API tools faq
paste
Advertisement
coolgoldboy166

mati PERO tiene un arma

coolgoldboy166
Nov 29th, 2017
229
0
Never
Add comment
Not a member of Pastebin yet? Sign Up, it unlocks many cool features!
text 141.73 KB | None | 0 0
raw download clone embed print report
  1. --Edited by coolgoldboy166
  2. ---NO TOOLS
  3. plr = game.Players.LocalPlayer
  4. repeat
  5. wait(0.4)
  6. until plr.Character
  7. chr = plr.Character
  8. human = chr:FindFirstChild("Humanoid")
  9. chr.Humanoid.MaxHealth = math.huge
  10. mouse = plr:GetMouse()
  11. equipd = false
  12. tors = chr.Torso
  13. rarm = chr["Right Arm"]
  14. larm = chr["Left Arm"]
  15. rleg = chr["Right Leg"]
  16. lleg = chr["Left Leg"]
  17. chr.Head.face.Texture = "rbxassetid://126198982"
  18. local txt = Instance.new("BillboardGui", chr)
  19. CV="Lime green"
  20. txt.Adornee = chr .Head
  21. txt.Name = "_status"
  22. txt.Size = UDim2.new(2, 0, 1.2, 0)
  23. txt.StudsOffset = Vector3.new(-9, 8, 0)
  24. local text = Instance.new("TextLabel", txt)
  25. text.Size = UDim2.new(10, 0, 7, 0)
  26. text.FontSize = "Size24"
  27. text.TextScaled = true
  28. text.TextTransparency = 0
  29. text.BackgroundTransparency = 1
  30. text.TextTransparency = 0
  31. text.TextStrokeTransparency = 0
  32. text.Font = "Bodoni"
  33. text.TextStrokeColor3 = Color3.new(0,0,0)
  34. text.TextColor3 = Color3.new(0,0,0)
  35. text.Text = "Mati"
  36. v=Instance.new("Part")
  37. v.Name = "ColorBrick"
  38. v.Parent= plr.Character
  39. v.FormFactor="Symmetric"
  40. v.Anchored=true
  41. v.CanCollide=false
  42. v.BottomSurface="Smooth"
  43. v.TopSurface="Smooth"
  44. v.Size=Vector3.new(10,5,3)
  45. v.Transparency=1
  46. v.CFrame=chr.Torso.CFrame
  47. v.BrickColor=BrickColor.new("Lime green")
  48. v.Transparency=1
  49. v.Shape="Block"
  50. chr.Shirt.ShirtTemplate = "rbxassetid://91908714"
  51. chr.Pants.PantsTemplate = "rbxassetid://144076759"
  52. z = Instance.new("Sound", tors)
  53. z.SoundId = "rbxassetid://738922960"
  54. z.Looped = true
  55. z.Volume = 4
  56. wait(.1)
  57. z:Play()
  58. for i,v in pairs(chr:children()) do
  59. if v:IsA("Hat") then
  60. v:Destroy()
  61. end
  62. end
  63. for i,v in pairs(chr:children()) do
  64. if v:IsA("Accessory") then
  65. v:Destroy()
  66. end
  67. end
  68. for i,v in pairs(chr:children()) do
  69. if v:IsA("Hair") then
  70. v:Destroy()
  71. end
  72. end
  73. local Part = Instance.new("Part",chr)
  74. Part.BrickColor = BrickColor.new("Royal blue")
  75. Part.Size = Vector3.new(1,1,1)
  76. Part.CanCollide = false
  77. Part.Material = "Neon"
  78. local M = Instance.new("SpecialMesh",Part)
  79. M.MeshId = "rbxassetid://"
  80. M.Scale = Vector3.new(1.2,1.2,1.2)
  81. M.TextureId = "rbxassetid://"
  82. local Part2 = Instance.new("Weld",Part)
  83. Part2.Part0 = chr.Head
  84. Part2.Part1 = Part
  85. Part2.C0 = CFrame.new(0,0.2,0)*CFrame.Angles(0,0,0)
  86. local Part1 = Instance.new("Part",chr)
  87. Part1.BrickColor = BrickColor.new("Really red")
  88. Part1.Size = Vector3.new(1,1,1)
  89. Part1.CanCollide = false
  90. Part1.Material = "Neon"
  91. local M1 = Instance.new("SpecialMesh",Part1)
  92. M1.MeshId = "rbxassetid://212966179"
  93. M1.Scale = Vector3.new(1.2,1.2,1.2)
  94. local Part21 = Instance.new("Weld",Part1)
  95. Part21.Part0 = chr.Head
  96. Part21.Part1 = Part1
  97. Part21.C0 = CFrame.new(0,0.1,0)*CFrame.Angles(0,0,0)
  98. hrp = chr.HumanoidRootPart
  99. head = chr.Head
  100. anim = human.Animator
  101. activu = false
  102. Heartbeat = Instance.new("BindableEvent")
  103. Heartbeat.Name = "Heartbeat"
  104. Heartbeat.Parent = script
  105. frame = 0.03333333333333333
  106. tf = 0
  107. game:GetService("RunService").Heartbeat:connect(function(s, p)
  108. tf = tf + s
  109. if tf >= frame then
  110. for i = 1, math.floor(tf / frame) do
  111. Heartbeat:Fire()
  112. end
  113. tf = tf - frame * math.floor(tf / frame)
  114. end
  115. end)
  116. function swait(num)
  117. if num == 0 or num == nil then
  118. Heartbeat.Event:wait()
  119. else
  120. for i = 1, num do
  121. Heartbeat.Event:wait()
  122. end
  123. end
  124. end
  125. RSC0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, 0, 0)
  126. RSC1 = CFrame.new(-0.5, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, 0, 0)
  127. LSC0 = CFrame.new(-1, 0.5, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0)
  128. LSC1 = CFrame.new(0.5, 0.5, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0)
  129. RHC0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, 0, 0)
  130. RHC1 = CFrame.new(0.5, 1, 0, 0, 0, 1, 0, 1, 0, -1, 0, 0)
  131. LHC0 = CFrame.new(-1, -1, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0)
  132. LHC1 = CFrame.new(-0.5, 1, 0, 0, 0, -1, 0, 1, 0, 1, 0, 0)
  133. NC0 = CFrame.new(0, 1, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  134. NC1 = CFrame.new(0, -0.5, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  135. RJC0 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  136. RJC1 = CFrame.new(0, 0, 0, -1, 0, 0, 0, 0, 1, 0, 1, 0)
  137. RS = tors:FindFirstChild("Right Shoulder")
  138. LS = tors:FindFirstChild("Left Shoulder")
  139. RH = tors:FindFirstChild("Right Hip")
  140. LH = tors:FindFirstChild("Left Hip")
  141. RJ = hrp:FindFirstChild("RootJoint")
  142. N = tors:FindFirstChild("Neck")
  143. cf = CFrame.new
  144. ang = CFrame.Angles
  145. rd = math.rad
  146. rd2 = math.random
  147. function nooutline(p)
  148. p.TopSurface, p.BottomSurface, p.LeftSurface, p.RightSurface, p.FrontSurface, p.BottomSurface = 10, 10, 10, 10, 10, 10
  149. end
  150. function makepart(color, name, reflec, mater, parnt, cfram)
  151. local port = Instance.new("Part")
  152. port.BrickColor = BrickColor.new(color)
  153. port.Name = name
  154. nooutline(port)
  155. port.Reflectance = reflec
  156. port.Material = mater
  157. port.Anchored = false
  158. port.CanCollide = false
  159. port.Locked = true
  160. port.Size = Vector3.new(0.2, 0.2, 0.2)
  161. port.Parent = parnt
  162. return port
  163. end
  164. function makemesh(meshtype, scale, meshid, parent)
  165. local mes = Instance.new("SpecialMesh")
  166. mes.MeshType = meshtype
  167. mes.Scale = scale
  168. if meshtype == "FileMesh" then
  169. mes.MeshId = meshid
  170. end
  171. mes.Parent = parent
  172. return mes
  173. end
  174. function makeweld(parent, p0, p1, c0, c1)
  175. local wel = Instance.new("Weld")
  176. wel.Part0 = p0
  177. wel.Part1 = p1
  178. wel.C0 = c0
  179. if c1 ~= nil then
  180. wel.C1 = c1
  181. end
  182. wel.Parent = parent
  183. return wel
  184. end
  185. function smokz(prnt)
  186. s = Instance.new("Smoke")
  187. s.Color = Color3.new(1, 1, 1)
  188. s.Enabled = false
  189. s.Name = "smok"
  190. s.Opacity = 0.5
  191. s.RiseVelocity = 0.2
  192. s.Size = 0.1
  193. s.Parent = prnt
  194. end
  195. function lerpz(joint, prop, cfrmz, alp)
  196. joint[prop] = joint[prop]:lerp(cfrmz, alp)
  197. end
  198. function resetlerp()
  199. RJ.C0 = RJC0
  200. RJ.C1 = RJC1
  201. N.C0 = NC0
  202. N.C1 = NC1
  203. RS.C0 = RSC0
  204. RS.C1 = RSC1
  205. LS.C0 = LSC0
  206. LS.C1 = LSC1
  207. RH.C0 = RHC0
  208. RH.C1 = RHC1
  209. LH.C0 = LHC0
  210. end
  211.  
  212.  
  213.  
  214.  
  215.  
  216.  
  217.  
  218.  
  219.  
  220.  
  221.  
  222. function RFistDamage()
  223.  
  224. end
  225. function rsmash()
  226. if activu == true then
  227. return
  228. end
  229. activu = true
  230.  
  231. human.WalkSpeed = human.WalkSpeed - 13
  232. animo(false)
  233. for _ = 1, 45 do
  234. swait()
  235. lerpz(RJ, "C0", RJC0 * cf(0, 0.8, -0.2) * ang(rd(10), rd(0), rd(-70)), 0.2)
  236. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(6), rd(2), rd(68)), 0.2)
  237. lerpz(RS, "C0", RSC0 * cf(rd2(-1, 1) / 10, rd2(-1, 1) / 10, rd2(-1, 1) / 10) * ang(rd(rd2(25, 35)), rd(rd2(-15, -5)), rd(rd2(80, 90))), 0.2)
  238. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  239. lerpz(LS, "C0", LSC0 * cf(-0.15, -0.4, 0.5) * ang(rd(-10), rd(60), rd(-86)), 0.2)
  240. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(80), rd(0)), 0.2)
  241. lerpz(RH, "C0", RHC0 * cf(0, 0.1, 0) * ang(rd(-6), rd(-29), rd(-2)), 0.2)
  242. lerpz(RH, "C1", RHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  243. lerpz(LH, "C0", LHC0 * cf(0.4, 0.2, -0.2) * ang(rd(-6), rd(80), rd(-10)), 0.2)
  244. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  245. end
  246. for _ = 1, 30 do
  247. swait()
  248. lerpz(RJ, "C0", RJC0 * cf(0, 1.2, -0.2) * ang(rd(5), rd(6), rd(-109)), 0.2)
  249. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(-2), rd(-6), rd(96)), 0.2)
  250. lerpz(RS, "C0", RSC0 * cf(rd2(-1, 1) / 10, rd2(-1, 1) / 10, rd2(-1, 1) / 10) * ang(rd(rd2(10, 20)), rd(rd2(-25, -15)), rd(rd2(100, 110))), 0.2)
  251. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(-10), rd(60), rd(-46)), 0.2)
  252. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(30), rd(0)), 0.2)
  253. lerpz(RH, "C0", RHC0 * cf(0, 0.1, 0) * ang(rd(-6), rd(-39), rd(-2)), 0.2)
  254. lerpz(LH, "C0", LHC0 * cf(0.4, 0.2, -0.2) * ang(rd(-6), rd(80), rd(-10)), 0.2)
  255. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(25), rd(0), rd(0)), 0.2)
  256.  
  257. end
  258. for l = 1, 3 do
  259. swait()
  260. lerpz(RJ, "C0", RJC0 * cf(0.4, -1.6, -0.2) * ang(rd(5), rd(6), rd(60)), 0.3 + l / 4)
  261. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(14), rd(-4), rd(-35)), 0.3 + l / 4)
  262. lerpz(RS, "C0", RSC0 * cf(0.3, -0.4, 0.55) * ang(rd(0), rd(-58), rd(95)), 0.3 + l / 4)
  263. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(-80), rd(0)), 0.3 + l / 4)
  264. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(-10), rd(60), rd(-66)), 0.3 + l / 4)
  265. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(30), rd(0)), 0.3 + l / 4)
  266. lerpz(RH, "C0", RHC0 * cf(0, 0.1, 0) * ang(rd(-6), rd(-39), rd(-2)), 0.3 + l / 4)
  267. lerpz(LH, "C0", LHC0 * cf(0.4, 0.2, -0.2) * ang(rd(-6), rd(80), rd(-10)), 0.3 + l / 4)
  268. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(25), rd(0), rd(0)), 0.3 + l / 4)
  269. end
  270. KABOOMZ()
  271. rarm.BrickColor = BrickColor.new("Pastel brown")
  272. for _ = 1, 8 do
  273. swait()
  274. lerpz(RJ, "C0", RJC0 * cf(1.5, -1.6, -0.7) * ang(rd(5), rd(18), rd(95)), 0.8)
  275. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(14), rd(-10), rd(-15)), 0.8)
  276. lerpz(RS, "C0", RSC0 * cf(0.3, -0.4, 0.55) * ang(rd(0), rd(40), rd(65)), 0.8)
  277. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(-80), rd(0)), 0.8)
  278. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(-10), rd(60), rd(-86)), 0.8)
  279. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(30), rd(0)), 0.8)
  280. lerpz(RH, "C0", RHC0 * cf(0, 0.7, 0) * ang(rd(-6), rd(-39), rd(24)), 0.8)
  281. lerpz(LH, "C0", LHC0 * cf(0.4, 0.2, -0.2) * ang(rd(-6), rd(80), rd(-20)), 0.8)
  282. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(25), rd(0), rd(0)), 0.8)
  283. end
  284. wait(1.5)
  285. animo(true)
  286. human.WalkSpeed = human.WalkSpeed + 13
  287. for _ = 1, 24 do
  288. swait()
  289. lerpz(RJ, "C0", RJC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  290. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  291. lerpz(RS, "C0", RSC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  292. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  293. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  294. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  295. lerpz(RH, "C0", RHC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  296. lerpz(LH, "C0", LHC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  297. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.2)
  298. end
  299. resetlerp()
  300. activu = false
  301. wait(5)
  302. rarm.BrickColor = BrickColor.new("Institutional white")
  303. end
  304.  
  305.  
  306.  
  307.  
  308. local debris=game:service"Debris"
  309. vt = Vector3.new
  310. bc = BrickColor.new
  311.  
  312.  
  313.  
  314.  
  315.  
  316.  
  317.  
  318.  
  319.  
  320.  
  321.  
  322.  
  323. function Ring()
  324.  
  325.  
  326. local effspwn = Instance.new("Part")
  327. local model = Instance.new("Model")
  328. game.Debris:AddItem(model, 20)
  329. model.Name = "smasheffects"
  330. model.Parent = workspace
  331. effspwn.Name = "spwnr"
  332. effspwn.Size = Vector3.new(1, 1, 1)
  333. effspwn.Anchored = true
  334. effspwn.CanCollide = false
  335. effspwn.Transparency = 1
  336. effspwn.CFrame = hrp.CFrame * CFrame.Angles(math.rad(180), 0, 0)
  337. effspwn.Parent = model
  338.  
