API tools faq
paste
Advertisement
MarcAndrew

Untitled

MarcAndrew
Mar 25th, 2018
145
0
Never
Add comment
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 212.44 KB | None | 0 0
raw download clone embed print report diff
  1. local ContentProvider = game:GetService("ContentProvider")
  2.  
  3. local function LoadAssets(AssetList)
  4. -- Takes an asset list and preloads it. Will not wait for them to load.
  5.  
  6. for _, AssetId in pairs(AssetList) do
  7. ContentProvider:Preload("http://www.roblox.com/asset/?id=" .. AssetId)
  8. end
  9. end
  10.  
  11. LoadAssets({11442510,30956707})
  12. local Gibs = game.Workspace
  13.  
  14. function Kill(Character)
  15. Character.Humanoid.Health = 0
  16. local poo = Instance.new("IntValue",Character)
  17. poo.Name = "haha nope"
  18. local svch = Character
  19. local hum = Character:findFirstChild("Humanoid")
  20. Character.Archivable = true
  21. local chrclone = Character:clone()
  22. Character.Archivable = false
  23.  
  24. local ch = chrclone:GetChildren()
  25. local i
  26. for i = 1,#ch do
  27. if ch[i].Name == "THandle1" or ch[i].Name == "THandle2" or ch[i].ClassName == "Script" then
  28. ch[i]:remove()
  29. end
  30. end
  31. local function Scan(ch)
  32. local e
  33. for e = 1,#ch do
  34. Scan(ch[e]:GetChildren())
  35. if ch[e].ClassName == "Weld" or ch[e].ClassName == "Motor6D" then
  36. ch[e]:remove()
  37. end
  38. end
  39. end
  40. Scan(chrclone:GetChildren())
  41.  
  42. local hum2 = chrclone:findFirstChild("Humanoid")
  43.  
  44.  
  45. if hum2 ~= nil then
  46. hum2.Name = "Humanoid2"
  47. hum2.PlatformStand = true
  48. hum2.Sit = true
  49. hum2.MaxHealth = 0
  50. hum2.Health = 0
  51. end
  52.  
  53. local ch = Character:GetChildren()
  54. local i
  55. for i = 1,#ch do
  56. if ch[i].Name == "THandle1" or ch[i].Name == "THandle2" then
  57. ch[i]:remove()
  58. end
  59. end
  60.  
  61. wait(0.2)
  62.  
  63. local ch = Character:GetChildren()
  64. local i
  65. for i = 1,#ch do
  66. if ch[i].ClassName == "Part" or ch[i].ClassName == "Hat" or ch[i].Name == "THandle1" or ch[i].Name == "THandle2" then
  67. ch[i]:remove()
  68. end
  69. end
  70. Character = chrclone
  71. local Torso = Character.Torso
  72. local movevector = Vector3.new()
  73.  
  74. if Torso then
  75. local Head = Character:FindFirstChild("Head")
  76. local Limb = Character:FindFirstChild("Right Arm")
  77. if Limb then
  78.  
  79. Limb.CFrame = Torso.CFrame * CFrame.new(1.5, 0, 0)
  80. local Joint = Instance.new("Glue")
  81. Joint.Name = "RightShoulder"
  82. Joint.Part0 = Torso
  83. Joint.Part1 = Limb
  84. Joint.C0 = CFrame.new(1.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  85. Joint.C1 = CFrame.new(-0, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  86. Joint.Parent = Torso
  87.  
  88. local B = Instance.new("Part")
  89. B.TopSurface = 0
  90. B.BottomSurface = 0
  91. B.formFactor = "Symmetric"
  92. B.Size = Vector3.new(1, 1, 1)
  93. B.Transparency = 1
  94. B.CFrame = Limb.CFrame * CFrame.new(0, -0.5, 0)
  95. B.Parent = Character
  96. local W = Instance.new("Weld")
  97. W.Part0 = Limb
  98. W.Part1 = B
  99. W.C0 = CFrame.new(0, -0.5, 0)
  100. W.Parent = Limb
  101.  
  102. end
  103. local Limb = Character:FindFirstChild("Left Arm")
  104. if Limb then
  105.  
  106. Limb.CFrame = Torso.CFrame * CFrame.new(-1.5, 0, 0)
  107. local Joint = Instance.new("Glue")
  108. Joint.Name = "LeftShoulder"
  109. Joint.Part0 = Torso
  110. Joint.Part1 = Limb
  111. Joint.C0 = CFrame.new(-1.5, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  112. Joint.C1 = CFrame.new(0, 0.5, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  113. Joint.Parent = Torso
  114.  
  115. local B = Instance.new("Part")
  116. B.TopSurface = 0
  117. B.BottomSurface = 0
  118. B.formFactor = "Symmetric"
  119. B.Size = Vector3.new(1, 1, 1)
  120. B.Transparency = 1
  121. B.CFrame = Limb.CFrame * CFrame.new(0, -0.5, 0)
  122. B.Parent = Character
  123. local W = Instance.new("Weld")
  124. W.Part0 = Limb
  125. W.Part1 = B
  126. W.C0 = CFrame.new(0, -0.5, 0)
  127. W.Parent = Limb
  128.  
  129. end
  130. local Limb = Character:FindFirstChild("Right Leg")
  131. if Limb then
  132.  
  133. Limb.CFrame = Torso.CFrame * CFrame.new(0.5, -2, 0)
  134. local Joint = Instance.new("Glue")
  135. Joint.Name = "RightHip"
  136. Joint.Part0 = Torso
  137. Joint.Part1 = Limb
  138. Joint.C0 = CFrame.new(0.5, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  139. Joint.C1 = CFrame.new(0, 1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  140. Joint.Parent = Torso
  141.  
  142. local B = Instance.new("Part")
  143. B.TopSurface = 0
  144. B.BottomSurface = 0
  145. B.formFactor = "Symmetric"
  146. B.Size = Vector3.new(1, 1, 1)
  147. B.Transparency = 1
  148. B.CFrame = Limb.CFrame * CFrame.new(0, -0.5, 0)
  149. B.Parent = Character
  150. local W = Instance.new("Weld")
  151. W.Part0 = Limb
  152. W.Part1 = B
  153. W.C0 = CFrame.new(0, -0.5, 0)
  154. W.Parent = Limb
  155.  
  156. end
  157. local Limb = Character:FindFirstChild("Left Leg")
  158. if Limb then
  159.  
  160. Limb.CFrame = Torso.CFrame * CFrame.new(-0.5, -2, 0)
  161. local Joint = Instance.new("Glue")
  162. Joint.Name = "LeftHip"
  163. Joint.Part0 = Torso
  164. Joint.Part1 = Limb
  165. Joint.C0 = CFrame.new(-0.5, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  166. Joint.C1 = CFrame.new(-0, 1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  167. Joint.Parent = Torso
  168.  
  169. local B = Instance.new("Part")
  170. B.TopSurface = 0
  171. B.BottomSurface = 0
  172. B.formFactor = "Symmetric"
  173. B.Size = Vector3.new(1, 1, 1)
  174. B.Transparency = 1
  175. B.CFrame = Limb.CFrame * CFrame.new(0, -0.5, 0)
  176. B.Parent = Character
  177. local W = Instance.new("Weld")
  178. W.Part0 = Limb
  179. W.Part1 = B
  180. W.C0 = CFrame.new(0, -0.5, 0)
  181. W.Parent = Limb
  182.  
  183. end
  184. --[
  185. local Bar = Instance.new("Part")
  186. Bar.TopSurface = 0
  187. Bar.BottomSurface = 0
  188. Bar.formFactor = "Symmetric"
  189. Bar.Size = Vector3.new(1, 1, 1)
  190. Bar.Transparency = 1
  191. Bar.CFrame = Torso.CFrame * CFrame.new(0, 0.5, 0)
  192. Bar.Parent = Character
  193. local Weld = Instance.new("Weld")
  194. Weld.Part0 = Torso
  195. Weld.Part1 = Bar
  196. Weld.C0 = CFrame.new(0, 0.5, 0)
  197. Weld.Parent = Torso
  198. --]]
  199. end
  200. Character.Parent = Gibs
  201. game.Debris:AddItem(Character, 12)
  202. if movevector ~= Vector3.new() then
  203. for i = 1,10 do
  204. wait()
  205. Torso.Velocity = Vector3.new(0,0,-100)
  206. Head.Velocity = movevector * 200
  207. end
  208. end
  209. local duh = Torso
  210. ee = Instance.new("Part")
  211. ee.Anchored = false
  212. ee.CanCollide = false
  213. ee.Parent = duh
  214. ee.Transparency =1
  215. ee.Size = Vector3.new(0.15, 0.15, 0.15)
  216. wee = Instance.new("Weld")
  217. wee.Parent = duh
  218. wee.Part0 = duh
  219. wee.Part1 = ee
  220. wee.C0 = CFrame.new(0, 1, 0)
  221. ge = Instance.new('ParticleEmitter')
  222. ge.Parent = ee
  223. ge.Texture = "rbxassetid://29712167"
  224. ge.Size = NumberSequence.new(0.2,0.05)
  225. ge.Acceleration = Vector3.new(0, -20, 0)
  226. ge.Rate = 100000
  227. ge.Speed = NumberRange.new(7,8)
  228. ge.Lifetime = NumberRange.new(3,4)
  229. ge.VelocitySpread = 10
  230. ge.VelocityInheritance = 0.3
  231. ea = Instance.new("Part")
  232. ea.Anchored = false
  233. ea.CanCollide = false
  234. ea.Parent = Character.Head
  235. ea.Transparency =1
  236. ea.Size = Vector3.new(0.15, 0.15, 0.15)
  237. wea = Instance.new("Weld")
  238. wea.Parent = Character.Head
  239. wea.Part0 = Character.Head
  240. wea.Part1 = ea
  241. wea.C0 = CFrame.new(0, -0.7, 0)
  242. ga = Instance.new('ParticleEmitter')
  243. ga.Parent = ea
  244. ga.Texture = "rbxassetid://29712167"
  245. ga.Size = NumberSequence.new(0.2,0.05)
  246. ga.Acceleration = Vector3.new(0, -20, 0)
  247. ga.Rate = 100000
  248. ga.Speed = NumberRange.new(7,8)
  249. ga.Lifetime = NumberRange.new(3,4)
  250. ga.VelocitySpread = 10
  251. ga.VelocityInheritance = 0.3
  252. ga.EmissionDirection = Enum.NormalId.Bottom
  253. end
  254.  
  255. local plr = game.Players.LocalPlayer
  256. local chr = plr.Character
  257. local mouse = plr:GetMouse()
  258. local intro = coroutine.wrap(function()
  259. local gui = Instance.new('ScreenGui',plr.PlayerGui)
  260. gui.Name = "Intro"
  261. local fr = Instance.new('Frame',gui)
  262. fr.Size = UDim2.new(0.4,0,0,0)
  263. fr.Position = UDim2.new(0.3,0,-0.1,0)
  264. fr.BorderColor3 = Color3.fromRGB(198, 45, 45)
  265. fr.BorderSizePixel = 5
  266. fr.BackgroundColor3 = Color3.fromRGB(38, 38, 38)
  267. local title = Instance.new('TextLabel',fr)
  268. title.Size = UDim2.new(1,0,0.4,0)
  269. title.Position = UDim2.new(0,0,0.1,0)
  270. title.BackgroundTransparency = 1
  271. title.TextColor3 = Color3.fromRGB(198, 45, 45)
  272. title.TextScaled = true
  273. title.Text = 'Deadpool Script'
  274. local desc = Instance.new('TextLabel',fr)
  275. desc.Size = UDim2.new(1,0,0.5,0)
  276. desc.Position = UDim2.new(0,0,0.5,0)
  277. desc.BackgroundTransparency = 1
  278. desc.TextColor3 = Color3.fromRGB(198, 45, 45)
  279. desc.TextScaled = true
  280. desc.Text = ''
  281. wait(1)
  282. fr:TweenSize(UDim2.new(0.4,0,0.5,0),Enum.EasingDirection.Out,Enum.EasingStyle.Bounce,2)
  283. wait(2)
  284. local str = 'Hotkey to equip katana is N. Use Z to stab and X to slice heads off. Created by mustardfoot.'
  285. local leng = string.len(str)
  286. for i = 1,leng do
  287. desc.Text = string.sub(str,1,i)
  288. wait()
  289. end
  290. wait(2)
  291. fr:TweenSize(UDim2.new(0.4,0,0,0),Enum.EasingDirection.Out,Enum.EasingStyle.Bounce,0.8)
  292. wait(2)
  293. gui:Destroy()
  294. end)
  295. intro()
  296.  
  297.  
  298. wait(2)
  299. local tors = chr.Torso
  300. chr.Head.Transparency = 1
  301. for i,v in pairs(chr:GetChildren()) do
  302. if v.ClassName == "CharacterMesh" then
  303. v:Destroy()
  304. end
  305. end
  306. local humroot = chr.HumanoidRootPart:Clone()
  307. local torsclone = tors:Clone()
  308. local anim = chr.Animate:Clone()
  309. local hum = chr.Humanoid:Clone()
  310. local head = chr.Head:Clone()
  311. local neck = chr.Torso.Neck:Clone()
  312. local rightarm = chr["Right Arm"]:Clone()
  313. local leftarm = chr["Left Arm"]:Clone()
  314. local leftleg = chr["Left Leg"]:Clone()
  315. local rightleg = chr["Right Leg"]:Clone()
  316. local rightshoulder = tors["Right Shoulder"]:Clone()
  317. local leftshoulder = tors["Left Shoulder"]:Clone()
  318. local righthip = tors["Right Hip"]:Clone()
  319. local lefthip = tors["Left Hip"]:Clone()
  320. local shirt = nil
  321. local pants = nil
  322. local hats = {}
  323. local lastpos = CFrame.new(0,0,0)
  324. local on = true
  325. local doing = false
  326. local stabbing = false
  327. local slicing = false
  328. local toolz = Instance.new('Tool',plr.Backpack)
  329. toolz.Name = "Katana"
  330. toolz.RequiresHandle = false
  331. toolz.CanBeDropped = false
  332. local partz = Instance.new('Part',toolz)
  333. partz.Size = Vector3.new(0.2,0.2,3)
  334. partz.CanCollide = false
  335. local meshz = Instance.new('SpecialMesh',partz)
  336. meshz.MeshId = 'rbxassetid://11442510'
  337. meshz.TextureId = 'rbxassetid://11442524'
  338. meshz.VertexColor = Vector3.new(0,0,0)
  339.  
  340. toolz.Equipped:connect(function(mouse)
  341. if chr:FindFirstChild('Right Arm') then
  342. local weld = Instance.new('Weld',partz)
  343. weld.Part0 = partz
  344. weld.Part1 = chr["Right Arm"]
  345. weld.C0 = CFrame.new(0.9,0,-1.25)*CFrame.Angles(math.pi,0,-math.pi/2)
  346. end
  347. mouse.KeyDown:connect(function(key)
  348. if doing == false then
  349. if key == 'z' then
  350. if chr:FindFirstChild('Right Arm') and chr:FindFirstChild('Torso') then
  351. doing = true
  352. local weld = Instance.new('Weld',chr["Right Arm"])
  353. weld.Part0 = chr["Right Arm"]
  354. weld.Part1 = chr.Torso
  355. weld.C0 = CFrame.new(-1.5,0,0)
  356. for i=1,25 do
  357. weld.C0 = weld.C0:lerp(CFrame.new(-1.5,1,0.9)*CFrame.Angles(math.pi/2.5,0,-math.pi/2.5),i/25)
  358. wait()
  359. end
  360. wait()
  361. stabbing = true
  362. for i=1,10 do
  363. weld.C0 = weld.C0:lerp(CFrame.new(-1.5,0.8,0)*CFrame.Angles(-math.pi/4,0,-math.pi/6),i/10)
  364. wait()
  365. end
  366. wait()
  367. for i=1,25 do
  368. weld.C0 = weld.C0:lerp(CFrame.new(-1.5,0,0),i/25)
  369. wait()
  370. end
  371. chr["Right Arm"]:Destroy()
  372. doing = false
  373. stabbing = false
  374. end
  375. elseif key == 'x' then
  376. if chr:FindFirstChild('Right Arm') and chr:FindFirstChild('Torso') then
  377. doing = true
  378. local weld = Instance.new('Weld',chr["Right Arm"])
  379. weld.Part0 = chr["Right Arm"]
  380. weld.Part1 = chr.Torso
  381. weld.C0 = CFrame.new(-1.5,0,0)
  382. for i=1,25 do
  383. weld.C0 = weld.C0:lerp(CFrame.new(-0.5,0.7,-0.5)*CFrame.Angles(math.pi/8,math.pi/1,math.pi/1.5),i/25)
  384. wait()
  385. end
  386. wait()
  387. slicing = true
  388. for i=1,5 do
  389. weld.C0 = weld.C0:lerp(CFrame.new(-1.5,0.8,0)*CFrame.Angles(-math.pi/8,0,-math.pi/4),i/5)
  390. wait()
  391. end
  392. wait()
  393. for i=1,12.5 do
  394. weld.C0 = weld.C0:lerp(CFrame.new(-1.5,0,0),i/12.5)
  395. wait()
  396. end
  397. chr["Right Arm"]:Destroy()
  398. doing = false
  399. slicing = false
  400. end
  401. end
  402. end
  403. end)
  404. end)
  405.  
  406. partz.Touched:connect(function(hit)
  407. if hit.Parent:FindFirstChild('Humanoid') and stabbing and hit.Parent ~= chr then
  408. hit.Parent.Humanoid.Health = 0
  409. elseif hit.Parent:FindFirstChild('heck') == nil and slicing then
  410. local he = Instance.new('IntValue',hit.Parent)
  411. he.Name = "heck"
  412. Kill(hit.Parent)
  413. end
  414. end)
  415.  
  416. toolz.Unequipped:connect(function(mouse)
  417. if partz:FindFirstChildOfClass('Weld') then
  418. partz:FindFirstChildOfClass('Weld'):Destroy()
  419. end
  420. end)
  421. toolz.AncestryChanged:connect(function(child, parent)
  422. if parent ~= chr and parent ~= plr.Backpack then
  423. wait()
  424. toolz.Parent = plr.Backpack
  425. end
  426. end)
  427.  
  428. mouse.KeyDown:connect(function(key)
  429. if key == "n" then
  430. wait()
  431. toolz:Equip()
  432. end
  433. end)
  434. if chr:FindFirstChildOfClass('Shirt') then
  435. shirt = chr:FindFirstChildOfClass('Shirt'):Clone()
  436. end
  437. if chr:FindFirstChildOfClass('Pants') then
  438. pants = chr:FindFirstChildOfClass('Pants'):Clone()
  439. end
  440. for i,v in pairs(chr:GetChildren()) do
  441. if v.ClassName == "Accessory" then
  442. table.insert(hats,v:Clone())
  443. end
  444. end
  445. local rootjoint = chr.HumanoidRootPart.RootJoint:Clone()
  446. chr.Humanoid:Destroy()
  447. local gui = Instance.new('ScreenGui')
  448. gui.Parent = game.Players.LocalPlayer.PlayerGui
  449. gui.Name = "Deadpool"
  450. gui.ResetOnSpawn = false
  451. local frame = Instance.new('Frame',gui)
  452. frame.Size = UDim2.new(0.2,0,0.2,0)
  453. frame.Position = UDim2.new(0,0,0.9,0)
  454. frame.BackgroundColor3 = Color3.fromRGB(38, 38, 38)
  455. frame.BorderSizePixel = 4
  456. frame.BorderColor3 = Color3.fromRGB(198, 45, 45)
  457. frame.Active = true
  458. frame.Draggable = true
  459. local txt = Instance.new('TextLabel',frame)
  460. txt.Text = "Deadpool Gui"
  461. txt.TextColor3 = Color3.fromRGB(198, 45, 45)
  462. txt.Size = UDim2.new(1,0,0.3,0)
  463. txt.TextScaled = true
  464. txt.BackgroundTransparency = 1
  465. local but = Instance.new('TextButton',frame)
  466. but.Text = "Toggle Suit"
  467. but.TextColor3 = Color3.fromRGB(38, 38, 38)
  468. but.Size = UDim2.new(0.7,0,0.3,0)
  469. but.Position = UDim2.new(0.15,0,0.5,0)
  470. but.BorderSizePixel = 0
  471. but.TextScaled = true
  472. but.BackgroundColor3 = Color3.fromRGB(198, 45, 45)
  473. but.MouseButton1Down:connect(function()
  474. on = not on
  475. end)
  476. game:GetService('RunService').Stepped:connect(function()
  477. if chr.Parent == nil then
  478. chr.RobloxLocked = false
  479. chr.Parent = game.Workspace
  480. end
  481. if chr:FindFirstChildOfClass('Humanoid') == nil then
  482. hum:Clone().Parent = chr
  483. chr.Animate:Destroy()
  484. anim:Clone().Parent = chr
  485. end
  486. if chr:FindFirstChild('HumanoidRootPart') == nil then
  487. humroot:Clone().Parent = chr
  488. humroot.CFrame = lastpos
  489. chr.Humanoid:Destroy()
  490. hum:Clone().Parent = chr
  491. chr.Animate:Destroy()
  492. anim:Clone().Parent = chr
  493. chr.HumanoidRootPart.RootJoint:Destroy()
  494. end
  495. if chr:FindFirstChild('Torso') == nil then
  496. chr.Humanoid:Destroy()
  497. local tor = tors:Clone()
  498. tor.Parent = chr
  499. hum:Clone().Parent = chr
  500. chr.Animate:Destroy()
  501. anim:Clone().Parent = chr
  502. end
  503. if chr.HumanoidRootPart:FindFirstChild('RootJoint') == nil then
  504. local rtj = rootjoint:Clone()
  505. rtj.Parent = chr.HumanoidRootPart
  506. rtj.Part0 = chr.HumanoidRootPart
  507. rtj.Part1 = chr.Torso
  508. end
  509. if chr:FindFirstChild('Head') == nil then
  510. chr.Humanoid:Destroy()
  511. head:Clone().Parent = chr
  512. hum:Clone().Parent = chr
  513. chr.Animate:Destroy()
  514. anim:Clone().Parent = chr
  515. end
  516. if chr.Torso:FindFirstChild('Neck') == nil then
  517. chr.Humanoid:Destroy()
  518. local hec = neck:Clone()
  519. hec.Parent = chr.Torso
  520. hec.Part0 = chr.Torso
  521. hec.Part1 = chr.Head
  522. hum:Clone().Parent = chr
  523. chr.Animate:Destroy()
  524. anim:Clone().Parent = chr
  525. end
  526. if chr:FindFirstChild('Right Leg') == nil then
  527. rightleg:Clone().Parent = chr
  528. local fi = righthip:Clone()
  529. fi.Parent = chr.Torso
  530. fi.Part0 = chr.Torso
  531. fi.Part1 = chr["Right Leg"]
  532. end
  533. if chr:FindFirstChild('Right Arm') == nil then
  534. rightarm:Clone().Parent = chr
  535. local fi = rightshoulder:Clone()
  536. fi.Parent = chr.Torso
  537. fi.Part0 = chr.Torso
  538. fi.Part1 = chr["Right Arm"]
  539. end
  540. if chr:FindFirstChild('Left Leg') == nil then
  541. leftleg:Clone().Parent = chr
  542. local fi = lefthip:Clone()
  543. fi.Parent = chr.Torso
  544. fi.Part0 = chr.Torso
  545. fi.Part1 = chr["Left Leg"]
  546. end
  547. if chr:FindFirstChild('Left Arm') == nil then
  548. leftarm:Clone().Parent = chr
  549. local fi = leftshoulder:Clone()
  550. fi.Parent = chr.Torso
  551. fi.Part0 = chr.Torso
  552. fi.Part1 = chr["Left Arm"]
  553. end
  554. for i,v in pairs(chr:GetChildren()) do
  555. if v.Name == "Mask" or v.ClassName == "Accessory" or v.ClassName == "Shirt" or v.ClassName == "Pants" or v.Name == "KatanaHolder" then
  556. v:Destroy()
  557. end
  558. end
  559. chr.Humanoid.Health = chr.Humanoid.MaxHealth
  560. if partz:FindFirstChild('Weld') == nil and toolz.Parent == chr then
  561. local weld = Instance.new('Weld',partz)
  562. weld.Part0 = partz
  563. weld.Part1 = chr["Right Arm"]
  564. weld.C0 = CFrame.new(0.9,0,-1.25)*CFrame.Angles(math.pi,0,-math.pi/2)
  565. end
  566. lastpos = chr.HumanoidRootPart.CFrame
  567. local kat = Instance.new('Part',chr)
  568. kat.Size = Vector3.new(0.4,3,0.2)
  569. kat.Name = "KatanaHolder"
  570. kat.Material = Enum.Material.SmoothPlastic
  571. kat.BrickColor = BrickColor.new('Really black')
  572. kat.CanCollide = false
  573. local we = Instance.new('Weld',kat)
  574. we.Part0 = kat
  575. we.Part1 = chr.Torso
  576. we.C0 = CFrame.new(0,0,-0.5)*CFrame.Angles(0,0,0.5)
  577. if on == true then
  578. local shirt = Instance.new('Shirt',chr)
  579. shirt.ShirtTemplate = 'rbxassetid://411297870'
  580. local pants = Instance.new('Pants',chr)
  581. pants.PantsTemplate = 'rbxassetid://1004411703'
  582. local mask = Instance.new('Part',chr)
  583. mask.Name = "Mask"
  584. mask.Size = Vector3.new(2,1,1)
  585. mask.BrickColor = BrickColor.new('Bright red')
  586. local mesh = Instance.new('SpecialMesh',mask)
  587. mesh.Scale = Vector3.new(1.3,1.3,1.3)
  588. local weld = Instance.new('Weld',mask)
  589. weld.Part0 = mask
  590. weld.Part1 = chr.Head
  591. local eyesurround = Instance.new('Part',mask)
  592. eyesurround.BrickColor = BrickColor.new('Really black')
  593. eyesurround.Size = Vector3.new(0.3,0.5,0.2)
  594. local mesh2 = Instance.new('SpecialMesh',eyesurround)
  595. mesh2.MeshType = Enum.MeshType.Sphere
  596. mesh2.Scale = Vector3.new(1,1,0.5)
  597. local weld2 = Instance.new('Weld',eyesurround)
  598. weld2.Part0 = eyesurround
  599. weld2.Part1 = mask
  600. weld2.C0 = CFrame.new(0.1,-0.22,0.58)*CFrame.Angles(0,0,-0.2)
  601. local eyesurround2 = Instance.new('Part',mask)
  602. eyesurround2.BrickColor = BrickColor.new('Really black')
  603. eyesurround2.Size = Vector3.new(0.3,0.5,0.2)
  604. local mesh3 = Instance.new('SpecialMesh',eyesurround2)
  605. mesh3.MeshType = Enum.MeshType.Sphere
  606. mesh3.Scale = Vector3.new(1,1,0.5)
  607. local weld3 = Instance.new('Weld',eyesurround2)
  608. weld3.Part0 = eyesurround2
  609. weld3.Part1 = mask
  610. weld3.C0 = CFrame.new(-0.1,-0.22,0.58)*CFrame.Angles(0,0,0.2)
  611. local eye = Instance.new('Part',mask)
  612. eye.BrickColor = BrickColor.new('Institutional white')
  613. eye.Size = Vector3.new(0.2,0.2,0.2)
  614. local mesh4 = Instance.new('SpecialMesh',eye)
  615. mesh4.MeshType = Enum.MeshType.Sphere
  616. mesh4.Scale = Vector3.new(1,1,0.5)
  617. local weld4 = Instance.new('Weld',eye)
  618. weld4.Part0 = eye
  619. weld4.Part1 = mask
  620. weld4.C0 = CFrame.new(0.1,-0.22,0.59)*CFrame.Angles(0,0,-0.2)
  621. local eye2 = Instance.new('Part',mask)
  622. eye2.BrickColor = BrickColor.new('Institutional white')
  623. eye2.Size = Vector3.new(0.2,0.2,0.2)
  624. local mesh5 = Instance.new('SpecialMesh',eye2)
  625. mesh5.MeshType = Enum.MeshType.Sphere
  626. mesh5.Scale = Vector3.new(1,1,0.5)
  627. local weld5 = Instance.new('Weld',eye2)
  628. weld5.Part0 = eye2
  629. weld5.Part1 = mask
  630. weld5.C0 = CFrame.new(-0.1,-0.22,0.59)*CFrame.Angles(0,0,0.2)
  631. else
  632. chr.Head.Transparency = 0
  633. if shirt ~= nil then
  634. shirt:Clone().Parent = chr
  635. end
  636. if pants ~= nil then
  637. pants:Clone().Parent = chr
  638. end
  639. for i,v in pairs(hats) do
  640. v:Clone().Parent = chr
  641. end
  642. end
  643. end)
  644.  
  645.  
  646.  
  647.  
  648.  
  649.  
  650.  
  651.  
  652. --[[
  653. Smith and Wesson M&P 45, chambered in .45 ACP ammunition.
  654. The standard magazine holds 10 rounds, although magazines that could hold 14 rounds were also made but looked incredibly stupid.
  655. Credit to litozinnamon for the crosshairs and bullethole decals. I used them without permission. Not like I asked him, anyhow.
  656. ]]
  657.  
  658. plr=game:service'Players'.LocalPlayer
  659. ch,char=plr.Character,plr.Character
  660. hum=ch.Humanoid
  661. tor,torso,rootpart,rj=ch.Torso,ch.Torso,ch.HumanoidRootPart,ch.HumanoidRootPart.RootJoint
  662. m,mouse=plr:GetMouse(),plr:GetMouse()
  663. cfn,ang,mr,int=CFrame.new,CFrame.Angles,math.rad,Instance.new
  664. bc=BrickColor.new
  665. head=ch.Head
  666. cam=workspace.CurrentCamera
  667.  
  668. rj.C0=cfn()
  669. rj.C1=cfn()
  670.  
  671. sheathed=false
  672. jammed=false
  673.  
  674.  
  675.  
  676.  
  677.  
  678.  
  679.  
  680.  
  681.  
  682.  
  683.  
  684. local minimumsize = Vector3.new(0.7,0.7,0.7) --Minimumsize for a part to get divided,higher numbers = less detailed and bigger/less bricks
  685. local surface_between_splitted_parts = 'SmoothNoOutlines' --the surface between splitted parts
  686. --local fragmented = workspace:FindFirstChild("Fragmented")
  687. local fragmentable = workspace --all fragmentable objects should be stored in here
  688. local list = {}
  689. local brickcount = 0
  690. --local m = Instance.new("Hint",workspace)
  691. local storage = {}
  692. local fillup = 1000 --it constantly generates new parts until it reaches this number(hacky way to prevent lagspikes if there is a large explosion),change it to 0 if you don´t want it to generate (useless) parts.
