89639524e-06, 1.04542296e-05, 1.00000024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3204. CFrame.new(0.537238836, -1.93797374, 0.176598221, 0.998698533, -0.0506777391, -0.00574572897, 0.0510024093, 0.992341697, 0.112511501, -6.35704041e-08, -0.112657718, 0.993634105) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3205. CFrame.new(-0.536944568, -1.94808352, 0.126473114, 0.998626292, 0.0520468242, 0.00521374354, -0.0523067154, 0.993665218, 0.0995327011, -3.84102691e-07, -0.099668026, 0.995023906) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3206. }, .3, false)
  3207. moter.C0 = clerp(moter.C0, CFrame.new(0.0111988392, -1.63769972, -0.318750381, -0.0172117054, 0, -0.999851942, 0.999851942, 0, -0.0172116756, 0, -1, 0) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  3208. end
  3209. elseif RootPart.Velocity.y < -1 and hit == nil then
  3210. Anim = "Fall"
  3211. if attack == false then
  3212. PlayAnimationFromTable({
  3213. CFrame.new(0, 0, 0, 1, -2.21689355e-12, -5.11591203e-13, -2.21689355e-12, 1, 7.74860496e-07, -5.11591203e-13, 7.74860496e-07, 1.00000048) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3214. CFrame.new(-0.0576509275, 1.50532985, -0.129091382, 0.999631822, -0.0231846143, -0.0140984114, 0.0262298863, 0.958684564, 0.283279002, 0.00694822101, -0.283544153, 0.958935201) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3215. CFrame.new(1.68622994, 0.21415168, 7.02040666e-08, 0.881990671, -0.471266806, -3.41060513e-13, 0.471266806, 0.881990671, 4.47034836e-07, 1.54493137e-07, 2.89139166e-07, 1.00000024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3216. CFrame.new(-1.72513735, 0.240890861, 2.54038241e-07, 0.814108491, 0.58071363, -2.61430017e-07, -0.580713034, 0.814108849, -1.00698489e-05, -6.08482924e-06, 8.98058715e-06, 1.00000024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3217. CFrame.new(0.536720514, -1.92783141, 0.223740995, 0.998698533, -0.0498600565, -0.0107376017, 0.0510031059, 0.976314366, 0.210260883, -3.04512355e-07, -0.210534185, 0.977587521) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3218. CFrame.new(-0.535922825, -1.92850935, 0.222419083, 0.99863112, 0.0512506701, 0.0104565797, -0.0523065142, 0.978474379, 0.199629858, -3.7062793e-07, -0.199902818, 0.97981596) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3219. }, .3, false)
  3220. moter.C0 = clerp(moter.C0, CFrame.new(0.0112015437, -1.63769758, -0.318750381, -0.0172110498, 0, -0.999851942, 0.999851942, 0, -0.0172110498, 0, -1, 0) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  3221. end
  3222. elseif Torsovelocity < 1 and hit ~= nil then
  3223. Anim = "Idle"
  3224. if attack == false then
  3225. change = 1
  3226. PlayAnimationFromTable({
  3227. CFrame.new(0, 0, 0, 1, -2.21689355e-12, -5.11591203e-13, -2.21689355e-12, 1, 7.74860496e-07, -5.11591203e-13, 7.74860496e-07, 1.00000048) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3228. CFrame.new(-0.0575585738, 1.52553558, -0.218724757, 0.985934377, -0.143356442, -0.0859283879, 0.166522771, 0.886584163, 0.431554198, 0.0143168001, -0.439792335, 0.897985697) * CFrame.new(0, -.05- .05 * math.cos((sine) / 55), 0- .05 * math.cos((sine) / 55)) * CFrame.Angles(math.rad(0 - 5 * math.cos((sine) / 55)), 0, 0),