  339. for i,v in pairs(FindNearestTorso(tors.CFrame.p,50))do
  340. if v:FindFirstChild('Humanoid') then
  341. v.Humanoid:TakeDamage(math.random(10000020,10000030))
  342. v.Humanoid.PlatformStand = true
  343. v:FindFirstChild("Torso").Velocity = head.CFrame.lookVector * 200
  344. end
  345. end
  346. coroutine.resume(coroutine.create(function()
  347. local shok = Instance.new("Part")
  348. shok.Name = "wring1"
  349. shok.BrickColor = BrickColor.new("Institutional white")
  350. shok.CFrame = effspwn.CFrame * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  351. shok.Size = Vector3.new(1, 1, 1)
  352. shok.Anchored = true
  353. shok.Material = "Neon"
  354. shok.Transparency = 0.25
  355. shok.CanCollide = false
  356. shok.Parent = model
  357. game.Debris:AddItem(shok, 12)
  358. local mesh = Instance.new("SpecialMesh")
  359. mesh.MeshType = "FileMesh"
  360. mesh.MeshId = "rbxassetid://3270017"
  361. mesh.Scale = Vector3.new(0.1, 0.1, 0.05)
  362. mesh.Parent = shok
  363. for e = 1, 30 do
  364. wait()
  365. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 3)
  366. shok.Transparency = shok.Transparency + 0.002
  367. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  368. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  369. end
  370. for e = 1, 38 do
  371. wait()
  372. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 0.1)
  373. shok.Transparency = shok.Transparency + 0.002
  374. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  375. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  376. end
  377. for e = 1, 24 do
  378. wait()
  379. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 0.1)
  380. shok.Transparency = shok.Transparency + 0.03
  381. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  382. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  383. end
  384. end))
  385. coroutine.resume(coroutine.create(function()
  386. local shok = Instance.new("Part")
  387. shok.Name = "wring2"
  388. shok.BrickColor = BrickColor.new("Institutional white")
  389. shok.CFrame = effspwn.CFrame * CFrame.new(0, 12, 0) * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  390. shok.Size = Vector3.new(1, 1, 1)
  391. shok.Anchored = true
  392. shok.Material = "Neon"
  393. shok.Transparency = 0.25
  394. shok.CanCollide = false
  395. shok.Parent = model
  396. game.Debris:AddItem(shok, 12)
  397. local mesh = Instance.new("SpecialMesh")
  398. mesh.MeshType = "FileMesh"
  399. mesh.MeshId = "rbxassetid://3270017"
  400. mesh.Scale = Vector3.new(12, 12, 0.05)
  401. mesh.Parent = shok
  402. for e = 1, 30 do
  403. wait()
  404. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 3)
  405. shok.Transparency = shok.Transparency + 0.002
  406. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  407. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  408. end
  409. for e = 1, 38 do
  410. wait()
  411. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 0.1)
  412. shok.Transparency = shok.Transparency + 0.002
  413. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  414. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  415. end
  416. for e = 1, 24 do
  417. wait()
  418. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 0.1)
  419. shok.Transparency = shok.Transparency + 0.03
  420. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  421. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  422. end
  423. end))
  424.  
  425. coroutine.resume(coroutine.create(function()
  426. local shok = Instance.new("Part")
  427. shok.Name = "shokwve"
  428. shok.BrickColor = BrickColor.new("Institutional white")
  429. shok.Position = effspwn.Position + Vector3.new(0, 5, 0)
  430. shok.Size = Vector3.new(1, 1, 1)
  431. shok.Anchored = true
  432. shok.Material = "Neon"
  433. shok.Transparency = 0.6
  434. shok.CanCollide = false
  435. shok.Parent = model
  436. game.Debris:AddItem(shok, 12)
  437. local mesh = Instance.new("SpecialMesh")
  438. mesh.MeshType = "FileMesh"
  439. mesh.MeshId = "rbxassetid://489415447"
  440. mesh.Scale = Vector3.new(1, 1, 1)
  441. mesh.Parent = shok
  442. for e = 1, 12 do
  443. wait()
  444. mesh.Scale = mesh.Scale + Vector3.new(2, 2, 2)
  445. shok.Transparency = shok.Transparency + 0.002
  446. end
  447. for e = 1, 32 do
  448. wait()
  449. mesh.Scale = mesh.Scale + Vector3.new(0.5, 0.5, 0.5)
  450. shok.Transparency = shok.Transparency + 0.002
  451. end
  452. for e = 1, 24 do
  453. wait()
  454. mesh.Scale = mesh.Scale + Vector3.new(0.5, 0.5, 0.5)
  455. shok.Transparency = shok.Transparency + 0.03
  456. end
  457. end))
  458. coroutine.resume(coroutine.create(function()
  459. local shok = Instance.new("Part")
  460. shok.Name = "shock2"
  461. shok.BrickColor = BrickColor.new("Institutional white")
  462. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  463. shok.Size = Vector3.new(1, 1, 1)
  464. shok.Anchored = true
  465. shok.Material = "Neon"
  466. shok.Transparency = 0.35
  467. shok.CanCollide = false
  468. shok.Parent = model
  469. game.Debris:AddItem(shok, 12)
  470. local mesh = Instance.new("SpecialMesh")
  471. mesh.MeshType = "FileMesh"
  472. mesh.MeshId = "rbxassetid://489415447"
  473. mesh.Scale = Vector3.new(12, 12, 12)
  474. mesh.Parent = shok
  475. for e = 1, 15 do
  476. wait()
  477. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  478. shok.Transparency = shok.Transparency + 0.004
  479. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  480. end
  481. for e = 1, 16 do
  482. wait()
  483. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  484. shok.Transparency = shok.Transparency + 0.004
  485. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  486. end
  487. for e = 1, 12 do
  488. wait()
  489. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  490. shok.Transparency = shok.Transparency + 0.06
  491. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  492. end
  493. end))
  494. coroutine.resume(coroutine.create(function()
  495. local shok = Instance.new("Part")
  496. shok.Name = "shock3"
  497. shok.BrickColor = BrickColor.new("Institutional white")
  498. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  499. shok.Size = Vector3.new(1, 1, 1)
  500. shok.Anchored = true
  501. shok.Material = "Neon"
  502. shok.Transparency = 0.35
  503. shok.CanCollide = false
  504. shok.Parent = model
  505. game.Debris:AddItem(shok, 12)
  506. local mesh = Instance.new("SpecialMesh")
  507. mesh.MeshType = "FileMesh"
  508. mesh.MeshId = "rbxassetid://489415447"
  509. mesh.Scale = Vector3.new(12, 12, 12)
  510. mesh.Parent = shok
  511. for e = 1, 15 do
  512. wait()
  513. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  514. shok.Transparency = shok.Transparency + 0.004
  515. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  516. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  517. end
  518. for e = 1, 16 do
  519. wait()
  520. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  521. shok.Transparency = shok.Transparency + 0.004
  522. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  523. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  524. end
  525. for e = 1, 12 do
  526. wait()
  527. mesh.Scale = mesh.Scale + Vector3.new(0.5, -1, 0.5)
  528. shok.Transparency = shok.Transparency + 0.06
  529. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  530. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  531. end
  532. end))
  533.  
  534. end
  535. function Landing()
  536.  
  537.  
  538.  
  539.  
  540.  
  541.  
  542. ROW = function(out, trans, s, wt, t, ang, plus)
  543. for i = 1, 360, 360/t do
  544. local c = Instance.new("Part", game.Workspace)
  545. c.FormFactor = 3
  546. c.TopSurface = 0
  547. c.BottomSurface = 0
  548. c.Size = s
  549. c.Anchored = true
  550. c.CanCollide = wt
  551. c.Material=workspace.Base.Material
  552. c.Transparency = trans
  553. c.BrickColor = workspace.Base.BrickColor
  554. c.CFrame = CFrame.new(tors.CFrame.x,0,tors.CFrame.z) * CFrame.Angles(0, math.rad(i + plus), 0) * CFrame.new(0, 0, out) * ang
  555. c.Locked=true
  556. game.Debris:AddItem(c,15)
  557. end
  558. end
  559.  
  560.  
  561.  
  562.  
  563.  
  564. ROW(12, 0, Vector3.new(34.5, 30, 3), true, 8, CFrame.Angles(math.rad(math.random (30,60)), 0, math.rad (math.random(-30,30))), 0)
  565. Ring()
  566.  
  567.  
  568.  
  569.  
  570.  
  571. end
  572.  
  573.  
  574.  
  575.  
  576.  
  577.  
  578.  
  579. function newRay(start,face,range,wat)
  580. local rey=Ray.new(start.p,(face.p-start.p).Unit*range)
  581. hit,pos=game.Workspace:FindPartOnRayWithIgnoreList(rey,wat)
  582. return rey,hit,pos
  583. end
  584.  
  585.  
  586.  
  587.  
  588. function jum()
  589. if activu == true then
  590. return
  591. end
  592. activu = true
  593. human.WalkSpeed = human.WalkSpeed - 13
  594. for l = 1, 30 do
  595. swait()
  596. lerpz(RJ, "C0", RJC0 * cf(0, 0, -0.5) * ang(rd(6), rd(0), rd(0)), 0.02 + l / 40)
  597. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(12), rd(0), rd(0)), 0.02 + l / 40)
  598. lerpz(RS, "C0", RSC0 * cf(0, 0, 0) * ang(rd(-8), rd(-7), rd(-10)), 0.02 + l / 40)
  599. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  600. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(-8), rd(7), rd(10)), 0.02 + l / 40)
  601. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  602. lerpz(RH, "C0", RHC0 * cf(0.4, 0.5, 0) * ang(rd(0), rd(-6), rd(8)), 0.02 + l / 40)
  603. lerpz(RH, "C1", RHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  604. lerpz(LH, "C0", LHC0 * cf(0, 0, 0) * ang(rd(3), rd(0), rd(42)), 0.02 + l / 40)
  605. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  606. end
  607. human.WalkSpeed = 50
  608. BV = Instance.new("BodyVelocity", tors)
  609. BV.maxForce = Vector3.new(0,100000,0)
  610. BV.P = 100000
  611. BV.velocity = Vector3.new(0,800,0)
  612. KABOOMZ2()
  613. coroutine.resume(coroutine.create(function()
  614. swait(3)
  615. BV:Destroy()
  616. end))
  617. for _ = 1, 18 do
  618. swait()
  619. lerpz(RJ, "C0", RJC0 * cf(0, 0, 0) * ang(rd(-3), rd(0), rd(0)), 0.6)
  620. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(-12), rd(0), rd(0)), 0.6)
  621. lerpz(RS, "C0", RSC0 * cf(0, 0, 0) * ang(rd(-9), rd(-9), rd(-15)), 0.6)
  622. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.6)
  623. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(-9), rd(9), rd(15)), 0.6)
  624. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.6)
  625. lerpz(RH, "C0", RHC0 * cf(0, 0, 0) * ang(rd(-6), rd(0), rd(-12)), 0.6)
  626. lerpz(RH, "C1", RHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.6)
  627. lerpz(LH, "C0", LHC0 * cf(0, 0, 0) * ang(rd(-6), rd(0), rd(12)), 0.6)
  628. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.6)
  629. end
  630. for _ = 1, 18 do
  631. swait()
  632. lerpz(RJ, "C0", RJC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  633. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  634. lerpz(RS, "C0", RSC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  635. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  636. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  637. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  638. lerpz(RH, "C0", RHC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  639. lerpz(RH, "C1", RHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  640. lerpz(LH, "C0", LHC0 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  641. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.3)
  642. end
  643. resetlerp()
  644. local ry,ht,ps=nil,nil,nil
  645. while ht==nil do
  646. ry,ht,ps=newRay(hrp.CFrame*CFrame.new(0,-2,0),hrp.CFrame*CFrame.new(0,-3,0),4.1,{chr})
  647. wait()
  648. end
  649. human.WalkSpeed = 0
  650. Landing()
  651. z = Instance.new("Sound",tors)
  652. z.SoundId = "rbxassetid://142070127"
  653. z.Volume = 2
  654. wait(.1)
  655. z:Play()
  656.  
  657. for l = 1, 30 do
  658. swait()
  659. lerpz(RJ, "C0", RJC0 * cf(0, 0, -0.5) * ang(rd(6), rd(0), rd(0)), 0.02 + l / 40)
  660. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(12), rd(0), rd(0)), 0.02 + l / 40)
  661. lerpz(RS, "C0", RSC0 * cf(0, 0, 0) * ang(rd(-8), rd(-7), rd(-10)), 0.02 + l / 40)
  662. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  663. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(-8), rd(7), rd(10)), 0.02 + l / 40)
  664. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  665. lerpz(RH, "C0", RHC0 * cf(0.4, 0.5, 0) * ang(rd(0), rd(-6), rd(8)), 0.02 + l / 40)
  666. lerpz(RH, "C1", RHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  667. lerpz(LH, "C0", LHC0 * cf(0, 0, 0) * ang(rd(3), rd(0), rd(42)), 0.02 + l / 40)
  668. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  669. end
  670. resetlerp()
  671. human.WalkSpeed = 16
  672.  
  673. activu = false
  674. end
  675.  
  676.  
  677.  
  678. local acos = math.acos
  679. local sqrt = math.sqrt
  680. local Vec3 = Vector3.new
  681. local fromAxisAngle = CFrame.fromAxisAngle
  682.  
  683. local function toAxisAngle(CFr)
  684. local X,Y,Z,R00,R01,R02,R10,R11,R12,R20,R21,R22 = CFr:components()
  685. local Angle = math.acos((R00+R11+R22-1)/2)
  686. local A = (R21-R12)^2+(R02-R20)^2+(R10-R01)^2
  687. A = A == 0 and 0.00001 or A
  688. local B = (R21-R12)^2+(R02-R20)^2+(R10-R01)^2
  689. B = B == 0 and 0.00001 or B
  690. local C = (R21-R12)^2+(R02-R20)^2+(R10-R01)^2
  691. C = C == 0 and 0.00001 or C
  692. local x = (R21-R12)/sqrt(A)
  693. local y = (R02-R20)/sqrt(B)
  694. local z = (R10-R01)/sqrt(C)
  695. return Vec3(x,y,z),Angle
  696. end
  697.  
  698. function ApplyTrig(Num,Func)
  699. local Min,Max = Func(0),Func(1)
  700. local i = Func(Num)
  701. return (i-Min)/(Max-Min)
  702. --[[if Func == "sin" then
  703. return (math.sin((1-Num)*math.pi)+1)/2
  704. elseif Func == "cos" then
  705. return (math.cos((1-Num)*math.pi)+1)/2
  706. end]]
  707. end
  708.  
  709. function LerpCFrame(CFrame1,CFrame2,Num)
  710. local Vec,Ang = toAxisAngle(CFrame1:inverse()*CFrame2)
  711. return CFrame1*fromAxisAngle(Vec,Ang*Num) + (CFrame2.p-CFrame1.p)*Num
  712. end
  713.  
  714. function Crater(Torso,Radius)
  715. spawn(function()
  716. local Ray = Ray.new(Torso.Position,Vector3.new(0,-1,0)*10)
  717. local Ignore = {}
  718. for i,v in pairs(game:GetService("Players"):GetPlayers()) do
  719. if v.Character ~= nil then
  720. Ignore[#Ignore+1] = v.Character
  721. end
  722. end
  723. local Hit,Pos,SurfaceNorm = workspace:FindPartOnRayWithIgnoreList(Ray,Ignore)
  724. if Hit == nil then return end
  725. local Parts = {}
  726. for i = 1,360,10 do
  727. local P = Instance.new("Part",Torso.Parent)
  728. P.Anchored = true
  729. P.FormFactor = "Custom"
  730. P.BrickColor = Hit.BrickColor
  731. P.Material = Hit.Material
  732. P.TopSurface = "Smooth"
  733. P.BottomSurface = "Smooth"
  734. P.Size = Vector3.new(5,10,10)*(math.random(80,100)/100)
  735. P.CFrame = ((CFrame.new(Pos,Pos+SurfaceNorm)*CFrame.Angles(math.rad(90),0,0))-Vector3.new(0,7,0))*CFrame.Angles(math.rad(math.random(-50,50)),math.rad(math.random(-50,50)),math.rad(math.random(-50,50)))
  736. Parts[#Parts+1] = {P,P.CFrame,((CFrame.new(Pos,Pos+SurfaceNorm)*CFrame.Angles(math.rad(90),0,0))-Vector3.new(0,1,0))*CFrame.Angles(0,math.rad(i),0)*CFrame.new(0,0,-Radius)*CFrame.Angles(math.rad(math.random(-50,-20)),math.rad(math.random(-15,15)),math.rad(math.random(-15,15))),P.Size}
  737. if math.random(0,5) == 0 then -- rubble
  738. local P = Instance.new("Part",Torso.Parent)
  739. P.Anchored = true
  740. P.FormFactor = "Custom"
  741. P.BrickColor = Hit.BrickColor
  742. P.Material = Hit.Material
  743. P.TopSurface = "Smooth"
  744. P.BottomSurface = "Smooth"
  745. P.Size = Vector3.new(2,2,2)*(math.random(80,100)/100)
  746. P.CFrame = ((CFrame.new(Pos,Pos+SurfaceNorm)*CFrame.Angles(math.rad(90),0,0))-Vector3.new(0,2.5,0))*CFrame.Angles(math.rad(math.random(-50,50)),math.rad(math.random(-50,50)),math.rad(math.random(-50,50)))
  747. Parts[#Parts+1] = {P,P.CFrame,(CFrame.new(Pos,Pos+SurfaceNorm)*CFrame.Angles(math.rad(90),0,0))*CFrame.Angles(0,math.rad(i),0)*CFrame.new(0,0,-Radius-8)*CFrame.Angles(math.rad(math.random(-90,90)),math.rad(math.random(-90,90)),math.rad(math.random(-90,90))),P.Size}
  748. end
  749. end
  750. for i = 0,1,0.05 do
  751. for i2,v in pairs(Parts) do
  752. v[1].CFrame = LerpCFrame(v[2],v[3],ApplyTrig(i,math.cos))
  753. end
  754. wait(0.02)
  755. end
  756. for i,v in pairs(Parts) do
  757. if v[1].Size.X > 2.1 then
  758. v[1].CFrame = v[1].CFrame+Vector3.new(0,2,0)
  759. end
  760. v[1].Anchored = false
  761. end
  762. for i = 0,1,0.05 do
  763. for i2,v in pairs(Parts) do
  764. v[1].Transparency = i
  765. if i == 1 then
  766. v[1]:Destroy()
  767. elseif i >= 0.25 then
  768. v[1].CanCollide = false
  769. end
  770. end
  771. wait(0.02)
  772. end
  773. Parts = nil
  774. end)
  775. end
  776.  