  693. local maximumstorage = 2000 --it will recycle parts if the number of parts in the storage doesnt exceed this number
  694. local storage_position = Vector3.new(0,0,5000) --place them somewhere off the map
  695. local stored_partsize = Vector3.new(1,1,1) --make them small
  696. local parts_created_per_frame = 5 --number of parts being created per frame to fill up the storage
  697.  
  698.  
  699. function fragmentate(cframe,size,color,explosion_position,explosion_blastradius,backsurface,bottomsurface,frontsurface,leftsurface,rightsurface,topsurface,transparency,reflectance)
  700. local xi = size.X >= minimumsize.X*(1+explosion_blastradius/16) and 2 or 1 --to reduce the lagg in large explosions we increase minimumsize based on the explosionradius...
  701. local yi = size.Y >= minimumsize.Y*(1+explosion_blastradius/16) and 2 or 1
  702. local zi = size.Z >= minimumsize.Z*(1+explosion_blastradius/16) and 2 or 1
  703. if xi == 1 and yi == 1 and zi == 1 or (cframe.p-explosion_position).magnitude > size.magnitude/2 + explosion_blastradius then --don´t fragmentate parts, that are too small to fragmentate or too far away from the explosion
  704. if xi == 1 and yi == 1 and zi == 1 then return end --optional
  705. if #storage > 0 then
  706. local p = storage[1]
  707. p.BrickColor = color
  708. p.Size = size
  709. p.BackSurface = backsurface
  710. p.BottomSurface = bottomsurface
  711. p.FrontSurface = frontsurface
  712. p.LeftSurface = leftsurface
  713. p.RightSurface = rightsurface
  714. p.TopSurface = topsurface
  715. p.Transparency = transparency
  716. p.CFrame = cframe
  717. p.Reflectance = reflectance
  718. table.remove(storage,1)
  719. else
  720. local p = Instance.new("Part",fragmentable)
  721. p.BrickColor = color
  722. p.FormFactor = "Custom"
  723. p.Size = size
  724. p.BackSurface = backsurface
  725. p.BottomSurface = bottomsurface
  726. p.FrontSurface = frontsurface
  727. p.LeftSurface = leftsurface
  728. p.RightSurface = rightsurface
  729. p.TopSurface = topsurface
  730. p.Transparency = transparency
  731. if p.Transparency>0.285 then
  732. p.Anchored = false
  733. else
  734. p.Anchored=true
  735. p.Material='Wood'
  736. end
  737. p.CFrame = cframe
  738. p.Reflectance = reflectance
  739. end
  740. --p:MakeJoints()
  741. -- m.Text = m.Text+1
  742. return --stop the function
  743. end
  744. local mody = math.random(-125,125)/1000 --some randomization
  745. for y = 1,yi do
  746. if math.random()> 0.5 then
  747. local modx = math.random(-125,125)/1000
  748. for x = 1,xi do
  749. local modz = math.random(-125,125)/1000
  750. for z = 1,zi do --offset = x/xi-0.75+modx)
  751. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)), --maths
  752. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  753. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z or agent767_was_here),color,explosion_position,explosion_blastradius,
  754. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  755. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  756. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  757. end
  758.  
  759. end
  760. else
  761. local modz = math.random(-125,125)/1000
  762. for z = 1,zi do
  763. local modx = math.random(-125,125)/1000
  764. for x = 1,xi do
  765. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)),
  766. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  767. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z),color,explosion_position,explosion_blastradius,
  768. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  769. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  770. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  771. end
  772. end
  773. end
  774. end
  775. end
  776.  
  777. function start_fragmentation(position,radius)
  778. local search = Region3.new(position-Vector3.new(radius,radius,radius)*1.1,position+Vector3.new(radius,radius,radius)*1.1)
  779. repeat
  780. local finish = false
  781. local parts = workspace:FindPartsInRegion3WithIgnoreList(search,list,100) --maximum number of parts that FindPartsInRegion3 can find is 100, so we have to do this to find them all
  782. for i = 1,#parts do
  783. table.insert(list,1,parts[i])
  784. end
  785. finish = true
  786. until #parts < 100 and finish
  787. print(#list)
  788. local t = tick()
  789. for i = 1,#list do
  790. local p = list[i]
  791. if p:IsDescendantOf(fragmentable) and p:GetMass()<3000 and p.Transparency>0.285 and p.Name~='Base' and p:IsDescendantOf(ch)==false then
  792. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  793. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  794. p.Anchored = false
  795. p.FormFactor = "Custom"
  796. p.Size = stored_partsize
  797. p.Position = storage_position
  798. table.insert(storage,1,p)
  799. else --storage is full
  800. p:Destroy()
  801. end
  802. -- m.Text = m.Text-1
  803. end
  804. if p:IsDescendantOf(fragmentable) and p:GetMass()<53000 and p.Transparency<0.05 and p.Name~='Base' and tostring(p.Material)=='Enum.Material.Wood' and p:IsDescendantOf(ch)==false then
  805. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  806. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  807. p.Anchored = true
  808. p.Material='Wood'
  809. p.FormFactor = "Custom"
  810. p.Size = stored_partsize
  811. p.Position = storage_position
  812. table.insert(storage,1,p)
  813. else --storage is full
  814. p:Destroy()
  815. end
  816. -- m.Text = m.Text-1
  817. end
  818. end
  819. list = {}
  820. -- print(tick()-t)
  821. end
  822.  
  823. --[[
  824. spawn(function()
  825. while wait() do --oh noes,a loop! So inefficient!
  826. if #storage < fillup then
  827. for i = 1, parts_created_per_frame do --creates parts to fill up the storage
  828. local p = Instance.new("Part",fragmentable)
  829. p.Anchored = false
  830. p.FormFactor = "Custom"
  831. p.Size = stored_partsize
  832. p.Position = storage_position
  833. table.insert(storage,1,p)
  834. end
  835. end
  836. end
  837. end)
  838. ]]
  839.  
  840.  
  841.  
  842.  
  843.  
  844.  
  845.  
  846.  
  847.  
  848.  
  849.  
  850.  
  851.  
  852.  
  853.  
  854.  
  855.  
  856.  
  857.  
  858.  
  859.  
  860.  
  861.  
  862. --local blankn=22416261
  863.  
  864. --172121567
  865.  
  866. crosshairs={
  867. {38140824};
  868. {38140833};
  869. {38140839};
  870. {38140843};
  871. {38140852};
  872. {38140910};
  873. {38140915};
  874. {38140923};
  875. {38140928};
  876. {38140931};
  877. {38208259};
  878. {38208275};
  879. {38208284};
  880. {38208303};
  881. {38208310};
  882. {38208325};
  883. {38208330};
  884. {38208352};
  885. {38208359};
  886. {38208377}
  887. }
  888.  
  889. bulletholes={
  890. 172274695;
  891. 172274721
  892. }
  893.  
  894. for _,v in pairs(crosshairs) do
  895. game:service'ContentProvider':Preload('rbxassetid://' .. tostring(v[1]-1))
  896. end
  897.  
  898. currentIco=2
  899. switchIco=function(num)
  900. if num<20 then
  901. else
  902. num=20
  903. end
  904. mouse.Icon='rbxassetid://' .. tostring(crosshairs[num][1]-1)
  905. currentIco=num
  906. end
  907.  
  908. switchIco(currentIco)
  909.  
  910. heldDown=false
  911.  
  912. spreadint=1
  913. --[[Settings]]--
  914. recoil=false -- Set to true for added realism
  915. magCapacity=20 -- How much a magazine can hold at once
  916. magAmmo=20 -- How much ammo is in the mag
  917. crosshairSpread=5
  918. spread=1
  919. pAmmunition=true -- more damage if true
  920.  
  921.  
  922. jamRate=500 -- How often the gun jams(the more the less) (no less than 1)
  923.  
  924. primaryColor='Really black'
  925. secondaryColor='Really black'
  926.  
  927. slideReflectance=0.01
  928. slideMaterial='Plastic'
  929.  
  930. --[[Attachments]]--
  931.  
  932. silencer=true
  933. highCapMag=false -- High capacity magazine
  934. laser=true
  935. automatic=false
  936. grip=true
  937.  
  938.  
  939. getSound=function(id)
  940. game:service'ContentProvider':Preload('rbxassetid'..tostring(id))
  941. local s=int("Sound",ch.Head)
  942. s.SoundId='rbxassetid://' .. tostring(id)
  943. s.Volume=1
  944. return s
  945. end
  946.  
  947. local fireSound=getSound(151997297--[[10209842]])
  948. fireSound.Pitch=1.3
  949. --1.8
  950.  
  951. local releaseSound=getSound(10209813)
  952. releaseSound.Pitch=4
  953.  
  954. local reloadSound=getSound(10209636)
  955. reloadSound.Pitch=3
  956.  
  957. local magazinelockSound=getSound(152206337)
  958. magazinelockSound.Pitch=1.4
  959.  
  960. local slideBackSound=getSound(152206263)
  961. slideBackSound.Pitch=2.5
  962.  
  963. local slideForwardSound=getSound(152206302)
  964. slideForwardSound.Pitch=2.5
  965.  
  966. local emptySound=getSound(2697295)
  967. emptySound.Pitch=5
  968.  
  969. local glassBreakSound=getSound(144884907)
  970.  
  971. local woodImpact=getSound(142082171)
  972.  
  973. local fleshImpact=getSound(144884872)
  974. fleshImpact.Pitch=1.7
  975.  
  976. if ch:findFirstChild("Tec-99") then
  977. ch['Tec-99']:Destroy()
  978. end
  979.  
  980. local tube=int("Model",ch)
  981. tube.Name='Tec-99'
  982. local hopper=Instance.new('HopperBin',plr.Backpack)
  983. hopper.Name=tube.Name
  984. Weld = function(p0,p1,x,y,z,rx,ry,rz,par)--recommend to use this with my weld. use this function only with arm lockers.
  985. p0.Position = p1.Position
  986. local w = Instance.new('Motor',par or p0)
  987. w.Part0 = p1
  988. w.Part1 = p0
  989. w.C0 = CFrame.new(x or 0,y or 0,z or 0)*CFrame.Angles(rx or 0,ry or 0,rz or 0)
  990. w.MaxVelocity = .1
  991. return w
  992. end
  993. function clerp(c1,c2,sp)
  994. local R1,R2,R3 = c1:toEulerAnglesXYZ()
  995. local R21,R22,R23 = c2:toEulerAnglesXYZ()
  996. return CFrame.new(
  997. c1.X + (c2.X-c1.X)*sp,
  998. c1.Y + (c2.Y-c1.Y)*sp,
  999. c1.Z + (c2.Z-c1.Z)*sp)*CFrame.Angles(
  1000. R1 + (R21-R1)*sp,
  1001. R2 + (R22-R2)*sp,
  1002. R3 + (R23-R3)*sp
  1003. )
  1004. end
  1005.  
  1006. tweenTable={}
  1007. Tween = function(Weld, Stop, Step,a)
  1008. ypcall(function()
  1009. local func = function()
  1010. local Start = Weld.C1
  1011. local X1, Y1, Z1 = Start:toEulerAnglesXYZ()
  1012. local Stop = Stop
  1013. local X2, Y2, Z2 = Stop:toEulerAnglesXYZ()
  1014. if not Step then Step=0.1 end
  1015. table.insert(tweenTable,{th=0,Weld=Weld,Step=Step,Start=Start,X1=X1,Y1=Y1,Z1=Z1,Stop=Stop,X2=X2,Y2=Y2,Z2=Z2})
  1016. end
  1017. if a then coroutine.wrap(func)() else func() end
  1018. end)
  1019. end
  1020. weld=function(p0,p1,c0)
  1021. local w=Instance.new("Weld",p0)
  1022. w.Part0=p0
  1023. w.Part1=p1
  1024. w.C0=c0
  1025. return w
  1026. end
  1027. cp=function(parent,color,size,anchored,cancollide)
  1028. local newp=Instance.new("Part",parent)
  1029. newp.TopSurface='SmoothNoOutlines'
  1030. newp.BottomSurface='SmoothNoOutlines'
  1031. newp.FrontSurface='SmoothNoOutlines'
  1032. newp.BackSurface='SmoothNoOutlines'
  1033. newp.RightSurface='SmoothNoOutlines'
  1034. newp.LeftSurface='SmoothNoOutlines'
  1035. newp.FormFactor="Custom"
  1036. newp.BrickColor=bc(color)
  1037. newp.Size=size
  1038. newp.Anchored=anchored
  1039. newp.CanCollide=cancollide
  1040. newp:BreakJoints()
  1041. return newp
  1042. end
  1043.  
  1044. initializeJoints=function()
  1045. rabr = cp(tube,'White',Vector3.new(1,1,1),false,false) rabr.Transparency = 1 rabr.Name='Locker'
  1046. rabr.Position = torso.Position
  1047. rw = Weld(rabr,torso,1.5,.5,0,0,0,0) rw.Parent = tube rw.Name = 'rw'
  1048. w = Instance.new("Weld",tube)
  1049. w.Part0,w.Part1 = ch['Right Arm'],rabr
  1050. w.C1 = CFrame.new(0,-.5,0)
  1051. labr = cp(tube,'White',Vector3.new(1,1,1),false,false) labr.Transparency = 1 labr.Name='Locker'
  1052. labr.Position = torso.Position
  1053. lw = Weld(labr,torso,-1.5,.5,0,0,0,0) lw.Parent = tube lw.Name = 'lw'
  1054. ww = Instance.new("Weld",tube)
  1055. ww.Part0,ww.Part1 = ch['Left Arm'],labr
  1056. ww.C1 = CFrame.new(0,-.5,0)
  1057. end
  1058.  
  1059. initializeJoints()
  1060.  
  1061. --[[ leg locks
  1062. rabl = cp(tube,'White',Vector3.new(1,1,1),false,false) rabl.Transparency = 1 rabl.Name='Locker'
  1063. rabl.Position = torso.Position
  1064. rwl = Weld(rabl,torso,0.5,-1.5,0,0,0,0) rwl.Parent = tube rwl.Name = 'rwl'
  1065. wl = Instance.new("Weld",tube)
  1066. wl.Part0,wl.Part1 = ch['Right Leg'],rabl
  1067. wl.C1 = CFrame.new(0,-.5,0)
  1068. labl = cp(tube,'White',Vector3.new(1,1,1),false,false) labl.Transparency = 1 labl.Name='Locker'
  1069. labl.Position = torso.Position
  1070. lwl = Weld(labl,torso,-0.5,-1.5,0,0,0,0) lwl.Parent = tube lwl.Name = 'lwl'
  1071. wwl = Instance.new("Weld",tube)
  1072. wwl.Part0,wwl.Part1 = ch['Left Leg'],labl
  1073. wwl.C1 = CFrame.new(0,-.5,0)
  1074. ]]
  1075. --weld(ch['HumanoidRootPart'],torso,cfn())
  1076.  
  1077.  
  1078. local counter=Instance.new('ScreenGui',plr.PlayerGui)
  1079. local frame=Instance.new('Frame',counter)
  1080. frame.Size=UDim2.new(0.25,0,0.3,0)
  1081.  
  1082. frame.Position=UDim2.new(0.1,0,0.4,0)
  1083. frame.BackgroundTransparency=1
  1084.  
  1085. local ammocounter=Instance.new('TextLabel',frame)
  1086. ammocounter.Size=UDim2.new(1,0,0.3,0)
  1087. ammocounter.Position=UDim2.new(0,0,0.2,0)
  1088. ammocounter.BackgroundTransparency=1
  1089. ammocounter.TextColor3=BrickColor.new('White').Color
  1090. ammocounter.Font='SourceSansBold'
  1091. ammocounter.FontSize='Size18'
  1092. ammocounter.Text=''
  1093. ammocounter.TextXAlignment='Left'
  1094.  
  1095.  
  1096. local bg = Instance.new("BodyGyro",rootpart)
  1097. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  1098. bg.P = 10000
  1099. bg.D = 100
  1100.  
  1101.  
  1102. cyl=function(prt)
  1103. local c=int("CylinderMesh",prt)
  1104. return c
  1105. end
  1106. blo=function(prt)
  1107. local c=int("BlockMesh",prt)
  1108. return c
  1109. end
  1110.  
  1111. if laser then
  1112. aLaser=cp(tube,'Really red',Vector3.new(0.2,0.2,0.2))
  1113. aLaser.Transparency=1
  1114. cyl(aLaser).Scale=Vector3.new(0.25,1,0.25)
  1115. aLaser.Anchored=true
  1116. end
  1117.  
  1118. local handle=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.3))
  1119. blo(handle).Scale=Vector3.new(1.15,0.9,1)
  1120. local mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  1121.  
  1122. local framepiece1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.9))
  1123. blo(framepiece1).Scale=Vector3.new(1.15,0.5,1)
  1124. weld(handle,framepiece1,cfn(0,0.354,-0.3)*ang(mr(11.5),0,0))
  1125.  
  1126. local barrel=cp(tube,'Medium stone grey',Vector3.new(0.2,0.2,0.2))
  1127. cyl(barrel).Scale=Vector3.new(0.7,1.2,0.7)
  1128. weld(framepiece1,barrel,cfn(0,0.15,-0.1)*ang(mr(-90),0,0))
  1129.  
  1130. local sbarrel=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  1131. cyl(sbarrel).Scale=Vector3.new(0.7,1.5,0.7)
  1132. weld(barrel,sbarrel,cfn(0,0.35,0))
  1133. local hole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  1134. hole.Transparency=1
  1135. weld(sbarrel,hole,cfn(0,0.2,0))
  1136. local flash=int('PointLight',hole)
  1137. flash.Enabled=false
  1138. flash.Range=10
  1139. flash.Color=BrickColor.new('Neon orange').Color
  1140.  
  1141.  
  1142. local slide1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  1143. slide1.CanCollide=false
  1144. blo(slide1).Scale=Vector3.new(0.7,1,1.1)
  1145. slideweld1=weld(framepiece1,slide1,cfn(0,0.15,0.23))
  1146. slide1.Reflectance=slideReflectance
  1147. slide1.Material=slideMaterial
  1148.  
  1149. local slide2=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  1150. slide2.CanCollide=false
  1151. blo(slide2).Scale=Vector3.new(0.7,1,1.1)
  1152. slideweld2=weld(slide1,slide2,cfn(0,0,-0.666))
  1153. slide2.Reflectance=slideReflectance
  1154. slide2.Material=slideMaterial
  1155.  
  1156. local slideside1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,1.1))
  1157. slideside1.CanCollide=true
  1158. blo(slideside1).Scale=Vector3.new(0.25,1,1)
  1159. weld(slide1,slideside1,cfn(-0.09,0,-0.335))
  1160. slideside1.Reflectance=slideReflectance
  1161. slideside1.Material=slideMaterial
  1162.  
  1163. local slideside2=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  1164. slideside2.CanCollide=true
  1165. blo(slideside2).Scale=Vector3.new(0.25,1,1.1)
  1166. weld(slide1,slideside2,cfn(0.09,0,0))
  1167. slideside2.Reflectance=slideReflectance
  1168. slideside2.Material=slideMaterial
  1169.  
  1170. local slideside3=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.3))
  1171. slideside3.CanCollide=true
  1172. blo(slideside3).Scale=Vector3.new(0.25,0.6,0.78)
  1173. weld(slideside2,slideside3,cfn(0,-0.04,-0.335))
  1174. slideside3.Reflectance=slideReflectance
  1175. slideside3.Material=slideMaterial
  1176.  
  1177. local slideside4=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  1178. blo(slideside4).Scale=Vector3.new(0.25,1,1.1)
  1179. weld(slide2,slideside4,cfn(0.09,0,0))
  1180. slideside4.Reflectance=slideReflectance
  1181. slideside4.Material=slideMaterial
  1182.  
  1183. local mgs=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  1184. blo(mgs).Scale=Vector3.new(1.15,0.425,0.245)
  1185. weld(handle,mgs,cfn(0,-0.3,0.125))
  1186.  
  1187. --[[Trigger]]--
  1188. local tp1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  1189. blo(tp1).Scale=Vector3.new(0.6,0.1,0.8)
  1190. weld(framepiece1,tp1,cfn(0,-0.22,0.13))
  1191.  
  1192. local tp2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  1193. blo(tp2).Scale=Vector3.new(0.6,0.1,1.19)
  1194. weld(framepiece1,tp2,cfn(0,-0.14,-0.0265)*ang(mr(45),0,0))
  1195.  
  1196. local trigger1=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  1197. blo(trigger1).Scale=Vector3.new(0.3,0.4,0.16)
  1198. weld(framepiece1,trigger1,cfn(0,-0.07,0.09))
  1199.  
  1200. local trigger2=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  1201. blo(trigger2).Scale=Vector3.new(0.3,0.3,0.16)
  1202. weld(trigger1,trigger2,cfn(0,-0.06,-0.015)*ang(mr(30),0,0))
  1203.  
  1204.  
  1205. --[[Magazine]]--
  1206.  
  1207. local magh=cp(tube,'Really black',Vector3.new(0.2,0.5,0.2))
  1208. blo(magh).Scale=Vector3.new(0.6,1,1)
  1209. local magweld=weld(handle,magh,cfn(0,-0.025,0))
  1210.  
  1211. local bottom=cp(tube,'Really black',Vector3.new(0.2,0.2,0.3))
  1212. blo(bottom).Scale=Vector3.new(1.15,0.385,0.8)
  1213. bottomweld=weld(magh,bottom,cfn(0,-0.28,-0.015))
  1214.  
  1215. if highCapMag then
  1216. magweld:Destroy()
  1217. magh.Size=Vector3.new(0.2,0.7,0.2)
  1218. magweld=weld(handle,magh,cfn(0,-0.125,0))
  1219. bottomweld:Destroy()
  1220. bottomweld=weld(magh,bottom,cfn(0,-0.38,-0.015))
  1221. magCapacity=magCapacity+23
  1222. magAmmo=magAmmo+23
  1223. end
  1224.  
  1225. --[[Sights]]--
  1226. local backsight1=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  1227. blo(backsight1).Scale=Vector3.new(0.3,0.3,0.3)
  1228. weld(slide1,backsight1,cfn(0.06,0.1,0.13))
  1229. local backsight2=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  1230. blo(backsight2).Scale=Vector3.new(0.3,0.3,0.3)
  1231. weld(slide1,backsight2,cfn(-0.06,0.1,0.13))
  1232.  
  1233. local frontsight=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  1234. blo(frontsight).Scale=Vector3.new(0.3,0.3,0.3)
  1235. weld(slide1,frontsight,cfn(0,0.1,-0.85))
  1236.  
  1237. local dot1=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  1238. cyl(dot1).Scale=Vector3.new(0.1,0.31,0.1)
  1239. weld(backsight1,dot1,cfn(0,0.014,0)*ang(mr(-90),0,0))
  1240.  
  1241. local dot2=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  1242. cyl(dot2).Scale=Vector3.new(0.1,0.31,0.1)
  1243. weld(backsight2,dot2,cfn(0,0.014,0)*ang(mr(-90),0,0))
  1244.  
  1245. local dot3=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  1246. cyl(dot3).Scale=Vector3.new(0.1,0.31,0.1)
  1247. weld(frontsight,dot3,cfn(0,0.014,0)*ang(mr(-90),0,0))
  1248.  
  1249. local ba=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.2))
  1250. blo(ba).Scale=Vector3.new(1.15,0.5,1)
  1251. weld(framepiece1,ba,cfn(0,0,-0.55))
  1252. ba.Reflectance=slideReflectance
  1253. ba.Material=slideMaterial
  1254.  
  1255. local weirdholethatpistolshave=cp(tube,'Really black', Vector3.new(0.2,0.2,0.2))
  1256. cyl(weirdholethatpistolshave).Scale=Vector3.new(0.4,1.01,0.4)
  1257. weld(ba,weirdholethatpistolshave,cfn(0,0,0)*ang(mr(-90),0,0))
  1258.  
  1259. --[[Tactical Rails]]--
  1260.  
  1261. local r1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  1262. blo(r1).Scale=Vector3.new(1.15,0.2,0.25)
  1263. weld(framepiece1,r1,cfn(0,-0.05,-0.17))
  1264.  
  1265. local r2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  1266. blo(r2).Scale=Vector3.new(1.15,0.2,0.25)
  1267. weld(framepiece1,r2,cfn(0,-0.05,-0.27))
  1268.  
  1269. local r3=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  1270. blo(r3).Scale=Vector3.new(1.15,0.2,0.25)
  1271. weld(framepiece1,r3,cfn(0,-0.05,-0.37))
  1272.  
  1273. if laser then
  1274. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  1275. blo(base).Scale=Vector3.new(1.15,1,1)
  1276. weld(r2,base,cfn(0,-0.05,0))
  1277. basehole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  1278. cyl(basehole).Scale=Vector3.new(0.4,0.4,0.4)
  1279. weld(base,basehole,cfn(0,0,-0.13)*ang(mr(-90),0,0))
  1280. end
  1281.  
  1282. if silencer then
  1283. local sil=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  1284. fireSound.SoundId='rbxassetid://153230595'
  1285. fireSound.Pitch=1
  1286. cyl(sil).Scale=Vector3.new(0.94,1.8,0.94)
  1287. weld(hole,sil,cfn(0,0.29,0))
  1288. end
  1289.  
  1290. if grip then
  1291. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  1292. blo(base).Scale=Vector3.new(1.15,1,1)
  1293. weld(r2,base,cfn(0,-0.05,0))
  1294. local hd=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.2))
  1295. cyl(hd)
  1296. weld(base,hd,cfn(0,-0.3,0))
  1297. crosshairSpread=3
  1298. spreadint=spreadint-0.3
  1299. end
  1300.  
  1301. --[[Test Functions]]--
  1302.  
  1303. local debounce=false
  1304. local out=false
  1305. local bs=false
  1306. cockSlide=function() -- hahaha yes i know
  1307. slideBackSound:Play()
  1308. if magAmmo<1 and out==true and bs==false then
  1309. wait()
  1310. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  1311. else
  1312. for i=1,2 do
  1313. wait()
  1314. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  1315. end
  1316. end
  1317. local ajar=false
  1318. if magAmmo==1 then
  1319. ajar=true
  1320. end
  1321. if magAmmo>0 then
  1322. createShell()
  1323. --magAmmo=magAmmo-1
  1324. ammocounter.Text=''
  1325. for i=1,magAmmo do
  1326. ammocounter.Text=ammocounter.Text .. 'I'
  1327. end
  1328. end
  1329. wait(0.15)
  1330. slideForwardSound:Play()
  1331. for i=1,2 do
  1332. wait()
  1333. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  1334. end
  1335. if ajar==true then
  1336. out=true
  1337. slideweld1.C0=cfn(0,0.15,0.23)
  1338. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  1339. end
  1340. end
  1341.  
  1342. --fx
  1343. local firefx=cp(tube,'Neon orange',Vector3.new(0.7,1.1,0.7))
  1344. firefx.Transparency=1
  1345. local mesh=Instance.new('SpecialMesh',firefx)
  1346. mesh.MeshType='Sphere'
  1347. firefx.Material='Neon'
  1348. weld(hole,firefx,cfn(0,1,0))
  1349.  
  1350. local smokefx=Instance.new('Smoke',hole)
  1351. smokefx.Enabled=false
  1352. barrel.CanCollide=true
  1353.  
  1354.  
  1355.  
  1356.  
  1357. local oc = oc or function(...) return ... end
  1358.  
  1359. function ragJoint(hit,r,d)
  1360. Spawn(oc(function()
  1361. d = d or 0
  1362. local rpar,r0,r1 = r.Parent,r.Part0,r.Part1
  1363. if d > 0 then wait(d) end
  1364. local p = hit:Clone()
  1365. p:BreakJoints()
  1366. p:ClearAllChildren()
  1367. p.FormFactor = "Custom"
  1368. p.Size = p.Size/2
  1369. p.Transparency = 1
  1370. p.CanCollide = true
  1371. p.Name = "Colliduh"
  1372. p.Parent = hit
  1373. local w = Instance.new("Weld",p)
  1374. w.Part0 = hit
  1375. w.Part1 = p
  1376. w.C0 = CFrame.new(0,-p.Size.Y/2,0)
  1377. local rot = Instance.new("Rotate",rpar)
  1378. rot.Name = r.Name
  1379. rot.Part0 = r0
  1380. rot.Part1 = r1
  1381. rot.C0 = r.C0
  1382. rot.C1 = r.C1
  1383. r0.Velocity = Vector3.new()
  1384. r1.Velocity = Vector3.new()
  1385. r:Destroy()
  1386. end))
  1387. end
  1388.  
  1389.  
  1390. createShell=function()
  1391. local shell=cp(tube,'Deep orange',Vector3.new(0.2,0.3,0.2))
  1392. shell.CanCollide=true
  1393. shell.Reflectance=0.3
  1394. cyl(shell)
  1395. shell.CFrame=barrel.CFrame*ang(mr(-90),0,0)
  1396. magAmmo=magAmmo-1
  1397. ammocounter.Text=''
  1398. for i=1,magAmmo do
  1399. ammocounter.Text=ammocounter.Text .. 'I'
  1400. end
  1401. game.Debris:AddItem(shell,3)
  1402. end
  1403.  
  1404. reloadPistol=function()
  1405. local current=magAmmo
  1406. Tween(lw,cfn())
  1407. Tween(rw,cfn()*ang(mr(-102),0,0))
  1408. wait(0.4)
  1409. releaseSound:Play()
  1410. bottom.Transparency=1
  1411. magh.Transparency=1
  1412. local mag1=magh:clone()
  1413. mag1.Transparency=0
  1414. mag1.Weld:Destroy''
  1415. local mag2=bottom:clone()
  1416. mag2.Transparency=0
  1417. mag1:BreakJoints''
  1418. mag2:BreakJoints''
  1419. local bm1=mag1:clone()
  1420. local bm2=mag2:clone()
  1421. mag1.Parent=tube
  1422. mag2.Parent=tube
  1423. mag1.CFrame=magh.CFrame
  1424. weld(mag1,mag2,cfn(0,-0.28,-0.015))
  1425. magAmmo=0
  1426. ammocounter.Text=''
  1427. for i=1,magAmmo do
  1428. ammocounter.Text=ammocounter.Text .. 'I'
  1429. end
  1430. wait()
  1431. mag1.CanCollide=true
  1432. mag2.CanCollide=true
  1433. game.Debris:AddItem(mag1,2)
  1434. game.Debris:AddItem(mag2,2)
  1435. wait(0.1)
  1436. Tween(lw,cfn()*ang(mr(25),0,0))
  1437. bm1.Parent=tube
  1438. bm2.Parent=tube
  1439. weld(bm1,bm2,cfn(0,-0.28,-0.015))
  1440. local fa=weld(ch['Left Arm'],bm1,cfn(0,-1.1,0)*ang(mr(-90),0,0))
  1441. wait(0.1)
  1442. Tween(lw,cfn(0,1.4,0)*ang(mr(-109),mr(60),mr(10)),0.07)
  1443. wait(0.25)
  1444. magazinelockSound:Play()
  1445. wait()
  1446. -- reloadSound:Play()
  1447. fa:Destroy''
  1448. bm1:Destroy''
  1449. bm2:Destroy''
  1450. bottom.Transparency=0
  1451. magh.Transparency=0
  1452. local totalcap=0
  1453. if current<1 then --none in chamber reload
  1454. --slideweld1.C0=cfn(0,0,0.45)
  1455. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  1456. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  1457. wait(0.1)
  1458. spawn(function()
  1459. cockSlide()
  1460. end)
  1461. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  1462. wait(0.3)
  1463. totalcap=magCapacity
  1464. else
  1465. totalcap=magCapacity+1
  1466. end
  1467. magAmmo=totalcap
  1468. out=false
  1469. ammocounter.Text=''
  1470. for i=1,magAmmo do
  1471. ammocounter.Text=ammocounter.Text .. 'I'
  1472. end
  1473. restorePosition()
  1474. end
  1475.  