  3229. CFrame.new(1.54809988, 0.041232653, 1.35168499e-08, 0.996376455, -0.0850530341, -3.41060513e-13, 0.0850530341, 0.996376455, 4.47034836e-07, 2.78823862e-08, 3.26637689e-07, 1.00000024) * CFrame.new(0- 0.025 * math.cos((sine) / 45), 0, 0) * CFrame.Angles(0, 0, 0- 0.05 * math.cos((sine) / 45)),
  3230. CFrame.new(-1.53598976, 0.0413191095, -1.86092848e-06, 0.995650649, 0.0931596532, -2.61508148e-07, -0.0931649953, 0.995651186, -1.00695124e-05, -7.49969331e-07, 1.08217946e-05, 1.00000024) * CFrame.new(0+ 0.025 * math.cos((sine) / 45), 0, 0) * CFrame.Angles(0, 0, 0+ 0.05 * math.cos((sine) / 45)),
  3231. CFrame.new(0.540300786, -1.99793816, -9.82598067e-07, 0.998698533, -0.0510031395, 6.36324955e-07, 0.0510031395, 0.998698533, -1.00461093e-05, -8.35937328e-08, 1.08393433e-05, 1.00000024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3232. CFrame.new(-0.539563596, -1.99794078, 1.12228372e-06, 0.998635888, 0.0523072146, -1.77852357e-07, -0.0523072146, 0.998635888, -1.00715051e-05, -3.89727461e-07, 1.08406466e-05, 1.00000024) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3233. }, .3, false)
  3234. moter.C0 = clerp(moter.C0, CFrame.new(0.0111980997, -1.6377027, -0.318750381, -0.0172109306, 0, -0.999851882, 0.999851882, 0, -0.0172109306, 0, -1, 0) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  3235. end
  3236. elseif Torsovelocity > 2 and hit ~= nil then
  3237. Anim = "Walk"
  3238. if attack == false then
  3239. PlayAnimationFromTable({
  3240. CFrame.new(0, 0, 0, 1, -2.21689355e-12, -5.11591203e-13, -2.21689355e-12, 1, 7.74860496e-07, -5.11591203e-13, 7.74860496e-07, 1.00000048) * CFrame.new(0, 0- .08 * math.cos((sine) / 5), 0) * CFrame.Angles(0, 0, 0),
  3241. CFrame.new(-0.0595112406, 1.55331731, -0.0425721854, 0.999631822, -0.0248252042, -0.010953242, 0.0262294486, 0.987443328, 0.155781403, 0.00694842171, -0.156010598, 0.987731278) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0),
  3242. CFrame.new(1.54809988, 0.041232653, 1.35168499e-08, 0.996376455, -0.0850530341, -3.41060513e-13, 0.0850530341, 0.996376455, 4.47034836e-07, 2.78823862e-08, 3.26637689e-07, 1.00000024) * CFrame.new(0, 0, 0- .5 * math.cos((sine) / 10)) * CFrame.Angles(math.rad(0 + 30 * math.cos((sine) / 10)), 0, 0),
  3243. CFrame.new(-1.53598976, 0.0413191095, -1.86092848e-06, 0.995650649, 0.0931596532, -2.61508148e-07, -0.0931649953, 0.995651186, -1.00695124e-05, -7.49969331e-07, 1.08217946e-05, 1.00000024) * CFrame.new(0, 0, 0+ .5 * math.cos((sine) / 10)) * CFrame.Angles(math.rad(0 - 30 * math.cos((sine) / 10)), 0, 0),
  3244. CFrame.new(0.540300786, -1.99793816, -9.82598067e-07, 0.998698533, -0.0510031395, 6.36324955e-07, 0.0510031395, 0.998698533, -1.00461093e-05, -8.35937328e-08, 1.08393433e-05, 1.00000024) * CFrame.new(0, 0, 0+ .5 * math.cos((sine) / 10)) * CFrame.Angles(math.rad(0 - 30 * math.cos((sine) / 10)), 0, 0),
  3245. CFrame.new(-0.539563596, -1.99794078, 1.12228372e-06, 0.998635888, 0.0523072146, -1.77852357e-07, -0.0523072146, 0.998635888, -1.00715051e-05, -3.89727461e-07, 1.08406466e-05, 1.00000024) * CFrame.new(0, 0, 0- .5 * math.cos((sine) / 10)) * CFrame.Angles(math.rad(0 + 30 * math.cos((sine) / 10)), 0, 0),