  777.  
  778. function FindNearestTorso(Position,Distance,SinglePlayer)
  779. if SinglePlayer then return(SinglePlayer.Torso.CFrame.p -Position).magnitude < Distance end
  780. local List = {}
  781. for i,v in pairs(workspace:GetChildren())do
  782. if v:IsA("Model")then
  783. if v:findFirstChild("Torso")then
  784. if v ~= chr then
  785. if(v.Torso.Position -Position).magnitude <= Distance then
  786. table.insert(List,v)
  787. end
  788. end
  789. end
  790. end
  791. end
  792. return List
  793. end
  794.  
  795. function KABOOMZ()
  796. local effspwn = Instance.new("Part")
  797. coroutine.resume(coroutine.create(function()
  798. local sound1 = Instance.new("Sound")
  799. sound1.SoundId = "rbxassetid://138137702"
  800. sound1.MaxDistance = 300
  801. sound1.EmitterSize = 20
  802. sound1.Volume = 5
  803. sound1.Pitch = 0.95
  804. sound1.Parent = effspwn
  805. local sound2 = Instance.new("Sound")
  806. sound2.SoundId = "rbxassetid://157878578"
  807. sound2.MaxDistance = 300
  808. sound2.EmitterSize = 20
  809. sound2.Volume = 2
  810. sound2.Pitch = 0.9
  811. sound2.Parent = effspwn
  812. local sound3 = Instance.new("Sound")
  813. sound3.SoundId = "rbxassetid://138250406"
  814. sound2.MaxDistance = 400
  815. sound2.EmitterSize = 30
  816. sound2.Volume = 1.5
  817. sound2.Pitch = 0.6
  818. sound2.Parent = effspwn
  819. sound2:Play()
  820. wait()
  821. sound1:Play()
  822. sound3:Play()
  823. end))
  824. local model = Instance.new("Model")
  825. game.Debris:AddItem(model, 20)
  826. model.Name = "smasheffects"
  827. model.Parent = workspace
  828. effspwn.Name = "spwnr"
  829. effspwn.Size = Vector3.new(1, 1, 1)
  830. effspwn.Anchored = true
  831. effspwn.CanCollide = false
  832. effspwn.Transparency = 1
  833. effspwn.CFrame = rarm.CFrame * CFrame.new(0, -0.7, 0)
  834. effspwn.Parent = model
  835.  
  836. Crater(head,60)
  837.  
  838. for i,v in pairs(FindNearestTorso(tors.CFrame.p,50))do
  839. if v:FindFirstChild('Humanoid') then
  840. v.Humanoid:TakeDamage(math.random(10000020,10000030))
  841. v.Humanoid.PlatformStand = true
  842. v:FindFirstChild("Torso").Velocity = head.CFrame.lookVector * 200
  843. end
  844. end
  845. coroutine.resume(coroutine.create(function()
  846. local shok = Instance.new("Part")
  847. shok.Name = "whoosh"
  848. shok.BrickColor = BrickColor.new("Institutional white")
  849. shok.CFrame = effspwn.CFrame * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  850. shok.Size = Vector3.new(1, 1, 1)
  851. shok.Anchored = true
  852. shok.Material = "Neon"
  853. shok.Transparency = 0.1
  854. shok.CanCollide = false
  855. shok.Parent = model
  856. game.Debris:AddItem(shok, 12)
  857. local mesh = Instance.new("SpecialMesh")
  858. mesh.MeshType = "FileMesh"
  859. mesh.MeshId = "rbxassetid://437347603"
  860. mesh.Scale = Vector3.new(0.8, 0.8, 0.3)
  861. mesh.Parent = shok
  862. for e = 1, 8 do
  863. wait()
  864. mesh.Scale = mesh.Scale + Vector3.new(0.24, 0.24, 0.22)
  865. shok.Transparency = shok.Transparency + 0.035
  866. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -14), 0.4)
  867. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(29))
  868. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  869. end
  870. for e = 1, 16 do
  871. wait()
  872. mesh.Scale = mesh.Scale + Vector3.new(0.13, 0.13, 0.12)
  873. shok.Transparency = shok.Transparency + 0.11
  874. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -5), 0.4)
  875. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(15))
  876. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  877. end
  878. end))
  879. coroutine.resume(coroutine.create(function()
  880. local shok = Instance.new("Part")
  881. shok.Name = "wring1"
  882. shok.BrickColor = BrickColor.new("Institutional white")
  883. shok.CFrame = effspwn.CFrame * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  884. shok.Size = Vector3.new(1, 1, 1)
  885. shok.Anchored = true
  886. shok.Material = "Neon"
  887. shok.Transparency = 0.25
  888. shok.CanCollide = false
  889. shok.Parent = model
  890. game.Debris:AddItem(shok, 12)
  891. local mesh = Instance.new("SpecialMesh")
  892. mesh.MeshType = "FileMesh"
  893. mesh.MeshId = "rbxassetid://3270017"
  894. mesh.Scale = Vector3.new(0.1, 0.1, 0.05)
  895. mesh.Parent = shok
  896. for e = 1, 30 do
  897. wait()
  898. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 3)
  899. shok.Transparency = shok.Transparency + 0.002
  900. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  901. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  902. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  903.  
  904. end
  905. for e = 1, 38 do
  906. wait()
  907. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 0.1)
  908. shok.Transparency = shok.Transparency + 0.002
  909. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  910. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  911. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  912.  
  913. end
  914. for e = 1, 24 do
  915. wait()
  916. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 0.1)
  917. shok.Transparency = shok.Transparency + 0.03
  918. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  919. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  920. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  921.  
  922. end
  923. end))
  924. coroutine.resume(coroutine.create(function()
  925. local shok = Instance.new("Part")
  926. shok.Name = "wring2"
  927. shok.BrickColor = BrickColor.new("Institutional white")
  928. shok.CFrame = effspwn.CFrame * CFrame.new(0, 12, 0) * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  929. shok.Size = Vector3.new(1, 1, 1)
  930. shok.Anchored = true
  931. shok.Material = "Neon"
  932. shok.Transparency = 0.25
  933. shok.CanCollide = false
  934. shok.Parent = model
  935. game.Debris:AddItem(shok, 12)
  936. local mesh = Instance.new("SpecialMesh")
  937. mesh.MeshType = "FileMesh"
  938. mesh.MeshId = "rbxassetid://3270017"
  939. mesh.Scale = Vector3.new(12, 12, 0.05)
  940. mesh.Parent = shok
  941. for e = 1, 30 do
  942. wait()
  943. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 3)
  944. shok.Transparency = shok.Transparency + 0.002
  945. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  946. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  947. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  948.  
  949. end
  950. for e = 1, 38 do
  951. wait()
  952. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 0.1)
  953. shok.Transparency = shok.Transparency + 0.002
  954. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  955. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  956. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  957.  
  958. end
  959. for e = 1, 24 do
  960. wait()
  961. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 0.1)
  962. shok.Transparency = shok.Transparency + 0.03
  963. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  964. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  965. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  966.  
  967. end
  968. end))
  969. coroutine.resume(coroutine.create(function()
  970. local shok = Instance.new("Part")
  971. shok.Name = "coil1"
  972. shok.BrickColor = BrickColor.new("Institutional white")
  973. shok.CFrame = effspwn.CFrame * CFrame.new(0, 12, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0))
  974. shok.Size = Vector3.new(1, 1, 1)
  975. shok.Anchored = true
  976. shok.Material = "Neon"
  977. shok.Transparency = 0.25
  978. shok.CanCollide = false
  979. shok.Parent = model
  980. game.Debris:AddItem(shok, 12)
  981. local mesh = Instance.new("SpecialMesh")
  982. mesh.MeshType = "FileMesh"
  983. mesh.MeshId = "http://www.roblox.com/asset/?id=1051557"
  984. mesh.Scale = Vector3.new(12, 12, 12)
  985. mesh.Parent = shok
  986. for e = 1, 15 do
  987. wait()
  988. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  989. shok.Transparency = shok.Transparency + 0.004
  990. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  991. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  992. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  993.  
  994. end
  995. for e = 1, 16 do
  996. wait()
  997. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  998. shok.Transparency = shok.Transparency + 0.004
  999. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1000. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1001. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1002.  
  1003. end
  1004. for e = 1, 12 do
  1005. wait()
  1006. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1007. shok.Transparency = shok.Transparency + 0.06
  1008. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1009. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1010. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1011.  
  1012. end
  1013. end))
  1014. coroutine.resume(coroutine.create(function()
  1015. local shok = Instance.new("Part")
  1016. shok.Name = "coil2"
  1017. shok.BrickColor = BrickColor.new("Institutional white")
  1018. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0))
  1019. shok.Size = Vector3.new(1, 1, 1)
  1020. shok.Anchored = true
  1021. shok.Material = "Neon"
  1022. shok.Transparency = 0.25
  1023. shok.CanCollide = false
  1024. shok.Parent = model
  1025. game.Debris:AddItem(shok, 12)
  1026. local mesh = Instance.new("SpecialMesh")
  1027. mesh.MeshType = "FileMesh"
  1028. mesh.MeshId = "http://www.roblox.com/asset/?id=1051557"
  1029. mesh.Scale = Vector3.new(6, 12, 6)
  1030. mesh.Parent = shok
  1031. for e = 1, 15 do
  1032. wait()
  1033. mesh.Scale = mesh.Scale + Vector3.new(1.1, 2.4, 1.1)
  1034. shok.Transparency = shok.Transparency + 0.005
  1035. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  1036. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-60), math.rad(0))
  1037. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1038.  
  1039. end
  1040. for e = 1, 16 do
  1041. wait()
  1042. mesh.Scale = mesh.Scale + Vector3.new(1.1, 2.4, 1.1)
  1043. shok.Transparency = shok.Transparency + 0.005
  1044. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1045. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-60), math.rad(0))
  1046. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1047.  
  1048. end
  1049. for e = 1, 12 do
  1050. wait()
  1051. mesh.Scale = mesh.Scale + Vector3.new(1.1, 2.4, 1.1)
  1052. shok.Transparency = shok.Transparency + 0.09
  1053. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1054. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-60), math.rad(0))
  1055. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1056.  
  1057. end
  1058. end))
  1059. coroutine.resume(coroutine.create(function()
  1060. local shok = Instance.new("Part")
  1061. shok.Name = "shokwve"
  1062. shok.BrickColor = BrickColor.new("Institutional white")
  1063. shok.Position = effspwn.Position - Vector3.new(0, 0.8, 0)
  1064. shok.Size = Vector3.new(1, 1, 1)
  1065. shok.Anchored = true
  1066. shok.Material = "Neon"
  1067. shok.Transparency = 0.6
  1068. shok.CanCollide = false
  1069. shok.Parent = model
  1070. game.Debris:AddItem(shok, 12)
  1071. local mesh = Instance.new("SpecialMesh")
  1072. mesh.MeshType = "FileMesh"
  1073. mesh.MeshId = "rbxassetid://489415447"
  1074. mesh.Scale = Vector3.new(1, 1, 1)
  1075. mesh.Parent = shok
  1076. for e = 1, 12 do
  1077. wait()
  1078. mesh.Scale = mesh.Scale + Vector3.new(2, 2, 2)
  1079. shok.Transparency = shok.Transparency + 0.002
  1080. end
  1081. for e = 1, 32 do
  1082. wait()
  1083. mesh.Scale = mesh.Scale + Vector3.new(0.5, 0.5, 0.5)
  1084. shok.Transparency = shok.Transparency + 0.002
  1085. end
  1086. for e = 1, 24 do
  1087. wait()
  1088. mesh.Scale = mesh.Scale + Vector3.new(0.5, 0.5, 0.5)
  1089. shok.Transparency = shok.Transparency + 0.03
  1090. end
  1091. end))
  1092. coroutine.resume(coroutine.create(function()
  1093. local shok = Instance.new("Part")
  1094. shok.Name = "shock2"
  1095. shok.BrickColor = BrickColor.new("Institutional white")
  1096. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  1097. shok.Size = Vector3.new(1, 1, 1)
  1098. shok.Anchored = true
  1099. shok.Material = "Neon"
  1100. shok.Transparency = 0.35
  1101. shok.CanCollide = false
  1102. shok.Parent = model
  1103. game.Debris:AddItem(shok, 12)
  1104. local mesh = Instance.new("SpecialMesh")
  1105. mesh.MeshType = "FileMesh"
  1106. mesh.MeshId = "rbxassetid://489415447"
  1107. mesh.Scale = Vector3.new(12, 12, 12)
  1108. mesh.Parent = shok
  1109. for e = 1, 15 do
  1110. wait()
  1111. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1112. shok.Transparency = shok.Transparency + 0.004
  1113. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1114. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1115.  
  1116. end
  1117. for e = 1, 16 do
  1118. wait()
  1119. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1120. shok.Transparency = shok.Transparency + 0.004
  1121. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1122. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1123.  
  1124. end
  1125. for e = 1, 12 do
  1126. wait()
  1127. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1128. shok.Transparency = shok.Transparency + 0.06
  1129. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1130. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1131.  
  1132. end
  1133. end))
  1134. coroutine.resume(coroutine.create(function()
  1135. local shok = Instance.new("Part")
  1136. shok.Name = "shock3"
  1137. shok.BrickColor = BrickColor.new("Institutional white")
  1138. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  1139. shok.Size = Vector3.new(1, 1, 1)
  1140. shok.Anchored = true
  1141. shok.Material = "Neon"
  1142. shok.Transparency = 0.35
  1143. shok.CanCollide = false
  1144. shok.Parent = model
  1145. game.Debris:AddItem(shok, 12)
  1146. local mesh = Instance.new("SpecialMesh")
  1147. mesh.MeshType = "FileMesh"
  1148. mesh.MeshId = "rbxassetid://489415447"
  1149. mesh.Scale = Vector3.new(12, 12, 12)
  1150. mesh.Parent = shok
  1151. for e = 1, 15 do
  1152. wait()
  1153. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1154. shok.Transparency = shok.Transparency + 0.004
  1155. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1156. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1157. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1158.  
  1159. end
  1160. for e = 1, 16 do
  1161. wait()
  1162. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1163. shok.Transparency = shok.Transparency + 0.004
  1164. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1165. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1166. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1167.  
  1168. end
  1169. for e = 1, 12 do
  1170. wait()
  1171. mesh.Scale = mesh.Scale + Vector3.new(0.5, -1, 0.5)
  1172. shok.Transparency = shok.Transparency + 0.06
  1173. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1174. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1175. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1176.  
  1177. end
  1178. end))
  1179. end
  1180. function KABOOMZ2()
  1181. local effspwn = Instance.new("Part")
  1182. coroutine.resume(coroutine.create(function()
  1183. local sound1 = Instance.new("Sound")
  1184. sound1.SoundId = "rbxassetid://138137702"
  1185. sound1.MaxDistance = 300
  1186. sound1.EmitterSize = 20
  1187. sound1.Volume = 2.5
  1188. sound1.Pitch = 0.65
  1189. sound1.Parent = effspwn
  1190. local sound2 = Instance.new("Sound")
  1191. sound2.SoundId = "rbxassetid://157878578"
  1192. sound2.MaxDistance = 300
  1193. sound2.EmitterSize = 20
  1194. sound2.Volume = 1
  1195. sound2.Pitch = 0.7
  1196. sound2.Parent = effspwn
  1197. local sound3 = Instance.new("Sound")
  1198. sound3.SoundId = "rbxassetid://138250406"
  1199. sound2.MaxDistance = 400
  1200. sound2.EmitterSize = 30
  1201. sound2.Volume = 0.5
  1202. sound2.Pitch = 0.5
  1203. sound2.Parent = effspwn
  1204. sound2:Play()
  1205. wait()
  1206. sound1:Play()
  1207. sound3:Play()
  1208. end))
  1209. local model = Instance.new("Model")
  1210. game.Debris:AddItem(model, 20)
  1211. model.Name = "smasheffects"
  1212. model.Parent = workspace
  1213. effspwn.Name = "spwnr"
  1214. effspwn.Size = Vector3.new(1, 1, 1)
  1215. effspwn.Anchored = true
  1216. effspwn.CanCollide = false
  1217. effspwn.Transparency = 1
  1218. effspwn.CFrame = hrp.CFrame * CFrame.Angles(math.rad(180), 0, 0)
  1219. effspwn.Parent = model
  1220.  