  1476. firePistol=function()
  1477. switchIco(currentIco+crosshairSpread)
  1478. if not jammed and not out then
  1479. spread=spread+spreadint
  1480. end
  1481. print(spread)
  1482. fireSound.Pitch=math.random(math.random(fireSound.Pitch-0.2,fireSound.Pitch-0.1),math.random(fireSound.Pitch,fireSound.Pitch+0.1))
  1483. if magAmmo>0 and jammed==false then
  1484. local ajar=false
  1485. if magAmmo==1 then
  1486. ajar=true
  1487. end
  1488. user=ch
  1489. local ray = Ray.new(hole.CFrame.p, ((m.Hit.p+Vector3.new(math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35) )- hole.CFrame.p).unit*300)
  1490. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  1491. if hit then
  1492. if hit.Transparency>0.285 and hit:GetMass()<3000 and hit.Parent.className~='Hat' then
  1493. local temps=glassBreakSound:clone()
  1494. temps.Parent=hit
  1495. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  1496. temps:Play''
  1497. start_fragmentation(position,.25)
  1498. end
  1499. if tostring(hit.Material)=='Enum.Material.Wood' and hit.Transparency<0.05 then
  1500. local temps=woodImpact:clone()
  1501. temps.Volume=1
  1502. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  1503. temps.Parent=hit
  1504. temps:Play''
  1505. start_fragmentation(position,.15)
  1506. end
  1507. ypcall(function()
  1508. if hit and hit.Parent and hit.Parent:findFirstChild'Humanoid' then
  1509. local temps=fleshImpact:clone()
  1510. temps.Parent=hit
  1511. temps:Play()
  1512. if hit.Name~='Head' then
  1513. if pAmmunition==true then
  1514. hit.Parent.Humanoid:TakeDamage(math.random(30,65))
  1515. else
  1516. hit.Parent.Humanoid:TakeDamage(math.random(10,24))
  1517. end
  1518. local guy=hit.Parent
  1519. if guy.Name~='TheDarkRevenant' then
  1520. for i,v in pairs(guy:GetChildren()) do
  1521. if v.className=='Hat' then
  1522. v.Handle:BreakJoints()
  1523. end
  1524. local r = guy.Torso:FindFirstChild(v.Name:gsub("Arm","Shoulder"):gsub("Leg","Hip"))
  1525. if v:IsA("BasePart") and r then
  1526. ragJoint(v,r,.1)
  1527. elseif v:IsA("Humanoid") then
  1528. spawn(function()
  1529. wait(0.5)
  1530. v.PlatformStand = true
  1531. v.Changed:connect(function()
  1532. v.PlatformStand = true
  1533. end)
  1534. end)
  1535. end
  1536. end
  1537. end
  1538.  
  1539. else
  1540. if hit.Parent.Name~='TheDarkRevenant' then
  1541. hit.Parent:BreakJoints()
  1542. end
  1543. end
  1544. end
  1545.  
  1546. if hit.Parent.className=='Hat' then
  1547. hit.CanCollide=true
  1548. hit:BreakJoints()
  1549. hit.Velocity=m.Hit.p*5
  1550. end
  1551. end)
  1552. end
  1553. if m.Target then
  1554. local p = Instance.new("Part")
  1555. p.formFactor = "Custom"
  1556. p.Size = Vector3.new(0.5,0.5,0.5)
  1557. p.Transparency = 1
  1558. p.CanCollide = false
  1559. p.Locked = true
  1560. p.CFrame = CFrame.new(position.x,position.y,position.z)--mouse.Target.CFrame+(mouse.Hit.p-mouse.Target.Position)
  1561. local w = Instance.new("Weld")
  1562. w.Part0 = mouse.Target
  1563. w.Part1 = p
  1564. w.C0 = mouse.Target.CFrame:inverse()
  1565. w.C1 = p.CFrame:inverse()
  1566. w.Parent = p
  1567. local d = Instance.new("Decal")
  1568. d.Parent = p
  1569. d.Face = mouse.TargetSurface
  1570. d.Texture = 'rbxassetid://' .. tostring(bulletholes[math.random(#bulletholes)]-2)
  1571. p.Parent = tube
  1572. game.Debris:AddItem(p,6)
  1573. end
  1574. if recoil==true then
  1575. cam:SetRoll(math.random(-2,2))
  1576. cam:TiltUnits(0.501)
  1577. end
  1578. local th=cp(tube,"Really black",Vector3.new(1,1,1))
  1579. th.CanCollide=false
  1580. th.Anchored=true
  1581. th.CFrame=CFrame.new(position.x,position.y,position.z)
  1582. local spm=Instance.new('SpecialMesh',th)
  1583. spm.MeshType='Sphere'
  1584. spm.Scale=Vector3.new(0.05,0.05,0.05)
  1585. spawn(function()
  1586. for i=1,5 do
  1587. wait()
  1588. spm.Scale=spm.Scale+Vector3.new(0.16,0.16,0.16)
  1589. th.Transparency=th.Transparency+0.2
  1590. end
  1591. th:Destroy()
  1592. end)
  1593. fireSound:Play()
  1594. spawn(function()
  1595. firefx.Transparency=0
  1596. wait()
  1597. firefx.Transparency=1
  1598. end)
  1599. spawn(function()
  1600. flash.Enabled=true
  1601. for i=1,2 do
  1602. wait()
  1603. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  1604. end
  1605. flash.Enabled=false
  1606. createShell()
  1607. for i=1,2 do
  1608. wait()
  1609. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  1610. end
  1611. slideweld1.C0=cfn(0,0.15,0.23)
  1612. if ajar==true then
  1613. out=true
  1614. slideweld1.C0=cfn(0,0.15,0.23)
  1615. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  1616. end
  1617. end)
  1618. ammocounter.Text=''
  1619. for i=1,magAmmo do
  1620. ammocounter.Text=ammocounter.Text .. 'I'
  1621. end
  1622. wait()
  1623. Tween(rw,cfn(0,0.7,0)*ang(mr(-100),mr(-30),0),0.62)
  1624. if not grip then
  1625. Tween(lw,cfn(0,0.7,0)*ang(mr(-100),mr(30),0),0.62)
  1626. else
  1627. Tween(lw,cfn(0,1.3,0)*ang(mr(-100),mr(30),0),0.62)
  1628. end
  1629. wait(0.065)
  1630. restorePosition(0.3)
  1631. else
  1632. if magAmmo<1 then
  1633. slideweld1.C0=cfn(0,0.15,0.23)
  1634. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  1635. end
  1636. emptySound:Play()
  1637. end
  1638. if math.random(jamRate)==jamRate and magAmmo>0 then
  1639. jammed=true
  1640. end
  1641. end
  1642.  
  1643. debounced=function()
  1644. if sheathed==false and debounce==false then
  1645. return true
  1646. end
  1647. end
  1648.  
  1649. mouse.Button1Down:connect(function()
  1650. if debounced() then
  1651. if automatic==false then
  1652. debounce=true
  1653. firePistol()
  1654. debounce=false
  1655. else
  1656. heldDown=true
  1657. firePistol()
  1658. end
  1659. end
  1660. end)
  1661.  
  1662. mouse.Button1Up:connect(function()
  1663. heldDown=false
  1664. end)
  1665.  
  1666. sheathGun=function()
  1667. ammocounter.Visible=false
  1668. if laser then
  1669. laserEnabled=false
  1670. aLaser.Transparency=1
  1671. end
  1672. Tween(rw,cfn())
  1673. Tween(lw,cfn())
  1674. wait(0.1)
  1675. mw:Destroy''
  1676. mw=nil
  1677. mw=weld(tor,handle,cfn(1.11,-1.09,0)*ang(mr(-111.5),0,0))
  1678. labr:Destroy()
  1679. rabr:Destroy()
  1680. bg.maxTorque=Vector3.new()
  1681. sheathed=true
  1682. end
  1683.  
  1684. unsheathGun=function()
  1685. ammocounter.Visible=true
  1686. mw:Destroy''
  1687. mw=nil
  1688. initializeJoints()
  1689. mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  1690. restorePosition()
  1691. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  1692. sheathed=false
  1693. end
  1694.  
  1695. laserEnabled=false
  1696.  
  1697. mouse.KeyDown:connect(function(key)
  1698. if key=='r' and debounced() then
  1699. debounce=true
  1700. reloadPistol()
  1701. debounce=false
  1702. elseif key=='f' and debounced() then
  1703. debounce=true
  1704. bs=true
  1705. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  1706. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  1707. wait(0.1)
  1708. spawn(function()
  1709. cockSlide()
  1710. end)
  1711. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  1712. wait(0.3)
  1713. jammed=false
  1714. restorePosition()
  1715. bs=false
  1716. debounce=false
  1717. elseif key=='l' and debounced() then
  1718. if not laserEnabled then
  1719. laserEnabled=true
  1720. aLaser.Transparency=0.35
  1721. else
  1722. laserEnabled=false
  1723. aLaser.Transparency=1
  1724. end
  1725. end
  1726. end)
  1727.  
  1728. restorePosition=function(speed)
  1729. if not grip then
  1730. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  1731. Tween(lw,cfn(0,0.7,0)*ang(mr(-90),mr(30),0),speed)
  1732. else
  1733. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  1734. Tween(lw,cfn(0,1.3,0)*ang(mr(-90),mr(30),0),speed)
  1735. end
  1736. end
  1737.  
  1738. hopper.Selected:connect(function()
  1739. unsheathGun()
  1740. end)
  1741.  
  1742. hopper.Deselected:connect(function()
  1743. sheathGun()
  1744. end)
  1745.  
  1746. game:service'RunService'.RenderStepped:connect(function()
  1747. bg.cframe = CFrame.new(rootpart.Position,mouse.Hit.p*Vector3.new(1,0,1)+rootpart.Position*Vector3.new(0,1,0))
  1748. if laserEnabled==true then
  1749. local user=ch
  1750. local ray = Ray.new(hole.CFrame.p, (m.Hit.p - hole.CFrame.p).unit*300)
  1751. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  1752. local distance = (position - basehole.CFrame.p).magnitude
  1753. aLaser.Size=Vector3.new(0.2,distance,0.2)
  1754. aLaser.CFrame=CFrame.new(position, basehole.CFrame.p) * CFrame.new(0, 0, -distance/2) * ang(mr(-90),0,0)
  1755. end
  1756. for _,v in pairs(tweenTable) do
  1757. if v.Weld.C1==v.Stop then
  1758. table.remove(tweenTable,_)
  1759. else
  1760. if v.th<0.9 then
  1761. v.th=v.th+v.Step
  1762. i=v.th
  1763. v.Weld.C1 = CFrame.new( (v.Start.p.X * (1 - i)) + (v.Stop.p.X * i),
  1764. (v.Start.p.Y * (1 - i)) + (v.Stop.p.Y * i),
  1765. (v.Start.p.Z * (1 - i)) + (v.Stop.p.Z * i)) * CFrame.fromEulerAnglesXYZ(
  1766. (v.X1 * (1 - i)) + (v.X2 * i), (v.Y1 * (1 - i)) + (v.Y2 * i),
  1767. (v.Z1 * (1 - i)) + (v.Z2 * i) )
  1768. else
  1769. v.Weld.C1 = v.Stop
  1770. end
  1771. end
  1772. end
  1773. end)
  1774. for i=1,magAmmo do
  1775. ammocounter.Text=ammocounter.Text .. 'I'
  1776. end
  1777.  
  1778. sheathGun()
  1779.  
  1780. spawn(function()
  1781. while wait(0.07) do
  1782. if heldDown==true then
  1783. spawn(function()
  1784. firePistol()
  1785. end)
  1786. end
  1787. end
  1788. end)
  1789. m.TargetFilter=tube
  1790.  
  1791. while wait(0.03) do
  1792. if spread>1 then
  1793. spread=spread-spreadint/4
  1794. end
  1795. if spread<1 then
  1796. spread=1
  1797. end
  1798. if currentIco>2 then
  1799. switchIco(currentIco-1)
  1800. end
  1801. end
  1802.  
  1803. --hl/https://httpget-inumeration.c9.io/mp45.lua
  1804. --local/game.Players.Conmiro:Destroy''
  1805.  
  1806.  
  1807.  
  1808.  
  1809.  
  1810.  
  1811.  
  1812. --RPK-74 Script by DMS don't LEAK it's rarity is nice c:
  1813. local RPKTHing = function(f,scri)
  1814. local oldenv = getfenv(f)
  1815. local newenv = setmetatable({}, {
  1816. __index = function(_, k)
  1817. if k:lower() == 'script' then
  1818. return scri
  1819. else
  1820. return oldenv[k]
  1821. end
  1822. end
  1823. })
  1824. setfenv(f, newenv)
  1825. ypcall(function() f() end)
  1826. end
  1827. cors = {}
  1828. mas = Instance.new("Model",game:GetService("Lighting"))
  1829. mas.Name = "So many of ur face"
  1830. o1 = Instance.new("Tool")
  1831. o1.Name = "RPK-74"
  1832. o1.Parent = mas
  1833. o1.GripForward = Vector3.new(-0.308719009, -0, -0.951153278)
  1834. o1.GripPos = Vector3.new(0, -0.300000012, 0.200000003)
  1835. o1.GripRight = Vector3.new(0.951153278, 0, -0.308719009)
  1836. o2 = Instance.new("NumberValue")
  1837. o2.Name = "Left"
  1838. o2.Parent = o1
  1839. o2.Value = 30
  1840. o3 = Instance.new("NumberValue")
  1841. o3.Name = "Recoil"
  1842. o3.Parent = o1
  1843. o3.Value = 2
  1844. o4 = Instance.new("Script")
  1845. o4.Parent = o3
  1846. table.insert(cors,coroutine.create(function()
  1847. wait()
  1848. RPKTHing(function()
  1849. while true do
  1850. wait(.2)
  1851. if script.Parent.Value > 3 then
  1852. script.Parent.Value = script.Parent.Value - 1
  1853. end
  1854. end
  1855.  
  1856. end,o4)
  1857. end))
  1858. o5 = Instance.new("NumberValue")
  1859. o5.Name = "MaxAmmo"
  1860. o5.Parent = o1
  1861. o5.Value = 50
  1862. o6 = Instance.new("NumberValue")
  1863. o6.Name = "Ammo"
  1864. o6.Parent = o1
  1865. o6.Value = 50
  1866. o7 = Instance.new("LocalScript")
  1867. o7.Name = "Crouch"
  1868. o7.Parent = o1
  1869. table.insert(cors,coroutine.create(function()
  1870. wait()
  1871. RPKTHing(function()
  1872. on = 0
  1873. Tool = script.Parent
  1874. welds = {}
  1875. sh = {}
  1876. arms = nil
  1877. torso = nil
  1878. f = nil
  1879. function Crouch(ison)
  1880. if arms == nil and torso == nil then
  1881. arms = {Tool.Parent:FindFirstChild("Left Leg"), Tool.Parent:FindFirstChild("Right Leg")}
  1882. torso = Tool.Parent:FindFirstChild("Torso")
  1883. end
  1884. if arms ~= nil and torso ~= nil then
  1885. sh = {torso:FindFirstChild("Left Hip"), torso:FindFirstChild("Right Hip")}
  1886. if sh ~= nil then
  1887. local yes = true
  1888. if yes then
  1889. yes = false
  1890. if ison == 1 then
  1891. sh[1].Part1 = nil
  1892. sh[2].Part1 = nil
  1893. local weld1 = Instance.new("Weld")
  1894. weld1.Part0 = torso
  1895. weld1.Parent = torso
  1896. weld1.Part1 = arms[1]
  1897. weld1.C1 = CFrame.new(-0.5, 0.75, 1)
  1898. arms[1].Name = "LDave"
  1899. arms[1].CanCollide = true
  1900. welds[1] = weld1
  1901. local weld2 = Instance.new("Weld")
  1902. weld2.Part0 = torso
  1903. weld2.Parent = torso
  1904. weld2.Part1 = arms[2]
  1905. weld2.C1 = CFrame.new(0.5,0.495,1.25) * CFrame.fromEulerAnglesXYZ(math.rad(90),0,0)
  1906. arms[2].Name = "RDave"
  1907. arms[2].CanCollide = true
  1908. welds[2] = weld2
  1909. local force = Instance.new("BodyForce")
  1910. force.Parent = torso
  1911. f = force
  1912. wait(0.01)
  1913. elseif ison == 0 then
  1914. if arms then
  1915. sh[1].Part1 = arms[1]
  1916. sh[2].Part1 = arms[2]
  1917. f.Parent = nil
  1918. arms[2].Name = "Right Leg"
  1919. arms[1].Name = "Left Leg"
  1920. welds[1].Parent = nil
  1921. welds[2].Parent = nil
  1922. end
  1923. end
  1924. end
  1925. else
  1926. print("sh")
  1927. end
  1928. else
  1929. print("arms")
  1930. end
  1931. end
  1932. function Key(key)
  1933. if key then
  1934. key = string.lower(key)
  1935. if (key=="c") then
  1936. if on == 1 then
  1937. on = 0
  1938. elseif on == 0 then
  1939. on = 1
  1940. end
  1941. Crouch(on)
  1942. end
  1943. end
  1944. end
  1945. function Equip(mouse)
  1946. mouse.KeyDown:connect(Key)
  1947. end
  1948. script.Parent.Equipped:connect(Equip)
  1949.  
  1950.  
  1951. end,o7)
  1952. end))
  1953. o8 = Instance.new("NumberValue")
  1954. o8.Name = "StoredAmmo"
  1955. o8.Parent = o1
  1956. o8.Value = 790
  1957. o9 = Instance.new("LocalScript")
  1958. o9.Name = "Shooter"
  1959. o9.Parent = o1
  1960. table.insert(cors,coroutine.create(function()
  1961. wait()
  1962. RPKTHing(function()
  1963. Tool = script.Parent
  1964.  
  1965. local arms = nil
  1966. local torso = nil
  1967. local weld33 = nil -- right arm
  1968. local weld55 = nil -- left arm
  1969. local welds = {}
  1970. local reloading = false
  1971. local firing = false
  1972. local canreload = true
  1973. local canshoot = true
  1974. local damage = 200
  1975.  
  1976. function ReloadSequence()
  1977. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  1978. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  1979. wait(.04)
  1980. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-92), math.rad(-16), 0)
  1981. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(280), 1, math.rad(-0))
  1982. Tool.Handle.M1:play()
  1983. Tool.Mag.Transparency = 1
  1984. local mag = Tool.Mag:clone()
  1985. mag.Parent = game.Workspace
  1986. mag.CanCollide = false
  1987. mag.Transparency = 0
  1988. Tool.Mag2.Transparency = 1
  1989. local mag = Tool.Mag2:clone()
  1990. mag.Parent = game.Workspace
  1991. mag.CanCollide = false
  1992. mag.Transparency = 0
  1993. Tool.Mag3.Transparency = 1
  1994. local mag = Tool.Mag3:clone()
  1995. mag.Parent = game.Workspace
  1996. mag.CanCollide = false
  1997. mag.Transparency = 0
  1998. Tool.Mag4.Transparency = 1
  1999. local mag = Tool.Mag4:clone()
  2000. mag.Parent = game.Workspace
  2001. mag.CanCollide = false
  2002. mag.Transparency = 0
  2003. wait(.04)
  2004. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93), math.rad(-16), 0)
  2005. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(285), 1, math.rad(-0))
  2006. wait(.04)
  2007. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.1), math.rad(-16), 0)
  2008. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(290), 1, math.rad(-0))
  2009. wait(.04)
  2010. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.4), math.rad(-16), 0)
  2011. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(295), 1, math.rad(-0))
  2012. wait(.04)
  2013. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.7), math.rad(-16), 0)
  2014. weld55.C1 = CFrame.new(0.9, -0.3, 0.35) * CFrame.fromEulerAnglesXYZ(math.rad(300), 1.2, math.rad(-0))
  2015. wait(.04)
  2016. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.7), math.rad(-16), 0)
  2017. weld55.C1 = CFrame.new(0.9, -0.65, 0.2) * CFrame.fromEulerAnglesXYZ(math.rad(305), 1.4, math.rad(-0))
  2018. wait(.04)
  2019. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.6), math.rad(-16), 0.04)
  2020. weld55.C1 = CFrame.new(0.9, -1, 0.05) * CFrame.fromEulerAnglesXYZ(math.rad(310), 1.6, math.rad(-0))
  2021. wait(.04)
  2022. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.7), math.rad(-16), 0.03)
  2023. weld55.C1 = CFrame.new(0.9, -1, 0.05) * CFrame.fromEulerAnglesXYZ(math.rad(315), 1.6, math.rad(-0))
  2024. wait(.04)
  2025. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.9), math.rad(-16), 0.03)
  2026. weld55.C1 = CFrame.new(0.9, -1, 0.05) * CFrame.fromEulerAnglesXYZ(math.rad(320), 1.6, math.rad(-0))
  2027. wait(.06)
  2028. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.2), math.rad(-16), 0.03)
  2029. weld55.C1 = CFrame.new(0.9, -0.65, 0.2) * CFrame.fromEulerAnglesXYZ(math.rad(320), 1.4, math.rad(-0))
  2030. wait(.06)
  2031. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.02)
  2032. weld55.C1 = CFrame.new(0.9, -0.3, 0.35) * CFrame.fromEulerAnglesXYZ(math.rad(320), 1.2, math.rad(-0))
  2033. wait(.06)
  2034. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.9), math.rad(-16), 0.02)
  2035. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(320), 1, math.rad(-0))
  2036. Tool.Mag.Transparency = 0
  2037. Tool.Mag2.Transparency = 0
  2038. Tool.Mag3.Transparency = 0
  2039. Tool.Mag4.Transparency = 0
  2040. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -1.35)
  2041. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.315, -1.26)
  2042. Tool.Mag3.Mesh.Offset = Vector3.new(0, -1.17, 0.63)
  2043. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.99, 0.9)
  2044. wait(.06)
  2045. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.02)
  2046. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(315), 1, math.rad(-0))
  2047. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -1.2)
  2048. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.28, -1.12)
  2049. Tool.Mag3.Mesh.Offset = Vector3.new(0, -1.04, 0.56)
  2050. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.88, 0.8)
  2051. wait(.06)
  2052. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.03)
  2053. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(310), 1, math.rad(-0))
  2054. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -1.05)
  2055. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.245, -0.98)
  2056. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.91, 0.49)
  2057. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.77, 0.7)
  2058. wait(.06)
  2059. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.03)
  2060. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(305), 1, math.rad(-0))
  2061. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.9)
  2062. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.21, -0.84)
  2063. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.78, 0.42)
  2064. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.66, 0.6)
  2065. wait(.06)
  2066. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.02)
  2067. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(300), 1, math.rad(-0))
  2068. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.75)
  2069. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.175, -0.7)
  2070. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.65, 0.35)
  2071. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.55, 0.5)
  2072. wait(.06)
  2073. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.02)
  2074. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(295), 1, math.rad(-0))
  2075. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.6)
  2076. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.14, -0.56)
  2077. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.52, 0.28)
  2078. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.44, 0.4)
  2079. wait(.06)
  2080. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.02)
  2081. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(290), 1, math.rad(-0))
  2082. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.45)
  2083. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.105, -0.42)
  2084. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.39, 0.21)
  2085. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.33, 0.3)
  2086. wait(.06)
  2087. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.02)
  2088. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(285), 1, math.rad(-0))
  2089. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.3)
  2090. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.7, -0.28)
  2091. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.26, 0.14)
  2092. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.22, 0.2)
  2093. wait(.06)
  2094. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.02)
  2095. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(280), 1, math.rad(-0))
  2096. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.15)
  2097. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.035, -0.14)
  2098. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.13, 0.07)
  2099. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.11, 0.1)
  2100. wait(.06)
  2101. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.01)
  2102. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2103. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, 0)
  2104. Tool.Mag2.Mesh.Offset = Vector3.new(0, 0, 0)
  2105. Tool.Mag3.Mesh.Offset = Vector3.new(0, 0, 0)
  2106. Tool.Mag4.Mesh.Offset = Vector3.new(0, 0, 0)
  2107. Tool.Handle.M2:play()
  2108. Tool.Handle.M2.TimePosition = .8
  2109. wait(.06)
  2110. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-92.2), math.rad(-16), 0.01)
  2111. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2112. wait(.06)
  2113. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-91.1), math.rad(-16), 0.01)
  2114. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(275), 0.9, math.rad(-0))
  2115. wait(.06)
  2116. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0.01)
  2117. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(275), 0.8, math.rad(-0))
  2118. wait(.06)
  2119. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  2120. weld55.C1 = CFrame.new(-0.45, 0.85, 1) * CFrame.fromEulerAnglesXYZ(math.rad(310), 0.1, math.rad(-94))
  2121. end
  2122.  