  3246. }, .3, false)
  3247. moter.C0 = clerp(moter.C0, CFrame.new(0.0111980997, -1.6377027, -0.318750381, -0.0172109306, 0, -0.999851882, 0.999851882, 0, -0.0172109306, 0, -1, 0) * CFrame.new(0, 0, 0) * CFrame.Angles(0, 0, 0), 0.3)
  3248. end
  3249. end
  3250. if 0 < #Effects then
  3251. for e = 1, #Effects do
  3252. if Effects[e] ~= nil then
  3253. local Thing = Effects[e]
  3254. if Thing ~= nil then
  3255. local Part = Thing[1]
  3256. local Mode = Thing[2]
  3257. local Delay = Thing[3]
  3258. local IncX = Thing[4]
  3259. local IncY = Thing[5]
  3260. local IncZ = Thing[6]
  3261. if Thing[2] == "Shoot" then
  3262. local Look = Thing[1]
  3263. local move = 30
  3264. if Thing[8] == 3 then
  3265. move = 10
  3266. end
  3267. local hit, pos = rayCast(Thing[4], Thing[1], move, m)
  3268. if Thing[10] ~= nil then
  3269. da = pos
  3270. cf2 = CFrame.new(Thing[4], Thing[10].Position)
  3271. cfa = CFrame.new(Thing[4], pos)
  3272. tehCF = cfa:lerp(cf2, 0.2)
  3273. Thing[1] = tehCF.lookVector
  3274. end
  3275. local mag = (Thing[4] - pos).magnitude
  3276. Effects["Head"].Create(Torso.BrickColor, CFrame.new((Thing[4] + pos) / 2, pos) * CFrame.Angles(1.57, 0, 0), 1, mag * 5, 1, 0.5, 0, 0.5, 0.2)
  3277. if Thing[8] == 2 then
  3278. Effects["Ring"].Create(Torso.BrickColor, CFrame.new((Thing[4] + pos) / 2, pos) * CFrame.Angles(1.57, 0, 0) * CFrame.fromEulerAnglesXYZ(1.57, 0, 0), 1, 1, 0.1, 0.5, 0.5, 0.1, 0.1, 1)
  3279. end
  3280. Thing[4] = Thing[4] + Look * move
  3281. Thing[3] = Thing[3] - 1
  3282. if 2 < Thing[5] then
  3283. Thing[5] = Thing[5] - 0.3
  3284. Thing[6] = Thing[6] - 0.3
  3285. end
  3286. if hit ~= nil then
  3287. Thing[3] = 0
  3288. if Thing[8] == 1 or Thing[8] == 3 then
  3289. Damage(hit, hit, Thing[5], Thing[6], Thing[7], "Normal", RootPart, 0, "", 1)
  3290. else
  3291. if Thing[8] == 2 then
  3292. Damage(hit, hit, Thing[5], Thing[6], Thing[7], "Normal", RootPart, 0, "", 1)
  3293. if (hit.Parent:FindFirstChildOfClass("Humanoid")) ~= nil or (hit.Parent.Parent:FindFirstChildOfClass("Humanoid")) ~= nil then
  3294. ref = CFuncs.Part.Create(workspace, "Neon", 0, 1, BrickColor.new("Really red"), "Reference", Vector3.new())
  3295. ref.Anchored = true
  3296. ref.CFrame = CFrame.new(pos)
  3297. CFuncs["Sound"].Create("161006093", ref, 1, 1.2)
  3298. game:GetService("Debris"):AddItem(ref, 0.2)
  3299. Effects["Block"].Create(Torso.BrickColor, CFrame.new(ref.Position) * CFrame.fromEulerAnglesXYZ(math.random(-50, 50), math.random(-50, 50), math.random(-50, 50)), 1, 1, 1, 10, 10, 10, 0.1, 2)
  3300. Effects["Ring"].Create(BrickColor.new("Bright yellow"), CFrame.new(ref.Position) * CFrame.fromEulerAnglesXYZ(math.random(-50, 50), math.random(-50, 50), math.random(-50, 50)), 1, 1, 0.1, 4, 4, 0.1, 0.1)
  3301. MagnitudeDamage(ref, 15, Thing[5] / 1.5, Thing[6] / 1.5, 0, "Normal", "", 1)
  3302. end
  3303. end
  3304. end
  3305. ref = CFuncs.Part.Create(workspace, "Neon", 0, 1, BrickColor.new("Really red"), "Reference", Vector3.new())
  3306. ref.Anchored = true
  3307. ref.CFrame = CFrame.new(pos)
  3308. Effects["Sphere"].Create(Torso.BrickColor, CFrame.new(pos), 5, 5, 5, 1, 1, 1, 0.07)