  1221.  
  1222.  
  1223.  
  1224.  
  1225. Crater(head,60)
  1226. Crater(head,120)
  1227.  
  1228. for i,v in pairs(FindNearestTorso(tors.CFrame.p,50))do
  1229. if v:FindFirstChild('Humanoid') then
  1230. v.Humanoid:TakeDamage(math.random(10000020,10000030))
  1231. v.Humanoid.PlatformStand = true
  1232. v:FindFirstChild("Torso").Velocity = head.CFrame.lookVector * 200
  1233. end
  1234. end
  1235.  
  1236. coroutine.resume(coroutine.create(function()
  1237. local shok = Instance.new("Part")
  1238. shok.Name = "whoosh"
  1239. shok.BrickColor = BrickColor.new("Institutional white")
  1240. shok.CFrame = effspwn.CFrame * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  1241. shok.Size = Vector3.new(1, 1, 1)
  1242. shok.Anchored = true
  1243. shok.Material = "Neon"
  1244. shok.Transparency = 0.1
  1245. shok.CanCollide = false
  1246. shok.Parent = model
  1247. game.Debris:AddItem(shok, 12)
  1248. local mesh = Instance.new("SpecialMesh")
  1249. mesh.MeshType = "FileMesh"
  1250. mesh.MeshId = "rbxassetid://437347603"
  1251. mesh.Scale = Vector3.new(0.8, 0.8, 0.3)
  1252. mesh.Parent = shok
  1253.  
  1254.  
  1255.  
  1256.  
  1257.  
  1258. for e = 1, 8 do
  1259. wait()
  1260. mesh.Scale = mesh.Scale + Vector3.new(0.24, 0.24, 0.22)
  1261. shok.Transparency = shok.Transparency + 0.035
  1262. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -22), 0.4)
  1263. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(29))
  1264. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1265.  
  1266. end
  1267. for e = 1, 16 do
  1268. wait()
  1269. mesh.Scale = mesh.Scale + Vector3.new(0.13, 0.13, 0.12)
  1270. shok.Transparency = shok.Transparency + 0.11
  1271. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -10), 0.4)
  1272. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(15))
  1273. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  1274.  
  1275. end
  1276. end))
  1277. coroutine.resume(coroutine.create(function()
  1278. local shok = Instance.new("Part")
  1279. shok.Name = "wring1"
  1280. shok.BrickColor = BrickColor.new("Institutional white")
  1281. shok.CFrame = effspwn.CFrame * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  1282. shok.Size = Vector3.new(1, 1, 1)
  1283. shok.Anchored = true
  1284. shok.Material = "Neon"
  1285. shok.Transparency = 0.25
  1286. shok.CanCollide = false
  1287. shok.Parent = model
  1288. game.Debris:AddItem(shok, 12)
  1289. local mesh = Instance.new("SpecialMesh")
  1290. mesh.MeshType = "FileMesh"
  1291. mesh.MeshId = "rbxassetid://3270017"
  1292. mesh.Scale = Vector3.new(0.1, 0.1, 0.05)
  1293. mesh.Parent = shok
  1294. for e = 1, 30 do
  1295. wait()
  1296. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 3)
  1297. shok.Transparency = shok.Transparency + 0.002
  1298. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  1299. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  1300. end
  1301. for e = 1, 38 do
  1302. wait()
  1303. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 0.1)
  1304. shok.Transparency = shok.Transparency + 0.002
  1305. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1306. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  1307. end
  1308. for e = 1, 24 do
  1309. wait()
  1310. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 0.1)
  1311. shok.Transparency = shok.Transparency + 0.03
  1312. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1313. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  1314. end
  1315. end))
  1316. coroutine.resume(coroutine.create(function()
  1317. local shok = Instance.new("Part")
  1318. shok.Name = "wring2"
  1319. shok.BrickColor = BrickColor.new("Institutional white")
  1320. shok.CFrame = effspwn.CFrame * CFrame.new(0, 12, 0) * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  1321. shok.Size = Vector3.new(1, 1, 1)
  1322. shok.Anchored = true
  1323. shok.Material = "Neon"
  1324. shok.Transparency = 0.25
  1325. shok.CanCollide = false
  1326. shok.Parent = model
  1327. game.Debris:AddItem(shok, 12)
  1328. local mesh = Instance.new("SpecialMesh")
  1329. mesh.MeshType = "FileMesh"
  1330. mesh.MeshId = "rbxassetid://3270017"
  1331. mesh.Scale = Vector3.new(12, 12, 0.05)
  1332. mesh.Parent = shok
  1333. for e = 1, 30 do
  1334. wait()
  1335. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 3)
  1336. shok.Transparency = shok.Transparency + 0.002
  1337. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  1338. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  1339. end
  1340. for e = 1, 38 do
  1341. wait()
  1342. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 0.1)
  1343. shok.Transparency = shok.Transparency + 0.002
  1344. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1345. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  1346. end
  1347. for e = 1, 24 do
  1348. wait()
  1349. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 0.1)
  1350. shok.Transparency = shok.Transparency + 0.03
  1351. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1352. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  1353. end
  1354. end))
  1355. coroutine.resume(coroutine.create(function()
  1356. local shok = Instance.new("Part")
  1357. shok.Name = "coil1"
  1358. shok.BrickColor = BrickColor.new("Institutional white")
  1359. shok.CFrame = effspwn.CFrame * CFrame.new(0, 12, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0))
  1360. shok.Size = Vector3.new(1, 1, 1)
  1361. shok.Anchored = true
  1362. shok.Material = "Neon"
  1363. shok.Transparency = 0.25
  1364. shok.CanCollide = false
  1365. shok.Parent = model
  1366. game.Debris:AddItem(shok, 12)
  1367. local mesh = Instance.new("SpecialMesh")
  1368. mesh.MeshType = "FileMesh"
  1369. mesh.MeshId = "http://www.roblox.com/asset/?id=1051557"
  1370. mesh.Scale = Vector3.new(12, 12, 12)
  1371. mesh.Parent = shok
  1372. for e = 1, 15 do
  1373. wait()
  1374. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1375. shok.Transparency = shok.Transparency + 0.004
  1376. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  1377. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1378. end
  1379. for e = 1, 16 do
  1380. wait()
  1381. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1382. shok.Transparency = shok.Transparency + 0.004
  1383. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1384. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1385. end
  1386. for e = 1, 12 do
  1387. wait()
  1388. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1389. shok.Transparency = shok.Transparency + 0.06
  1390. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1391. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1392. end
  1393. end))
  1394. coroutine.resume(coroutine.create(function()
  1395. local shok = Instance.new("Part")
  1396. shok.Name = "coil2"
  1397. shok.BrickColor = BrickColor.new("Institutional white")
  1398. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0))
  1399. shok.Size = Vector3.new(1, 1, 1)
  1400. shok.Anchored = true
  1401. shok.Material = "Neon"
  1402. shok.Transparency = 0.25
  1403. shok.CanCollide = false
  1404. shok.Parent = model
  1405. game.Debris:AddItem(shok, 12)
  1406. local mesh = Instance.new("SpecialMesh")
  1407. mesh.MeshType = "FileMesh"
  1408. mesh.MeshId = "http://www.roblox.com/asset/?id=1051557"
  1409. mesh.Scale = Vector3.new(6, 12, 6)
  1410. mesh.Parent = shok
  1411. for e = 1, 15 do
  1412. wait()
  1413. mesh.Scale = mesh.Scale + Vector3.new(1.1, 2.4, 1.1)
  1414. shok.Transparency = shok.Transparency + 0.005
  1415. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  1416. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-60), math.rad(0))
  1417. end
  1418. for e = 1, 16 do
  1419. wait()
  1420. mesh.Scale = mesh.Scale + Vector3.new(1.1, 2.4, 1.1)
  1421. shok.Transparency = shok.Transparency + 0.005
  1422. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1423. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-60), math.rad(0))
  1424. end
  1425. for e = 1, 12 do
  1426. wait()
  1427. mesh.Scale = mesh.Scale + Vector3.new(1.1, 2.4, 1.1)
  1428. shok.Transparency = shok.Transparency + 0.09
  1429. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  1430. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-60), math.rad(0))
  1431. end
  1432. end))
  1433. coroutine.resume(coroutine.create(function()
  1434. local shok = Instance.new("Part")
  1435. shok.Name = "shokwve"
  1436. shok.BrickColor = BrickColor.new("Institutional white")
  1437. shok.Position = effspwn.Position + Vector3.new(0, 5, 0)
  1438. shok.Size = Vector3.new(1, 1, 1)
  1439. shok.Anchored = true
  1440. shok.Material = "Neon"
  1441. shok.Transparency = 0.6
  1442. shok.CanCollide = false
  1443. shok.Parent = model
  1444. game.Debris:AddItem(shok, 12)
  1445. local mesh = Instance.new("SpecialMesh")
  1446. mesh.MeshType = "FileMesh"
  1447. mesh.MeshId = "rbxassetid://489415447"
  1448. mesh.Scale = Vector3.new(1, 1, 1)
  1449. mesh.Parent = shok
  1450. for e = 1, 12 do
  1451. wait()
  1452. mesh.Scale = mesh.Scale + Vector3.new(2, 2, 2)
  1453. shok.Transparency = shok.Transparency + 0.002
  1454. end
  1455. for e = 1, 32 do
  1456. wait()
  1457. mesh.Scale = mesh.Scale + Vector3.new(0.5, 0.5, 0.5)
  1458. shok.Transparency = shok.Transparency + 0.002
  1459. end
  1460. for e = 1, 24 do
  1461. wait()
  1462. mesh.Scale = mesh.Scale + Vector3.new(0.5, 0.5, 0.5)
  1463. shok.Transparency = shok.Transparency + 0.03
  1464. end
  1465. end))
  1466. coroutine.resume(coroutine.create(function()
  1467. local shok = Instance.new("Part")
  1468. shok.Name = "shock2"
  1469. shok.BrickColor = BrickColor.new("Institutional white")
  1470. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  1471. shok.Size = Vector3.new(1, 1, 1)
  1472. shok.Anchored = true
  1473. shok.Material = "Neon"
  1474. shok.Transparency = 0.35
  1475. shok.CanCollide = false
  1476. shok.Parent = model
  1477. game.Debris:AddItem(shok, 12)
  1478. local mesh = Instance.new("SpecialMesh")
  1479. mesh.MeshType = "FileMesh"
  1480. mesh.MeshId = "rbxassetid://489415447"
  1481. mesh.Scale = Vector3.new(12, 12, 12)
  1482. mesh.Parent = shok
  1483. for e = 1, 15 do
  1484. wait()
  1485. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1486. shok.Transparency = shok.Transparency + 0.004
  1487. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1488. end
  1489. for e = 1, 16 do
  1490. wait()
  1491. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1492. shok.Transparency = shok.Transparency + 0.004
  1493. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1494. end
  1495. for e = 1, 12 do
  1496. wait()
  1497. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  1498. shok.Transparency = shok.Transparency + 0.06
  1499. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  1500. end
  1501. end))
  1502. coroutine.resume(coroutine.create(function()
  1503. local shok = Instance.new("Part")
  1504. shok.Name = "shock3"
  1505. shok.BrickColor = BrickColor.new("Institutional white")
  1506. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  1507. shok.Size = Vector3.new(1, 1, 1)
  1508. shok.Anchored = true
  1509. shok.Material = "Neon"
  1510. shok.Transparency = 0.35
  1511. shok.CanCollide = false
  1512. shok.Parent = model
  1513. game.Debris:AddItem(shok, 12)
  1514. local mesh = Instance.new("SpecialMesh")
  1515. mesh.MeshType = "FileMesh"
  1516. mesh.MeshId = "rbxassetid://489415447"
  1517. mesh.Scale = Vector3.new(12, 12, 12)
  1518. mesh.Parent = shok
  1519. for e = 1, 15 do
  1520. wait()
  1521. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1522. shok.Transparency = shok.Transparency + 0.004
  1523. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1524. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1525. end
  1526. for e = 1, 16 do
  1527. wait()
  1528. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1529. shok.Transparency = shok.Transparency + 0.004
  1530. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1531. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1532. end
  1533. for e = 1, 12 do
  1534. wait()
  1535. mesh.Scale = mesh.Scale + Vector3.new(0.5, -1, 0.5)
  1536. shok.Transparency = shok.Transparency + 0.06
  1537. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1538. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1539. end
  1540. end))
  1541. end
  1542.  
  1543.  
  1544.  
  1545. tor = chr.Torso
  1546. Debounce = false
  1547.  
  1548. Invis = function()
  1549. for i = 1,20 do
  1550. chr['Right Arm'].Transparency = chr['Right Arm'].Transparency + .05
  1551. chr['Left Arm'].Transparency = chr['Left Arm'].Transparency + .05
  1552. chr['Right Leg'].Transparency = chr['Right Leg'].Transparency + .05
  1553. chr['Left Leg'].Transparency = chr['Left Leg'].Transparency + .05
  1554. chr['Head'].Transparency = chr['Head'].Transparency + .05
  1555. chr['Torso'].Transparency = chr['Torso'].Transparency + .05
  1556. chr.Head['face'].Transparency = chr.Head['face'].Transparency + .05
  1557. game["Run Service"].RenderStepped:wait()
  1558. end
  1559. end
  1560.  
  1561. Vis = function()
  1562. for i = 1,20 do
  1563. chr['Right Arm'].Transparency = chr['Right Arm'].Transparency - .05
  1564. chr['Left Arm'].Transparency = chr['Left Arm'].Transparency - .05
  1565. chr['Right Leg'].Transparency = chr['Right Leg'].Transparency - .05
  1566. chr['Left Leg'].Transparency = chr['Left Leg'].Transparency - .05
  1567. chr['Head'].Transparency = chr['Head'].Transparency - .05
  1568. chr['Torso'].Transparency = chr['Torso'].Transparency - .05
  1569. chr.Head['face'].Transparency = chr.Head['face'].Transparency - .05
  1570. game["Run Service"].RenderStepped:wait()
  1571. end
  1572. end
  1573.  
  1574. Fade = function(Part)
  1575. if Part:IsA'Part' then
  1576. for i = 1,20 do
  1577. Part.Transparency = Part.Transparency + .05
  1578. Part.Size = Part.Size - Vector3.new(.04,.04,.04)
  1579. Part.CFrame = Part.CFrame * CFrame.new(0,-.1,0)
  1580. wait()
  1581. end
  1582. Part:Destroy()
  1583. end
  1584. end
  1585.  
  1586. Teleport = function(cx,cy,cz)
  1587. Debounce = true
  1588. tor.Anchored = true
  1589. Invis()
  1590. --MakeTpPart()
  1591. tor.Anchored = false
  1592. tor.CFrame = CFrame.new(cx,cy,cz) * CFrame.new(0,3,0)
  1593. tor.Anchored = true
  1594. Vis()
  1595. tor.Anchored = false
  1596. Debounce = false
  1597. end;
  1598.  
  1599.  
  1600.  
  1601. tps = Instance.new("Sound",chr)
  1602. tps.SoundId = "http://www.roblox.com/asset/?id = 449860746"
  1603. tps.Volume = 30
  1604.  
  1605.  
  1606. function Tele()
  1607. human.WalkSpeed = 0
  1608. if activu == true then
  1609. return
  1610. end
  1611. activu = true
  1612.  