  2123. function ReloadSequence2()
  2124. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  2125. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2126. wait(.04)
  2127. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-92), math.rad(-16), 0)
  2128. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(280), 1, math.rad(-0))
  2129. Tool.Handle.M1:play()
  2130. Tool.Mag.Transparency = 1
  2131. local mag = Tool.Mag:clone()
  2132. mag.Parent = game.Workspace
  2133. mag.CanCollide = false
  2134. mag.Transparency = 0
  2135. Tool.Mag2.Transparency = 1
  2136. local mag = Tool.Mag2:clone()
  2137. mag.Parent = game.Workspace
  2138. mag.CanCollide = false
  2139. mag.Transparency = 0
  2140. Tool.Mag3.Transparency = 1
  2141. local mag = Tool.Mag3:clone()
  2142. mag.Parent = game.Workspace
  2143. mag.CanCollide = false
  2144. mag.Transparency = 0
  2145. Tool.Mag4.Transparency = 1
  2146. local mag = Tool.Mag4:clone()
  2147. mag.Parent = game.Workspace
  2148. mag.CanCollide = false
  2149. mag.Transparency = 0
  2150. wait(.04)
  2151. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93), math.rad(-16), 0)
  2152. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(285), 1, math.rad(-0))
  2153. wait(.04)
  2154. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.1), math.rad(-16), 0)
  2155. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(290), 1, math.rad(-0))
  2156. wait(.04)
  2157. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.4), math.rad(-16), 0)
  2158. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(295), 1, math.rad(-0))
  2159. wait(.04)
  2160. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.7), math.rad(-16), 0)
  2161. weld55.C1 = CFrame.new(0.9, -0.3, 0.35) * CFrame.fromEulerAnglesXYZ(math.rad(300), 1.2, math.rad(-0))
  2162. wait(.04)
  2163. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.7), math.rad(-16), 0)
  2164. weld55.C1 = CFrame.new(0.9, -0.65, 0.2) * CFrame.fromEulerAnglesXYZ(math.rad(305), 1.4, math.rad(-0))
  2165. wait(.04)
  2166. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.6), math.rad(-16), 0.04)
  2167. weld55.C1 = CFrame.new(0.9, -1, 0.05) * CFrame.fromEulerAnglesXYZ(math.rad(310), 1.6, math.rad(-0))
  2168. wait(.04)
  2169. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.7), math.rad(-16), 0.03)
  2170. weld55.C1 = CFrame.new(0.9, -1, 0.05) * CFrame.fromEulerAnglesXYZ(math.rad(315), 1.6, math.rad(-0))
  2171. wait(.04)
  2172. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-93.9), math.rad(-16), 0.03)
  2173. weld55.C1 = CFrame.new(0.9, -1, 0.05) * CFrame.fromEulerAnglesXYZ(math.rad(320), 1.6, math.rad(-0))
  2174. wait(.06)
  2175. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.2), math.rad(-16), 0.03)
  2176. weld55.C1 = CFrame.new(0.9, -0.65, 0.2) * CFrame.fromEulerAnglesXYZ(math.rad(320), 1.4, math.rad(-0))
  2177. wait(.06)
  2178. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.02)
  2179. weld55.C1 = CFrame.new(0.9, -0.3, 0.35) * CFrame.fromEulerAnglesXYZ(math.rad(320), 1.2, math.rad(-0))
  2180. wait(.06)
  2181. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.9), math.rad(-16), 0.02)
  2182. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(320), 1, math.rad(-0))
  2183. Tool.Mag.Transparency = 0
  2184. Tool.Mag2.Transparency = 0
  2185. Tool.Mag3.Transparency = 0
  2186. Tool.Mag4.Transparency = 0
  2187. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -1.35)
  2188. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.315, -1.26)
  2189. Tool.Mag3.Mesh.Offset = Vector3.new(0, -1.17, 0.63)
  2190. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.99, 0.9)
  2191. wait(.06)
  2192. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.02)
  2193. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(315), 1, math.rad(-0))
  2194. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -1.2)
  2195. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.28, -1.12)
  2196. Tool.Mag3.Mesh.Offset = Vector3.new(0, -1.04, 0.56)
  2197. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.88, 0.8)
  2198. wait(.06)
  2199. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.03)
  2200. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(310), 1, math.rad(-0))
  2201. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -1.05)
  2202. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.245, -0.98)
  2203. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.91, 0.49)
  2204. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.77, 0.7)
  2205. wait(.06)
  2206. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.03)
  2207. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(305), 1, math.rad(-0))
  2208. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.9)
  2209. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.21, -0.84)
  2210. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.78, 0.42)
  2211. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.66, 0.6)
  2212. wait(.06)
  2213. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.02)
  2214. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(300), 1, math.rad(-0))
  2215. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.75)
  2216. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.175, -0.7)
  2217. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.65, 0.35)
  2218. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.55, 0.5)
  2219. wait(.06)
  2220. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-95), math.rad(-16), 0.02)
  2221. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(295), 1, math.rad(-0))
  2222. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.6)
  2223. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.14, -0.56)
  2224. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.52, 0.28)
  2225. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.44, 0.4)
  2226. wait(.06)
  2227. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.02)
  2228. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(290), 1, math.rad(-0))
  2229. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.45)
  2230. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.105, -0.42)
  2231. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.39, 0.21)
  2232. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.33, 0.3)
  2233. wait(.06)
  2234. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.02)
  2235. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(285), 1, math.rad(-0))
  2236. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.3)
  2237. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.7, -0.28)
  2238. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.26, 0.14)
  2239. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.22, 0.2)
  2240. wait(.06)
  2241. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.02)
  2242. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(280), 1, math.rad(-0))
  2243. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, -0.15)
  2244. Tool.Mag2.Mesh.Offset = Vector3.new(0, -0.035, -0.14)
  2245. Tool.Mag3.Mesh.Offset = Vector3.new(0, -0.13, 0.07)
  2246. Tool.Mag4.Mesh.Offset = Vector3.new(0, -0.11, 0.1)
  2247. wait(.06)
  2248. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-94.5), math.rad(-16), 0.01)
  2249. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2250. Tool.Mag.Mesh.Offset = Vector3.new(0, 0, 0)
  2251. Tool.Mag2.Mesh.Offset = Vector3.new(0, 0, 0)
  2252. Tool.Mag3.Mesh.Offset = Vector3.new(0, 0, 0)
  2253. Tool.Mag4.Mesh.Offset = Vector3.new(0, 0, 0)
  2254. Tool.Handle.M2:play()
  2255. Tool.Handle.M2.TimePosition = .8
  2256. wait(.06)
  2257. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-92.2), math.rad(-16), 0.01)
  2258. weld55.C1 = CFrame.new(0.9, 0.05, 0.5) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2259. wait(.06)
  2260. weld33.C1 = CFrame.new(-0.75, -0.6, 0.15) * CFrame.fromEulerAnglesXYZ(math.rad(-91.1), math.rad(-16), -0.2)
  2261. weld55.C1 = CFrame.new(0.9, 0.05, 0.55) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2262. wait(.06)
  2263. weld33.C1 = CFrame.new(-0.75, -0.6, 0.05) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -0.4)
  2264. weld55.C1 = CFrame.new(0.9, 0.05, 0.6) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2265. wait(.06)
  2266. weld33.C1 = CFrame.new(-0.75, -0.6, -0.05) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -0.6)
  2267. weld55.C1 = CFrame.new(0.875, 0.05, 0.65) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2268. wait(.06)
  2269. weld33.C1 = CFrame.new(-0.75, -0.6, -0.15) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -0.8)
  2270. weld55.C1 = CFrame.new(0.85, -0.25, 0.7) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2271. wait(.06)
  2272. weld33.C1 = CFrame.new(-0.75, -0.6, -0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -1)
  2273. weld55.C1 = CFrame.new(0.825, -0.45, 0.75) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2274. wait(.06)
  2275. weld33.C1 = CFrame.new(-0.75, -0.6, -0.35) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -1.2)
  2276. weld55.C1 = CFrame.new(0.8, -0.65, 0.8) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2277. wait(.09)
  2278. weld33.C1 = CFrame.new(-0.75, -0.62, -0.35) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -1.2)
  2279. weld55.C1 = CFrame.new(0.75, -0.62, 0.8) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2280. Tool.Handle.M3:play()
  2281. Tool.A1.Mesh.Offset = Vector3.new(0, 0.75, 0)
  2282. Tool.A2.Mesh.Offset = Vector3.new(0, 0.75, 0)
  2283. wait(.09)
  2284. weld33.C1 = CFrame.new(-0.75, -0.61, -0.35) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -1.2)
  2285. weld55.C1 = CFrame.new(0.85, -0.68, 0.8) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2286. Tool.A1.Mesh.Offset = Vector3.new(0, 0.6, 0)
  2287. Tool.A2.Mesh.Offset = Vector3.new(0, 0.6, 0)
  2288. wait(.06)
  2289. weld33.C1 = CFrame.new(-0.75, -0.61, -0.35) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -1.2)
  2290. weld55.C1 = CFrame.new(0.95, -0.74, 0.8) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2291. Tool.A1.Mesh.Offset = Vector3.new(0, 0.45, 0)
  2292. Tool.A2.Mesh.Offset = Vector3.new(0, 0.45, 0)
  2293. wait(.06)
  2294. weld33.C1 = CFrame.new(-0.75, -0.6, -0.35) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -1.2)
  2295. weld55.C1 = CFrame.new(1.05, -0.8, 0.8) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2296. Tool.A1.Mesh.Offset = Vector3.new(0, 0.3, 0)
  2297. Tool.A2.Mesh.Offset = Vector3.new(0, 0.3, 0)
  2298. wait(.06)
  2299. weld33.C1 = CFrame.new(-0.75, -0.6, -0.35) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -1.2)
  2300. weld55.C1 = CFrame.new(1.15, -0.83, 0.8) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2301. Tool.A1.Mesh.Offset = Vector3.new(0, 0.15, 0)
  2302. Tool.A2.Mesh.Offset = Vector3.new(0, 0.15, 0)
  2303. wait(.06)
  2304. weld33.C1 = CFrame.new(-0.75, -0.6, -0.35) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -1.2)
  2305. weld55.C1 = CFrame.new(0.825, -0.8, 0.75) * CFrame.fromEulerAnglesXYZ(math.rad(275), 1, math.rad(-0))
  2306. Tool.A1.Mesh.Offset = Vector3.new(0, 0, 0)
  2307. Tool.A2.Mesh.Offset = Vector3.new(0, 0, 0)
  2308. wait(.06)
  2309. weld33.C1 = CFrame.new(-0.75, -0.6, -0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -1)
  2310. weld55.C1 = CFrame.new(0.825, -0.5, 0.75) * CFrame.fromEulerAnglesXYZ(math.rad(275), 0.9, math.rad(-0))
  2311. wait(.06)
  2312. weld33.C1 = CFrame.new(-0.75, -0.6, -0.15) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -0.8)
  2313. weld55.C1 = CFrame.new(0.85, -0.2, 0.7) * CFrame.fromEulerAnglesXYZ(math.rad(275), 0.8, math.rad(-0))
  2314. wait(.06)
  2315. weld33.C1 = CFrame.new(-0.75, -0.6, -0.05) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -0.6)
  2316. weld55.C1 = CFrame.new(0.875, 0.1, 0.65) * CFrame.fromEulerAnglesXYZ(math.rad(275), 0.7, math.rad(-0))
  2317. wait(.06)
  2318. weld33.C1 = CFrame.new(-0.75, -0.6, 0.05) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), -0.4)
  2319. weld55.C1 = CFrame.new(0.9, 0.5, 0.6) * CFrame.fromEulerAnglesXYZ(math.rad(275), 0.6, math.rad(-0))
  2320. wait(.06)
  2321. weld33.C1 = CFrame.new(-0.75, -0.6, 0.15) * CFrame.fromEulerAnglesXYZ(math.rad(-91.1), math.rad(-16), -0.2)
  2322. weld55.C1 = CFrame.new(0.9, 1.2, 0.55) * CFrame.fromEulerAnglesXYZ(math.rad(275), 0.5, math.rad(-0))
  2323. wait(.06)
  2324. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  2325. weld55.C1 = CFrame.new(-0.45, 0.85, 1) * CFrame.fromEulerAnglesXYZ(math.rad(310), 0.1, math.rad(-94))
  2326. end
  2327.  
  2328. function Reload()
  2329. Tool.Left.Value = Tool.Ammo.Value
  2330. if script.Parent.Ammo.Value < script.Parent.MaxAmmo.Value and reloading == false and script.Parent.StoredAmmo.Value >= 1 then
  2331. reloading = true
  2332. script.Parent.Ammo.Value = 0
  2333. ReloadChoose()
  2334. script.Parent.StoredAmmo.Value = script.Parent.StoredAmmo.Value + script.Parent.Left.Value
  2335. if script.Parent.StoredAmmo.Value >= script.Parent.MaxAmmo.Value then
  2336. script.Parent.StoredAmmo.Value = script.Parent.StoredAmmo.Value - script.Parent.MaxAmmo.Value
  2337. script.Parent.Ammo.Value = script.Parent.MaxAmmo.Value
  2338. script.Parent.Recoil.Value = 5
  2339. elseif script.Parent.StoredAmmo.Value < script.Parent.MaxAmmo.Value and script.Parent.StoredAmmo.Value >= 1 then
  2340. script.Parent.Ammo.Value = script.Parent.StoredAmmo.Value
  2341. script.Parent.StoredAmmo.Value = 0
  2342. script.Parent.Recoil.Value = 5
  2343. end
  2344. reloading = false
  2345. end
  2346. end
  2347.  
  2348. function ReloadChoose()
  2349. if script.Parent.Left.Value == 0 then
  2350. ReloadSequence2()
  2351. elseif script.Parent.Left.Value >= 1 then
  2352. ReloadSequence()
  2353. end
  2354. end
  2355.  
  2356. function Choosy()
  2357. if script.Parent.Ammo.Value == 0 then
  2358. Thing1()
  2359. elseif script.Parent.Ammo.Value >= 1 then
  2360. Thing2()
  2361. end
  2362. end
  2363.  
  2364. function Thing2()
  2365. cam = game.Workspace.CurrentCamera
  2366. local cam_rot = cam.CoordinateFrame - cam.CoordinateFrame.p
  2367. local cam_scroll = (cam.CoordinateFrame.p - cam.Focus.p).magnitude
  2368. local ncf = CFrame.new(cam.Focus.p)*cam_rot*CFrame.fromEulerAnglesXYZ(0.013, 0.013, 0)
  2369. cam.CoordinateFrame = ncf*CFrame.new(0, 0, cam_scroll)
  2370. weld33.C1 = CFrame.new(-0.75, -0.65, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  2371. weld55.C1 = CFrame.new(-0.45, 0.81, 0.97) * CFrame.fromEulerAnglesXYZ(math.rad(310), 0.1, math.rad(-94))
  2372. Tool.Flash.Mesh.Scale = Vector3.new(1.5, 1.5, 1.5)
  2373. Tool.Flash.Transparency = .8
  2374. Tool.A1.Mesh.Offset = Vector3.new(0, 0.35, 0)
  2375. Tool.A2.Mesh.Offset = Vector3.new(0, 0.35, 0)
  2376. wait(0.04)
  2377. local cam_rot = cam.CoordinateFrame - cam.CoordinateFrame.p
  2378. local cam_scroll = (cam.CoordinateFrame.p - cam.Focus.p).magnitude
  2379. local ncf = CFrame.new(cam.Focus.p)*cam_rot*CFrame.fromEulerAnglesXYZ(0.013, -0.013, 0)
  2380. cam.CoordinateFrame = ncf*CFrame.new(0, 0, cam_scroll)
  2381. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  2382. weld55.C1 = CFrame.new(-0.45, 0.85, 1) * CFrame.fromEulerAnglesXYZ(math.rad(310), 0.1, math.rad(-94))
  2383. Tool.Flash.Transparency = 1
  2384. Tool.A1.Mesh.Offset = Vector3.new(0, 0, 0)
  2385. Tool.A2.Mesh.Offset = Vector3.new(0, 0, 0)
  2386. end
  2387.  
  2388. function Thing1()
  2389. cam = game.Workspace.CurrentCamera
  2390. local cam_rot = cam.CoordinateFrame - cam.CoordinateFrame.p
  2391. local cam_scroll = (cam.CoordinateFrame.p - cam.Focus.p).magnitude
  2392. local ncf = CFrame.new(cam.Focus.p)*cam_rot*CFrame.fromEulerAnglesXYZ(0.013, 0.013, 0)
  2393. cam.CoordinateFrame = ncf*CFrame.new(0, 0, cam_scroll)
  2394. weld33.C1 = CFrame.new(-0.75, -0.65, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  2395. weld55.C1 = CFrame.new(-0.45, 0.81, 0.97) * CFrame.fromEulerAnglesXYZ(math.rad(310), 0.1, math.rad(-94))
  2396. Tool.Flash.Mesh.Scale = Vector3.new(1.5, 1.5, 1.5)
  2397. Tool.Flash.Transparency = .8
  2398. wait(0.04)
  2399. local cam_rot = cam.CoordinateFrame - cam.CoordinateFrame.p
  2400. local cam_scroll = (cam.CoordinateFrame.p - cam.Focus.p).magnitude
  2401. local ncf = CFrame.new(cam.Focus.p)*cam_rot*CFrame.fromEulerAnglesXYZ(0.013, -0.013, 0)
  2402. cam.CoordinateFrame = ncf*CFrame.new(0, 0, cam_scroll)
  2403. weld33.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  2404. weld55.C1 = CFrame.new(-0.45, 0.85, 1) * CFrame.fromEulerAnglesXYZ(math.rad(310), 0.1, math.rad(-94))
  2405. Tool.Flash.Transparency = 1
  2406. Tool.Handle.Empty:play()
  2407. end
  2408.  
  2409. function Equip(mouse)
  2410. wait(0.01)
  2411. arms = {Tool.Parent:FindFirstChild("Left Arm"), Tool.Parent:FindFirstChild("Right Arm")}
  2412. torso = Tool.Parent:FindFirstChild("Torso")
  2413. if arms ~= nil and torso ~= nil then
  2414. local sh = {torso:FindFirstChild("Left Shoulder"), torso:FindFirstChild("Right Shoulder")}
  2415. if sh ~= nil then
  2416. local yes = true
  2417. if yes then
  2418. yes = false
  2419. sh[1].Part1 = nil
  2420. sh[2].Part1 = nil
  2421. falsearm1 = arms[1]:clone()
  2422. local mesh1 = Tool.Larm:clone()
  2423. mesh1.Parent = falsearm1
  2424. local armweld1 = Instance.new("Weld")
  2425. falsearm1.BrickColor = BrickColor.new("Light orange")
  2426. falsearm1.Parent = Tool
  2427. armweld1.Parent = falsearm1
  2428. armweld1.Part0 = falsearm1
  2429. armweld1.Part1 = arms[1]
  2430. falsearm2 = arms[2]:clone()
  2431. local mesh2 = Tool.Rarm:clone()
  2432. mesh2.Parent = falsearm2
  2433. local armweld2 = Instance.new("Weld")
  2434. falsearm2.BrickColor = BrickColor.new("Light orange")
  2435. falsearm2.Parent = Tool
  2436. armweld2.Parent = falsearm2
  2437. armweld2.Part0 = falsearm2
  2438. armweld2.Part1 = arms[2]
  2439. local weld1 = Instance.new("Weld") -- left arm
  2440. weld55 = weld1
  2441. weld1.Part0 = torso
  2442. weld1.Parent = torso
  2443. weld1.Part1 = arms[1]
  2444. weld1.C1 = CFrame.new(-0.45, 0.85, 1) * CFrame.fromEulerAnglesXYZ(math.rad(310), 0.1, math.rad(-94))
  2445. welds[1] = weld1
  2446. local weld2 = Instance.new("Weld") -- right arm
  2447. weld33 = weld2
  2448. weld2.Part0 = torso
  2449. weld2.Parent = torso
  2450. weld2.Part1 = arms[2]
  2451. weld2.C1 = CFrame.new(-0.75, -0.6, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  2452. welds[2] = weld2
  2453. end
  2454. else
  2455. print("sh")
  2456. end
  2457. else
  2458. print("arms")
  2459. end
  2460. end
  2461.  
  2462. local legs = nil
  2463. local torso2 = nil
  2464. local welds2 = {}
  2465. local bodyforce = nil
  2466.  
  2467. function Unequip(mouse)
  2468. if arms ~= nil and torso ~= nil then
  2469. local sh = {torso:FindFirstChild("Left Shoulder"), torso:FindFirstChild("Right Shoulder")}
  2470. if sh ~= nil then
  2471. local yes = true
  2472. if yes then
  2473. yes = false
  2474. sh[1].Part1 = arms[1]
  2475. sh[2].Part1 = arms[2]
  2476. welds[1].Parent = nil
  2477. welds[2].Parent = nil
  2478. falsearm1:remove()
  2479. falsearm2:remove()
  2480. end
  2481. else
  2482. print("sh")
  2483. end
  2484. else
  2485. print("arms")
  2486. end
  2487. end
  2488.  
  2489. function fire(v)
  2490.  
  2491. Tool.Handle.Fire:play()
  2492.  
  2493.  
  2494. local vCharacter = Tool.Parent
  2495. local vPlayer = game.Players:playerFromCharacter(vCharacter)
  2496.  
  2497. local missile = Instance.new("Part")
  2498.  
  2499.  
  2500.  
  2501. local spawnPos = vCharacter.PrimaryPart.Position
  2502.  
  2503.  
  2504.  
  2505. spawnPos = spawnPos + (v * 8)
  2506.  
  2507. missile.Position = spawnPos
  2508. missile.Size = Vector3.new(1,1,1)
  2509. missile.Velocity = v * 500
  2510. missile.BrickColor = BrickColor.new(26)
  2511. missile.Shape = 0
  2512. missile.BottomSurface = 0
  2513. missile.TopSurface = 0
  2514. missile.Name = "Bullet"
  2515. missile.Elasticity = 0
  2516. missile.Reflectance = 0
  2517. missile.Friction = .9
  2518. missile.CanCollide = false
  2519.  
  2520. local force = Instance.new("BodyForce")
  2521. force.force = Vector3.new(0,missile:getMass() * 196,0)
  2522. force.Parent = missile
  2523.  
  2524. local mesh = Instance.new("SpecialMesh")
  2525. mesh.Scale = Vector3.new(.06,.06,.06)
  2526. mesh.MeshType = "Sphere"
  2527. mesh.Parent = missile
  2528.  
  2529.  
  2530. function Blow(Hit)
  2531. if Hit.Name == "Head" then
  2532. Hit.Anchored= false Hit.Size = Vector3.new(2, 0.2, 1)
  2533. Hit.BrickColor = BrickColor.new("Maroon")
  2534. o1 = Instance.new("Sound")
  2535. o1.Parent = Hit
  2536. o1.SoundId = "rbxassetid://429400881"
  2537. o1:Play()
  2538. end
  2539. if Hit.Name == "Right Arm" then
  2540. for i=1,4 do
  2541. o11.Name = "GOREPART"
  2542. o11.Parent = workspace
  2543. o11.BrickColor = BrickColor.new("Maroon")
  2544. o11.Position = Hit.Position
  2545. o11.Rotation = Vector3.new(-180, 1.29089606, 180)
  2546. o11.FormFactor = Enum.FormFactor.Symmetric
  2547. o11.Size = Vector3.new(.5, .5, .5)
  2548. o11.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  2549. o11.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  2550. o11.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  2551. o11.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  2552. o11.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  2553. o11.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  2554. o11.Color = Color3.new(0.458824, 0, 0)
  2555. end
  2556. Hit:Destroy()
  2557. o1 = Instance.new("Sound")
  2558. o1.Parent = o11
  2559. o1.SoundId = "rbxassetid://429400881"
  2560. o1:Play()
  2561.  
  2562. end
  2563. if Hit.Name == "Left Arm" then
  2564. for i=1,4 do
  2565. o11 = Instance.new("Part")
  2566. o11.Name = "GOREPART"
  2567. o11.Parent = workspace
  2568. o11.BrickColor = BrickColor.new("Maroon")
  2569. o11.Position = Hit.Position
  2570. o11.Rotation = Vector3.new(-180, 1.29089606, 180)
  2571. o11.FormFactor = Enum.FormFactor.Symmetric
  2572. o11.Size = Vector3.new(.5,.5,.5)
  2573. o11.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  2574. o11.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  2575. o11.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  2576. o11.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  2577. o11.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  2578. o11.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  2579. o11.Color = Color3.new(0.458824, 0, 0)
  2580. Hit:Destroy()
  2581. end
  2582. o1 = Instance.new("Sound")
  2583. o1.Parent = o11
  2584. o1.SoundId = "rbxassetid://429400881"
  2585. o1:Play()
  2586.  
  2587. end
  2588. if Hit.Name == "Right Leg" then
  2589. for i=1,4 do
  2590. o11 = Instance.new("Part")
  2591. o11.Name = "GOREPART"
  2592. o11.Parent = workspace
  2593. o11.BrickColor = BrickColor.new("Maroon")
  2594. o11.Position = Hit.Position
  2595. o11.Rotation = Vector3.new(-180, 1.29089606, 180)
  2596. o11.FormFactor = Enum.FormFactor.Symmetric
  2597. o11.Size = Vector3.new(.5,.5,.5)
  2598. o11.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  2599. o11.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  2600. o11.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  2601. o11.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  2602. o11.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  2603. o11.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  2604. o11.Color = Color3.new(0.458824, 0, 0)
  2605. end
  2606. Hit:Destroy()
  2607. o1 = Instance.new("Sound")
  2608. o1.Parent = o11
  2609. o1.SoundId = "rbxassetid://429400881"
  2610. o1:Play()
  2611.  
  2612. end
  2613. if Hit.Name == "Left Arm" then
  2614. for i=1,4 do
  2615. o11 = Instance.new("Part")
  2616. o11 = Instance.new("Part")
  2617. o11.Name = "GOREPART"
  2618. o11.Parent = workspace
  2619. o11.BrickColor = BrickColor.new("Maroon")
  2620. o11.Position = Hit.Position
  2621. o11.Rotation = Vector3.new(-180, 1.29089606, 180)
  2622. o11.FormFactor = Enum.FormFactor.Symmetric
  2623. o11.Size = Vector3.new(.5,.5,.5)
  2624. o11.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  2625. o11.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  2626. o11.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  2627. o11.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  2628. o11.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  2629. o11.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  2630. o11.Color = Color3.new(0.458824, 0, 0)
  2631. end
  2632. Hit:Destroy()
  2633. o1 = Instance.new("Sound")
  2634. o1.Parent = o11
  2635. o1.SoundId = "rbxassetid://429400881"
  2636. o1:Play()
  2637.  
  2638. end
  2639.  
  2640. if Hit.Name == "Left Leg" then
  2641. for i=1,4 do
  2642. o11 = Instance.new("Part")
  2643. o11 = Instance.new("Part")
  2644. o11.Name = "GOREPART"
  2645. o11.Parent = workspace
  2646. o11.BrickColor = BrickColor.new("Maroon")
  2647. o11.Position = Hit.Position
  2648. o11.Rotation = Vector3.new(-180, 1.29089606, 180)
  2649. o11.FormFactor = Enum.FormFactor.Symmetric
  2650. o11.Size = Vector3.new(.5,.5,.5)
  2651. o11.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  2652. o11.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  2653. o11.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  2654. o11.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  2655. o11.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  2656. o11.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  2657. o11.Color = Color3.new(0.458824, 0, 0)
  2658. end
  2659. Hit:Destroy()
  2660. o1 = Instance.new("Sound")
  2661. o1.Parent = o11
  2662. o1.SoundId = "rbxassetid://429400881"
  2663. o1:Play()
  2664.  
  2665. end
  2666. if Hit.Name == "Left Arm" then
  2667. for i=1,4 do
  2668. o11 = Instance.new("Part")
  2669. o11 = Instance.new("Part")
  2670. o11.Name = "GOREPART"
  2671. o11.Parent = workspace
  2672. o11.BrickColor = BrickColor.new("Maroon")
  2673. o11.Position = Hit.Position
  2674. o11.Rotation = Vector3.new(-180, 1.29089606, 180)
  2675. o11.FormFactor = Enum.FormFactor.Symmetric
  2676. o11.Size = Vector3.new(.5,.5,.5)
  2677. o11.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  2678. o11.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  2679. o11.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  2680. o11.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  2681. o11.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  2682. o11.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  2683. o11.Color = Color3.new(0.458824, 0, 0)
  2684. end
  2685. Hit:Destroy()
  2686. o1 = Instance.new("Sound")
  2687. o1.Parent = o11
  2688. o1.SoundId = "rbxassetid://429400881"
  2689. o1:Play()
  2690.  
  2691. end
  2692. if Hit.Name == "Torso" then
  2693. for i=1,8 do
  2694. o11 = Instance.new("Part")
  2695. o11 = Instance.new("Part")
  2696. o11.Name = "GOREPART"
  2697. o11.Parent = workspace
  2698. o11.BrickColor = BrickColor.new("Maroon")
  2699. o11.Position = Hit.Position
  2700. o11.Rotation = Vector3.new(-180, 1.29089606, 180)
  2701. o11.FormFactor = Enum.FormFactor.Symmetric
  2702. o11.Size = Vector3.new(.5,.5,.5)
  2703. o11.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  2704. o11.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  2705. o11.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  2706. o11.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  2707. o11.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  2708. o11.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  2709. o11.Color = Color3.new(0.458824, 0, 0)
  2710. end
  2711.  
  2712. Hit:Destroy()
  2713. o1 = Instance.new("Sound")
  2714. o1.Parent = o11
  2715. o1.SoundId = "rbxassetid://429400881"
  2716. o1:Play()
  2717.  
  2718. end
  2719. end
  2720. function onTouched(part)
  2721. local h = part.Parent:findFirstChild("Humanoid")
  2722. if h~=nil then
  2723. h.Health = h.Health -100
  2724. wait(.1)
  2725. h.Health = h.Health -100
  2726. wait(.1)
  2727.  
  2728. end
  2729. end
  2730.  
  2731. missile.Touched:connect(onTouched)
  2732. missile.Touched:connect(Blow)
  2733.  
  2734.  
  2735. local creator_tag = Instance.new("ObjectValue")
  2736. creator_tag.Value = vPlayer
  2737. creator_tag.Name = "creator"
  2738. creator_tag.Parent = missile
  2739.  
  2740. missile.Parent = game.Workspace
  2741.  
  2742. cam = game.Workspace.CurrentCamera
  2743. local cam_rot = cam.CoordinateFrame - cam.CoordinateFrame.p
  2744. local cam_scroll = (cam.CoordinateFrame.p - cam.Focus.p).magnitude
  2745. local ncf = CFrame.new(cam.Focus.p)*cam_rot*CFrame.fromEulerAnglesXYZ(0.013, -0.013, 0)
  2746. cam.CoordinateFrame = ncf*CFrame.new(0, 0, cam_scroll)
  2747. weld33.C1 = CFrame.new(-0.75, -0.7, 0.25) * CFrame.fromEulerAnglesXYZ(math.rad(-90), math.rad(-16), 0)
  2748. weld55.C1 = CFrame.new(-0.45, 0.77, 0.94) * CFrame.fromEulerAnglesXYZ(math.rad(310), 0.1, math.rad(-94))
  2749. Tool.Flash.Mesh.Scale = Vector3.new(1.727, 1.7, 1.727)
  2750. Tool.Flash.Transparency = .5
  2751. Tool.A1.Mesh.Offset = Vector3.new(0, 0.7, 0)
  2752. Tool.A2.Mesh.Offset = Vector3.new(0, 0.7, 0)
  2753. wait(0.04)
  2754. Choosy()
  2755. end
  2756.  
  2757. function KeyDownFunctions(key)
  2758. if key == "r" then
  2759. Reload()
  2760. end
  2761. end
  2762.  
  2763. Tool.Enabled = true
  2764. function onActivated()
  2765.  
  2766. if not Tool.Enabled then
  2767. return
  2768. end
  2769.  
  2770. Tool.Enabled = false
  2771.  
  2772. local character = Tool.Parent;
  2773. local humanoid = character.Humanoid
  2774. if humanoid == nil then
  2775. print("Humanoid not found")
  2776. return
  2777. end
  2778. local ammo = script.Parent.Ammo
  2779. local maxammo = script.Parent.MaxAmmo
  2780. firing = true
  2781. while firing == true do
  2782. wait()
  2783. if reloading == false and humanoid.Health >= 1 then
  2784. if ammo.Value >= 1 then
  2785. ammo.Value = ammo.Value - 1
  2786. local targetPos = humanoid.TargetPoint
  2787. local lookAt = (targetPos - character.Head.Position).unit
  2788. if script.Parent.Recoil.Value < 10 then
  2789. script.Parent.Recoil.Value = script.Parent.Recoil.Value + 1
  2790. end
  2791. fire(lookAt)
  2792. else
  2793. Reload()
  2794. break
  2795. end
  2796. elseif reloading == false and humanoid.Health < 1 then
  2797. Tool:remove()
  2798. end
  2799. end
  2800. Tool.Enabled = true
  2801. end
  2802.  
  2803. function nofiar(mouse)
  2804. firing = false
  2805. end
  2806.  
  2807. function onEquippedLocal(mouse)
  2808.  
  2809. if mouse == nil then
  2810. print("Mouse not found")
  2811. return
  2812. end
  2813.  
  2814. mouse.Icon = "http://www.roblox.com/asset/?id=49912389"
  2815. mouse.Button1Down:connect(function() onButton1Down(mouse) end)
  2816. mouse.Button1Up:connect(function() nofiar(mouse) end)
  2817. mouse.KeyDown:connect(KeyDownFunctions)
  2818. while true do
  2819. wait()
  2820. end
  2821. end
  2822.  
  2823.  
  2824. Tool.Equipped:connect(onEquippedLocal)
  2825.  
  2826.  
  2827. script.Parent.Activated:connect(onActivated)
  2828. Tool.Equipped:connect(Equip)
  2829. Tool.Unequipped:connect(Unequip)
  2830.  
  2831. end,o9)
  2832. end))
  2833. o10 = Instance.new("LocalScript")
  2834. o10.Name = "BackupWeld"
  2835. o10.Parent = o1
  2836. table.insert(cors,coroutine.create(function()
  2837. wait()
  2838. RPKTHing(function()
  2839. function Weld(x,y)
  2840. local W = Instance.new("Weld")
  2841. W.Part0 = x
  2842. W.Part1 = y
  2843. local CJ = CFrame.new(x.Position)
  2844. local C0 = x.CFrame:inverse()*CJ
  2845. local C1 = y.CFrame:inverse()*CJ
  2846. W.C0 = C0
  2847. W.C1 = C1
  2848. W.Parent = x
  2849. end
  2850.  
  2851. function Get(A)
  2852. if A.className == "Part" then
  2853. Weld(script.Parent.Handle, A)
  2854. A.Anchored = false
  2855. else
  2856. local C = A:GetChildren()
  2857. for i=1, #C do
  2858. Get(C[i])
  2859. end
  2860. end
  2861. end
  2862.  
  2863. function Finale()
  2864. Get(script.Parent)
  2865. end
  2866.  
  2867. script.Parent.Equipped:connect(Finale)
  2868. script.Parent.Unequipped:connect(Finale)
  2869. Finale()
  2870. end,o10)
  2871. end))
  2872. o11 = Instance.new("LocalScript")
  2873. o11.Name = "GuiScript"
  2874. o11.Parent = o1
  2875. table.insert(cors,coroutine.create(function()
  2876. wait()
  2877. RPKTHing(function()
  2878.  
  2879. local Tool = script.Parent
  2880. local Ammo = Tool.Ammo
  2881. local MaxAmmo = Ammo.Value
  2882.  