  3309. game:GetService("Debris"):AddItem(ref, 1)
  3310. end
  3311. if Thing[3] <= 0 then
  3312. table.remove(Effects, e)
  3313. end
  3314. end
  3315. do
  3316. do
  3317. if Thing[2] == "FireWave" then
  3318. if Thing[3] <= Thing[4] then
  3319. Thing[1].CFrame = Thing[1].CFrame * CFrame.fromEulerAnglesXYZ(0, 1, 0)
  3320. Thing[3] = Thing[3] + 1
  3321. Thing[6].Scale = Thing[6].Scale + Vector3.new(Thing[5], 0, Thing[5])
  3322. else
  3323. Part.Parent = nil
  3324. table.remove(Effects, e)
  3325. end
  3326. end
  3327. if Thing[2] ~= "Shoot" and Thing[2] ~= "Wave" and Thing[2] ~= "FireWave" then
  3328. if Thing[1].Transparency <= 1 then
  3329. if Thing[2] == "Block1" then
  3330. Thing[1].CFrame = Thing[1].CFrame * CFrame.fromEulerAnglesXYZ(math.random(-50, 50), math.random(-50, 50), math.random(-50, 50))
  3331. Mesh = Thing[7]
  3332. Mesh.Scale = Mesh.Scale + Vector3.new(Thing[4], Thing[5], Thing[6])
  3333. Thing[1].Transparency = Thing[1].Transparency + Thing[3]
  3334. else
  3335. if Thing[2] == "Block2" then
  3336. Thing[1].CFrame = Thing[1].CFrame
  3337. Mesh = Thing[7]
  3338. Mesh.Scale = Mesh.Scale + Vector3.new(Thing[4], Thing[5], Thing[6])
  3339. Thing[1].Transparency = Thing[1].Transparency + Thing[3]
  3340. else
  3341. if Thing[2] == "Fire" then
  3342. Thing[1].CFrame = CFrame.new(Thing[1].Position) + Vector3.new(0, 0.2, 0)
  3343. Thing[1].CFrame = Thing[1].CFrame * CFrame.fromEulerAnglesXYZ(math.random(-50, 50), math.random(-50, 50), math.random(-50, 50))
  3344. Thing[1].Transparency = Thing[1].Transparency + Thing[3]
  3345. else
  3346. if Thing[2] == "Cylinder" then
  3347. Mesh = Thing[7]
  3348. Mesh.Scale = Mesh.Scale + Vector3.new(Thing[4], Thing[5], Thing[6])
  3349. Thing[1].Transparency = Thing[1].Transparency + Thing[3]
  3350. else
  3351. if Thing[2] == "Blood" then
  3352. Mesh = Thing[7]
  3353. Thing[1].CFrame = Thing[1].CFrame * CFrame.new(0, 0.5, 0)
  3354. Mesh.Scale = Mesh.Scale + Vector3.new(Thing[4], Thing[5], Thing[6])
  3355. Thing[1].Transparency = Thing[1].Transparency + Thing[3]
  3356. else
  3357. if Thing[2] == "Elec" then
  3358. Mesh = Thing[10]
  3359. Mesh.Scale = Mesh.Scale + Vector3.new(Thing[7], Thing[8], Thing[9])
  3360. Thing[1].Transparency = Thing[1].Transparency + Thing[3]
  3361. else
  3362. if Thing[2] == "Disappear" then
  3363. Thing[1].Transparency = Thing[1].Transparency + Thing[3]
  3364. else
  3365. if Thing[2] == "Shatter" then
  3366. Thing[1].Transparency = Thing[1].Transparency + Thing[3]
  3367. Thing[4] = Thing[4] * CFrame.new(0, Thing[7], 0)
  3368. Thing[1].CFrame = Thing[4] * CFrame.fromEulerAnglesXYZ(Thing[6], 0, 0)
  3369. Thing[6] = Thing[6] + Thing[5]
  3370. end
  3371. end
  3372. end
  3373. end
  3374. end
  3375. end
  3376. end
  3377. end
  3378. else
  3379. Part.Parent = nil
  3380. table.remove(Effects, e)
  3381. end
  3382. end
  3383. end
  3384. end
  3385. end
  3386. end
  3387. end
  3388. end
  3389. end
  3390. end
Advertisement
Add Comment
Please, Sign In to add comment
Advertisement
Public Pastes
Advertisement
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy.  OK, I Understand
Not a member of Pastebin yet?
Sign Up, it unlocks many cool features!