  1613. for l = 1, 30 do
  1614. swait()
  1615. lerpz(RJ, "C0", RJC0 * cf(0, 0, -0.5) * ang(rd(6), rd(0), rd(0)), 0.02 + l / 40)
  1616. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(12), rd(0), rd(0)), 0.02 + l / 40)
  1617. lerpz(RS, "C0", RSC0 * cf(0, 0, 0) * ang(rd(-8), rd(-7), rd(-10)), 0.02 + l / 40)
  1618. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  1619. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(-8), rd(7), rd(10)), 0.02 + l / 40)
  1620. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  1621. lerpz(RH, "C0", RHC0 * cf(0.4, 0.5, 0) * ang(rd(0), rd(-6), rd(8)), 0.02 + l / 40)
  1622. lerpz(RH, "C1", RHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  1623. lerpz(LH, "C0", LHC0 * cf(0, 0, 0) * ang(rd(3), rd(0), rd(42)), 0.02 + l / 40)
  1624. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  1625. end
  1626. local rng = Instance.new("Part", chr)
  1627. rng.Anchored = true
  1628. rng.BrickColor = BrickColor.new("Institutional white")
  1629. rng.CanCollide = false
  1630. rng.FormFactor = 3
  1631. rng.Name = "Ring"
  1632. rng.Size = Vector3.new(1, 1, 1)
  1633. rng.Transparency = 0.5
  1634. rng.TopSurface = 0
  1635. rng.BottomSurface = 0
  1636. rng.Position = tors.Position - Vector3.new(0,2,0)
  1637. rng.CFrame = rng.CFrame * CFrame.Angles(math.rad(90), math.rad(0), math.rad(0))
  1638. local rngm = Instance.new("SpecialMesh", rng)
  1639. rngm.MeshId = "http://www.roblox.com/asset/?id=3270017"
  1640. rngm.Scale = Vector3.new(1, 1, 2)
  1641. lleg.BrickColor = BrickColor.new("Pastel brown")
  1642. rleg.BrickColor = BrickColor.new("Pastel brown")
  1643. coroutine.wrap(function()
  1644. for i = 1, 60, 8 do
  1645. rngm.Scale = Vector3.new(1.2 + i*1.1, 1.2 + i*1.1, 1)
  1646. rng.Transparency = i/60
  1647. wait()
  1648. end
  1649. wait()
  1650. rng:Destroy()
  1651. end)()
  1652. tps:Play()
  1653. Teleport(mouse.Hit.X,mouse.Hit.Y,mouse.Hit.Z)
  1654. resetlerp()
  1655. human.WalkSpeed = 16
  1656. activu = false
  1657. wait(5)
  1658. lleg.BrickColor = BrickColor.new("Institutional white")
  1659. rleg.BrickColor = BrickColor.new("Institutional white")
  1660. end
  1661.  
  1662.  
  1663.  
  1664.  
  1665. boom3 = Instance.new("Sound",chr)
  1666. boom3.SoundId = "http://www.roblox.com/asset/?id = 450719019"
  1667. boom3.Volume = 50
  1668.  
  1669.  
  1670.  
  1671.  
  1672.  
  1673. gprop = {}
  1674. function materialhit(hit)
  1675. if hit.Parent ~= chr and hit.Parent.Parent ~= chr and hit.Name ~= "Trace" and hit.Parent:FindFirstChild("Humanoid") == nil then
  1676. gprop = {hit.BrickColor,hit.Material}
  1677. end
  1678. end
  1679. chr["Left Leg"].Touched:connect(materialhit)
  1680. chr["Right Leg"].Touched:connect(materialhit)
  1681.  
  1682.  
  1683. function KickBoom()
  1684. local effspwn = Instance.new("Part")
  1685. local model = Instance.new("Model")
  1686. game.Debris:AddItem(model, 20)
  1687. model.Name = "smasheffects"
  1688. model.Parent = chr
  1689. effspwn.Name = "spwnr"
  1690. effspwn.Size = Vector3.new(1, 1, 1)
  1691. effspwn.Anchored = true
  1692. effspwn.CanCollide = false
  1693. effspwn.Transparency = 1
  1694. effspwn.CFrame = hrp.CFrame * CFrame.Angles(math.rad(180), 0, 0)
  1695. effspwn.Parent = model
  1696.  
  1697. for i = 1, 15 do
  1698. local gtrace = Instance.new("Part",game.Workspace)
  1699. gtrace.BrickColor = gprop[1]
  1700. gtrace.Material = gprop[2]
  1701. gtrace.Size = Vector3.new(16,16,16)
  1702. gtrace.Anchored = true
  1703. gtrace.CanCollide = false
  1704. gtrace.CFrame = (chr.HumanoidRootPart.CFrame + Vector3.new(math.random(-70,70),-6,math.random(-70,70))) * CFrame.fromEulerAnglesXYZ(math.random(0,math.rad(359)),math.random(0,math.rad(359)),math.random(0,math.rad(359)))
  1705. local gdisp = coroutine.wrap(function()
  1706. wait(3)
  1707. for i = 1, 9 do
  1708. wait(.1)
  1709. gtrace.Transparency = gtrace.Transparency + .1
  1710. end
  1711. gtrace:Destroy()
  1712. end)
  1713. gdisp()
  1714. end
  1715.  
  1716. Crater(head,67)
  1717.  
  1718. for i,v in pairs(FindNearestTorso(tors.CFrame.p,50))do
  1719. if v:FindFirstChild('Humanoid') then
  1720. v.Humanoid:TakeDamage(math.random(10000020,10000030))
  1721. v.Humanoid.PlatformStand = true
  1722. v:FindFirstChild("Torso").Velocity = head.CFrame.lookVector * 250
  1723. end
  1724. end
  1725.  
  1726. coroutine.resume(coroutine.create(function()
  1727. local shok = Instance.new("Part")
  1728. shok.Name = "shock3"
  1729. shok.BrickColor = BrickColor.new("Institutional white")
  1730. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  1731. shok.Size = Vector3.new(1, 1, 1)
  1732. shok.Anchored = true
  1733. shok.Material = "Neon"
  1734. shok.Transparency = 0.35
  1735. shok.CanCollide = false
  1736. shok.Parent = model
  1737. game.Debris:AddItem(shok, 12)
  1738. local mesh = Instance.new("SpecialMesh")
  1739. mesh.MeshType = "FileMesh"
  1740. mesh.MeshId = "rbxassetid://489415447"
  1741. mesh.Scale = Vector3.new(19, 19, 19)
  1742. mesh.Parent = shok
  1743. for e = 1, 15 do
  1744. wait()
  1745. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1746. shok.Transparency = shok.Transparency + 0.004
  1747. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1748. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1749. end
  1750. for e = 1, 16 do
  1751. wait()
  1752. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1753. shok.Transparency = shok.Transparency + 0.004
  1754. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1755. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1756. end
  1757. for e = 1, 12 do
  1758. wait()
  1759. mesh.Scale = mesh.Scale + Vector3.new(0.5, -1, 0.5)
  1760. shok.Transparency = shok.Transparency + 0.06
  1761. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1762. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1763. end
  1764. end))
  1765.  
  1766.  
  1767. coroutine.resume(coroutine.create(function()
  1768. local shok = Instance.new("Part")
  1769. shok.Name = "shock3"
  1770. shok.BrickColor = BrickColor.new("Institutional white")
  1771. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  1772. shok.Size = Vector3.new(1, 1, 1)
  1773. shok.Anchored = true
  1774. shok.Material = "Neon"
  1775. shok.Transparency = 0.35
  1776. shok.CanCollide = false
  1777. shok.Parent = model
  1778. game.Debris:AddItem(shok, 12)
  1779. local mesh = Instance.new("SpecialMesh")
  1780. mesh.MeshType = "FileMesh"
  1781. mesh.MeshId = "rbxassetid://489415447"
  1782. mesh.Scale = Vector3.new(47, 47, 47)
  1783. mesh.Parent = shok
  1784. for e = 1, 15 do
  1785. wait()
  1786. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1787. shok.Transparency = shok.Transparency + 0.004
  1788. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1789. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1790. end
  1791. for e = 1, 16 do
  1792. wait()
  1793. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1794. shok.Transparency = shok.Transparency + 0.004
  1795. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1796. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1797. end
  1798. for e = 1, 12 do
  1799. wait()
  1800. mesh.Scale = mesh.Scale + Vector3.new(0.5, -1, 0.5)
  1801. shok.Transparency = shok.Transparency + 0.06
  1802. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1803. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1804. end
  1805. end))
  1806.  
  1807. coroutine.resume(coroutine.create(function()
  1808. local shok = Instance.new("Part")
  1809. shok.Name = "shock3"
  1810. shok.BrickColor = BrickColor.new("Institutional white")
  1811. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  1812. shok.Size = Vector3.new(1, 1, 1)
  1813. shok.Anchored = true
  1814. shok.Material = "Neon"
  1815. shok.Transparency = 0.35
  1816. shok.CanCollide = false
  1817. shok.Parent = model
  1818. game.Debris:AddItem(shok, 12)
  1819. local mesh = Instance.new("SpecialMesh")
  1820. mesh.MeshType = "FileMesh"
  1821. mesh.MeshId = "rbxassetid://489415447"
  1822. mesh.Scale = Vector3.new(79, 79, 79)
  1823. mesh.Parent = shok
  1824. for e = 1, 15 do
  1825. wait()
  1826. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1827. shok.Transparency = shok.Transparency + 0.004
  1828. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1829. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1830. end
  1831. for e = 1, 16 do
  1832. wait()
  1833. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  1834. shok.Transparency = shok.Transparency + 0.004
  1835. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1836. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1837. end
  1838. for e = 1, 12 do
  1839. wait()
  1840. mesh.Scale = mesh.Scale + Vector3.new(0.5, -1, 0.5)
  1841. shok.Transparency = shok.Transparency + 0.06
  1842. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  1843. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  1844. end
  1845. end))
  1846. end
  1847.  
  1848.  
  1849.  
  1850.  
  1851. function rayCast(Pos, Dir, Max, Ignore) -- Origin Position , Direction, MaxDistance , IgnoreDescendants
  1852. return game:service("Workspace"):FindPartOnRay(Ray.new(Pos, Dir.unit * (Max or 999.999)), Ignore)
  1853. end
  1854. cam = workspace.CurrentCamera
  1855.  
  1856.  
  1857.  
  1858.  
  1859.  
  1860.  
  1861.  
  1862.  
  1863. function NoOutline(Part)
  1864. Part.TopSurface,Part.BottomSurface,Part.LeftSurface,Part.RightSurface,Part.FrontSurface,Part.BackSurface = 10,10,10,10,10,10
  1865. end
  1866.  
  1867.  
  1868.  
  1869.  
  1870. it = Instance.new
  1871.  
  1872.  
  1873.  
  1874.  
  1875.  
  1876.  
  1877.  
  1878.  
  1879.  
  1880.  
  1881. so = function(id,par,vol,pit)
  1882. coroutine.resume(coroutine.create(function()
  1883. local sou = Instance.new("Sound",par or workspace)
  1884. sou.Volume=vol
  1885. sou.Pitch=pit or 1
  1886. sou.SoundId=id
  1887. swait()
  1888. sou:play()
  1889. game:GetService("Debris"):AddItem(sou,6)
  1890. end))
  1891. end
  1892.  
  1893.  
  1894. function Stom()
  1895.  
  1896. cf=CFrame.new
  1897. angles=CFrame.Angles
  1898. euler=CFrame.fromEulerAnglesXYZ
  1899. necko=cf(0, 1, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  1900. RootPart=chr.HumanoidRootPart
  1901. RootJoint=RootPart.RootJoint
  1902. RootCF=euler(-1.57,0,3.14)
  1903.  
  1904. function QuaternionFromCFrame(cf)
  1905. local mx, my, mz, m00, m01, m02, m10, m11, m12, m20, m21, m22 = cf:components()
  1906. local trace = m00 + m11 + m22
  1907. if trace > 0 then
  1908. local s = math.sqrt(1 + trace)
  1909. local recip = 0.5/s
  1910. return (m21-m12)*recip, (m02-m20)*recip, (m10-m01)*recip, s*0.5
  1911. else
  1912. local i = 0
  1913. if m11 > m00 then
  1914. i = 1
  1915. end
  1916. if m22 > (i == 0 and m00 or m11) then
  1917. i = 2
  1918. end
  1919. if i == 0 then
  1920. local s = math.sqrt(m00-m11-m22+1)
  1921. local recip = 0.5/s
  1922. return 0.5*s, (m10+m01)*recip, (m20+m02)*recip, (m21-m12)*recip
  1923. elseif i == 1 then
  1924. local s = math.sqrt(m11-m22-m00+1)
  1925. local recip = 0.5/s
  1926. return (m01+m10)*recip, 0.5*s, (m21+m12)*recip, (m02-m20)*recip
  1927. elseif i == 2 then
  1928. local s = math.sqrt(m22-m00-m11+1)
  1929. local recip = 0.5/s return (m02+m20)*recip, (m12+m21)*recip, 0.5*s, (m10-m01)*recip
  1930. end
  1931. end
  1932. end
  1933.  
  1934. function QuaternionToCFrame(px, py, pz, x, y, z, w)
  1935. local xs, ys, zs = x + x, y + y, z + z
  1936. local wx, wy, wz = w*xs, w*ys, w*zs
  1937. local xx = x*xs
  1938. local xy = x*ys
  1939. local xz = x*zs
  1940. local yy = y*ys
  1941. local yz = y*zs
  1942. local zz = z*zs
  1943. return CFrame.new(px, py, pz,1-(yy+zz), xy - wz, xz + wy,xy + wz, 1-(xx+zz), yz - wx, xz - wy, yz + wx, 1-(xx+yy))
  1944. end
  1945.  
  1946. function QuaternionSlerp(a, b, t)
  1947. local cosTheta = a[1]*b[1] + a[2]*b[2] + a[3]*b[3] + a[4]*b[4]
  1948. local startInterp, finishInterp;
  1949. if cosTheta >= 0.0001 then
  1950. if (1 - cosTheta) > 0.0001 then
  1951. local theta = math.acos(cosTheta)
  1952. local invSinTheta = 1/math.sin(theta)
  1953. startInterp = math.sin((1-t)*theta)*invSinTheta
  1954. finishInterp = math.sin(t*theta)*invSinTheta
  1955. else
  1956. startInterp = 1-t
  1957. finishInterp = t
  1958. end
  1959. else
  1960. if (1+cosTheta) > 0.0001 then
  1961. local theta = math.acos(-cosTheta)
  1962. local invSinTheta = 1/math.sin(theta)
  1963. startInterp = math.sin((t-1)*theta)*invSinTheta
  1964. finishInterp = math.sin(t*theta)*invSinTheta
  1965. else
  1966. startInterp = t-1
  1967. finishInterp = t
  1968. end
  1969. end
  1970. return a[1]*startInterp + b[1]*finishInterp, a[2]*startInterp + b[2]*finishInterp, a[3]*startInterp + b[3]*finishInterp, a[4]*startInterp + b[4]*finishInterp
  1971. end
  1972.  
  1973. function rayCast(Pos, Dir, Max, Ignore) -- Origin Position , Direction, MaxDistance , IgnoreDescendants
  1974. return game:service("Workspace"):FindPartOnRay(Ray.new(Pos, Dir.unit * (Max or 999.999)), Ignore)
  1975. end
  1976.  
  1977. function clerp(a,b,t)
  1978. local qa = {QuaternionFromCFrame(a)}
  1979. local qb = {QuaternionFromCFrame(b)}
  1980. local ax, ay, az = a.x, a.y, a.z
  1981. local bx, by, bz = b.x, b.y, b.z
  1982. local _t = 1-t
  1983. return QuaternionToCFrame(_t*ax + t*bx, _t*ay + t*by, _t*az + t*bz,QuaternionSlerp(qa, qb, t))
  1984. end
  1985.  
  1986.  
  1987.  
  1988. if activu == true then
  1989. return
  1990. end
  1991. activu = true
  1992.  
  1993.  
  1994.  
  1995. human.WalkSpeed = 0
  1996. for i = 0,1,0.1 do
  1997. swait()
  1998. RootJoint.C0 = clerp(RootJoint.C0,RootCF*cf(0,0,0)* angles(math.rad(0),math.rad(0),math.rad(0)),.3)
  1999. tors.Neck.C0 = clerp(tors.Neck.C0,necko *angles(math.rad(5),math.rad(0),math.rad(0)),.3)
  2000. RS.C0 = clerp(RS.C0, CFrame.new(1.5, 0.5, 0) * angles(math.rad(10), math.rad(0), math.rad(20)), 0.3)
  2001. LS.C0 = clerp(LS.C0, CFrame.new(-1.5, 0.5, 0) * angles(math.rad(10), math.rad(0), math.rad(-20)), 0.3)
  2002. RH.C0=clerp(RH.C0,cf(1,-1,0)*angles(math.rad(0),math.rad(90),math.rad(0))*angles(math.rad(-2),math.rad(0),math.rad(0)),.3)
  2003. LH.C0=clerp(LH.C0,cf(-1,-.1,-.5)*angles(math.rad(0),math.rad(-90),math.rad(0))*angles(math.rad(-3),math.rad(0),math.rad(0)),.3)
  2004. end
  2005. wait(1)
  2006. for i = 0,1,0.1 do
  2007. swait()
  2008. RootJoint.C0 = clerp(RootJoint.C0,RootCF*cf(0,0,0)* angles(math.rad(10),math.rad(0),math.rad(0)),.3)
  2009. tors.Neck.C0 = clerp(tors.Neck.C0,necko *angles(math.rad(-5),math.rad(0),math.rad(0)),.3)
  2010. RS.C0 = clerp(RS.C0, CFrame.new(1.5, 0.5, 0) * angles(math.rad(-20), math.rad(0), math.rad(30)), 0.3)
  2011. LS.C0 = clerp(LS.C0, CFrame.new(-1.5, 0.5, 0) * angles(math.rad(-20), math.rad(0), math.rad(-30)), 0.3)
  2012. RH.C0=clerp(RH.C0,cf(1,-1,0)*angles(math.rad(0),math.rad(90),math.rad(10))*angles(math.rad(-2),math.rad(0),math.rad(0)),.3)
  2013. LH.C0=clerp(LH.C0,cf(-1,-1,-.5)*angles(math.rad(0),math.rad(-90),math.rad(-10))*angles(math.rad(-3),math.rad(0),math.rad(0)),.3)
  2014. end
  2015. KickBoom()
  2016. so("http://roblox.com/asset/?id=144699494",lleg,2,1.1)
  2017. so("http://roblox.com/asset/?id=321321137",lleg,1,1)
  2018. so("http://roblox.com/asset/?id=506384002",lleg,1,1)
  2019. so("http://roblox.com/asset/?id=157878578",lleg,25,1)
  2020. so("http://roblox.com/asset/?id=165970126",lleg,25,1)
  2021.  