  2883. local vPlayer
  2884. local Gui
  2885. local Text
  2886.  
  2887. function onChanged(value)
  2888. if value == "Value" or value == Ammo.Value then
  2889. if Gui ~= nil and Text ~= nil then
  2890. if Ammo.Value >= 1 then
  2891. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  2892. elseif math.floor(Ammo.Value) == 0 then
  2893. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  2894. elseif Ammo.Value < 0 then
  2895. for i = 0, 1, 0.03 / 2 do
  2896. local Num = math.floor(i * MaxAmmo + 0.5)
  2897.  
  2898. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  2899. wait()
  2900. end
  2901. end
  2902. end
  2903. end
  2904. end
  2905.  
  2906. function on2Changed()
  2907. if Gui ~= nil and Text ~= nil then
  2908.  
  2909. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  2910. wait()
  2911. end
  2912. end
  2913.  
  2914. function setUpGui()
  2915. if vPlayer == nil or vPlayer:findFirstChild("PlayerGui") == nil then
  2916. return
  2917. end
  2918.  
  2919. Gui = Instance.new("ScreenGui")
  2920. Text = Instance.new("TextLabel")
  2921.  
  2922. Gui.Name = "DEDisplay"
  2923. Gui.Parent = vPlayer.PlayerGui
  2924.  
  2925. Text.BackgroundColor3 = BrickColor.Black().Color
  2926. Text.BackgroundTransparency = 1
  2927. Text.BorderColor3 = BrickColor.White().Color
  2928. Text.BorderSizePixel = 0
  2929. Text.Name = "Ammo"
  2930. Text.Parent = Gui
  2931. Text.Position = UDim2.new(0.15, 0, 0.825, 0)
  2932. Text.Size = UDim2.new(0, -60, 0, 64)
  2933. Text.FontSize = "Size18"
  2934. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  2935. Text.TextColor3 = BrickColor.White().Color
  2936. end
  2937.  
  2938. function onEquippedLocal(mouse)
  2939. vPlayer = game.Players.LocalPlayer
  2940.  
  2941. setUpGui()
  2942. end
  2943.  
  2944. function onUnequippedLocal(mouse)
  2945. if Gui then
  2946. Gui:remove()
  2947. end
  2948.  
  2949. Gui = nil
  2950. Text = nil
  2951. vPlayer = nil
  2952. end
  2953.  
  2954. Tool.Equipped:connect(onEquippedLocal)
  2955. Tool.Unequipped:connect(onUnequippedLocal)
  2956.  
  2957. Ammo.Changed:connect(onChanged)
  2958. Tool.StoredAmmo.Changed:connect(on2Changed)
  2959. end,o11)
  2960. end))
  2961. o12 = Instance.new("LocalScript")
  2962. o12.Name = "GuiScript(backup)"
  2963. o12.Parent = o1
  2964. table.insert(cors,coroutine.create(function()
  2965. wait()
  2966. RPKTHing(function()
  2967.  
  2968.  
  2969. local Tool = script.Parent
  2970. local Ammo = Tool.Ammo
  2971. local MaxAmmo = Ammo.Value
  2972.  
  2973. local vPlayer
  2974. local Gui
  2975. local Text
  2976.  
  2977. function onChanged(value)
  2978. if value == "Value" or value == Ammo.Value then
  2979. if Gui ~= nil and Text ~= nil then
  2980. if Ammo.Value >= 1 then
  2981. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  2982. elseif math.floor(Ammo.Value) == 0 then
  2983. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  2984. elseif Ammo.Value < 0 then
  2985. for i = 0, 1, 0.03 / 2 do
  2986. local Num = math.floor(i * MaxAmmo + 0.5)
  2987.  
  2988. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  2989. wait()
  2990. end
  2991. end
  2992. end
  2993. end
  2994. end
  2995.  
  2996. function on2Changed()
  2997. if Gui ~= nil and Text ~= nil then
  2998.  
  2999. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  3000. wait()
  3001. end
  3002. end
  3003.  
  3004. function setUpGui()
  3005. if vPlayer == nil or vPlayer:findFirstChild("PlayerGui") == nil then
  3006. return
  3007. end
  3008.  
  3009. Gui = Instance.new("ScreenGui")
  3010. Text = Instance.new("TextLabel")
  3011.  
  3012. Gui.Name = "DEDisplay"
  3013. Gui.Parent = vPlayer.PlayerGui
  3014.  
  3015. Text.BackgroundColor3 = BrickColor.Black().Color
  3016. Text.BackgroundTransparency = 1
  3017. Text.BorderColor3 = BrickColor.White().Color
  3018. Text.BorderSizePixel = 0
  3019. Text.Name = "Ammo"
  3020. Text.Parent = Gui
  3021. Text.Position = UDim2.new(0.15, 0, 0.825, 0)
  3022. Text.Size = UDim2.new(0, -60, 0, 64)
  3023. Text.FontSize = "Size18"
  3024. Text.Text = ""..script.Parent.Ammo.Value.."|"..script.Parent.StoredAmmo.Value..""
  3025. Text.TextColor3 = BrickColor.White().Color
  3026. end
  3027.  
  3028. function onEquippedLocal(mouse)
  3029. vPlayer = game.Players.LocalPlayer
  3030.  
  3031. setUpGui()
  3032. end
  3033.  
  3034. function onUnequippedLocal(mouse)
  3035. if Gui then
  3036. Gui:remove()
  3037. end
  3038.  
  3039. Gui = nil
  3040. Text = nil
  3041. vPlayer = nil
  3042. end
  3043.  
  3044. Tool.Equipped:connect(onEquippedLocal)
  3045. Tool.Unequipped:connect(onUnequippedLocal)
  3046.  
  3047. Ammo.Changed:connect(onChanged)
  3048. Tool.StoredAmmo.Changed:connect(on2Changed)
  3049. end,o12)
  3050. end))
  3051. o13 = Instance.new("SpecialMesh")
  3052. o13.Name = "Larm"
  3053. o13.Parent = o1
  3054. o13.Scale = Vector3.new(0.99000001, 0.99000001, 0.99000001)
  3055. o13.MeshType = Enum.MeshType.FileMesh
  3056. o14 = Instance.new("SpecialMesh")
  3057. o14.Name = "Rarm"
  3058. o14.Parent = o1
  3059. o14.Scale = Vector3.new(0.99000001, 0.99000001, 0.99000001)
  3060. o14.MeshType = Enum.MeshType.FileMesh
  3061. o15 = Instance.new("LocalScript")
  3062. o15.Name = "Zoom Script"
  3063. o15.Parent = o1
  3064. table.insert(cors,coroutine.create(function()
  3065. wait()
  3066. RPKTHing(function()
  3067. local Tool = script.Parent
  3068. a=false
  3069. cam=nil
  3070. wut = Tool.Parent
  3071.  
  3072.  
  3073.  
  3074. function onEquipped(mouse2)
  3075. mouse2.KeyDown:connect(onkeyDown)
  3076. mouse = mouse2
  3077. end
  3078. function onkeyDown(key)
  3079. if key == "q" then
  3080. if not a then
  3081. cam=game.Workspace.CurrentCamera:clone()
  3082. cam.Parent=game.Workspace
  3083. game.Workspace.CurrentCamera.CameraSubject = Tool.Zoom
  3084. game.Workspace.CurrentCamera.CameraType=1
  3085. Tool.Recoil.Value = 5
  3086. Tool.ZoomedInXD.Value = true
  3087. Tool.Parent.Humanoid.WalkSpeed = 10
  3088. a=true
  3089. else
  3090. game.Workspace.CurrentCamera.CameraSubject=game.Players.LocalPlayer.Character
  3091. game.Workspace.CurrentCamera:Remove()
  3092. game.Workspace.CurrentCamera=cam
  3093. Tool.ZoomedInXD.Value = false
  3094. Tool.Recoil.Value = 10
  3095. Tool.Parent.Humanoid.WalkSpeed = 16
  3096. a=false
  3097. end
  3098. end
  3099. end
  3100.  
  3101.  
  3102.  
  3103.  
  3104. script.Parent.Equipped:connect(onEquipped)
  3105.  
  3106. end,o15)
  3107. end))
  3108. o16 = Instance.new("BoolValue")
  3109. o16.Name = "ZoomedInXD"
  3110. o16.Parent = o1
  3111. o17 = Instance.new("Part")
  3112. o17.Name = "Flash"
  3113. o17.Parent = o1
  3114. o17.Material = Enum.Material.SmoothPlastic
  3115. o17.BrickColor = BrickColor.new("Bright orange")
  3116. o17.Transparency = 1
  3117. o17.Position = Vector3.new(-113.539955, 1.41896844, 64.0666275)
  3118. o17.Rotation = Vector3.new(90.0000076, -5.12203633e-006, 180)
  3119. o17.Anchored = true
  3120. o17.CFrame = CFrame.new(-113.539955, 1.41896844, 64.0666275, -1, -1.50995419e-007, -8.93963943e-008, 8.93963801e-008, 1.04308192e-007, -1, 1.50995433e-007, -1, -1.04308178e-007)
  3121. o17.FormFactor = Enum.FormFactor.Custom
  3122. o17.Size = Vector3.new(0.216666669, 0.516666651, 0.216666669)
  3123. o17.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3124. o17.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3125. o17.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3126. o17.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3127. o17.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3128. o17.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3129. o17.Color = Color3.new(0.854902, 0.521569, 0.254902)
  3130. o18 = Instance.new("SpecialMesh")
  3131. o18.Parent = o17
  3132. o18.Scale = Vector3.new(2, 1.70000005, 2)
  3133. o18.MeshType = Enum.MeshType.Sphere
  3134. o19 = Instance.new("Part")
  3135. o19.Name = "Mag4"
  3136. o19.Parent = o1
  3137. o19.Material = Enum.Material.SmoothPlastic
  3138. o19.BrickColor = BrickColor.new("Neon orange")
  3139. o19.Position = Vector3.new(-113.539955, 0.229444504, 60.9571648)
  3140. o19.Rotation = Vector3.new(118.099487, 3.31188382e-010, 180)
  3141. o19.Anchored = true
  3142. o19.CFrame = CFrame.new(-113.539955, 0.229444504, 60.9571648, -1, -5.07987836e-012, 5.78032761e-012, -8.24089842e-012, 0.471000105, -0.882123709, 1.93443677e-012, -0.882123709, -0.471000105)
  3143. o19.FormFactor = Enum.FormFactor.Custom
  3144. o19.Size = Vector3.new(0.200000003, 0.349999994, 0.333333343)
  3145. o19.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3146. o19.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3147. o19.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3148. o19.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3149. o19.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3150. o19.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3151. o19.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3152. o20 = Instance.new("BlockMesh")
  3153. o20.Parent = o19
  3154. o20.Scale = Vector3.new(0.833333373, 1, 1)
  3155. o21 = Instance.new("Part")
  3156. o21.Parent = o1
  3157. o21.Material = Enum.Material.SmoothPlastic
  3158. o21.BrickColor = BrickColor.new("Really black")
  3159. o21.Position = Vector3.new(-113.564957, 1.57731104, 61.0416603)
  3160. o21.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3161. o21.Anchored = true
  3162. o21.CFrame = CFrame.new(-113.564957, 1.57731104, 61.0416603, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3163. o21.FormFactor = Enum.FormFactor.Custom
  3164. o21.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3165. o21.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3166. o21.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3167. o21.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3168. o21.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3169. o21.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3170. o21.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3171. o21.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3172. o22 = Instance.new("CylinderMesh")
  3173. o22.Parent = o21
  3174. o22.Scale = Vector3.new(0.666666687, 0.333333343, 0.666666687)
  3175. o23 = Instance.new("Part")
  3176. o23.Parent = o1
  3177. o23.Material = Enum.Material.SmoothPlastic
  3178. o23.BrickColor = BrickColor.new("Neon orange")
  3179. o23.Position = Vector3.new(-113.539955, 1.48563385, 61.6083183)
  3180. o23.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3181. o23.Anchored = true
  3182. o23.CFrame = CFrame.new(-113.539955, 1.48563385, 61.6083183, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3183. o23.FormFactor = Enum.FormFactor.Custom
  3184. o23.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3185. o23.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3186. o23.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3187. o23.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3188. o23.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3189. o23.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3190. o23.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3191. o23.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3192. o24 = Instance.new("BlockMesh")
  3193. o24.Parent = o23
  3194. o24.Scale = Vector3.new(0.916666687, 0.333333343, 0.25)
  3195. o25 = Instance.new("Part")
  3196. o25.Parent = o1
  3197. o25.Material = Enum.Material.SmoothPlastic
  3198. o25.BrickColor = BrickColor.new("Really black")
  3199. o25.Position = Vector3.new(-113.639954, 1.42504084, 59.9866371)
  3200. o25.Rotation = Vector3.new(-79.9999847, -4.91393648e-010, 90)
  3201. o25.Anchored = true
  3202. o25.CFrame = CFrame.new(-113.639954, 1.42504084, 59.9866371, 7.54961107e-008, -1, -8.5764373e-012, 0.173648521, 1.31013387e-008, 0.984807789, -0.984807789, -7.43506305e-008, 0.173648506)
  3203. o25.FormFactor = Enum.FormFactor.Custom
  3204. o25.Size = Vector3.new(0.333333343, 0.200000003, 0.200000003)
  3205. o25.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3206. o25.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3207. o25.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3208. o25.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3209. o25.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3210. o25.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3211. o25.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3212. o26 = Instance.new("BlockMesh")
  3213. o26.Parent = o25
  3214. o26.Scale = Vector3.new(1, 0.0833333358, 0.25)
  3215. o27 = Instance.new("Part")
  3216. o27.Parent = o1
  3217. o27.Material = Enum.Material.SmoothPlastic
  3218. o27.BrickColor = BrickColor.new("Really black")
  3219. o27.Position = Vector3.new(-113.539955, 1.54396498, 59.6333504)
  3220. o27.Rotation = Vector3.new(90.0000153, 5.00939313e-006, 180)
  3221. o27.Anchored = true
  3222. o27.CFrame = CFrame.new(-113.539955, 1.54396498, 59.6333504, -1, -2.13552136e-012, 8.74304007e-008, -8.74304007e-008, 2.68221214e-007, -1, 2.11207028e-012, -1, -2.68221214e-007)
  3223. o27.FormFactor = Enum.FormFactor.Custom
  3224. o27.Size = Vector3.new(0.200000003, 0.316666663, 0.200000003)
  3225. o27.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3226. o27.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3227. o27.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3228. o27.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3229. o27.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3230. o27.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3231. o27.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3232. o28 = Instance.new("BlockMesh")
  3233. o28.Parent = o27
  3234. o28.Scale = Vector3.new(0.666666687, 1, 0.666666687)
  3235. o29 = Instance.new("Part")
  3236. o29.Parent = o1
  3237. o29.Material = Enum.Material.SmoothPlastic
  3238. o29.BrickColor = BrickColor.new("Really black")
  3239. o29.Position = Vector3.new(-113.503296, 1.67397296, 63.7049255)
  3240. o29.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3241. o29.Anchored = true
  3242. o29.CFrame = CFrame.new(-113.503296, 1.67397296, 63.7049255, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3243. o29.FormFactor = Enum.FormFactor.Custom
  3244. o29.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3245. o29.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3246. o29.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3247. o29.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3248. o29.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3249. o29.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3250. o29.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3251. o29.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3252. o30 = Instance.new("BlockMesh")
  3253. o30.Parent = o29
  3254. o30.Scale = Vector3.new(0.0416666679, 0.333333343, 0.116666667)
  3255. o31 = Instance.new("Part")
  3256. o31.Name = "A1"
  3257. o31.Parent = o1
  3258. o31.Material = Enum.Material.SmoothPlastic
  3259. o31.Position = Vector3.new(-113.594955, 1.53563416, 60.4333305)
  3260. o31.Rotation = Vector3.new(90.0000534, 5.02050989e-006, -180)
  3261. o31.Anchored = true
  3262. o31.CFrame = CFrame.new(-113.594955, 1.53563416, 60.4333305, -1, 1.50991113e-007, 8.76244286e-008, -8.76243078e-008, 8.19564661e-007, -1, -1.50991184e-007, -1, -8.19564661e-007)
  3263. o31.FormFactor = Enum.FormFactor.Custom
  3264. o31.Size = Vector3.new(0.200000003, 0.483333319, 0.200000003)
  3265. o31.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3266. o31.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3267. o31.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3268. o31.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3269. o31.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3270. o31.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3271. o32 = Instance.new("BlockMesh")
  3272. o32.Parent = o31
  3273. o32.Scale = Vector3.new(0.0833333358, 1, 0.583333313)
  3274. o33 = Instance.new("Part")
  3275. o33.Parent = o1
  3276. o33.Material = Enum.Material.SmoothPlastic
  3277. o33.BrickColor = BrickColor.new("Neon orange")
  3278. o33.Position = Vector3.new(-113.539955, 1.50229883, 61.1333237)
  3279. o33.Rotation = Vector3.new(-90, -5.40231693e-010, -180)
  3280. o33.Anchored = true
  3281. o33.CFrame = CFrame.new(-113.539955, 1.50229883, 61.1333237, -1, 2.13871629e-012, -9.42882144e-012, -9.42882057e-012, -1.19209389e-007, 1, 2.1387152e-012, 1, 1.19209389e-007)
  3282. o33.FormFactor = Enum.FormFactor.Custom
  3283. o33.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3284. o33.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3285. o33.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3286. o33.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3287. o33.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3288. o33.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3289. o33.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3290. o33.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3291. o34 = Instance.new("SpecialMesh")
  3292. o34.Parent = o33
  3293. o34.Scale = Vector3.new(0.916666687, 0.0833333358, 0.0833333358)
  3294. o34.MeshType = Enum.MeshType.Wedge
  3295. o35 = Instance.new("Part")
  3296. o35.Parent = o1
  3297. o35.Material = Enum.Material.SmoothPlastic
  3298. o35.BrickColor = BrickColor.new("Really black")
  3299. o35.Position = Vector3.new(-113.589958, 1.68949139, 60.6720581)
  3300. o35.Rotation = Vector3.new(92.0000153, 5.39824214e-006, -180)
  3301. o35.Anchored = true
  3302. o35.CFrame = CFrame.new(-113.589958, 1.68949139, 60.6720581, -1, 1.50990815e-007, 9.42170999e-008, -8.88901752e-008, 0.0348996483, -0.999390841, -1.54186978e-007, -0.999390841, -0.0348996483)
  3303. o35.FormFactor = Enum.FormFactor.Custom
  3304. o35.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3305. o35.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3306. o35.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3307. o35.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3308. o35.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3309. o35.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3310. o35.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3311. o35.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3312. o36 = Instance.new("BlockMesh")
  3313. o36.Parent = o35
  3314. o36.Scale = Vector3.new(0.333333343, 0.0833333358, 0.166666672)
  3315. o37 = Instance.new("Part")
  3316. o37.Parent = o1
  3317. o37.Material = Enum.Material.SmoothPlastic
  3318. o37.BrickColor = BrickColor.new("Really black")
  3319. o37.Position = Vector3.new(-113.639954, 1.31208479, 59.9074783)
  3320. o37.Rotation = Vector3.new(-79.9999847, 1.02127977e-007, 180)
  3321. o37.Anchored = true
  3322. o37.CFrame = CFrame.new(-113.639954, 1.31208479, 59.9074783, -1, -1.50989592e-007, 1.78246939e-009, 2.79745027e-008, -0.173648521, 0.984807789, -1.48386178e-007, 0.984807789, 0.173648506)
  3323. o37.FormFactor = Enum.FormFactor.Custom
  3324. o37.Size = Vector3.new(0.200000003, 0.449999988, 0.200000003)
  3325. o37.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3326. o37.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3327. o37.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3328. o37.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3329. o37.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3330. o37.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3331. o37.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3332. o38 = Instance.new("SpecialMesh")
  3333. o38.Parent = o37
  3334. o38.Scale = Vector3.new(0.0833333358, 1, 0.333333343)
  3335. o38.MeshType = Enum.MeshType.Wedge
  3336. o39 = Instance.new("Part")
  3337. o39.Parent = o1
  3338. o39.Material = Enum.Material.SmoothPlastic
  3339. o39.BrickColor = BrickColor.new("Neon orange")
  3340. o39.Position = Vector3.new(-113.539955, 1.2939744, 60.8916626)
  3341. o39.Rotation = Vector3.new(-14.9999905, 9.48099853e-007, 90)
  3342. o39.Anchored = true
  3343. o39.CFrame = CFrame.new(-113.539955, 1.2939744, 60.8916626, -4.37199184e-008, -1, 1.65474638e-008, 0.965925932, -3.79474017e-008, 0.258818895, -0.258818895, 2.72991603e-008, 0.965925932)
  3344. o39.FormFactor = Enum.FormFactor.Custom
  3345. o39.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3346. o39.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3347. o39.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3348. o39.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3349. o39.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3350. o39.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3351. o39.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3352. o39.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3353. o40 = Instance.new("CylinderMesh")
  3354. o40.Parent = o39
  3355. o40.Scale = Vector3.new(0.666666687, 0.916666687, 0.666666687)
  3356. o41 = Instance.new("Part")
  3357. o41.Name = "Mag"
  3358. o41.Parent = o1
  3359. o41.Material = Enum.Material.SmoothPlastic
  3360. o41.BrickColor = BrickColor.new("Neon orange")
  3361. o41.Position = Vector3.new(-113.539955, 1.07309115, 60.3711433)
  3362. o41.Rotation = Vector3.new(-96.9999847, -5.9200047e-006, 180)
  3363. o41.Anchored = true
  3364. o41.CFrame = CFrame.new(-113.539955, 1.07309115, 60.3711433, -1, -1.50992278e-007, -1.03323572e-007, -1.20954695e-007, 0.12186902, 0.99254626, -1.37274853e-007, 0.99254626, -0.12186902)
  3365. o41.FormFactor = Enum.FormFactor.Custom
  3366. o41.Size = Vector3.new(0.200000003, 0.333333343, 0.50999999)
  3367. o41.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3368. o41.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3369. o41.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3370. o41.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3371. o41.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3372. o41.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3373. o41.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3374. o42 = Instance.new("BlockMesh")
  3375. o42.Parent = o41
  3376. o42.Scale = Vector3.new(0.833333373, 1, 1)
  3377. o43 = Instance.new("Part")
  3378. o43.Name = "A2"
  3379. o43.Parent = o1
  3380. o43.Material = Enum.Material.SmoothPlastic
  3381. o43.Position = Vector3.new(-113.686623, 1.50230181, 60.6583405)
  3382. o43.Rotation = Vector3.new(90.0000076, 6.21862455e-008, -180)
  3383. o43.Anchored = true
  3384. o43.CFrame = CFrame.new(-113.686623, 1.50230181, 60.6583405, -1, 1.50991127e-007, 1.0853547e-009, -1.08533893e-009, 1.04308192e-007, -1, -1.50991127e-007, -1, -1.04308192e-007)
  3385. o43.FormFactor = Enum.FormFactor.Custom
  3386. o43.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3387. o43.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3388. o43.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3389. o43.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3390. o43.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3391. o43.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3392. o43.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3393. o44 = Instance.new("BlockMesh")
  3394. o44.Parent = o43
  3395. o44.Scale = Vector3.new(0.833333373, 0.166666672, 0.25)
  3396. o45 = Instance.new("Part")
  3397. o45.Name = "Handle"
  3398. o45.Parent = o1
  3399. o45.Material = Enum.Material.SmoothPlastic
  3400. o45.BrickColor = BrickColor.new("Really black")
  3401. o45.Transparency = 1
  3402. o45.Position = Vector3.new(-113.539955, 1.01230443, 59.8150177)
  3403. o45.Rotation = Vector3.new(-179.999985, 1.15806685e-007, 180)
  3404. o45.Anchored = true
  3405. o45.CFrame = CFrame.new(-113.539955, 1.01230443, 59.8150177, -1, -1.51002368e-007, 2.02120787e-009, -1.51002368e-007, 1, 3.27825802e-007, -2.02125738e-009, 3.27825802e-007, -1)
  3406. o45.FormFactor = Enum.FormFactor.Custom
  3407. o45.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3408. o45.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3409. o45.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3410. o45.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3411. o45.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3412. o45.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3413. o45.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3414. o45.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3415. o46 = Instance.new("BlockMesh")
  3416. o46.Parent = o45
  3417. o46.Scale = Vector3.new(0.166666672, 0.75, 0.166666672)
  3418. o47 = Instance.new("Sound")
  3419. o47.Name = "Empty"
  3420. o47.Parent = o45
  3421. o47.SoundId = "rbxasset://sounds//clickfast.wav"
  3422. o47.Volume = 1
  3423. o48 = Instance.new("Sound")
  3424. o48.Name = "M1"
  3425. o48.Parent = o45
  3426. o48.Pitch = 1
  3427. o48.SoundId = "http://roblox.com/asset/?id=233931573"
  3428. o48.Volume = 1
  3429. o49 = Instance.new("Sound")
  3430. o49.Name = "M2"
  3431. o49.Pitch = 1.7
  3432. o49.Parent = o45
  3433. o49.SoundId = "http://roblox.com/asset/?id=147323220"
  3434. o49.Volume = 1
  3435. o50 = Instance.new("Sound")
  3436. o50.Name = "Fire"
  3437. o50.Parent = o45
  3438. o50.Pitch = 1.25
  3439. o50.Volume = 4
  3440. o50.SoundId = "http://roblox.com/asset/?id=258193800"
  3441. o50.PlayOnRemove = true
  3442. o51 = Instance.new("Sound")
  3443. o51.Name = "M3"
  3444. o51.Parent = o45
  3445. o51.SoundId = "http://roblox.com/asset/?id=152206337"
  3446. o51.Volume = 1
  3447. o51.PlayOnRemove = true
  3448. o53 = Instance.new("Part")
  3449. o53.Name = "Mag2"
  3450. o53.Parent = o1
  3451. o53.Material = Enum.Material.SmoothPlastic
  3452. o53.BrickColor = BrickColor.new("Neon orange")
  3453. o53.Position = Vector3.new(-113.539955, 0.701820016, 60.4757118)
  3454. o53.Rotation = Vector3.new(-117.412865, -4.27430313e-010, 180)
  3455. o53.Anchored = true
  3456. o53.CFrame = CFrame.new(-113.539955, 0.701820016, 60.4757118, -1, -1.888052e-012, -7.46006642e-012, -8.24089842e-012, 0.460395187, 0.88770467, 1.93443677e-012, 0.88770467, -0.460395187)
  3457. o53.FormFactor = Enum.FormFactor.Custom
  3458. o53.Size = Vector3.new(0.200000003, 0.333333343, 0.400000006)
  3459. o53.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3460. o53.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3461. o53.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3462. o53.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3463. o53.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3464. o53.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3465. o53.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3466. o54 = Instance.new("BlockMesh")
  3467. o54.Parent = o53
  3468. o54.Scale = Vector3.new(0.833333373, 1, 1)
  3469. o55 = Instance.new("Part")
  3470. o55.Name = "Mag3"
  3471. o55.Parent = o1
  3472. o55.Material = Enum.Material.SmoothPlastic
  3473. o55.BrickColor = BrickColor.new("Neon orange")
  3474. o55.Position = Vector3.new(-113.539955, 0.422861636, 60.6890869)
  3475. o55.Rotation = Vector3.new(133.099686, 2.44571335e-010, 180)
  3476. o55.Anchored = true
  3477. o55.CFrame = CFrame.new(-113.539955, 0.422861636, 60.6890869, -1, -6.40285958e-012, 4.26857508e-012, -8.24089842e-012, 0.683264196, -0.730159819, 1.93443677e-012, -0.730159819, -0.683264196)
  3478. o55.FormFactor = Enum.FormFactor.Custom
  3479. o55.Size = Vector3.new(0.200000003, 0.449999988, 0.333333343)
  3480. o55.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3481. o55.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3482. o55.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3483. o55.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3484. o55.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3485. o55.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3486. o55.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3487. o56 = Instance.new("BlockMesh")
  3488. o56.Parent = o55
  3489. o56.Scale = Vector3.new(0.833333373, 1, 1)
  3490. o57 = Instance.new("Part")
  3491. o57.Parent = o1
  3492. o57.Material = Enum.Material.SmoothPlastic
  3493. o57.BrickColor = BrickColor.new("Really black")
  3494. o57.Position = Vector3.new(-113.539955, 1.20230353, 59.8150177)
  3495. o57.Rotation = Vector3.new(-179.999985, 1.15806685e-007, 180)
  3496. o57.Anchored = true
  3497. o57.CFrame = CFrame.new(-113.539955, 1.20230353, 59.8150177, -1, -1.51002368e-007, 2.02120787e-009, -1.51002368e-007, 1, 3.27825802e-007, -2.02125738e-009, 3.27825802e-007, -1)
  3498. o57.FormFactor = Enum.FormFactor.Custom
  3499. o57.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3500. o57.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3501. o57.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3502. o57.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3503. o57.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3504. o57.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3505. o57.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3506. o57.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3507. o58 = Instance.new("BlockMesh")
  3508. o58.Parent = o57
  3509. o58.Scale = Vector3.new(0.166666672, 0.75, 0.166666672)
  3510. o59 = Instance.new("Sound")
  3511. o59.Name = "Empty"
  3512. o59.Parent = o57
  3513. o59.SoundId = "rbxasset://sounds//clickfast.wav"
  3514. o59.Volume = 1
  3515. o60 = Instance.new("Sound")
  3516. o60.Name = "M1"
  3517. o60.Parent = o57
  3518. o60.Pitch = 1
  3519. o60.SoundId = "http://roblox.com/asset/?id=233931573"
  3520. o60.Volume = 1
  3521. o61 = Instance.new("Sound")
  3522. o61.Name = "M2"
  3523. o61.Parent = o57
  3524. o61.Pitch = 1.7
  3525. o61.SoundId = "http://roblox.com/asset/?id=147323220"
  3526. o61.Volume = 1
  3527. o62 = Instance.new("Sound")
  3528. o62.Name = "Fire"
  3529. o62.Parent = o57
  3530. o62.Pitch = 1.25
  3531. o62.SoundId = "http://roblox.com/asset/?id=258193800"
  3532. o62.PlayOnRemove = true
  3533. o62.Volume = 4
  3534. o63 = Instance.new("Sound")
  3535. o63.Name = "M3"
  3536. o63.Parent = o57
  3537. o63.SoundId = "http://roblox.com/asset/?id=10209881"
  3538. o63.Volume = 1
  3539. o63.PlayOnRemove = true
  3540. o64 = Instance.new("Part")
  3541. o64.Parent = o1
  3542. o64.Material = Enum.Material.SmoothPlastic
  3543. o64.BrickColor = BrickColor.new("Neon orange")
  3544. o64.Position = Vector3.new(-113.539955, 1.50229979, 61.2999878)
  3545. o64.Rotation = Vector3.new(-89.9999924, -5.01429398e-010, 1.22437713e-010)
  3546. o64.Anchored = true
  3547. o64.CFrame = CFrame.new(-113.539955, 1.50229979, 61.2999878, 1, -2.13694123e-012, -8.75159407e-012, 8.75159493e-012, 2.38418806e-007, 1, -2.13693885e-012, -1, 2.38418806e-007)
  3548. o64.FormFactor = Enum.FormFactor.Custom
  3549. o64.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3550. o64.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3551. o64.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3552. o64.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3553. o64.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3554. o64.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3555. o64.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3556. o64.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3557. o65 = Instance.new("SpecialMesh")
  3558. o65.Parent = o64
  3559. o65.Scale = Vector3.new(0.916666687, 0.0833333358, 0.0833333358)
  3560. o65.MeshType = Enum.MeshType.Wedge
  3561. o66 = Instance.new("Part")
  3562. o66.Parent = o1
  3563. o66.Material = Enum.Material.SmoothPlastic
  3564. o66.BrickColor = BrickColor.new("Neon orange")
  3565. o66.Position = Vector3.new(-113.5373, 0.891278505, 58.2646141)
  3566. o66.Rotation = Vector3.new(-180, -2.50457879e-006, -4.2913037e-010)
  3567. o66.Anchored = true
  3568. o66.CFrame = CFrame.new(-113.5373, 0.891278505, 58.2646141, 1, 7.489738e-012, -4.37131469e-008, 8.24089842e-012, -0.999991596, 4.37110295e-008, -4.3712955e-008, -4.37110295e-008, -0.999991596)
  3569. o66.CanCollide = false
  3570. o66.FormFactor = Enum.FormFactor.Symmetric
  3571. o66.Size = Vector3.new(1, 1, 1)
  3572. o66.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3573. o66.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3574. o66.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3575. o66.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3576. o66.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3577. o66.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3578. o66.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3579. o67 = Instance.new("SpecialMesh")
  3580. o67.Parent = o66
  3581. o67.Scale = Vector3.new(0.192307696, 0.0384615399, 0.653846145)
  3582. o67.MeshType = Enum.MeshType.Wedge
  3583. o68 = Instance.new("Part")
  3584. o68.Parent = o1
  3585. o68.Material = Enum.Material.SmoothPlastic
  3586. o68.BrickColor = BrickColor.new("Really black")
  3587. o68.Position = Vector3.new(-113.539955, 1.49396372, 62.1166382)
  3588. o68.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3589. o68.Anchored = true
  3590. o68.CFrame = CFrame.new(-113.539955, 1.49396372, 62.1166382, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3591. o68.FormFactor = Enum.FormFactor.Custom
  3592. o68.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3593. o68.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3594. o68.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3595. o68.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3596. o68.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3597. o68.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3598. o68.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3599. o68.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3600. o69 = Instance.new("BlockMesh")
  3601. o69.Parent = o68
  3602. o69.Scale = Vector3.new(0.333333343, 0.0833333358, 0.666666687)