  2022. wait(3)
  2023. human.WalkSpeed = 16
  2024. resetlerp()
  2025. activu = false
  2026. end
  2027.  
  2028.  
  2029.  
  2030.  
  2031.  
  2032. function Smash()
  2033. for i = 1, 15 do
  2034. local gtrace = Instance.new("Part",game.Workspace)
  2035. gtrace.BrickColor = gprop[1]
  2036. gtrace.Material = gprop[2]
  2037. gtrace.Size = Vector3.new(19,19,19)
  2038. gtrace.Anchored = true
  2039. gtrace.CanCollide = false
  2040. gtrace.CFrame = (chr.HumanoidRootPart.CFrame + Vector3.new(math.random(-60,60),-6,math.random(-60,60))) * CFrame.fromEulerAnglesXYZ(math.random(0,math.rad(359)),math.random(0,math.rad(359)),math.random(0,math.rad(359)))
  2041. local gdisp = coroutine.wrap(function()
  2042. wait(7)
  2043. for i = 1, 9 do
  2044. wait(.1)
  2045. gtrace.Transparency = gtrace.Transparency + .1
  2046. end
  2047. gtrace:Destroy()
  2048. end)
  2049. gdisp()
  2050. end
  2051.  
  2052. Crater(head,67)
  2053. end
  2054.  
  2055. function Smash2()
  2056. for i = 1, 15 do
  2057. local gtrace = Instance.new("Part",game.Workspace)
  2058. gtrace.BrickColor = gprop[1]
  2059. gtrace.Material = gprop[2]
  2060. gtrace.Size = Vector3.new(19,19,19)
  2061. gtrace.Anchored = true
  2062. gtrace.CanCollide = false
  2063. gtrace.CFrame = (chr.HumanoidRootPart.CFrame + Vector3.new(math.random(-70,70),-6,math.random(-70,70))) * CFrame.fromEulerAnglesXYZ(math.random(0,math.rad(359)),math.random(0,math.rad(359)),math.random(0,math.rad(359)))
  2064. local gdisp = coroutine.wrap(function()
  2065. wait(7)
  2066. for i = 1, 9 do
  2067. wait(.1)
  2068. gtrace.Transparency = gtrace.Transparency + .1
  2069. end
  2070. gtrace:Destroy()
  2071. end)
  2072. gdisp()
  2073. end
  2074.  
  2075. end
  2076.  
  2077. function Smash3()
  2078. for i = 1, 15 do
  2079. local gtrace = Instance.new("Part",game.Workspace)
  2080. gtrace.BrickColor = gprop[1]
  2081. gtrace.Material = gprop[2]
  2082. gtrace.Size = Vector3.new(19,19,19)
  2083. gtrace.Anchored = true
  2084. gtrace.CanCollide = false
  2085. gtrace.CFrame = (chr.HumanoidRootPart.CFrame + Vector3.new(math.random(-50,50),-6,math.random(-50,50))) * CFrame.fromEulerAnglesXYZ(math.random(0,math.rad(359)),math.random(0,math.rad(359)),math.random(0,math.rad(359)))
  2086. local gdisp = coroutine.wrap(function()
  2087. wait(7)
  2088. for i = 1, 9 do
  2089. wait(.1)
  2090. gtrace.Transparency = gtrace.Transparency + .1
  2091. end
  2092. gtrace:Destroy()
  2093. end)
  2094. gdisp()
  2095. end
  2096.  
  2097. end
  2098.  
  2099.  
  2100. function Smash4()
  2101. for i = 1, 15 do
  2102. local gtrace = Instance.new("Part",game.Workspace)
  2103. gtrace.BrickColor = gprop[1]
  2104. gtrace.Material = gprop[2]
  2105. gtrace.Size = Vector3.new(19,19,19)
  2106. gtrace.Anchored = true
  2107. gtrace.CanCollide = false
  2108. gtrace.CFrame = (chr.HumanoidRootPart.CFrame + Vector3.new(math.random(-40,40),-6,math.random(-40,40))) * CFrame.fromEulerAnglesXYZ(math.random(0,math.rad(359)),math.random(0,math.rad(359)),math.random(0,math.rad(359)))
  2109. local gdisp = coroutine.wrap(function()
  2110. wait(7)
  2111. for i = 1, 9 do
  2112. wait(.1)
  2113. gtrace.Transparency = gtrace.Transparency + .1
  2114. end
  2115. gtrace:Destroy()
  2116. end)
  2117. gdisp()
  2118. end
  2119.  
  2120. end
  2121.  
  2122. function Smash5()
  2123. for i = 1, 15 do
  2124. local gtrace = Instance.new("Part",game.Workspace)
  2125. gtrace.BrickColor = gprop[1]
  2126. gtrace.Material = gprop[2]
  2127. gtrace.Size = Vector3.new(19,19,19)
  2128. gtrace.Anchored = true
  2129. gtrace.CanCollide = false
  2130. gtrace.CFrame = (chr.HumanoidRootPart.CFrame + Vector3.new(math.random(-30,30),-6,math.random(-30,30))) * CFrame.fromEulerAnglesXYZ(math.random(0,math.rad(359)),math.random(0,math.rad(359)),math.random(0,math.rad(359)))
  2131. local gdisp = coroutine.wrap(function()
  2132. wait(7)
  2133. for i = 1, 9 do
  2134. wait(.1)
  2135. gtrace.Transparency = gtrace.Transparency + .1
  2136. end
  2137. gtrace:Destroy()
  2138. end)
  2139. gdisp()
  2140. end
  2141.  
  2142. end
  2143.  
  2144. function Smash6()
  2145. for i = 1, 15 do
  2146. local gtrace = Instance.new("Part",game.Workspace)
  2147. gtrace.BrickColor = gprop[1]
  2148. gtrace.Material = gprop[2]
  2149. gtrace.Size = Vector3.new(19,19,19)
  2150. gtrace.Anchored = true
  2151. gtrace.CanCollide = false
  2152. gtrace.CFrame = (chr.HumanoidRootPart.CFrame + Vector3.new(math.random(-20,20),-6,math.random(-20,20))) * CFrame.fromEulerAnglesXYZ(math.random(0,math.rad(359)),math.random(0,math.rad(359)),math.random(0,math.rad(359)))
  2153. local gdisp = coroutine.wrap(function()
  2154. wait(7)
  2155. for i = 1, 9 do
  2156. wait(.1)
  2157. gtrace.Transparency = gtrace.Transparency + .1
  2158. end
  2159. gtrace:Destroy()
  2160. end)
  2161. gdisp()
  2162. end
  2163.  
  2164. end
  2165.  
  2166.  
  2167. for i,v in pairs(FindNearestTorso(tors.CFrame.p,99))do
  2168. if v:FindFirstChild('Humanoid') then
  2169. v.Humanoid:TakeDamage(math.random(9999999999999999999999999999999999999999999999999999999999999999999999999999999999999999,9999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999))
  2170. v.Humanoid.PlatformStand = true
  2171. v:FindFirstChild("Torso").Velocity = head.CFrame.lookVector * 600
  2172. end
  2173. end
  2174.  
  2175.  
  2176. function HeavenSmash()
  2177.  
  2178.  
  2179. if activu == true then
  2180. return
  2181. end
  2182. activu = true
  2183. human.WalkSpeed = 0
  2184. so("http://www.roblox.com/asset/?id=169445572",head,1.5,1.5)
  2185. so("http://www.roblox.com/asset/?id=169380495",head,1.5,1.5)
  2186. for l = 1, 30 do
  2187. swait()
  2188. lerpz(RJ, "C0", RJC0 * cf(0, 0, -0.5) * ang(rd(6), rd(0), rd(0)), 0.02 + l / 40)
  2189. lerpz(N, "C0", NC0 * cf(0, 0, 0) * ang(rd(12), rd(0), rd(0)), 0.02 + l / 40)
  2190. lerpz(RS, "C0", RSC0 * cf(0, 0, 0) * ang(rd(-8), rd(-7), rd(-10)), 0.02 + l / 40)
  2191. lerpz(RS, "C1", RSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  2192. lerpz(LS, "C0", LSC0 * cf(0, 0, 0) * ang(rd(-8), rd(7), rd(10)), 0.02 + l / 40)
  2193. lerpz(LS, "C1", LSC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  2194. lerpz(RH, "C0", RHC0 * cf(0.4, 0.5, 0) * ang(rd(0), rd(-6), rd(8)), 0.02 + l / 40)
  2195. lerpz(RH, "C1", RHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  2196. lerpz(LH, "C0", LHC0 * cf(0, 0, 0) * ang(rd(3), rd(0), rd(42)), 0.02 + l / 40)
  2197. lerpz(LH, "C1", LHC1 * cf(0, 0, 0) * ang(rd(0), rd(0), rd(0)), 0.02 + l / 40)
  2198. end
  2199.  
  2200.  
  2201. resetlerp()
  2202.  
  2203. BV = Instance.new("BodyVelocity", tors)
  2204. BV.maxForce = Vector3.new(0,200000,0)
  2205. BV.P = 100000
  2206. BV.velocity = Vector3.new(0,150,0)
  2207. local rng = Instance.new("Part", chr)
  2208. rng.Anchored = true
  2209. rng.BrickColor = BrickColor.new("Institutional white")
  2210. rng.CanCollide = false
  2211. rng.FormFactor = 3
  2212. rng.Name = "Ring"
  2213. rng.Size = Vector3.new(1, 1, 1)
  2214. rng.Transparency = 0.5
  2215. rng.TopSurface = 0
  2216. rng.BottomSurface = 0
  2217. rng.Position = tors.Position - Vector3.new(0,2,0)
  2218. rng.CFrame = rng.CFrame * CFrame.Angles(math.rad(90), math.rad(0), math.rad(0))
  2219. local rngm = Instance.new("SpecialMesh", rng)
  2220. rngm.MeshId = "http://www.roblox.com/asset/?id=3270017"
  2221. rngm.Scale = Vector3.new(10, 10, 20)
  2222. x = Instance.new("Sound",tors)
  2223. x.SoundId = "http://www.roblox.com/asset/?id=169445602"
  2224. x.Looped = false
  2225. x.Pitch = .7
  2226. x.Volume = 30
  2227. x:Play()
  2228. coroutine.wrap(function()
  2229. for i = 1, 60, 8 do
  2230. rngm.Scale = Vector3.new(10.20 + i*10.10, 10.20 + i*10.10, 10)
  2231. rng.Transparency = i/60
  2232. wait()
  2233. end
  2234. wait()
  2235. rng:Destroy()
  2236. end)()
  2237. wait(2.6)
  2238. BV:Destroy()
  2239. tors.Anchored = true
  2240. wait(3.2)
  2241. tors.Anchored = false
  2242. BV = Instance.new("BodyVelocity", tors)
  2243. BV.maxForce = Vector3.new(0,-20000,0)
  2244. BV.P = 1000
  2245. BV.velocity = Vector3.new(0,-150,0)
  2246. wait(1)
  2247. BV:Destroy()
  2248. wait(0.01)
  2249.  
  2250. human.WalkSpeed = 0
  2251. boom3:Play()
  2252.  
  2253. Smash()
  2254. Smash2()
  2255. Smash3()
  2256. Ring()
  2257. wait(2)
  2258. human.WalkSpeed = 16
  2259. activu = false
  2260. end
  2261.  
  2262.  
  2263.  
  2264. sound = Instance.new("Sound", game.Players.LocalPlayer.Character["Right Leg"])
  2265. sound.SoundId = "rbxassetid://220025776"
  2266. sound.Volume = 6
  2267.  
  2268. sound2 = Instance.new("Sound", game.Players.LocalPlayer.Character["Torso"])
  2269. sound2.SoundId = "rbxassetid://386946017"
  2270. sound2.Volume = 6
  2271.  
  2272. sound3 = Instance.new("Sound", game.Players.LocalPlayer.Character)
  2273. sound3.SoundId = "rbxassetid://165969964"
  2274. sound3.Volume = 6
  2275.  
  2276. function rip()
  2277. activu = true
  2278. local detect = Instance.new("Part", game.Players.LocalPlayer.Character)
  2279. detect.Size = Vector3.new(1,1,1)
  2280. detect:BreakJoints()
  2281. detect.CanCollide = false
  2282. local weld = Instance.new("Weld", detect)
  2283. weld.Part0 = game.Players.LocalPlayer.Character["Torso"]
  2284. weld.Part1 = detect
  2285. weld.C0 = weld.C0 * CFrame.new(0,-1,0)
  2286.  
  2287.  
  2288.  
  2289. local function attack(prt)
  2290. local humanoid = prt.Parent:findFirstChild("Humanoid")
  2291. if humanoid ~= nil then
  2292. local torso = prt.Parent:findFirstChild("Torso")
  2293.  
  2294.  
  2295.  
  2296.  
  2297.  
  2298.  
  2299.  
  2300. function KABOOMZ3()
  2301. local effspwn = Instance.new("Part")
  2302. coroutine.resume(coroutine.create(function()
  2303. local sound1 = Instance.new("Sound")
  2304. sound1.SoundId = "rbxassetid://138137702"
  2305. sound1.MaxDistance = 300
  2306. sound1.EmitterSize = 20
  2307. sound1.Volume = 2.5
  2308. sound1.Pitch = 0.65
  2309. sound1.Parent = effspwn
  2310. local sound2 = Instance.new("Sound")
  2311. sound2.SoundId = "rbxassetid://157878578"
  2312. sound2.MaxDistance = 300
  2313. sound2.EmitterSize = 20
  2314. sound2.Volume = 1
  2315. sound2.Pitch = 0.7
  2316. sound2.Parent = effspwn
  2317. local sound3 = Instance.new("Sound")
  2318. sound3.SoundId = "rbxassetid://138250406"
  2319. sound2.MaxDistance = 400
  2320. sound2.EmitterSize = 30
  2321. sound2.Volume = 0.5
  2322. sound2.Pitch = 0.5
  2323. sound2.Parent = effspwn
  2324. sound2:Play()
  2325. wait()
  2326. sound1:Play()
  2327. sound3:Play()
  2328. end))
  2329. local model = Instance.new("Model")
  2330. game.Debris:AddItem(model, 20)
  2331. model.Name = "smasheffects"
  2332. model.Parent = workspace
  2333. effspwn.Name = "spwnr"
  2334. effspwn.Size = Vector3.new(1, 1, 1)
  2335. effspwn.Anchored = true
  2336. effspwn.CanCollide = false
  2337. effspwn.Transparency = 1
  2338. effspwn.CFrame = torso.CFrame * CFrame.Angles(math.rad(180), 0, 0)
  2339. effspwn.Parent = model
  2340.  
  2341.  
  2342.  
  2343.  
  2344.  
  2345. Crater(head,60)
  2346. Crater(head,120)
  2347.  
  2348. for i,v in pairs(FindNearestTorso(tors.CFrame.p,50))do
  2349. if v:FindFirstChild('Humanoid') then
  2350. v.Humanoid:TakeDamage(math.random(10000020,10000030))
  2351. v.Humanoid.PlatformStand = true
  2352. v:FindFirstChild("Torso").Velocity = head.CFrame.lookVector * 200
  2353. end
  2354. end
  2355.  
  2356. coroutine.resume(coroutine.create(function()
  2357. local shok = Instance.new("Part")
  2358. shok.Name = "whoosh"
  2359. shok.BrickColor = BrickColor.new("Institutional white")
  2360. shok.CFrame = effspwn.CFrame * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  2361. shok.Size = Vector3.new(1, 1, 1)
  2362. shok.Anchored = true
  2363. shok.Material = "Neon"
  2364. shok.Transparency = 0.1
  2365. shok.CanCollide = false
  2366. shok.Parent = model
  2367. game.Debris:AddItem(shok, 12)
  2368. local mesh = Instance.new("SpecialMesh")
  2369. mesh.MeshType = "FileMesh"
  2370. mesh.MeshId = "rbxassetid://437347603"
  2371. mesh.Scale = Vector3.new(0.8, 0.8, 0.3)
  2372. mesh.Parent = shok
  2373.  
  2374.  
  2375.  
  2376.  
  2377.  
  2378. for e = 1, 8 do
  2379. wait()
  2380. mesh.Scale = mesh.Scale + Vector3.new(0.24, 0.24, 0.22)
  2381. shok.Transparency = shok.Transparency + 0.035
  2382. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -22), 0.4)
  2383. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(29))
  2384. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  2385.  
  2386. end
  2387. for e = 1, 16 do
  2388. wait()
  2389. mesh.Scale = mesh.Scale + Vector3.new(0.13, 0.13, 0.12)
  2390. shok.Transparency = shok.Transparency + 0.11
  2391. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -10), 0.4)
  2392. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(15))
  2393. hito(shok, 10, 999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999999, 3)
  2394.  
  2395. end
  2396. end))
  2397. coroutine.resume(coroutine.create(function()
  2398. local shok = Instance.new("Part")
  2399. shok.Name = "wring1"
  2400. shok.BrickColor = BrickColor.new("Institutional white")
  2401. shok.CFrame = effspwn.CFrame * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  2402. shok.Size = Vector3.new(1, 1, 1)
  2403. shok.Anchored = true
  2404. shok.Material = "Neon"
  2405. shok.Transparency = 0.25
  2406. shok.CanCollide = false
  2407. shok.Parent = model
  2408. game.Debris:AddItem(shok, 12)
  2409. local mesh = Instance.new("SpecialMesh")
  2410. mesh.MeshType = "FileMesh"
  2411. mesh.MeshId = "rbxassetid://3270017"
  2412. mesh.Scale = Vector3.new(0.1, 0.1, 0.05)
  2413. mesh.Parent = shok
  2414. for e = 1, 30 do
  2415. wait()
  2416. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 3)
  2417. shok.Transparency = shok.Transparency + 0.002
  2418. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  2419. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  2420. end
  2421. for e = 1, 38 do
  2422. wait()
  2423. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 0.1)
  2424. shok.Transparency = shok.Transparency + 0.002
  2425. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  2426. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  2427. end
  2428. for e = 1, 24 do
  2429. wait()
  2430. mesh.Scale = mesh.Scale + Vector3.new(2.6, 2.6, 0.1)
  2431. shok.Transparency = shok.Transparency + 0.03
  2432. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  2433. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(-2))
  2434. end
  2435. end))
  2436. coroutine.resume(coroutine.create(function()
  2437. local shok = Instance.new("Part")
  2438. shok.Name = "wring2"
  2439. shok.BrickColor = BrickColor.new("Institutional white")
  2440. shok.CFrame = effspwn.CFrame * CFrame.new(0, 12, 0) * CFrame.Angles(math.rad(-90), math.rad(0), math.rad(0))
  2441. shok.Size = Vector3.new(1, 1, 1)
  2442. shok.Anchored = true
  2443. shok.Material = "Neon"
  2444. shok.Transparency = 0.25
  2445. shok.CanCollide = false
  2446. shok.Parent = model
  2447. game.Debris:AddItem(shok, 12)
  2448. local mesh = Instance.new("SpecialMesh")
  2449. mesh.MeshType = "FileMesh"
  2450. mesh.MeshId = "rbxassetid://3270017"
  2451. mesh.Scale = Vector3.new(12, 12, 0.05)
  2452. mesh.Parent = shok
  2453. for e = 1, 30 do
  2454. wait()
  2455. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 3)
  2456. shok.Transparency = shok.Transparency + 0.002
  2457. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  2458. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  2459. end
  2460. for e = 1, 38 do
  2461. wait()
  2462. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 0.1)
  2463. shok.Transparency = shok.Transparency + 0.002
  2464. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  2465. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  2466. end
  2467. for e = 1, 24 do
  2468. wait()
  2469. mesh.Scale = mesh.Scale + Vector3.new(2.8, 2.8, 0.1)
  2470. shok.Transparency = shok.Transparency + 0.03
  2471. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  2472. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(0), math.rad(2))
  2473. end
  2474. end))
  2475. coroutine.resume(coroutine.create(function()
  2476. local shok = Instance.new("Part")
  2477. shok.Name = "coil1"
  2478. shok.BrickColor = BrickColor.new("Institutional white")
  2479. shok.CFrame = effspwn.CFrame * CFrame.new(0, 12, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0))
  2480. shok.Size = Vector3.new(1, 1, 1)
  2481. shok.Anchored = true
  2482. shok.Material = "Neon"
  2483. shok.Transparency = 0.25
  2484. shok.CanCollide = false
  2485. shok.Parent = model
  2486. game.Debris:AddItem(shok, 12)
  2487. local mesh = Instance.new("SpecialMesh")
  2488. mesh.MeshType = "FileMesh"
  2489. mesh.MeshId = "http://www.roblox.com/asset/?id=1051557"
  2490. mesh.Scale = Vector3.new(12, 12, 12)
  2491. mesh.Parent = shok
  2492. for e = 1, 15 do
  2493. wait()
  2494. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  2495. shok.Transparency = shok.Transparency + 0.004
  2496. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  2497. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  2498. end
  2499. for e = 1, 16 do
  2500. wait()
  2501. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  2502. shok.Transparency = shok.Transparency + 0.004
  2503. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  2504. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  2505. end
  2506. for e = 1, 12 do
  2507. wait()
  2508. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  2509. shok.Transparency = shok.Transparency + 0.06
  2510. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  2511. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  2512. end
  2513. end))
  2514. coroutine.resume(coroutine.create(function()
  2515. local shok = Instance.new("Part")
  2516. shok.Name = "coil2"
  2517. shok.BrickColor = BrickColor.new("Institutional white")
  2518. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(0), math.rad(0))
  2519. shok.Size = Vector3.new(1, 1, 1)
  2520. shok.Anchored = true
  2521. shok.Material = "Neon"
  2522. shok.Transparency = 0.25
  2523. shok.CanCollide = false
  2524. shok.Parent = model
  2525. game.Debris:AddItem(shok, 12)
  2526. local mesh = Instance.new("SpecialMesh")
  2527. mesh.MeshType = "FileMesh"
  2528. mesh.MeshId = "http://www.roblox.com/asset/?id=1051557"
  2529. mesh.Scale = Vector3.new(6, 12, 6)
  2530. mesh.Parent = shok
  2531. for e = 1, 15 do
  2532. wait()
  2533. mesh.Scale = mesh.Scale + Vector3.new(1.1, 2.4, 1.1)
  2534. shok.Transparency = shok.Transparency + 0.005
  2535. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -1), 0.4)
  2536. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-60), math.rad(0))
  2537. end
  2538. for e = 1, 16 do
  2539. wait()
  2540. mesh.Scale = mesh.Scale + Vector3.new(1.1, 2.4, 1.1)
  2541. shok.Transparency = shok.Transparency + 0.005
  2542. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  2543. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-60), math.rad(0))
  2544. end
  2545. for e = 1, 12 do
  2546. wait()
  2547. mesh.Scale = mesh.Scale + Vector3.new(1.1, 2.4, 1.1)
  2548. shok.Transparency = shok.Transparency + 0.09
  2549. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 0, -0.12), 0.4)
  2550. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-60), math.rad(0))
  2551. end
  2552. end))
  2553. coroutine.resume(coroutine.create(function()
  2554. local shok = Instance.new("Part")
  2555. shok.Name = "shokwve"
  2556. shok.BrickColor = BrickColor.new("Institutional white")
  2557. shok.Position = effspwn.Position + Vector3.new(0, 5, 0)
  2558. shok.Size = Vector3.new(1, 1, 1)
  2559. shok.Anchored = true
  2560. shok.Material = "Neon"
  2561. shok.Transparency = 0.6
  2562. shok.CanCollide = false
  2563. shok.Parent = model
  2564. game.Debris:AddItem(shok, 12)
  2565. local mesh = Instance.new("SpecialMesh")
  2566. mesh.MeshType = "FileMesh"
  2567. mesh.MeshId = "rbxassetid://489415447"
  2568. mesh.Scale = Vector3.new(1, 1, 1)
  2569. mesh.Parent = shok
  2570. for e = 1, 12 do
  2571. wait()
  2572. mesh.Scale = mesh.Scale + Vector3.new(2, 2, 2)
  2573. shok.Transparency = shok.Transparency + 0.002
  2574. end
  2575. for e = 1, 32 do
  2576. wait()
  2577. mesh.Scale = mesh.Scale + Vector3.new(0.5, 0.5, 0.5)
  2578. shok.Transparency = shok.Transparency + 0.002
  2579. end
  2580. for e = 1, 24 do
  2581. wait()
  2582. mesh.Scale = mesh.Scale + Vector3.new(0.5, 0.5, 0.5)
  2583. shok.Transparency = shok.Transparency + 0.03
  2584. end
  2585. end))
  2586. coroutine.resume(coroutine.create(function()
  2587. local shok = Instance.new("Part")
  2588. shok.Name = "shock2"
  2589. shok.BrickColor = BrickColor.new("Institutional white")
  2590. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  2591. shok.Size = Vector3.new(1, 1, 1)
  2592. shok.Anchored = true
  2593. shok.Material = "Neon"
  2594. shok.Transparency = 0.35
  2595. shok.CanCollide = false
  2596. shok.Parent = model
  2597. game.Debris:AddItem(shok, 12)
  2598. local mesh = Instance.new("SpecialMesh")
  2599. mesh.MeshType = "FileMesh"
  2600. mesh.MeshId = "rbxassetid://489415447"
  2601. mesh.Scale = Vector3.new(12, 12, 12)
  2602. mesh.Parent = shok
  2603. for e = 1, 15 do
  2604. wait()
  2605. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  2606. shok.Transparency = shok.Transparency + 0.004
  2607. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  2608. end
  2609. for e = 1, 16 do
  2610. wait()
  2611. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  2612. shok.Transparency = shok.Transparency + 0.004
  2613. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  2614. end
  2615. for e = 1, 12 do
  2616. wait()
  2617. mesh.Scale = mesh.Scale + Vector3.new(1.5, 2.8, 1.5)
  2618. shok.Transparency = shok.Transparency + 0.06
  2619. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(35), math.rad(0))
  2620. end
  2621. end))
  2622. coroutine.resume(coroutine.create(function()
  2623. local shok = Instance.new("Part")
  2624. shok.Name = "shock3"
  2625. shok.BrickColor = BrickColor.new("Institutional white")
  2626. shok.CFrame = effspwn.CFrame * CFrame.new(0, 6, 0) * CFrame.Angles(math.rad(0), math.rad(90), math.rad(0))
  2627. shok.Size = Vector3.new(1, 1, 1)
  2628. shok.Anchored = true
  2629. shok.Material = "Neon"
  2630. shok.Transparency = 0.35
  2631. shok.CanCollide = false
  2632. shok.Parent = model
  2633. game.Debris:AddItem(shok, 12)
  2634. local mesh = Instance.new("SpecialMesh")
  2635. mesh.MeshType = "FileMesh"
  2636. mesh.MeshId = "rbxassetid://489415447"
  2637. mesh.Scale = Vector3.new(12, 12, 12)
  2638. mesh.Parent = shok
  2639. for e = 1, 15 do
  2640. wait()
  2641. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  2642. shok.Transparency = shok.Transparency + 0.004
  2643. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  2644. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  2645. end
  2646. for e = 1, 16 do
  2647. wait()
  2648. mesh.Scale = mesh.Scale + Vector3.new(0.5, 2.6, 0.5)
  2649. shok.Transparency = shok.Transparency + 0.004
  2650. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  2651. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  2652. end
  2653. for e = 1, 12 do
  2654. wait()
  2655. mesh.Scale = mesh.Scale + Vector3.new(0.5, -1, 0.5)
  2656. shok.Transparency = shok.Transparency + 0.06
  2657. shok.CFrame = shok.CFrame:lerp(shok.CFrame * CFrame.new(0, 2, 0), 0.4)
  2658. shok.CFrame = shok.CFrame * CFrame.Angles(math.rad(0), math.rad(-16), math.rad(0))
  2659. end
  2660. end))
  2661. end
  2662.  
  2663.  
  2664.  
  2665. if torso ~= nil then
  2666. game.Players.LocalPlayer.Character.Humanoid.JumpPower = 0
  2667. game.Players.LocalPlayer.Character.Humanoid.WalkSpeed = 0
  2668. for i = 1,5 do
  2669. wait()
  2670. game.Players.LocalPlayer.Character.Torso["Left Hip"].C0 = game.Players.LocalPlayer.Character.Torso["Left Hip"].C0 * CFrame.Angles(0,0,0.25)
  2671. game.Players.LocalPlayer.Character.Torso["Right Hip"].C0 = game.Players.LocalPlayer.Character.Torso["Right Hip"].C0 * CFrame.Angles(0,0,0.25)
  2672. game.Players.LocalPlayer.Character.HumanoidRootPart.RootJoint.C0 = game.Players.LocalPlayer.Character.HumanoidRootPart.RootJoint.C0 * CFrame.Angles(-0.25,0,0)
  2673. end
  2674. sound:Play()
  2675. local bodyVel = Instance.new("BodyPosition", torso)
  2676. bodyVel.Position = game.Players.LocalPlayer.Character.Torso.Position + Vector3.new(0,1000,0)
  2677. bodyVel.MaxForce = Vector3.new(math.huge,math.huge,math.huge)
  2678. wait(2)
  2679. torso.Anchored = true
  2680. for i = 1,5 do
  2681. wait()
  2682. game.Players.LocalPlayer.Character.Torso["Left Hip"].C0 = game.Players.LocalPlayer.Character.Torso["Left Hip"].C0 * CFrame.Angles(0,0,-0.25)
  2683. game.Players.LocalPlayer.Character.Torso["Right Hip"].C0 = game.Players.LocalPlayer.Character.Torso["Right Hip"].C0 * CFrame.Angles(0,0,-0.25)
  2684. game.Players.LocalPlayer.Character.HumanoidRootPart.RootJoint.C0 = game.Players.LocalPlayer.Character.HumanoidRootPart.RootJoint.C0 * CFrame.Angles(0.25,0,0)
  2685. end
  2686. for i = 1,5 do
  2687. wait()
  2688. game.Players.LocalPlayer.Character.Torso["Left Hip"].C0 = game.Players.LocalPlayer.Character.Torso["Left Hip"].C0 * CFrame.Angles(0,0,-0.08)
  2689. game.Players.LocalPlayer.Character.HumanoidRootPart.RootJoint.C0 = game.Players.LocalPlayer.Character.HumanoidRootPart.RootJoint.C0 * CFrame.Angles(0.08,0,0)
  2690. end
  2691. wait(1)
  2692. local bodyvel = Instance.new("BodyPosition" , game.Players.LocalPlayer.Character.Torso)
  2693. bodyvel.MaxForce = Vector3.new(math.huge,math.huge,math.huge)
  2694. bodyvel.Position = torso.Position
  2695. for i = 1,5 do
  2696. wait()
  2697. game.Players.LocalPlayer.Character.Torso["Right Hip"].C0 = game.Players.LocalPlayer.Character.Torso["Right Hip"].C0 * CFrame.Angles(0,0,0)
  2698. game.Players.LocalPlayer.Character.Torso["Left Hip"].C0 = game.Players.LocalPlayer.Character.Torso["Left Hip"].C0 * CFrame.Angles(0,0,0.08)
  2699. game.Players.LocalPlayer.Character.HumanoidRootPart.RootJoint.C0 = game.Players.LocalPlayer.Character.HumanoidRootPart.RootJoint.C0 * CFrame.Angles(-0.15,0,0)
  2700. end
  2701. wait(2)
  2702. bodyVel:destroy()
  2703. game.Players.LocalPlayer.Character.Torso.Anchored = true
  2704. torso.Anchored = false
  2705. humanoid.PlatformStand = true
  2706. local bodyVel = Instance.new("BodyPosition", torso)
  2707. bodyVel.Position = game.Players.LocalPlayer.Character.Torso.Position - Vector3.new(0,1000,0)
  2708. bodyVel.MaxForce = Vector3.new(math.huge,math.huge,math.huge)
  2709. sound2:Play()
  2710.  