  3603. o70 = Instance.new("Part")
  3604. o70.Parent = o1
  3605. o70.Material = Enum.Material.SmoothPlastic
  3606. o70.BrickColor = BrickColor.new("Neon orange")
  3607. o70.Position = Vector3.new(-113.539955, 1.11064351, 59.6583519)
  3608. o70.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3609. o70.Anchored = true
  3610. o70.CFrame = CFrame.new(-113.539955, 1.11064351, 59.6583519, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3611. o70.FormFactor = Enum.FormFactor.Custom
  3612. o70.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3613. o70.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3614. o70.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3615. o70.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3616. o70.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3617. o70.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3618. o70.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3619. o70.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3620. o71 = Instance.new("BlockMesh")
  3621. o71.Parent = o70
  3622. o71.Scale = Vector3.new(0.916666687, 0.5, 0.333333343)
  3623. o72 = Instance.new("Part")
  3624. o72.Parent = o1
  3625. o72.Material = Enum.Material.SmoothPlastic
  3626. o72.BrickColor = BrickColor.new("Neon orange")
  3627. o72.Position = Vector3.new(-113.539955, 1.50229979, 61.5666542)
  3628. o72.Rotation = Vector3.new(-89.9999924, -4.79929207e-010, 1.22844804e-010)
  3629. o72.Anchored = true
  3630. o72.CFrame = CFrame.new(-113.539955, 1.50229979, 61.5666542, 1, -2.14404623e-012, -8.37634476e-012, 8.37634562e-012, 2.23517574e-007, 1, -2.14404427e-012, -1, 2.23517588e-007)
  3631. o72.FormFactor = Enum.FormFactor.Custom
  3632. o72.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3633. o72.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3634. o72.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3635. o72.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3636. o72.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3637. o72.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3638. o72.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3639. o72.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3640. o73 = Instance.new("SpecialMesh")
  3641. o73.Parent = o72
  3642. o73.Scale = Vector3.new(0.916666687, 0.0833333358, 0.0833333358)
  3643. o73.MeshType = Enum.MeshType.Wedge
  3644. o74 = Instance.new("Part")
  3645. o74.Parent = o1
  3646. o74.Material = Enum.Material.SmoothPlastic
  3647. o74.BrickColor = BrickColor.new("Really black")
  3648. o74.Position = Vector3.new(-113.539955, 1.06898797, 59.508358)
  3649. o74.Rotation = Vector3.new(-89.9999924, -5.20843257e-010, 1.22437671e-010)
  3650. o74.Anchored = true
  3651. o74.CFrame = CFrame.new(-113.539955, 1.06898797, 59.508358, 1, -2.13694058e-012, -9.0904298e-012, 9.0904298e-012, 1.63912873e-007, 1, -2.13693885e-012, -1, 1.63912887e-007)
  3652. o74.FormFactor = Enum.FormFactor.Custom
  3653. o74.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3654. o74.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3655. o74.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3656. o74.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3657. o74.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3658. o74.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3659. o74.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3660. o74.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3661. o75 = Instance.new("BlockMesh")
  3662. o75.Parent = o74
  3663. o75.Scale = Vector3.new(0.916666687, 1, 0.75)
  3664. o76 = Instance.new("Part")
  3665. o76.Parent = o1
  3666. o76.Material = Enum.Material.SmoothPlastic
  3667. o76.BrickColor = BrickColor.new("Neon orange")
  3668. o76.Position = Vector3.new(-113.539955, 1.48563385, 61.3499832)
  3669. o76.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3670. o76.Anchored = true
  3671. o76.CFrame = CFrame.new(-113.539955, 1.48563385, 61.3499832, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3672. o76.FormFactor = Enum.FormFactor.Custom
  3673. o76.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3674. o76.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3675. o76.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3676. o76.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3677. o76.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3678. o76.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3679. o76.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3680. o76.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3681. o77 = Instance.new("BlockMesh")
  3682. o77.Parent = o76
  3683. o77.Scale = Vector3.new(0.916666687, 0.416666687, 0.25)
  3684. o78 = Instance.new("Part")
  3685. o78.Parent = o1
  3686. o78.Material = Enum.Material.SmoothPlastic
  3687. o78.BrickColor = BrickColor.new("Really black")
  3688. o78.Position = Vector3.new(-113.539955, 1.09897149, 59.8350143)
  3689. o78.Rotation = Vector3.new(-119.999992, 5.93669711e-006, -1.54809596e-010)
  3690. o78.Anchored = true
  3691. o78.CFrame = CFrame.new(-113.539955, 1.09897149, 59.8350143, 1, 2.7019372e-012, 1.03614909e-007, -8.97317989e-008, -0.499999911, 0.866025507, 5.18097814e-008, -0.866025507, -0.499999911)
  3692. o78.FormFactor = Enum.FormFactor.Custom
  3693. o78.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3694. o78.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3695. o78.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3696. o78.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3697. o78.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3698. o78.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3699. o78.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3700. o78.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3701. o79 = Instance.new("SpecialMesh")
  3702. o79.Parent = o78
  3703. o79.Scale = Vector3.new(0.166666672, 0.166666672, 0.416666687)
  3704. o79.MeshType = Enum.MeshType.Wedge
  3705. o80 = Instance.new("Part")
  3706. o80.Parent = o1
  3707. o80.Material = Enum.Material.SmoothPlastic
  3708. o80.BrickColor = BrickColor.new("Neon orange")
  3709. o80.Position = Vector3.new(-113.5373, 1.04512715, 58.2646141)
  3710. o80.Rotation = Vector3.new(2.50447852e-006, 2.50457879e-006, 4.2913037e-010)
  3711. o80.Anchored = true
  3712. o80.CFrame = CFrame.new(-113.5373, 1.04512715, 58.2646141, 1, -7.489738e-012, 4.37131469e-008, 8.24089842e-012, 0.999991596, -4.37110295e-008, -4.3712955e-008, 4.37110295e-008, 0.999991596)
  3713. o80.CanCollide = false
  3714. o80.FormFactor = Enum.FormFactor.Symmetric
  3715. o80.Size = Vector3.new(1, 1, 1)
  3716. o80.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3717. o80.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3718. o80.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3719. o80.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3720. o80.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3721. o80.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3722. o80.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3723. o81 = Instance.new("BlockMesh")
  3724. o81.Parent = o80
  3725. o81.Scale = Vector3.new(0.192307696, 0.269230783, 0.653846145)
  3726. o82 = Instance.new("Part")
  3727. o82.Parent = o1
  3728. o82.Material = Enum.Material.SmoothPlastic
  3729. o82.BrickColor = BrickColor.new("Neon orange")
  3730. o82.Position = Vector3.new(-113.539955, 1.50229883, 61.3999901)
  3731. o82.Rotation = Vector3.new(-90, -5.61757252e-010, -180)
  3732. o82.Anchored = true
  3733. o82.CFrame = CFrame.new(-113.539955, 1.50229883, 61.3999901, -1, 2.14582128e-012, -9.80451397e-012, -9.80451397e-012, -1.04308192e-007, 1, 2.14582041e-012, 1, 1.04308192e-007)
  3734. o82.FormFactor = Enum.FormFactor.Custom
  3735. o82.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3736. o82.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3737. o82.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3738. o82.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3739. o82.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3740. o82.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3741. o82.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3742. o82.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3743. o83 = Instance.new("SpecialMesh")
  3744. o83.Parent = o82
  3745. o83.Scale = Vector3.new(0.916666687, 0.0833333358, 0.0833333358)
  3746. o83.MeshType = Enum.MeshType.Wedge
  3747. o84 = Instance.new("Part")
  3748. o84.Parent = o1
  3749. o84.Material = Enum.Material.SmoothPlastic
  3750. o84.BrickColor = BrickColor.new("Really black")
  3751. o84.Position = Vector3.new(-113.539955, 1.6573081, 60.983326)
  3752. o84.Rotation = Vector3.new(90.0000076, 5.29337331e-006, -180)
  3753. o84.Anchored = true
  3754. o84.CFrame = CFrame.new(-113.539955, 1.6573081, 60.983326, -1, 1.50991141e-007, 9.23867916e-008, -9.2386756e-008, 1.93715223e-007, -1, -1.50991141e-007, -1, -1.93715223e-007)
  3755. o84.FormFactor = Enum.FormFactor.Custom
  3756. o84.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3757. o84.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3758. o84.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3759. o84.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3760. o84.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3761. o84.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3762. o84.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3763. o84.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3764. o85 = Instance.new("BlockMesh")
  3765. o85.Parent = o84
  3766. o85.Scale = Vector3.new(0.666666687, 0.25, 0.25)
  3767. o86 = Instance.new("Part")
  3768. o86.Parent = o1
  3769. o86.Material = Enum.Material.SmoothPlastic
  3770. o86.BrickColor = BrickColor.new("Dark stone grey")
  3771. o86.Position = Vector3.new(-113.539955, 1.61896086, 61.0416603)
  3772. o86.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3773. o86.Anchored = true
  3774. o86.CFrame = CFrame.new(-113.539955, 1.61896086, 61.0416603, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3775. o86.FormFactor = Enum.FormFactor.Custom
  3776. o86.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3777. o86.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3778. o86.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3779. o86.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3780. o86.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3781. o86.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3782. o86.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3783. o86.Color = Color3.new(0.388235, 0.372549, 0.384314)
  3784. o87 = Instance.new("BlockMesh")
  3785. o87.Parent = o86
  3786. o87.Scale = Vector3.new(0.25, 0.333333343, 0.25)
  3787. o88 = Instance.new("Part")
  3788. o88.Parent = o1
  3789. o88.Material = Enum.Material.SmoothPlastic
  3790. o88.BrickColor = BrickColor.new("Really black")
  3791. o88.Position = Vector3.new(-113.569962, 1.69896829, 63.7049255)
  3792. o88.Rotation = Vector3.new(-90, 24.9996357, -2.59040348e-007)
  3793. o88.Anchored = true
  3794. o88.CFrame = CFrame.new(-113.569962, 1.69896829, 63.7049255, 0.906310558, 4.09752721e-009, 0.422612488, -0.422612458, 1.3219902e-007, 0.906310558, -5.21553183e-008, -1, 1.21545028e-007)
  3795. o88.FormFactor = Enum.FormFactor.Custom
  3796. o88.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3797. o88.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3798. o88.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3799. o88.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3800. o88.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3801. o88.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3802. o88.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3803. o88.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3804. o89 = Instance.new("BlockMesh")
  3805. o89.Parent = o88
  3806. o89.Scale = Vector3.new(0.0416666679, 0.333333343, 0.166666672)
  3807. o90 = Instance.new("Part")
  3808. o90.Parent = o1
  3809. o90.Material = Enum.Material.SmoothPlastic
  3810. o90.BrickColor = BrickColor.new("Really black")
  3811. o90.Position = Vector3.new(-113.639954, 1.38396943, 59.6916847)
  3812. o90.Rotation = Vector3.new(-89.9999924, -5.20461618e-010, 90)
  3813. o90.Anchored = true
  3814. o90.CFrame = CFrame.new(-113.639954, 1.38396943, 59.6916847, 7.54973826e-008, -1, -9.08376846e-012, 2.23517574e-007, -9.06689307e-012, 1, -1, -7.54973826e-008, 2.23517588e-007)
  3815. o90.FormFactor = Enum.FormFactor.Custom
  3816. o90.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3817. o90.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3818. o90.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3819. o90.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3820. o90.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3821. o90.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3822. o90.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3823. o90.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3824. o91 = Instance.new("CylinderMesh")
  3825. o91.Parent = o90
  3826. o91.Scale = Vector3.new(0.666666687, 0.0833333358, 0.666666687)
  3827. o92 = Instance.new("Part")
  3828. o92.Parent = o1
  3829. o92.Material = Enum.Material.SmoothPlastic
  3830. o92.BrickColor = BrickColor.new("Really black")
  3831. o92.Position = Vector3.new(-113.48996, 1.68949139, 60.6720581)
  3832. o92.Rotation = Vector3.new(92.0000153, 5.39824214e-006, -180)
  3833. o92.Anchored = true
  3834. o92.CFrame = CFrame.new(-113.48996, 1.68949139, 60.6720581, -1, 1.50990815e-007, 9.42170999e-008, -8.88901752e-008, 0.0348996483, -0.999390841, -1.54186978e-007, -0.999390841, -0.0348996483)
  3835. o92.FormFactor = Enum.FormFactor.Custom
  3836. o92.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3837. o92.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3838. o92.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3839. o92.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3840. o92.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3841. o92.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3842. o92.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3843. o92.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3844. o93 = Instance.new("BlockMesh")
  3845. o93.Parent = o92
  3846. o93.Scale = Vector3.new(0.333333343, 0.0833333358, 0.166666672)
  3847. o94 = Instance.new("Part")
  3848. o94.Parent = o1
  3849. o94.Material = Enum.Material.SmoothPlastic
  3850. o94.BrickColor = BrickColor.new("Really black")
  3851. o94.Position = Vector3.new(-113.539955, 1.52947271, 63.6085854)
  3852. o94.Rotation = Vector3.new(-59.9999962, -3.89844712e-010, 3.66455755e-010)
  3853. o94.Anchored = true
  3854. o94.CFrame = CFrame.new(-113.539955, 1.52947271, 63.6085854, 1, -6.39585954e-012, -6.8040738e-012, 9.0904298e-012, 0.500000119, 0.866025388, -2.13693885e-012, -0.866025388, 0.500000119)
  3855. o94.FormFactor = Enum.FormFactor.Custom
  3856. o94.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3857. o94.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3858. o94.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3859. o94.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3860. o94.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3861. o94.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3862. o94.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3863. o94.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3864. o95 = Instance.new("BlockMesh")
  3865. o95.Parent = o94
  3866. o95.Scale = Vector3.new(0.333333343, 0.0833333358, 0.583333313)
  3867. o96 = Instance.new("Part")
  3868. o96.Parent = o1
  3869. o96.Material = Enum.Material.SmoothPlastic
  3870. o96.BrickColor = BrickColor.new("Neon orange")
  3871. o96.Position = Vector3.new(-113.5373, 1.04512715, 58.7069168)
  3872. o96.Rotation = Vector3.new(-180, -2.50457879e-006, -4.2913037e-010)
  3873. o96.Anchored = true
  3874. o96.CFrame = CFrame.new(-113.5373, 1.04512715, 58.7069168, 1, 7.489738e-012, -4.37131469e-008, 8.24089842e-012, -0.999991596, 4.37110295e-008, -4.3712955e-008, -4.37110295e-008, -0.999991596)
  3875. o96.CanCollide = false
  3876. o96.FormFactor = Enum.FormFactor.Symmetric
  3877. o96.Size = Vector3.new(1, 1, 1)
  3878. o96.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3879. o96.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3880. o96.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3881. o96.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3882. o96.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3883. o96.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3884. o96.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3885. o97 = Instance.new("SpecialMesh")
  3886. o97.Parent = o96
  3887. o97.Scale = Vector3.new(0.192307696, 0.269230783, 0.230769232)
  3888. o97.MeshType = Enum.MeshType.Wedge
  3889. o98 = Instance.new("Part")
  3890. o98.Parent = o1
  3891. o98.Material = Enum.Material.SmoothPlastic
  3892. o98.BrickColor = BrickColor.new("Neon orange")
  3893. o98.Position = Vector3.new(-113.5373, 1.23742986, 58.3800011)
  3894. o98.Rotation = Vector3.new(2.50447852e-006, 2.50457879e-006, 4.2913037e-010)
  3895. o98.Anchored = true
  3896. o98.CFrame = CFrame.new(-113.5373, 1.23742986, 58.3800011, 1, -7.489738e-012, 4.37131469e-008, 8.24089842e-012, 0.999991596, -4.37110295e-008, -4.3712955e-008, 4.37110295e-008, 0.999991596)
  3897. o98.CanCollide = false
  3898. o98.FormFactor = Enum.FormFactor.Symmetric
  3899. o98.Size = Vector3.new(1, 1, 1)
  3900. o98.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3901. o98.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3902. o98.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3903. o98.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3904. o98.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3905. o98.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3906. o98.Color = Color3.new(0.835294, 0.45098, 0.239216)
  3907. o99 = Instance.new("BlockMesh")
  3908. o99.Parent = o98
  3909. o99.Scale = Vector3.new(0.192307696, 0.115384616, 0.884615362)
  3910. o100 = Instance.new("Part")
  3911. o100.Parent = o1
  3912. o100.Material = Enum.Material.SmoothPlastic
  3913. o100.BrickColor = BrickColor.new("Dark stone grey")
  3914. o100.Position = Vector3.new(-113.539955, 1.33564579, 59.3583641)
  3915. o100.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3916. o100.Anchored = true
  3917. o100.CFrame = CFrame.new(-113.539955, 1.33564579, 59.3583641, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3918. o100.FormFactor = Enum.FormFactor.Custom
  3919. o100.Size = Vector3.new(0.200000003, 0.200000003, 0.216666669)
  3920. o100.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3921. o100.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3922. o100.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3923. o100.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3924. o100.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3925. o100.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3926. o100.Color = Color3.new(0.388235, 0.372549, 0.384314)
  3927. o101 = Instance.new("BlockMesh")
  3928. o101.Parent = o100
  3929. o101.Scale = Vector3.new(0.833333373, 0.5, 1)
  3930. o102 = Instance.new("Part")
  3931. o102.Parent = o1
  3932. o102.Material = Enum.Material.SmoothPlastic
  3933. o102.BrickColor = BrickColor.new("Really black")
  3934. o102.Position = Vector3.new(-113.539955, 1.41896677, 61.7166557)
  3935. o102.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3936. o102.Anchored = true
  3937. o102.CFrame = CFrame.new(-113.539955, 1.41896677, 61.7166557, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3938. o102.FormFactor = Enum.FormFactor.Custom
  3939. o102.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3940. o102.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3941. o102.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3942. o102.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3943. o102.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3944. o102.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3945. o102.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3946. o102.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3947. o103 = Instance.new("CylinderMesh")
  3948. o103.Parent = o102
  3949. o103.Scale = Vector3.new(0.583333313, 0.25, 0.583333313)
  3950. o104 = Instance.new("Part")
  3951. o104.Parent = o1
  3952. o104.Material = Enum.Material.SmoothPlastic
  3953. o104.BrickColor = BrickColor.new("Really black")
  3954. o104.Position = Vector3.new(-113.539955, 1.41896856, 63.2416458)
  3955. o104.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3956. o104.Anchored = true
  3957. o104.CFrame = CFrame.new(-113.539955, 1.41896856, 63.2416458, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3958. o104.FormFactor = Enum.FormFactor.Custom
  3959. o104.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3960. o104.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3961. o104.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3962. o104.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3963. o104.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3964. o104.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3965. o104.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3966. o104.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3967. o105 = Instance.new("CylinderMesh")
  3968. o105.Parent = o104
  3969. o105.Scale = Vector3.new(0.5, 1, 0.5)
  3970. o106 = Instance.new("Part")
  3971. o106.Parent = o1
  3972. o106.Material = Enum.Material.SmoothPlastic
  3973. o106.BrickColor = BrickColor.new("Really black")
  3974. o106.Position = Vector3.new(-113.539955, 1.37730253, 63.4383125)
  3975. o106.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  3976. o106.Anchored = true
  3977. o106.CFrame = CFrame.new(-113.539955, 1.37730253, 63.4383125, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  3978. o106.FormFactor = Enum.FormFactor.Custom
  3979. o106.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  3980. o106.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  3981. o106.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  3982. o106.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  3983. o106.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  3984. o106.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  3985. o106.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  3986. o106.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  3987. o107 = Instance.new("BlockMesh")
  3988. o107.Parent = o106
  3989. o107.Scale = Vector3.new(0.166666672, 0.5, 0.333333343)
  3990. o108 = Instance.new("Part")
  3991. o108.Parent = o1
  3992. o108.Material = Enum.Material.SmoothPlastic
  3993. o108.BrickColor = BrickColor.new("Really black")
  3994. o108.Position = Vector3.new(-113.539955, 1.18563902, 60.0650139)
  3995. o108.Rotation = Vector3.new(-89.9999924, -5.91999378e-006, 180)
  3996. o108.Anchored = true
  3997. o108.CFrame = CFrame.new(-113.539955, 1.18563902, 60.0650139, -1, -1.50991156e-007, -1.0332338e-007, -1.03323345e-007, -2.23517574e-007, 1, -1.5099117e-007, 1, 2.23517574e-007)
  3998. o108.FormFactor = Enum.FormFactor.Custom
  3999. o108.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4000. o108.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4001. o108.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4002. o108.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4003. o108.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4004. o108.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4005. o108.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4006. o108.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4007. o109 = Instance.new("BlockMesh")
  4008. o109.Parent = o108
  4009. o109.Scale = Vector3.new(0.833333373, 0.5, 0.916666687)
  4010. o110 = Instance.new("Part")
  4011. o110.Parent = o1
  4012. o110.Material = Enum.Material.SmoothPlastic
  4013. o110.BrickColor = BrickColor.new("Neon orange")
  4014. o110.Position = Vector3.new(-113.514954, 1.57730913, 61.6666527)
  4015. o110.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4016. o110.Anchored = true
  4017. o110.CFrame = CFrame.new(-113.514954, 1.57730913, 61.6666527, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4018. o110.FormFactor = Enum.FormFactor.Custom
  4019. o110.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4020. o110.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4021. o110.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4022. o110.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4023. o110.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4024. o110.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4025. o110.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4026. o110.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4027. o111 = Instance.new("CylinderMesh")
  4028. o111.Parent = o110
  4029. o111.Scale = Vector3.new(0.666666687, 0.25, 0.666666687)
  4030. o112 = Instance.new("Part")
  4031. o112.Parent = o1
  4032. o112.Material = Enum.Material.SmoothPlastic
  4033. o112.BrickColor = BrickColor.new("Really black")
  4034. o112.Position = Vector3.new(-113.539955, 1.56063223, 61.9083138)
  4035. o112.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4036. o112.Anchored = true
  4037. o112.CFrame = CFrame.new(-113.539955, 1.56063223, 61.9083138, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4038. o112.FormFactor = Enum.FormFactor.Custom
  4039. o112.Size = Vector3.new(0.200000003, 0.433333337, 0.200000003)
  4040. o112.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4041. o112.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4042. o112.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4043. o112.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4044. o112.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4045. o112.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4046. o112.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4047. o113 = Instance.new("CylinderMesh")
  4048. o113.Parent = o112
  4049. o113.Scale = Vector3.new(0.333333343, 1, 0.333333343)
  4050. o114 = Instance.new("Part")
  4051. o114.Parent = o1
  4052. o114.Material = Enum.Material.SmoothPlastic
  4053. o114.BrickColor = BrickColor.new("Really black")
  4054. o114.Position = Vector3.new(-113.539955, 1.20231974, 59.5666847)
  4055. o114.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4056. o114.Anchored = true
  4057. o114.CFrame = CFrame.new(-113.539955, 1.20231974, 59.5666847, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4058. o114.FormFactor = Enum.FormFactor.Custom
  4059. o114.Size = Vector3.new(0.200000003, 0.316666663, 0.200000003)
  4060. o114.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4061. o114.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4062. o114.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4063. o114.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4064. o114.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4065. o114.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4066. o114.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4067. o115 = Instance.new("BlockMesh")
  4068. o115.Parent = o114
  4069. o115.Scale = Vector3.new(0.833333373, 1, 0.583333313)
  4070. o116 = Instance.new("Part")
  4071. o116.Parent = o1
  4072. o116.Material = Enum.Material.SmoothPlastic
  4073. o116.BrickColor = BrickColor.new("Neon orange")
  4074. o116.Position = Vector3.new(-113.539955, 1.43563318, 61.6666527)
  4075. o116.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4076. o116.Anchored = true
  4077. o116.CFrame = CFrame.new(-113.539955, 1.43563318, 61.6666527, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4078. o116.FormFactor = Enum.FormFactor.Custom
  4079. o116.Size = Vector3.new(0.200000003, 0.200000003, 0.283333331)
  4080. o116.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4081. o116.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4082. o116.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4083. o116.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4084. o116.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4085. o116.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4086. o116.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4087. o117 = Instance.new("BlockMesh")
  4088. o117.Parent = o116
  4089. o117.Scale = Vector3.new(0.916666687, 0.25, 1)
  4090. o118 = Instance.new("Part")
  4091. o118.Parent = o1
  4092. o118.Material = Enum.Material.SmoothPlastic
  4093. o118.BrickColor = BrickColor.new("Really black")
  4094. o118.Position = Vector3.new(-113.48996, 1.67825508, 60.750042)
  4095. o118.Rotation = Vector3.new(-87.9999847, -2.80858876e-006, 90)
  4096. o118.Anchored = true
  4097. o118.CFrame = CFrame.new(-113.48996, 1.67825508, 60.750042, -4.37141736e-008, -1, -4.90191212e-008, 0.0348996781, -5.0514867e-008, 0.999390841, -0.999390841, 4.197679e-008, 0.0348996781)
  4098. o118.FormFactor = Enum.FormFactor.Custom
  4099. o118.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4100. o118.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4101. o118.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4102. o118.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4103. o118.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4104. o118.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4105. o118.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4106. o118.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4107. o119 = Instance.new("CylinderMesh")
  4108. o119.Parent = o118
  4109. o119.Scale = Vector3.new(0.25, 0.333333343, 0.25)
  4110. o120 = Instance.new("Part")
  4111. o120.Parent = o1
  4112. o120.Material = Enum.Material.SmoothPlastic
  4113. o120.BrickColor = BrickColor.new("Neon orange")
  4114. o120.Position = Vector3.new(-113.539955, 1.61896086, 61.3583183)
  4115. o120.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4116. o120.Anchored = true
  4117. o120.CFrame = CFrame.new(-113.539955, 1.61896086, 61.3583183, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4118. o120.FormFactor = Enum.FormFactor.Custom
  4119. o120.Size = Vector3.new(0.200000003, 0.566666663, 0.200000003)
  4120. o120.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4121. o120.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4122. o120.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4123. o120.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4124. o120.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4125. o120.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4126. o120.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4127. o121 = Instance.new("BlockMesh")
  4128. o121.Parent = o120
  4129. o121.Scale = Vector3.new(0.25, 1, 0.25)
  4130. o122 = Instance.new("Part")
  4131. o122.Parent = o1
  4132. o122.Material = Enum.Material.SmoothPlastic
  4133. o122.BrickColor = BrickColor.new("Neon orange")
  4134. o122.Position = Vector3.new(-113.514954, 1.57731104, 61.3583183)
  4135. o122.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4136. o122.Anchored = true
  4137. o122.CFrame = CFrame.new(-113.514954, 1.57731104, 61.3583183, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4138. o122.FormFactor = Enum.FormFactor.Custom
  4139. o122.Size = Vector3.new(0.200000003, 0.566666663, 0.200000003)
  4140. o122.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4141. o122.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4142. o122.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4143. o122.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4144. o122.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4145. o122.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4146. o122.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4147. o123 = Instance.new("CylinderMesh")
  4148. o123.Parent = o122
  4149. o123.Scale = Vector3.new(0.666666687, 1, 0.666666687)
  4150. o124 = Instance.new("Part")
  4151. o124.Parent = o1
  4152. o124.Material = Enum.Material.SmoothPlastic
  4153. o124.BrickColor = BrickColor.new("Really black")
  4154. o124.Position = Vector3.new(-113.539955, 1.51565146, 59.4416924)
  4155. o124.Rotation = Vector3.new(112.000015, 5.29329009e-006, -180)
  4156. o124.Anchored = true
  4157. o124.CFrame = CFrame.new(-113.539955, 1.51565146, 59.4416924, -1, 1.50987916e-007, 9.2385342e-008, -2.90970945e-008, 0.374606788, -0.927183807, -1.74601695e-007, -0.927183807, -0.374606788)
  4158. o124.FormFactor = Enum.FormFactor.Custom
  4159. o124.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4160. o124.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4161. o124.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4162. o124.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4163. o124.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4164. o124.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4165. o124.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4166. o124.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4167. o125 = Instance.new("BlockMesh")
  4168. o125.Parent = o124
  4169. o125.Scale = Vector3.new(0.333333343, 0.333333343, 0.25)
  4170. o126 = Instance.new("Part")
  4171. o126.Parent = o1
  4172. o126.Material = Enum.Material.SmoothPlastic
  4173. o126.BrickColor = BrickColor.new("Neon orange")
  4174. o126.Position = Vector3.new(-113.539955, 1.46897125, 61.1333237)
  4175. o126.Rotation = Vector3.new(90.0000076, -5.00833175e-006, -1.2209328e-010)
  4176. o126.Anchored = true
  4177. o126.CFrame = CFrame.new(-113.539955, 1.46897125, 61.1333237, 1, 2.13092976e-012, -8.74118768e-008, -8.74118768e-008, -1.04308192e-007, -1, -2.14004747e-012, 1, -1.04308192e-007)
  4178. o126.FormFactor = Enum.FormFactor.Custom
  4179. o126.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4180. o126.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4181. o126.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4182. o126.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4183. o126.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4184. o126.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4185. o126.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4186. o126.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4187. o127 = Instance.new("SpecialMesh")
  4188. o127.Parent = o126
  4189. o127.Scale = Vector3.new(0.916666687, 0.0833333358, 0.0833333358)
  4190. o127.MeshType = Enum.MeshType.Wedge
  4191. o128 = Instance.new("Part")
  4192. o128.Parent = o1
  4193. o128.Material = Enum.Material.SmoothPlastic
  4194. o128.BrickColor = BrickColor.new("Really black")
  4195. o128.Position = Vector3.new(-113.539955, 1.34397781, 62.5949593)
  4196. o128.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4197. o128.Anchored = true
  4198. o128.CFrame = CFrame.new(-113.539955, 1.34397781, 62.5949593, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4199. o128.FormFactor = Enum.FormFactor.Custom
  4200. o128.Size = Vector3.new(0.200000003, 1.80666661, 0.200000003)
  4201. o128.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4202. o128.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4203. o128.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4204. o128.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4205. o128.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4206. o128.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4207. o128.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4208. o129 = Instance.new("CylinderMesh")
  4209. o129.Parent = o128
  4210. o129.Scale = Vector3.new(0.166666672, 1, 0.166666672)
  4211. o130 = Instance.new("Part")
  4212. o130.Parent = o1
  4213. o130.Material = Enum.Material.SmoothPlastic
  4214. o130.BrickColor = BrickColor.new("Neon orange")
  4215. o130.Position = Vector3.new(-113.5373, 1.39128041, 58.5915298)
  4216. o130.Rotation = Vector3.new(2.50447852e-006, 2.50457879e-006, 4.2913037e-010)
  4217. o130.Anchored = true
  4218. o130.CFrame = CFrame.new(-113.5373, 1.39128041, 58.5915298, 1, -7.489738e-012, 4.37131469e-008, 8.24089842e-012, 0.999991596, -4.37110295e-008, -4.3712955e-008, 4.37110295e-008, 0.999991596)
  4219. o130.CanCollide = false
  4220. o130.FormFactor = Enum.FormFactor.Symmetric
  4221. o130.Size = Vector3.new(1, 1, 2)
  4222. o130.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4223. o130.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4224. o130.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4225. o130.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4226. o130.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4227. o130.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4228. o130.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4229. o131 = Instance.new("SpecialMesh")
  4230. o131.Parent = o130
  4231. o131.Scale = Vector3.new(0.192307696, 0.115384616, 0.769230783)
  4232. o131.MeshType = Enum.MeshType.Wedge
  4233. o132 = Instance.new("Part")
  4234. o132.Parent = o1
  4235. o132.Material = Enum.Material.SmoothPlastic
  4236. o132.BrickColor = BrickColor.new("Really black")
  4237. o132.Position = Vector3.new(-113.539955, 1.24397194, 60.1083488)
  4238. o132.Rotation = Vector3.new(-90, -5.21097721e-010, -180)
  4239. o132.Anchored = true
  4240. o132.CFrame = CFrame.new(-113.539955, 1.24397194, 60.1083488, -1, 2.13516336e-012, -9.09487069e-012, -9.09487069e-012, -7.45058344e-008, 1, 2.13516271e-012, 1, 7.45058344e-008)
  4241. o132.FormFactor = Enum.FormFactor.Custom
  4242. o132.Size = Vector3.new(0.200000003, 1.43333328, 0.200000003)
  4243. o132.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4244. o132.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4245. o132.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4246. o132.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4247. o132.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4248. o132.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4249. o132.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4250. o133 = Instance.new("SpecialMesh")
  4251. o133.Parent = o132
  4252. o133.Scale = Vector3.new(0.916666687, 1, 0.333333343)
  4253. o133.MeshType = Enum.MeshType.Wedge
  4254. o134 = Instance.new("Part")
  4255. o134.Parent = o1
  4256. o134.Material = Enum.Material.SmoothPlastic
  4257. o134.BrickColor = BrickColor.new("Neon orange")
  4258. o134.Position = Vector3.new(-113.539955, 1.32259893, 61.0306549)
  4259. o134.Rotation = Vector3.new(-14.9999905, 9.48099853e-007, 90)
  4260. o134.Anchored = true
  4261. o134.CFrame = CFrame.new(-113.539955, 1.32259893, 61.0306549, -4.37199184e-008, -1, 1.65474638e-008, 0.965925932, -3.79474017e-008, 0.258818895, -0.258818895, 2.72991603e-008, 0.965925932)
  4262. o134.FormFactor = Enum.FormFactor.Custom
  4263. o134.Size = Vector3.new(0.200000003, 0.200000003, 0.283333331)
  4264. o134.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4265. o134.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4266. o134.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4267. o134.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4268. o134.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4269. o134.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4270. o134.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4271. o135 = Instance.new("BlockMesh")
  4272. o135.Parent = o134
  4273. o135.Scale = Vector3.new(0.583333313, 0.916666687, 1)
  4274. o136 = Instance.new("Part")
  4275. o136.Parent = o1
  4276. o136.Material = Enum.Material.SmoothPlastic
  4277. o136.BrickColor = BrickColor.new("Really black")
  4278. o136.Position = Vector3.new(-113.539955, 1.46064508, 63.6715851)
  4279. o136.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4280. o136.Anchored = true
  4281. o136.CFrame = CFrame.new(-113.539955, 1.46064508, 63.6715851, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4282. o136.FormFactor = Enum.FormFactor.Custom
  4283. o136.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4284. o136.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4285. o136.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4286. o136.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4287. o136.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4288. o136.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4289. o136.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4290. o136.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4291. o137 = Instance.new("BlockMesh")
  4292. o137.Parent = o136
  4293. o137.Scale = Vector3.new(0.333333343, 1, 0.25)
  4294. o138 = Instance.new("Part")
  4295. o138.Parent = o1
  4296. o138.Material = Enum.Material.SmoothPlastic
  4297. o138.BrickColor = BrickColor.new("Really black")
  4298. o138.Position = Vector3.new(-113.556625, 1.56064665, 60.2416763)
  4299. o138.Rotation = Vector3.new(-90, -5.00939223e-006, 180)
  4300. o138.Anchored = true
  4301. o138.CFrame = CFrame.new(-113.556625, 1.56064665, 60.2416763, -1, -8.74191883e-008, -8.74303865e-008, -8.74303652e-008, -1.34110536e-007, 1, -8.74191954e-008, 1, 1.34110536e-007)
  4302. o138.FormFactor = Enum.FormFactor.Custom
  4303. o138.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4304. o138.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4305. o138.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4306. o138.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4307. o138.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4308. o138.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4309. o138.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4310. o138.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4311. o139 = Instance.new("SpecialMesh")
  4312. o139.Parent = o138
  4313. o139.Scale = Vector3.new(0.5, 0.166666672, 0.333333343)
  4314. o139.MeshType = Enum.MeshType.Wedge
  4315. o140 = Instance.new("Part")
  4316. o140.Parent = o1
  4317. o140.Material = Enum.Material.SmoothPlastic
  4318. o140.BrickColor = BrickColor.new("Really black")
  4319. o140.Position = Vector3.new(-113.539955, 1.46897125, 62.2333107)
  4320. o140.Rotation = Vector3.new(90.0000076, -5.00833175e-006, -1.2209328e-010)
  4321. o140.Anchored = true
  4322. o140.CFrame = CFrame.new(-113.539955, 1.46897125, 62.2333107, 1, 2.13092976e-012, -8.74118768e-008, -8.74118768e-008, -1.04308192e-007, -1, -2.14004747e-012, 1, -1.04308192e-007)
  4323. o140.FormFactor = Enum.FormFactor.Custom
  4324. o140.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4325. o140.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4326. o140.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4327. o140.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4328. o140.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4329. o140.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4330. o140.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4331. o140.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4332. o141 = Instance.new("SpecialMesh")
  4333. o141.Parent = o140
  4334. o141.Scale = Vector3.new(0.333333343, 0.583333313, 0.25)
  4335. o141.MeshType = Enum.MeshType.Wedge
  4336. o142 = Instance.new("Part")
  4337. o142.Parent = o1
  4338. o142.Material = Enum.Material.SmoothPlastic
  4339. o142.BrickColor = BrickColor.new("Really black")
  4340. o142.Position = Vector3.new(-113.556625, 1.60230219, 60.4500046)
  4341. o142.Rotation = Vector3.new(90.0000076, 5.20843257e-010, 180)
  4342. o142.Anchored = true
  4343. o142.CFrame = CFrame.new(-113.556625, 1.60230219, 60.4500046, -1, -2.13694058e-012, 9.0904298e-012, -9.0904298e-012, 1.63912873e-007, -1, 2.13693885e-012, -1, -1.63912887e-007)
  4344. o142.FormFactor = Enum.FormFactor.Custom
  4345. o142.Size = Vector3.new(0.200000003, 0.449999988, 0.200000003)
  4346. o142.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4347. o142.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4348. o142.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4349. o142.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4350. o142.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4351. o142.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4352. o142.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4353. o143 = Instance.new("BlockMesh")
  4354. o143.Parent = o142
  4355. o143.Scale = Vector3.new(0.5, 1, 0.0833333358)
  4356. o144 = Instance.new("Part")
  4357. o144.Parent = o1
  4358. o144.Material = Enum.Material.SmoothPlastic
  4359. o144.BrickColor = BrickColor.new("Neon orange")
  4360. o144.Position = Vector3.new(-113.5373, 1.23742986, 59.0915222)
  4361. o144.Rotation = Vector3.new(-180, -2.50457879e-006, -4.2913037e-010)
  4362. o144.Anchored = true
  4363. o144.CFrame = CFrame.new(-113.5373, 1.23742986, 59.0915222, 1, 7.489738e-012, -4.37131469e-008, 8.24089842e-012, -0.999991596, 4.37110295e-008, -4.3712955e-008, -4.37110295e-008, -0.999991596)
  4364. o144.CanCollide = false
  4365. o144.FormFactor = Enum.FormFactor.Symmetric
  4366. o144.Size = Vector3.new(1, 1, 1)
  4367. o144.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4368. o144.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4369. o144.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4370. o144.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4371. o144.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4372. o144.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4373. o144.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4374. o145 = Instance.new("SpecialMesh")
  4375. o145.Parent = o144
  4376. o145.Scale = Vector3.new(0.192307696, 0.115384616, 0.538461566)
  4377. o145.MeshType = Enum.MeshType.Wedge
  4378. o146 = Instance.new("Part")
  4379. o146.Parent = o1
  4380. o146.Material = Enum.Material.SmoothPlastic
  4381. o146.BrickColor = BrickColor.new("Neon orange")
  4382. o146.Position = Vector3.new(-113.564957, 1.57730913, 61.6666527)
  4383. o146.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4384. o146.Anchored = true
  4385. o146.CFrame = CFrame.new(-113.564957, 1.57730913, 61.6666527, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4386. o146.FormFactor = Enum.FormFactor.Custom
  4387. o146.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4388. o146.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4389. o146.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4390. o146.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4391. o146.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4392. o146.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4393. o146.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4394. o146.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4395. o147 = Instance.new("CylinderMesh")
  4396. o147.Parent = o146
  4397. o147.Scale = Vector3.new(0.666666687, 0.25, 0.666666687)
  4398. o148 = Instance.new("Part")
  4399. o148.Parent = o1
  4400. o148.Material = Enum.Material.SmoothPlastic
  4401. o148.BrickColor = BrickColor.new("Neon orange")
  4402. o148.Position = Vector3.new(-113.539955, 1.37730265, 61.2333298)
  4403. o148.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4404. o148.Anchored = true
  4405. o148.CFrame = CFrame.new(-113.539955, 1.37730265, 61.2333298, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4406. o148.FormFactor = Enum.FormFactor.Custom
  4407. o148.Size = Vector3.new(0.200000003, 0.816666663, 0.200000003)
  4408. o148.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4409. o148.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4410. o148.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4411. o148.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4412. o148.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4413. o148.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4414. o148.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4415. o149 = Instance.new("BlockMesh")
  4416. o149.Parent = o148
  4417. o149.Scale = Vector3.new(0.916666687, 1, 0.833333373)
  4418. o150 = Instance.new("Part")
  4419. o150.Parent = o1
  4420. o150.Material = Enum.Material.SmoothPlastic
  4421. o150.BrickColor = BrickColor.new("Really black")
  4422. o150.Position = Vector3.new(-113.539955, 1.52730358, 63.7299118)
  4423. o150.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4424. o150.Anchored = true
  4425. o150.CFrame = CFrame.new(-113.539955, 1.52730358, 63.7299118, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4426. o150.FormFactor = Enum.FormFactor.Custom
  4427. o150.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4428. o150.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4429. o150.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4430. o150.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4431. o150.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4432. o150.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4433. o150.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4434. o150.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4435. o151 = Instance.new("BlockMesh")
  4436. o151.Parent = o150
  4437. o151.Scale = Vector3.new(0.333333343, 0.0833333358, 0.416666687)
  4438. o152 = Instance.new("Part")
  4439. o152.Parent = o1
  4440. o152.Material = Enum.Material.SmoothPlastic
  4441. o152.BrickColor = BrickColor.new("Really black")
  4442. o152.Position = Vector3.new(-113.539955, 1.56564903, 60.8416634)
  4443. o152.Rotation = Vector3.new(90.0000076, 5.20458232e-010, -180)
  4444. o152.Anchored = true
  4445. o152.CFrame = CFrame.new(-113.539955, 1.56564903, 60.8416634, -1, 1.50991141e-007, 9.08370948e-012, -9.05445944e-012, 1.93715223e-007, -1, -1.50991127e-007, -1, -1.93715238e-007)
  4446. o152.FormFactor = Enum.FormFactor.Custom
  4447. o152.Size = Vector3.new(0.200000003, 0.333333343, 0.200000003)
  4448. o152.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4449. o152.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4450. o152.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4451. o152.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4452. o152.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4453. o152.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4454. o152.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4455. o153 = Instance.new("BlockMesh")
  4456. o153.Parent = o152
  4457. o153.Scale = Vector3.new(0.666666687, 1, 0.666666687)
  4458. o154 = Instance.new("Part")
  4459. o154.Parent = o1
  4460. o154.Material = Enum.Material.SmoothPlastic
  4461. o154.BrickColor = BrickColor.new("Really black")
  4462. o154.Position = Vector3.new(-113.539955, 1.02732003, 59.8650208)
  4463. o154.Rotation = Vector3.new(-89.9999924, -5.91999378e-006, 180)
  4464. o154.Anchored = true
  4465. o154.CFrame = CFrame.new(-113.539955, 1.02732003, 59.8650208, -1, -1.50991156e-007, -1.0332338e-007, -1.03323345e-007, -2.23517574e-007, 1, -1.5099117e-007, 1, 2.23517574e-007)
  4466. o154.FormFactor = Enum.FormFactor.Custom
  4467. o154.Size = Vector3.new(0.200000003, 0.233333334, 0.200000003)
  4468. o154.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4469. o154.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4470. o154.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4471. o154.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4472. o154.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4473. o154.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4474. o154.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4475. o155 = Instance.new("BlockMesh")
  4476. o155.Parent = o154
  4477. o155.Scale = Vector3.new(0.833333373, 1, 0.166666672)
  4478. o156 = Instance.new("Part")
  4479. o156.Parent = o1
  4480. o156.Material = Enum.Material.SmoothPlastic
  4481. o156.BrickColor = BrickColor.new("Really black")
  4482. o156.Position = Vector3.new(-113.539955, 1.54396701, 59.4333611)
  4483. o156.Rotation = Vector3.new(90.0000153, 5.00939313e-006, 180)
  4484. o156.Anchored = true
  4485. o156.CFrame = CFrame.new(-113.539955, 1.54396701, 59.4333611, -1, -2.13552136e-012, 8.74304007e-008, -8.74304007e-008, 2.68221214e-007, -1, 2.11207028e-012, -1, -2.68221214e-007)
  4486. o156.FormFactor = Enum.FormFactor.Custom
  4487. o156.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4488. o156.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4489. o156.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4490. o156.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4491. o156.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4492. o156.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4493. o156.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4494. o156.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4495. o157 = Instance.new("SpecialMesh")
  4496. o157.Parent = o156
  4497. o157.Scale = Vector3.new(0.666666687, 0.416666687, 0.666666687)
  4498. o157.MeshType = Enum.MeshType.Wedge
  4499. o158 = Instance.new("Part")
  4500. o158.Parent = o1
  4501. o158.Material = Enum.Material.SmoothPlastic
  4502. o158.BrickColor = BrickColor.new("Really black")
  4503. o158.Position = Vector3.new(-113.539955, 1.67565107, 60.8250008)
  4504. o158.Rotation = Vector3.new(92.0000153, 5.24563802e-006, -180)
  4505. o158.Anchored = true
  4506. o158.CFrame = CFrame.new(-113.539955, 1.67565107, 60.8250008, -1, 1.50990815e-007, 9.15536518e-008, -8.62283471e-008, 0.0348996483, -0.999390841, -1.54094025e-007, -0.999390841, -0.0348996483)
  4507. o158.FormFactor = Enum.FormFactor.Custom
  4508. o158.Size = Vector3.new(0.200000003, 0.300000012, 0.200000003)
  4509. o158.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4510. o158.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4511. o158.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4512. o158.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4513. o158.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4514. o158.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4515. o158.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4516. o159 = Instance.new("BlockMesh")
  4517. o159.Parent = o158
  4518. o159.Scale = Vector3.new(0.5, 1, 0.0833333358)
  4519. o160 = Instance.new("Part")
  4520. o160.Parent = o1
  4521. o160.Material = Enum.Material.SmoothPlastic
  4522. o160.BrickColor = BrickColor.new("Really black")
  4523. o160.Position = Vector3.new(-113.539955, 1.48563671, 60.9749908)
  4524. o160.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4525. o160.Anchored = true
  4526. o160.CFrame = CFrame.new(-113.539955, 1.48563671, 60.9749908, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4527. o160.FormFactor = Enum.FormFactor.Custom
  4528. o160.Size = Vector3.new(0.200000003, 0.300000012, 0.200000003)
  4529. o160.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4530. o160.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4531. o160.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4532. o160.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4533. o160.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4534. o160.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4535. o160.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4536. o161 = Instance.new("BlockMesh")
  4537. o161.Parent = o160
  4538. o161.Scale = Vector3.new(0.916666687, 1, 0.25)
  4539. o162 = Instance.new("Part")
  4540. o162.Parent = o1
  4541. o162.Material = Enum.Material.SmoothPlastic
  4542. o162.BrickColor = BrickColor.new("Really black")
  4543. o162.Position = Vector3.new(-113.569962, 1.64896476, 63.7049255)
  4544. o162.Rotation = Vector3.new(-90, -24.9996357, 2.5930288e-007)
  4545. o162.Anchored = true
  4546. o162.CFrame = CFrame.new(-113.569962, 1.64896476, 63.7049255, 0.906310558, -4.10167988e-009, -0.422612488, 0.422612488, 1.3219875e-007, 0.906310558, 5.21514458e-008, -1, 1.21546535e-007)
  4547. o162.FormFactor = Enum.FormFactor.Custom
  4548. o162.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4549. o162.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4550. o162.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4551. o162.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4552. o162.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4553. o162.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4554. o162.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4555. o162.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4556. o163 = Instance.new("BlockMesh")
  4557. o163.Parent = o162
  4558. o163.Scale = Vector3.new(0.0416666679, 0.333333343, 0.166666672)
  4559. o164 = Instance.new("Part")
  4560. o164.Parent = o1
  4561. o164.Material = Enum.Material.SmoothPlastic
  4562. o164.BrickColor = BrickColor.new("Really black")
  4563. o164.Position = Vector3.new(-113.539955, 1.12770569, 59.7194443)
  4564. o164.Rotation = Vector3.new(-20.9999943, 7.03878584e-007, 5.00940268e-006)
  4565. o164.Anchored = true
  4566. o164.CFrame = CFrame.new(-113.539955, 1.12770569, 59.7194443, 1, -8.74305712e-008, 1.22849988e-008, 7.72209248e-008, 0.933580458, 0.358367831, -4.28013394e-008, -0.358367831, 0.933580458)
  4567. o164.FormFactor = Enum.FormFactor.Custom
  4568. o164.Size = Vector3.new(0.200000003, 0.233333334, 0.200000003)
  4569. o164.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4570. o164.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4571. o164.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4572. o164.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4573. o164.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4574. o164.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4575. o164.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4576. o165 = Instance.new("BlockMesh")
  4577. o165.Parent = o164
  4578. o165.Scale = Vector3.new(0.833333373, 1, 0.166666672)
  4579. o166 = Instance.new("Part")
  4580. o166.Parent = o1
  4581. o166.Material = Enum.Material.SmoothPlastic
  4582. o166.BrickColor = BrickColor.new("Neon orange")
  4583. o166.Position = Vector3.new(-113.539955, 1.46897221, 61.5666542)
  4584. o166.Rotation = Vector3.new(90.0000153, 5.00935221e-006, 180)
  4585. o166.Anchored = true
  4586. o166.CFrame = CFrame.new(-113.539955, 1.46897221, 61.5666542, -1, -2.1435733e-012, 8.74296902e-008, -8.74296902e-008, 2.38418806e-007, -1, 2.12272821e-012, -1, -2.38418806e-007)
  4587. o166.FormFactor = Enum.FormFactor.Custom
  4588. o166.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4589. o166.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4590. o166.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4591. o166.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4592. o166.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4593. o166.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4594. o166.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4595. o166.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4596. o167 = Instance.new("SpecialMesh")
  4597. o167.Parent = o166
  4598. o167.Scale = Vector3.new(0.916666687, 0.0833333358, 0.0833333358)
  4599. o167.MeshType = Enum.MeshType.Wedge
  4600. o168 = Instance.new("Part")
  4601. o168.Parent = o1
  4602. o168.Material = Enum.Material.SmoothPlastic
  4603. o168.BrickColor = BrickColor.new("Neon orange")
  4604. o168.Position = Vector3.new(-113.539955, 1.46897125, 61.3999939)
  4605. o168.Rotation = Vector3.new(90.0000076, -5.00841907e-006, -1.11534677e-010)
  4606. o168.Anchored = true
  4607. o168.CFrame = CFrame.new(-113.539955, 1.46897125, 61.3999939, 1, 1.94664727e-012, -8.74134045e-008, -8.74119266e-008, -1.1920865e-007, -0.999991596, -2.13294204e-012, 0.999991596, -1.1920865e-007)
  4608. o168.FormFactor = Enum.FormFactor.Custom
  4609. o168.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4610. o168.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4611. o168.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4612. o168.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4613. o168.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4614. o168.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4615. o168.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4616. o168.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4617. o169 = Instance.new("SpecialMesh")
  4618. o169.Parent = o168
  4619. o169.Scale = Vector3.new(0.916666687, 0.0833333358, 0.0833333358)
  4620. o169.MeshType = Enum.MeshType.Wedge
  4621. o170 = Instance.new("Part")
  4622. o170.Parent = o1
  4623. o170.Material = Enum.Material.SmoothPlastic
  4624. o170.BrickColor = BrickColor.new("Really black")
  4625. o170.Position = Vector3.new(-113.576622, 1.67397296, 63.7049255)
  4626. o170.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4627. o170.Anchored = true
  4628. o170.CFrame = CFrame.new(-113.576622, 1.67397296, 63.7049255, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4629. o170.FormFactor = Enum.FormFactor.Custom
  4630. o170.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4631. o170.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4632. o170.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4633. o170.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4634. o170.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4635. o170.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4636. o170.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4637. o170.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4638. o171 = Instance.new("BlockMesh")
  4639. o171.Parent = o170
  4640. o171.Scale = Vector3.new(0.0416666679, 0.333333343, 0.116666667)
  4641. o172 = Instance.new("Part")
  4642. o172.Parent = o1
  4643. o172.Material = Enum.Material.SmoothPlastic
  4644. o172.BrickColor = BrickColor.new("Really black")
  4645. o172.Position = Vector3.new(-113.581627, 1.53563416, 60.233345)
  4646. o172.Rotation = Vector3.new(90.0000534, 5.02050989e-006, -180)
  4647. o172.Anchored = true
  4648. o172.CFrame = CFrame.new(-113.581627, 1.53563416, 60.233345, -1, 1.50991113e-007, 8.76244286e-008, -8.76243078e-008, 8.19564661e-007, -1, -1.50991184e-007, -1, -8.19564661e-007)
  4649. o172.FormFactor = Enum.FormFactor.Custom
  4650. o172.Size = Vector3.new(0.200000003, 0.883333325, 0.200000003)
  4651. o172.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4652. o172.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4653. o172.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4654. o172.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4655. o172.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4656. o172.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4657. o172.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4658. o173 = Instance.new("BlockMesh")
  4659. o173.Parent = o172
  4660. o173.Scale = Vector3.new(0.0833333358, 1, 0.583333313)
  4661. o174 = Instance.new("Part")
  4662. o174.Parent = o1
  4663. o174.Material = Enum.Material.SmoothPlastic
  4664. o174.BrickColor = BrickColor.new("Really black")
  4665. o174.Position = Vector3.new(-113.539955, 1.66896427, 63.7049255)
  4666. o174.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4667. o174.Anchored = true
  4668. o174.CFrame = CFrame.new(-113.539955, 1.66896427, 63.7049255, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4669. o174.FormFactor = Enum.FormFactor.Custom
  4670. o174.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4671. o174.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4672. o174.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4673. o174.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4674. o174.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4675. o174.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4676. o174.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4677. o174.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4678. o175 = Instance.new("BlockMesh")
  4679. o175.Parent = o174
  4680. o175.Scale = Vector3.new(0.0500000045, 0.166666672, 0.166666672)
  4681. o176 = Instance.new("Part")
  4682. o176.Parent = o1
  4683. o176.Material = Enum.Material.SmoothPlastic
  4684. o176.BrickColor = BrickColor.new("Really black")
  4685. o176.Position = Vector3.new(-113.556625, 1.56897795, 60.0083504)
  4686. o176.Rotation = Vector3.new(90.0000076, 5.29337331e-006, -180)
  4687. o176.Anchored = true
  4688. o176.CFrame = CFrame.new(-113.556625, 1.56897795, 60.0083504, -1, 1.50991141e-007, 9.23867916e-008, -9.2386756e-008, 1.93715223e-007, -1, -1.50991141e-007, -1, -1.93715223e-007)
  4689. o176.FormFactor = Enum.FormFactor.Custom
  4690. o176.Size = Vector3.new(0.200000003, 0.433333337, 0.200000003)
  4691. o176.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4692. o176.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4693. o176.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4694. o176.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4695. o176.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4696. o176.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4697. o176.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4698. o177 = Instance.new("BlockMesh")
  4699. o177.Parent = o176
  4700. o177.Scale = Vector3.new(0.5, 1, 0.416666687)
  4701. o178 = Instance.new("Part")
  4702. o178.Parent = o1
  4703. o178.Material = Enum.Material.SmoothPlastic
  4704. o178.BrickColor = BrickColor.new("Really black")
  4705. o178.Position = Vector3.new(-113.539955, 1.37730074, 62.1583138)
  4706. o178.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4707. o178.Anchored = true
  4708. o178.CFrame = CFrame.new(-113.539955, 1.37730074, 62.1583138, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4709. o178.FormFactor = Enum.FormFactor.Custom
  4710. o178.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4711. o178.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4712. o178.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4713. o178.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4714. o178.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4715. o178.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4716. o178.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4717. o178.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4718. o179 = Instance.new("BlockMesh")
  4719. o179.Parent = o178
  4720. o179.Scale = Vector3.new(0.166666672, 0.5, 0.333333343)
  4721. o180 = Instance.new("Part")
  4722. o180.Parent = o1
  4723. o180.Material = Enum.Material.SmoothPlastic
  4724. o180.BrickColor = BrickColor.new("Neon orange")
  4725. o180.Position = Vector3.new(-113.539955, 1.32731259, 59.3583603)
  4726. o180.Rotation = Vector3.new(-89.9999924, -5.20639698e-010, 1.22437713e-010)
  4727. o180.Anchored = true
  4728. o180.CFrame = CFrame.new(-113.539955, 1.32731259, 59.3583603, 1, -2.13694123e-012, -9.08687708e-012, 9.08687708e-012, 2.53319939e-007, 1, -2.13693885e-012, -1, 2.53319968e-007)
  4729. o180.FormFactor = Enum.FormFactor.Custom
  4730. o180.Size = Vector3.new(0.200000003, 0.200000003, 0.233333334)
  4731. o180.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4732. o180.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4733. o180.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4734. o180.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4735. o180.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4736. o180.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4737. o180.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4738. o181 = Instance.new("SpecialMesh")
  4739. o181.Parent = o180
  4740. o181.Scale = Vector3.new(0.916666687, 0.333333343, 1)
  4741. o181.MeshType = Enum.MeshType.Wedge
  4742. o182 = Instance.new("Part")
  4743. o182.Parent = o1
  4744. o182.Material = Enum.Material.SmoothPlastic
  4745. o182.BrickColor = BrickColor.new("Really black")
  4746. o182.Position = Vector3.new(-113.539955, 1.61062944, 63.7049179)
  4747. o182.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4748. o182.Anchored = true
  4749. o182.CFrame = CFrame.new(-113.539955, 1.61062944, 63.7049179, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4750. o182.FormFactor = Enum.FormFactor.Custom
  4751. o182.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4752. o182.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4753. o182.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4754. o182.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4755. o182.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4756. o182.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4757. o182.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4758. o182.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4759. o183 = Instance.new("BlockMesh")
  4760. o183.Parent = o182
  4761. o183.Scale = Vector3.new(0.333333343, 0.333333343, 0.416666687)
  4762. o184 = Instance.new("Part")
  4763. o184.Parent = o1
  4764. o184.Material = Enum.Material.SmoothPlastic
  4765. o184.BrickColor = BrickColor.new("Really black")
  4766. o184.Position = Vector3.new(-113.539955, 0.896721542, 59.4836807)
  4767. o184.Rotation = Vector3.new(-73.9999924, -4.66918282e-010, 2.61258543e-010)
  4768. o184.Anchored = true
  4769. o184.CFrame = CFrame.new(-113.539955, 0.896721542, 59.4836807, 1, -4.5598217e-012, -8.14926165e-012, 9.0904298e-012, 0.275637537, 0.96126169, -2.13693885e-012, -0.96126169, 0.275637507)
  4770. o184.FormFactor = Enum.FormFactor.Custom
  4771. o184.Size = Vector3.new(0.200000003, 0.216666669, 0.449999988)
  4772. o184.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4773. o184.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4774. o184.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4775. o184.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4776. o184.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4777. o184.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4778. o184.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4779. o185 = Instance.new("BlockMesh")
  4780. o185.Parent = o184
  4781. o185.Scale = Vector3.new(0.916666687, 1, 1)
  4782. o186 = Instance.new("Part")
  4783. o186.Parent = o1
  4784. o186.Material = Enum.Material.SmoothPlastic
  4785. o186.BrickColor = BrickColor.new("Really black")
  4786. o186.Position = Vector3.new(-113.539955, 0.956089139, 59.6394043)
  4787. o186.Rotation = Vector3.new(-73.9999924, -5.12302313e-006, -180)
  4788. o186.Anchored = true
  4789. o186.CFrame = CFrame.new(-113.539955, 0.956089139, 59.6394043, -1, 8.74258674e-008, -8.94136178e-008, -1.10047722e-007, -0.275637537, 0.96126169, 5.93933862e-008, 0.96126169, 0.275637507)
  4790. o186.FormFactor = Enum.FormFactor.Custom
  4791. o186.Size = Vector3.new(0.200000003, 0.200000003, 0.316666663)
  4792. o186.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4793. o186.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4794. o186.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4795. o186.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4796. o186.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4797. o186.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4798. o186.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4799. o187 = Instance.new("SpecialMesh")
  4800. o187.Parent = o186
  4801. o187.Scale = Vector3.new(0.916666687, 0.25, 1)
  4802. o187.MeshType = Enum.MeshType.Wedge
  4803. o188 = Instance.new("Part")
  4804. o188.Parent = o1
  4805. o188.Material = Enum.Material.SmoothPlastic
  4806. o188.BrickColor = BrickColor.new("Really black")
  4807. o188.Position = Vector3.new(-113.539955, 1.46064496, 59.3583641)
  4808. o188.Rotation = Vector3.new(90.0000153, 5.00939313e-006, 180)
  4809. o188.Anchored = true
  4810. o188.CFrame = CFrame.new(-113.539955, 1.46064496, 59.3583641, -1, -2.13552136e-012, 8.74304007e-008, -8.74304007e-008, 2.68221214e-007, -1, 2.11207028e-012, -1, -2.68221214e-007)
  4811. o188.FormFactor = Enum.FormFactor.Custom
  4812. o188.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4813. o188.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4814. o188.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4815. o188.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4816. o188.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4817. o188.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4818. o188.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4819. o188.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4820. o189 = Instance.new("SpecialMesh")
  4821. o189.Parent = o188
  4822. o189.Scale = Vector3.new(0.916666687, 0.333333343, 0.166666672)
  4823. o189.MeshType = Enum.MeshType.Wedge
  4824. o190 = Instance.new("Part")
  4825. o190.Parent = o1
  4826. o190.Material = Enum.Material.SmoothPlastic
  4827. o190.BrickColor = BrickColor.new("Neon orange")
  4828. o190.Position = Vector3.new(-113.5373, 1.31434989, 58.6492157)
  4829. o190.Rotation = Vector3.new(2.50447852e-006, 2.50457879e-006, 4.2913037e-010)
  4830. o190.Anchored = true
  4831. o190.CFrame = CFrame.new(-113.5373, 1.31434989, 58.6492157, 1, -7.489738e-012, 4.37131469e-008, 8.24089842e-012, 0.999991596, -4.37110295e-008, -4.3712955e-008, 4.37110295e-008, 0.999991596)
  4832. o190.CanCollide = false
  4833. o190.FormFactor = Enum.FormFactor.Symmetric
  4834. o190.Size = Vector3.new(1, 1, 1)
  4835. o190.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4836. o190.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4837. o190.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4838. o190.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4839. o190.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4840. o190.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4841. o190.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4842. o191 = Instance.new("BlockMesh")
  4843. o191.Parent = o190
  4844. o191.Scale = Vector3.new(0.192307696, 0.0384615399, 1.42307687)
  4845. o192 = Instance.new("Part")
  4846. o192.Parent = o1
  4847. o192.Material = Enum.Material.SmoothPlastic
  4848. o192.BrickColor = BrickColor.new("Really black")
  4849. o192.Position = Vector3.new(-113.539955, 1.40230477, 60.75)
  4850. o192.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4851. o192.Anchored = true
  4852. o192.CFrame = CFrame.new(-113.539955, 1.40230477, 60.75, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4853. o192.FormFactor = Enum.FormFactor.Custom
  4854. o192.Size = Vector3.new(0.200000003, 0.200000003, 0.25)
  4855. o192.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4856. o192.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4857. o192.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4858. o192.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4859. o192.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4860. o192.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4861. o192.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4862. o193 = Instance.new("BlockMesh")
  4863. o193.Parent = o192
  4864. o193.Scale = Vector3.new(0.916666687, 0.75, 1)
  4865. o194 = Instance.new("Part")
  4866. o194.Parent = o1
  4867. o194.Material = Enum.Material.SmoothPlastic
  4868. o194.BrickColor = BrickColor.new("Neon orange")
  4869. o194.Position = Vector3.new(-113.5373, 1.10281682, 57.8800049)
  4870. o194.Rotation = Vector3.new(-2.50447738e-006, 2.50457879e-006, -180)
  4871. o194.Anchored = true
  4872. o194.CFrame = CFrame.new(-113.5373, 1.10281682, 57.8800049, -1, 7.49355959e-012, 4.37131469e-008, -8.24089842e-012, -0.999991596, 4.37110117e-008, 4.3712955e-008, 4.37110117e-008, 0.999991596)
  4873. o194.CanCollide = false
  4874. o194.FormFactor = Enum.FormFactor.Symmetric
  4875. o194.Size = Vector3.new(1, 1, 1)
  4876. o194.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4877. o194.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4878. o194.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4879. o194.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4880. o194.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4881. o194.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4882. o194.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4883. o195 = Instance.new("SpecialMesh")
  4884. o195.Parent = o194
  4885. o195.Scale = Vector3.new(0.192307696, 0.461538464, 0.115384616)
  4886. o195.MeshType = Enum.MeshType.Wedge
  4887. o196 = Instance.new("Part")
  4888. o196.Parent = o1
  4889. o196.Material = Enum.Material.SmoothPlastic
  4890. o196.BrickColor = BrickColor.new("Really black")
  4891. o196.Position = Vector3.new(-113.509956, 1.64896476, 63.7049255)
  4892. o196.Rotation = Vector3.new(-90, 24.9996357, -2.59040348e-007)
  4893. o196.Anchored = true
  4894. o196.CFrame = CFrame.new(-113.509956, 1.64896476, 63.7049255, 0.906310558, 4.09752721e-009, 0.422612488, -0.422612458, 1.3219902e-007, 0.906310558, -5.21553183e-008, -1, 1.21545028e-007)
  4895. o196.FormFactor = Enum.FormFactor.Custom
  4896. o196.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4897. o196.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4898. o196.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4899. o196.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4900. o196.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4901. o196.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4902. o196.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4903. o196.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4904. o197 = Instance.new("BlockMesh")
  4905. o197.Parent = o196
  4906. o197.Scale = Vector3.new(0.0416666679, 0.333333343, 0.166666672)
  4907. o198 = Instance.new("Part")
  4908. o198.Parent = o1
  4909. o198.Material = Enum.Material.SmoothPlastic
  4910. o198.BrickColor = BrickColor.new("Really black")
  4911. o198.Position = Vector3.new(-113.539955, 1.37730229, 60.0333443)
  4912. o198.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4913. o198.Anchored = true
  4914. o198.CFrame = CFrame.new(-113.539955, 1.37730229, 60.0333443, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4915. o198.FormFactor = Enum.FormFactor.Custom
  4916. o198.Size = Vector3.new(0.200000003, 1.2833333, 0.200000003)
  4917. o198.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4918. o198.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4919. o198.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4920. o198.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4921. o198.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4922. o198.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4923. o198.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4924. o199 = Instance.new("BlockMesh")
  4925. o199.Parent = o198
  4926. o199.Scale = Vector3.new(0.916666687, 1, 1)
  4927. o200 = Instance.new("Part")
  4928. o200.Parent = o1
  4929. o200.Material = Enum.Material.SmoothPlastic
  4930. o200.BrickColor = BrickColor.new("Really black")
  4931. o200.Position = Vector3.new(-113.539955, 1.05897915, 60.0933495)
  4932. o200.Rotation = Vector3.new(-87.9999847, -5.91998833e-006, 180)
  4933. o200.Anchored = true
  4934. o200.CFrame = CFrame.new(-113.539955, 1.05897915, 60.0933495, -1, -1.50990829e-007, -1.03323288e-007, -9.79908066e-008, -0.0348997675, 0.999390841, -1.54504804e-007, 0.999390841, 0.0348997675)
  4935. o200.FormFactor = Enum.FormFactor.Custom
  4936. o200.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4937. o200.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4938. o200.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4939. o200.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4940. o200.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4941. o200.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4942. o200.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4943. o200.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4944. o201 = Instance.new("BlockMesh")
  4945. o201.Parent = o200
  4946. o201.Scale = Vector3.new(0.666666687, 0.166666672, 0.416666687)
  4947. o202 = Instance.new("Part")
  4948. o202.Parent = o1
  4949. o202.Material = Enum.Material.SmoothPlastic
  4950. o202.BrickColor = BrickColor.new("Really black")
  4951. o202.Position = Vector3.new(-113.589958, 1.67825508, 60.750042)
  4952. o202.Rotation = Vector3.new(-87.9999847, -2.80858876e-006, 90)
  4953. o202.Anchored = true
  4954. o202.CFrame = CFrame.new(-113.589958, 1.67825508, 60.750042, -4.37141736e-008, -1, -4.90191212e-008, 0.0348996781, -5.0514867e-008, 0.999390841, -0.999390841, 4.197679e-008, 0.0348996781)
  4955. o202.FormFactor = Enum.FormFactor.Custom
  4956. o202.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  4957. o202.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4958. o202.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4959. o202.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4960. o202.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4961. o202.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4962. o202.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4963. o202.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  4964. o203 = Instance.new("CylinderMesh")
  4965. o203.Parent = o202
  4966. o203.Scale = Vector3.new(0.25, 0.333333343, 0.25)
  4967. o204 = Instance.new("Part")
  4968. o204.Parent = o1
  4969. o204.Material = Enum.Material.SmoothPlastic
  4970. o204.BrickColor = BrickColor.new("Neon orange")
  4971. o204.Position = Vector3.new(-113.539955, 1.54396534, 61.3583183)
  4972. o204.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4973. o204.Anchored = true
  4974. o204.CFrame = CFrame.new(-113.539955, 1.54396534, 61.3583183, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4975. o204.FormFactor = Enum.FormFactor.Custom
  4976. o204.Size = Vector3.new(0.200000003, 0.566666663, 0.200000003)
  4977. o204.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4978. o204.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4979. o204.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  4980. o204.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  4981. o204.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  4982. o204.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  4983. o204.Color = Color3.new(0.835294, 0.45098, 0.239216)
  4984. o205 = Instance.new("BlockMesh")
  4985. o205.Parent = o204
  4986. o205.Scale = Vector3.new(0.916666687, 1, 0.333333343)
  4987. o206 = Instance.new("Part")
  4988. o206.Parent = o1
  4989. o206.Material = Enum.Material.SmoothPlastic
  4990. o206.BrickColor = BrickColor.new("Neon orange")
  4991. o206.Position = Vector3.new(-113.564957, 1.57731104, 61.3583183)
  4992. o206.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  4993. o206.Anchored = true
  4994. o206.CFrame = CFrame.new(-113.564957, 1.57731104, 61.3583183, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  4995. o206.FormFactor = Enum.FormFactor.Custom
  4996. o206.Size = Vector3.new(0.200000003, 0.566666663, 0.200000003)
  4997. o206.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  4998. o206.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  4999. o206.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5000. o206.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5001. o206.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5002. o206.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5003. o206.Color = Color3.new(0.835294, 0.45098, 0.239216)
  5004. o207 = Instance.new("CylinderMesh")
  5005. o207.Parent = o206
  5006. o207.Scale = Vector3.new(0.666666687, 1, 0.666666687)
  5007. o208 = Instance.new("Part")
  5008. o208.Parent = o1
  5009. o208.Material = Enum.Material.SmoothPlastic
  5010. o208.BrickColor = BrickColor.new("Neon orange")
  5011. o208.Position = Vector3.new(-113.539955, 1.54396534, 61.0416641)
  5012. o208.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  5013. o208.Anchored = true
  5014. o208.CFrame = CFrame.new(-113.539955, 1.54396534, 61.0416641, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  5015. o208.FormFactor = Enum.FormFactor.Custom
  5016. o208.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5017. o208.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5018. o208.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5019. o208.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5020. o208.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5021. o208.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5022. o208.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5023. o208.Color = Color3.new(0.835294, 0.45098, 0.239216)
  5024. o209 = Instance.new("BlockMesh")
  5025. o209.Parent = o208
  5026. o209.Scale = Vector3.new(0.916666687, 0.333333343, 0.333333343)
  5027. o210 = Instance.new("Part")
  5028. o210.Parent = o1
  5029. o210.Material = Enum.Material.SmoothPlastic
  5030. o210.BrickColor = BrickColor.new("Really black")
  5031. o210.Position = Vector3.new(-113.514954, 1.57731104, 61.0416603)
  5032. o210.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  5033. o210.Anchored = true
  5034. o210.CFrame = CFrame.new(-113.514954, 1.57731104, 61.0416603, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  5035. o210.FormFactor = Enum.FormFactor.Custom
  5036. o210.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5037. o210.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5038. o210.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5039. o210.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5040. o210.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5041. o210.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5042. o210.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5043. o210.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5044. o211 = Instance.new("CylinderMesh")
  5045. o211.Parent = o210
  5046. o211.Scale = Vector3.new(0.666666687, 0.333333343, 0.666666687)
  5047. o212 = Instance.new("Part")
  5048. o212.Parent = o1
  5049. o212.Material = Enum.Material.SmoothPlastic
  5050. o212.BrickColor = BrickColor.new("Neon orange")
  5051. o212.Position = Vector3.new(-113.539955, 1.61895657, 61.6666527)
  5052. o212.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  5053. o212.Anchored = true
  5054. o212.CFrame = CFrame.new(-113.539955, 1.61895657, 61.6666527, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  5055. o212.FormFactor = Enum.FormFactor.Custom
  5056. o212.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5057. o212.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5058. o212.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5059. o212.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5060. o212.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5061. o212.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5062. o212.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5063. o212.Color = Color3.new(0.835294, 0.45098, 0.239216)
  5064. o213 = Instance.new("BlockMesh")
  5065. o213.Parent = o212
  5066. o213.Scale = Vector3.new(0.25, 0.25, 0.25)
  5067. o214 = Instance.new("Part")
  5068. o214.Parent = o1
  5069. o214.Material = Enum.Material.SmoothPlastic
  5070. o214.BrickColor = BrickColor.new("Really black")
  5071. o214.Position = Vector3.new(-113.639954, 1.3777262, 59.9190521)
  5072. o214.Rotation = Vector3.new(-79.9999847, -4.91393648e-010, 90)
  5073. o214.Anchored = true
  5074. o214.CFrame = CFrame.new(-113.639954, 1.3777262, 59.9190521, 7.54961107e-008, -1, -8.5764373e-012, 0.173648521, 1.31013387e-008, 0.984807789, -0.984807789, -7.43506305e-008, 0.173648506)
  5075. o214.FormFactor = Enum.FormFactor.Custom
  5076. o214.Size = Vector3.new(0.449999988, 0.200000003, 0.200000003)
  5077. o214.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5078. o214.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5079. o214.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5080. o214.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5081. o214.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5082. o214.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5083. o214.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5084. o215 = Instance.new("BlockMesh")
  5085. o215.Parent = o214
  5086. o215.Scale = Vector3.new(1, 0.0833333358, 0.333333343)
  5087. o216 = Instance.new("Part")
  5088. o216.Parent = o1
  5089. o216.Material = Enum.Material.SmoothPlastic
  5090. o216.BrickColor = BrickColor.new("Really black")
  5091. o216.Position = Vector3.new(-113.539955, 1.61063278, 63.6465836)
  5092. o216.Rotation = Vector3.new(90.0000076, 5.00937449e-006, 180)
  5093. o216.Anchored = true
  5094. o216.CFrame = CFrame.new(-113.539955, 1.61063278, 63.6465836, -1, -8.74234445e-008, 8.7430081e-008, -8.74300881e-008, 1.93715223e-007, -1, 8.74234232e-008, -1, -1.93715252e-007)
  5095. o216.FormFactor = Enum.FormFactor.Custom
  5096. o216.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5097. o216.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5098. o216.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5099. o216.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5100. o216.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5101. o216.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5102. o216.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5103. o216.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5104. o217 = Instance.new("SpecialMesh")
  5105. o217.Parent = o216
  5106. o217.Scale = Vector3.new(0.333333343, 0.25, 0.416666687)
  5107. o217.MeshType = Enum.MeshType.Wedge
  5108. o218 = Instance.new("Part")
  5109. o218.Parent = o1
  5110. o218.Material = Enum.Material.SmoothPlastic
  5111. o218.BrickColor = BrickColor.new("Really black")
  5112. o218.Position = Vector3.new(-113.539955, 1.49396372, 62.1833)
  5113. o218.Rotation = Vector3.new(90.0000076, -5.00833175e-006, -1.2209328e-010)
  5114. o218.Anchored = true
  5115. o218.CFrame = CFrame.new(-113.539955, 1.49396372, 62.1833, 1, 2.13092976e-012, -8.74118768e-008, -8.74118768e-008, -1.04308192e-007, -1, -2.14004747e-012, 1, -1.04308192e-007)
  5116. o218.FormFactor = Enum.FormFactor.Custom
  5117. o218.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5118. o218.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5119. o218.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5120. o218.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5121. o218.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5122. o218.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5123. o218.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5124. o218.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5125. o219 = Instance.new("SpecialMesh")
  5126. o219.Parent = o218
  5127. o219.Scale = Vector3.new(0.333333343, 0.583333313, 0.666666687)
  5128. o219.MeshType = Enum.MeshType.Wedge
  5129. o220 = Instance.new("Part")
  5130. o220.Parent = o1
  5131. o220.Material = Enum.Material.SmoothPlastic
  5132. o220.BrickColor = BrickColor.new("Really black")
  5133. o220.Position = Vector3.new(-113.48996, 1.54398501, 60.233345)
  5134. o220.Rotation = Vector3.new(90.0000153, 5.00939313e-006, 180)
  5135. o220.Anchored = true
  5136. o220.CFrame = CFrame.new(-113.48996, 1.54398501, 60.233345, -1, -2.13552136e-012, 8.74304007e-008, -8.74304007e-008, 2.68221214e-007, -1, 2.11207028e-012, -1, -2.68221214e-007)
  5137. o220.FormFactor = Enum.FormFactor.Custom
  5138. o220.Size = Vector3.new(0.200000003, 0.883333325, 0.200000003)
  5139. o220.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5140. o220.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5141. o220.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5142. o220.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5143. o220.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5144. o220.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5145. o220.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5146. o221 = Instance.new("BlockMesh")
  5147. o221.Parent = o220
  5148. o221.Scale = Vector3.new(0.166666672, 1, 0.666666687)
  5149. o222 = Instance.new("Part")
  5150. o222.Name = "Zoom"
  5151. o222.Parent = o1
  5152. o222.Material = Enum.Material.SmoothPlastic
  5153. o222.BrickColor = BrickColor.new("Really black")
  5154. o222.Transparency = 1
  5155. o222.Position = Vector3.new(-113.539955, 1.72229445, 59.8150215)
  5156. o222.Rotation = Vector3.new(-179.999985, 1.15806685e-007, 180)
  5157. o222.Anchored = true
  5158. o222.CFrame = CFrame.new(-113.539955, 1.72229445, 59.8150215, -1, -1.51002368e-007, 2.02120787e-009, -1.51002368e-007, 1, 3.27825802e-007, -2.02125738e-009, 3.27825802e-007, -1)
  5159. o222.FormFactor = Enum.FormFactor.Custom
  5160. o222.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5161. o222.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5162. o222.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5163. o222.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5164. o222.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5165. o222.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5166. o222.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5167. o222.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5168. o223 = Instance.new("BlockMesh")
  5169. o223.Parent = o222
  5170. o223.Scale = Vector3.new(0.166666672, 0.75, 0.166666672)
  5171. o224 = Instance.new("Sound")
  5172. o224.Name = "Empty"
  5173. o224.Parent = o222
  5174. o224.SoundId = "rbxasset://sounds//clickfast.wav"
  5175. o224.Volume = 1
  5176. o225 = Instance.new("Sound")
  5177. o225.Name = "M1"
  5178. o225.Parent = o222
  5179. o225.Pitch = 1
  5180. o225.SoundId = "http://roblox.com/asset/?id=233931573"
  5181. o225.Volume = 1
  5182. o226 = Instance.new("Sound")
  5183. o226.Name = "M2"
  5184. o226.Pitch = 1.7
  5185. o226.Parent = o222
  5186. o226.SoundId = "0"
  5187. o226.Volume = 1
  5188. o227 = Instance.new("Sound")
  5189. o227.Name = "Fire"
  5190. o227.Parent = o222
  5191. o227.Pitch = 1.25
  5192. o227.SoundId = "http://roblox.com/asset/?id=258193800"
  5193. o227.PlayOnRemove = true
  5194. o228 = Instance.new("Sound")
  5195. o228.Name = "M3"
  5196. o228.Parent = o222
  5197. o228.SoundId = "0"
  5198. o228.Volume = 1
  5199. o228.PlayOnRemove = true
  5200. o229 = Instance.new("Part")
  5201. o229.Parent = o1
  5202. o229.Material = Enum.Material.SmoothPlastic
  5203. o229.BrickColor = BrickColor.new("Neon orange")
  5204. o229.Position = Vector3.new(-113.539955, 1.46897221, 61.2999878)
  5205. o229.Rotation = Vector3.new(90.0000153, 5.00937495e-006, 180)
  5206. o229.Anchored = true
  5207. o229.CFrame = CFrame.new(-113.539955, 1.46897221, 61.2999878, -1, -1.94638273e-012, 8.74300881e-008, -8.74301023e-008, 2.38417329e-007, -0.999991596, 2.10141236e-012, -0.999991596, -2.38417329e-007)
  5208. o229.FormFactor = Enum.FormFactor.Custom
  5209. o229.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5210. o229.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5211. o229.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5212. o229.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5213. o229.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5214. o229.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5215. o229.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5216. o229.Color = Color3.new(0.835294, 0.45098, 0.239216)
  5217. o230 = Instance.new("SpecialMesh")
  5218. o230.Parent = o229
  5219. o230.Scale = Vector3.new(0.916666687, 0.0833333358, 0.0833333358)
  5220. o230.MeshType = Enum.MeshType.Wedge
  5221. o231 = Instance.new("Part")
  5222. o231.Parent = o1
  5223. o231.Material = Enum.Material.SmoothPlastic
  5224. o231.BrickColor = BrickColor.new("Really black")
  5225. o231.Position = Vector3.new(-113.539955, 1.41896868, 62.2083168)
  5226. o231.Rotation = Vector3.new(-90, -5.20843257e-010, 1.22437671e-010)
  5227. o231.Anchored = true
  5228. o231.CFrame = CFrame.new(-113.539955, 1.41896868, 62.2083168, 1, -2.13694036e-012, -9.0904298e-012, 9.0904298e-012, 1.34110536e-007, 1, -2.13693885e-012, -1, 1.3411055e-007)
  5229. o231.FormFactor = Enum.FormFactor.Custom
  5230. o231.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5231. o231.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5232. o231.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5233. o231.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5234. o231.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5235. o231.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5236. o231.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5237. o231.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5238. o232 = Instance.new("CylinderMesh")
  5239. o232.Parent = o231
  5240. o232.Scale = Vector3.new(0.5, 1, 0.5)
  5241. o233 = Instance.new("Part")
  5242. o233.Parent = o1
  5243. o233.Material = Enum.Material.SmoothPlastic
  5244. o233.BrickColor = BrickColor.new("Really black")
  5245. o233.Position = Vector3.new(-113.539955, 1.41896856, 62.8066254)
  5246. o233.Rotation = Vector3.new(-89.9999924, -5.20843257e-010, 1.22437671e-010)
  5247. o233.Anchored = true
  5248. o233.CFrame = CFrame.new(-113.539955, 1.41896856, 62.8066254, 1, -2.13694058e-012, -9.0904298e-012, 9.0904298e-012, 1.63912873e-007, 1, -2.13693885e-012, -1, 1.63912887e-007)
  5249. o233.FormFactor = Enum.FormFactor.Custom
  5250. o233.Size = Vector3.new(0.200000003, 2.13000011, 0.200000003)
  5251. o233.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5252. o233.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5253. o233.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5254. o233.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5255. o233.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5256. o233.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5257. o233.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5258. o234 = Instance.new("Decal")
  5259. o234.Parent = o233
  5260. o234.Texture = "http://www.roblox.com/asset/?id=47760372"
  5261. o234.Face = Enum.NormalId.Bottom
  5262. o235 = Instance.new("CylinderMesh")
  5263. o235.Parent = o233
  5264. o235.Scale = Vector3.new(0.416666687, 1, 0.416666687)
  5265. o236 = Instance.new("Part")
  5266. o236.Parent = o1
  5267. o236.Material = Enum.Material.SmoothPlastic
  5268. o236.BrickColor = BrickColor.new("Really black")
  5269. o236.Position = Vector3.new(-113.509956, 1.69896829, 63.7049255)
  5270. o236.Rotation = Vector3.new(-90, -24.9996357, 2.5930288e-007)
  5271. o236.Anchored = true
  5272. o236.CFrame = CFrame.new(-113.509956, 1.69896829, 63.7049255, 0.906310558, -4.10167988e-009, -0.422612488, 0.422612488, 1.3219875e-007, 0.906310558, 5.21514458e-008, -1, 1.21546535e-007)
  5273. o236.FormFactor = Enum.FormFactor.Custom
  5274. o236.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5275. o236.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5276. o236.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5277. o236.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5278. o236.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5279. o236.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5280. o236.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5281. o236.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5282. o237 = Instance.new("BlockMesh")
  5283. o237.Parent = o236
  5284. o237.Scale = Vector3.new(0.0416666679, 0.333333343, 0.166666672)
  5285. o238 = Instance.new("Part")
  5286. o238.Parent = o1
  5287. o238.Material = Enum.Material.SmoothPlastic
  5288. o238.BrickColor = BrickColor.new("Really black")
  5289. o238.Position = Vector3.new(-113.539955, 1.07028496, 60.0163193)
  5290. o238.Rotation = Vector3.new(-134.999985, -5.91992693e-006, 180)
  5291. o238.Anchored = true
  5292. o238.CFrame = CFrame.new(-113.539955, 1.07028496, 60.0163193, -1, -1.50998176e-007, -1.03322215e-007, -1.79831659e-007, 0.707106709, 0.707106948, -3.37120198e-008, 0.707106948, -0.707106709)
  5293. o238.FormFactor = Enum.FormFactor.Custom
  5294. o238.Size = Vector3.new(0.200000003, 0.200000003, 0.200000003)
  5295. o238.BackSurface = Enum.SurfaceType.SmoothNoOutlines
  5296. o238.BottomSurface = Enum.SurfaceType.SmoothNoOutlines
  5297. o238.FrontSurface = Enum.SurfaceType.SmoothNoOutlines
  5298. o238.LeftSurface = Enum.SurfaceType.SmoothNoOutlines
  5299. o238.RightSurface = Enum.SurfaceType.SmoothNoOutlines
  5300. o238.TopSurface = Enum.SurfaceType.SmoothNoOutlines
  5301. o238.Color = Color3.new(0.0666667, 0.0666667, 0.0666667)
  5302. o239 = Instance.new("BlockMesh")
  5303. o239.Parent = o238
  5304. o239.Scale = Vector3.new(0.833333373, 0.666666687, 0.166666672)
  5305. mas.Parent = workspace
  5306. mas:MakeJoints()
  5307. local mas1 = mas:GetChildren()
  5308. for i=1,#mas1 do
  5309. mas1[i].Parent = workspace
  5310. ypcall(function() mas1[i]:MakeJoints() end)
  5311. end
  5312. mas:Destroy()
  5313. for i=1,#cors do
  5314. coroutine.resume(cors[i])
  5315. end
  5316. o1.Parent = game.Players.LocalPlayer.Backpack
  5317.  
  5318.  
  5319.  
  5320. local naeeym2 = Instance.new("BillboardGui",Character)
  5321. naeeym2.AlwaysOnTop = true
  5322. naeeym2.Size = UDim2.new(5,35,2,35)
  5323. naeeym2.StudsOffset = Vector3.new(0,3,0)
  5324. naeeym2.Adornee = Character.Head
  5325. naeeym2.Name = "Name"
  5326. naeeym2.MaxDistance = 200
  5327. local tecks2 = Instance.new("TextLabel",naeeym2)
  5328. tecks2.BackgroundTransparency = 1
  5329. tecks2.TextScaled = true
  5330. tecks2.BorderSizePixel = 0
  5331. tecks2.Text = "Deadpool"
  5332. tecks2.Font = "Antique"
  5333. tecks2.TextSize = 30
  5334. tecks2.TextStrokeTransparency = 1
  5335. tecks2.TextColor3 = Color3.new(0,0,0)
  5336. tecks2.TextStrokeColor3 = Color3.new(0,0,0)
  5337. tecks2.Size = UDim2.new(1,0,0.5,0)
  5338. tecks2.Parent = naeeym2
Advertisement
Add Comment
Please, Sign In to add comment
Advertisement
Public Pastes
Advertisement
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy.  OK, I Understand
Not a member of Pastebin yet?
Sign Up, it unlocks many cool features!