  2711. wait(1.2)
  2712. game.Players.LocalPlayer.Character.Torso.Anchored = false
  2713. game.Players.LocalPlayer.Character.HumanoidRootPart.RootJoint.C0 = CFrame.new(0, 0, 0, -1, -0, -0, 0, 0, 1, 0, 1, 0)
  2714. game.Players.LocalPlayer.Character.Torso["Right Hip"].C0 = CFrame.new(1, -1, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2715. game.Players.LocalPlayer.Character.Torso["Right Shoulder"].C0 = CFrame.new(1, 0.5, 0, 0, 0, 1, 0, 1, 0, -1, -0, -0)
  2716. game.Players.LocalPlayer.Character.Torso["Left Hip"].C0 = CFrame.new(-1, -1, 0, -0, -0, -1, 0, 1, 0, 1, 0, 0)
  2717. activu = false
  2718. wait(0.5)
  2719. bodyvel:destroy()
  2720. local ROW3 = function(out, trans, s, wt, t, ang, plus)
  2721. for i = 1, 360, 360/t do
  2722. local c = Instance.new("Part", game.Workspace)
  2723. c.FormFactor = 3
  2724. c.TopSurface = 0
  2725. c.BottomSurface = 0
  2726. c.Size = s
  2727. c.Anchored = true
  2728. c.CanCollide = wt
  2729. c.Material=workspace.Base.Material
  2730. c.Transparency = trans
  2731. c.BrickColor = workspace.Base.BrickColor
  2732. c.CFrame = CFrame.new(torso.CFrame.x,0,torso.CFrame.z) * CFrame.Angles(0, math.rad(i + plus), 0) * CFrame.new(0, 0, out) * ang
  2733. c.Locked=true
  2734. game.Debris:AddItem(c,25)
  2735. end
  2736. end
  2737.  
  2738.  
  2739.  
  2740.  
  2741. sound3:Play()
  2742. ROW3(12, 0, Vector3.new(34.5, 30, 3), true, 8, CFrame.Angles(math.rad(math.random (30,60)), 0, math.rad (math.random(-30,30))), 0)
  2743. game.Players.LocalPlayer.Character.Torso.Anchored = true
  2744. KABOOMZ3()
  2745. wait(0.1)
  2746.  
  2747. game.Players.LocalPlayer.Character.Torso.Anchored = false
  2748. game.Players.LocalPlayer.Character.Humanoid.WalkSpeed = 16
  2749. game.Players.LocalPlayer.Character.Humanoid.JumpPower = 50
  2750.  
  2751.  
  2752. end
  2753. end
  2754. end
  2755. detect.Touched:connect(attack)
  2756. wait(0.1)
  2757. detect:destroy()
  2758. activu = false
  2759. end
  2760.  
  2761.  
  2762.  
  2763. function hito(partoz, magn, dmg, debtim)
  2764. for _, guy in pairs(workspace:GetChildren()) do
  2765. if guy:FindFirstChild("Humanoid") and guy:FindFirstChild("Head") and guy ~= chr and magn > (guy:FindFirstChild("Head").Position - partoz.Position).magnitude and guy:FindFirstChild("Head"):FindFirstChild("alabo") == nil then
  2766. do
  2767. local humz = guy:FindFirstChild("Humanoid")
  2768. local hed = guy:FindFirstChild("Head")
  2769. humz:TakeDamage(dmg)
  2770. local db = Instance.new("StringValue")
  2771. db.Name = "alabo"
  2772. db.Parent = hed
  2773. delay(debtim, function()
  2774. db:Destroy()
  2775. end)
  2776. end
  2777. end
  2778. end
  2779. end
  2780. function animo(yep)
  2781. if yep == true then
  2782. anim.Parent = human
  2783. chr.Animate.Disabled = false
  2784. elseif yep == false then
  2785. chr.Animate.Disabled = true
  2786. anim.Parent = nil
  2787. end
  2788. end
  2789. mouse.KeyDown:connect(function(key)
  2790. if key == "e" then
  2791. rsmash()
  2792. end
  2793. if key == "t" then
  2794. jum()
  2795. end
  2796. if key == "r" then
  2797. Tele()
  2798. end
  2799. if key == "q" then
  2800. Stom()
  2801. end
  2802. if key == "f" then
  2803. HeavenSmash()
  2804. end
  2805. if key == "h" then
  2806. rip()
  2807. end
  2808. end)
  2809.  
  2810. --[[
  2811. Smith and Wesson M&P 45, chambered in .45 ACP ammunition.
  2812. The standard magazine holds 10 rounds, although magazines that could hold 14 rounds were also made but looked incredibly stupid.
  2813. Credit to litozinnamon for the crosshairs and bullethole decals. I used them without permission. Not like I asked him, anyhow.
  2814. ]]
  2815.  
  2816. plr=game:service'Players'.LocalPlayer
  2817. ch,char=plr.Character,plr.Character
  2818. hum=ch.Humanoid
  2819. tor,torso,rootpart,rj=ch.Torso,ch.Torso,ch.HumanoidRootPart,ch.HumanoidRootPart.RootJoint
  2820. m,mouse=plr:GetMouse(),plr:GetMouse()
  2821. cfn,ang,mr,int=CFrame.new,CFrame.Angles,math.rad,Instance.new
  2822. bc=BrickColor.new
  2823. head=ch.Head
  2824. cam=workspace.CurrentCamera
  2825.  
  2826. rj.C0=cfn()
  2827. rj.C1=cfn()
  2828.  
  2829. sheathed=false
  2830. jammed=false
  2831.  
  2832.  
  2833.  
  2834.  
  2835.  
  2836.  
  2837.  
  2838.  
  2839.  
  2840.  
  2841.  
  2842. local minimumsize = Vector3.new(0.7,0.7,0.7) --Minimumsize for a part to get divided,higher numbers = less detailed and bigger/less bricks
  2843. local surface_between_splitted_parts = 'SmoothNoOutlines' --the surface between splitted parts
  2844. --local fragmented = workspace:FindFirstChild("Fragmented")
  2845. local fragmentable = workspace --all fragmentable objects should be stored in here
  2846. local list = {}
  2847. local brickcount = 0
  2848. --local m = Instance.new("Hint",workspace)
  2849. local storage = {}
  2850. local fillup = 1000 --it constantly generates new parts until it reaches this number(hacky way to prevent lagspikes if there is a large explosion),change it to 0 if you don´t want it to generate (useless) parts.
  2851. local maximumstorage = 2000 --it will recycle parts if the number of parts in the storage doesnt exceed this number
  2852. local storage_position = Vector3.new(0,0,5000) --place them somewhere off the map
  2853. local stored_partsize = Vector3.new(1,1,1) --make them small
  2854. local parts_created_per_frame = 5 --number of parts being created per frame to fill up the storage
  2855.  
  2856.  
  2857. function fragmentate(cframe,size,color,explosion_position,explosion_blastradius,backsurface,bottomsurface,frontsurface,leftsurface,rightsurface,topsurface,transparency,reflectance)
  2858. local xi = size.X >= minimumsize.X*(1+explosion_blastradius/16) and 2 or 1 --to reduce the lagg in large explosions we increase minimumsize based on the explosionradius...
  2859. local yi = size.Y >= minimumsize.Y*(1+explosion_blastradius/16) and 2 or 1
  2860. local zi = size.Z >= minimumsize.Z*(1+explosion_blastradius/16) and 2 or 1
  2861. if xi == 1 and yi == 1 and zi == 1 or (cframe.p-explosion_position).magnitude > size.magnitude/2 + explosion_blastradius then --don´t fragmentate parts, that are too small to fragmentate or too far away from the explosion
  2862. if xi == 1 and yi == 1 and zi == 1 then return end --optional
  2863. if #storage > 0 then
  2864. local p = storage[1]
  2865. p.BrickColor = color
  2866. p.Size = size
  2867. p.BackSurface = backsurface
  2868. p.BottomSurface = bottomsurface
  2869. p.FrontSurface = frontsurface
  2870. p.LeftSurface = leftsurface
  2871. p.RightSurface = rightsurface
  2872. p.TopSurface = topsurface
  2873. p.Transparency = transparency
  2874. p.CFrame = cframe
  2875. p.Reflectance = reflectance
  2876. table.remove(storage,1)
  2877. else
  2878. local p = Instance.new("Part",fragmentable)
  2879. p.BrickColor = color
  2880. p.FormFactor = "Custom"
  2881. p.Size = size
  2882. p.BackSurface = backsurface
  2883. p.BottomSurface = bottomsurface
  2884. p.FrontSurface = frontsurface
  2885. p.LeftSurface = leftsurface
  2886. p.RightSurface = rightsurface
  2887. p.TopSurface = topsurface
  2888. p.Transparency = transparency
  2889. if p.Transparency>0.285 then
  2890. p.Anchored = false
  2891. else
  2892. p.Anchored=true
  2893. p.Material='Wood'
  2894. end
  2895. p.CFrame = cframe
  2896. p.Reflectance = reflectance
  2897. end
  2898. --p:MakeJoints()
  2899. -- m.Text = m.Text+1
  2900. return --stop the function
  2901. end
  2902. local mody = math.random(-125,125)/1000 --some randomization
  2903. for y = 1,yi do
  2904. if math.random()> 0.5 then
  2905. local modx = math.random(-125,125)/1000
  2906. for x = 1,xi do
  2907. local modz = math.random(-125,125)/1000
  2908. for z = 1,zi do --offset = x/xi-0.75+modx)
  2909. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)), --maths
  2910. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  2911. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z or agent767_was_here),color,explosion_position,explosion_blastradius,
  2912. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  2913. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  2914. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  2915. end
  2916.  
  2917. end
  2918. else
  2919. local modz = math.random(-125,125)/1000
  2920. for z = 1,zi do
  2921. local modx = math.random(-125,125)/1000
  2922. for x = 1,xi do
  2923. fragmentate(cframe*CFrame.new(size.X*(xi==1 and 0 or x/xi-0.75+modx),size.Y*(yi==1 and 0 or y/yi-0.75+mody),size.Z*(zi==1 and 0 or z/zi-0.75+modz)),
  2924. Vector3.new(xi == 2 and size.X*(1-2*math.abs(x/xi-0.75+modx)) or size.X,yi == 2 and size.Y*(1-2*math.abs(y/yi-0.75+mody)) or size.Y,
  2925. zi == 2 and size.Z*(1-2*math.abs(z/zi-0.75+modz)) or size.Z),color,explosion_position,explosion_blastradius,
  2926. z~=zi and surface_between_splitted_parts or backsurface,y==2 and surface_between_splitted_parts or bottomsurface,
  2927. z==2 and surface_between_splitted_parts or frontsurface,x==2 and surface_between_splitted_parts or leftsurface,x~=xi and surface_between_splitted_parts or rightsurface,
  2928. y~=yi and surface_between_splitted_parts or topsurface,transparency,reflectance)
  2929. end
  2930. end
  2931. end
  2932. end
  2933. end
  2934.  
  2935. function start_fragmentation(position,radius)
  2936. local search = Region3.new(position-Vector3.new(radius,radius,radius)*1.1,position+Vector3.new(radius,radius,radius)*1.1)
  2937. repeat
  2938. local finish = false
  2939. local parts = workspace:FindPartsInRegion3WithIgnoreList(search,list,100) --maximum number of parts that FindPartsInRegion3 can find is 100, so we have to do this to find them all
  2940. for i = 1,#parts do
  2941. table.insert(list,1,parts[i])
  2942. end
  2943. finish = true
  2944. until #parts < 100 and finish
  2945. print(#list)
  2946. local t = tick()
  2947. for i = 1,#list do
  2948. local p = list[i]
  2949. if p:IsDescendantOf(fragmentable) and p:GetMass()<3000 and p.Transparency>0.285 and p.Name~='Base' and p:IsDescendantOf(ch)==false then
  2950. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  2951. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  2952. p.Anchored = false
  2953. p.FormFactor = "Custom"
  2954. p.Size = stored_partsize
  2955. p.Position = storage_position
  2956. table.insert(storage,1,p)
  2957. else --storage is full
  2958. p:Destroy()
  2959. end
  2960. -- m.Text = m.Text-1
  2961. end
  2962. if p:IsDescendantOf(fragmentable) and p:GetMass()<53000 and p.Transparency<0.05 and p.Name~='Base' and tostring(p.Material)=='Enum.Material.Wood' and p:IsDescendantOf(ch)==false then
  2963. fragmentate(p.CFrame,p.Size,p.BrickColor,position,radius,p.BackSurface,p.BottomSurface,p.FrontSurface,p.LeftSurface,p.RightSurface,p.TopSurface,p.Transparency,p.Reflectance)
  2964. if #storage < maximumstorage and p.Shape == "Block" then --recycle them
  2965. p.Anchored = true
  2966. p.Material='Wood'
  2967. p.FormFactor = "Custom"
  2968. p.Size = stored_partsize
  2969. p.Position = storage_position
  2970. table.insert(storage,1,p)
  2971. else --storage is full
  2972. p:Destroy()
  2973. end
  2974. -- m.Text = m.Text-1
  2975. end
  2976. end
  2977. list = {}
  2978. -- print(tick()-t)
  2979. end
  2980.  
  2981. --[[
  2982. spawn(function()
  2983. while wait() do --oh noes,a loop! So inefficient!
  2984. if #storage < fillup then
  2985. for i = 1, parts_created_per_frame do --creates parts to fill up the storage
  2986. local p = Instance.new("Part",fragmentable)
  2987. p.Anchored = false
  2988. p.FormFactor = "Custom"
  2989. p.Size = stored_partsize
  2990. p.Position = storage_position
  2991. table.insert(storage,1,p)
  2992. end
  2993. end
  2994. end
  2995. end)
  2996. ]]
  2997.  
  2998.  
  2999.  
  3000.  
  3001.  
  3002.  
  3003.  
  3004.  
  3005.  
  3006.  
  3007.  
  3008.  
  3009.  
  3010.  
  3011.  
  3012.  
  3013.  
  3014.  
  3015.  
  3016.  
  3017.  
  3018.  
  3019.  
  3020. --local blankn=22416261
  3021.  
  3022. --172121567
  3023.  
  3024. crosshairs={
  3025. {38140824};
  3026. {38140833};
  3027. {38140839};
  3028. {38140843};
  3029. {38140852};
  3030. {38140910};
  3031. {38140915};
  3032. {38140923};
  3033. {38140928};
  3034. {38140931};
  3035. {38208259};
  3036. {38208275};
  3037. {38208284};
  3038. {38208303};
  3039. {38208310};
  3040. {38208325};
  3041. {38208330};
  3042. {38208352};
  3043. {38208359};
  3044. {38208377}
  3045. }
  3046.  
  3047. bulletholes={
  3048. 172274695;
  3049. 172274721
  3050. }
  3051.  
  3052. for _,v in pairs(crosshairs) do
  3053. game:service'ContentProvider':Preload('rbxassetid://' .. tostring(v[1]-1))
  3054. end
  3055.  
  3056. currentIco=2
  3057. switchIco=function(num)
  3058. if num<20 then
  3059. else
  3060. num=20
  3061. end
  3062. mouse.Icon='rbxassetid://' .. tostring(crosshairs[num][1]-1)
  3063. currentIco=num
  3064. end
  3065.  
  3066. switchIco(currentIco)
  3067.  
  3068. heldDown=false
  3069.  
  3070. spreadint=1
  3071. --[[Settings]]--
  3072. recoil=false -- Set to true for added realism
  3073. magCapacity=20 -- How much a magazine can hold at once
  3074. magAmmo=20 -- How much ammo is in the mag
  3075. crosshairSpread=5
  3076. spread=1
  3077. pAmmunition=true -- more damage if true
  3078.  
  3079.  
  3080. jamRate=500 -- How often the gun jams(the more the less) (no less than 1)
  3081.  
  3082. primaryColor='Really black'
  3083. secondaryColor='Really black'
  3084.  
  3085. slideReflectance=0.01
  3086. slideMaterial='Plastic'
  3087.  
  3088. --[[Attachments]]--
  3089.  
  3090. silencer=true
  3091. highCapMag=false -- High capacity magazine
  3092. laser=true
  3093. automatic=false
  3094. grip=true
  3095.  
  3096.  
  3097. getSound=function(id)
  3098. game:service'ContentProvider':Preload('rbxassetid'..tostring(id))
  3099. local s=int("Sound",ch.Head)
  3100. s.SoundId='rbxassetid://' .. tostring(id)
  3101. s.Volume=1
  3102. return s
  3103. end
  3104.  
  3105. local fireSound=getSound(151997297--[[10209842]])
  3106. fireSound.Pitch=1.3
  3107. --1.8
  3108.  
  3109. local releaseSound=getSound(10209813)
  3110. releaseSound.Pitch=4
  3111.  
  3112. local reloadSound=getSound(10209636)
  3113. reloadSound.Pitch=3
  3114.  
  3115. local magazinelockSound=getSound(152206337)
  3116. magazinelockSound.Pitch=1.4
  3117.  
  3118. local slideBackSound=getSound(152206263)
  3119. slideBackSound.Pitch=2.5
  3120.  
  3121. local slideForwardSound=getSound(152206302)
  3122. slideForwardSound.Pitch=2.5
  3123.  
  3124. local emptySound=getSound(2697295)
  3125. emptySound.Pitch=5
  3126.  
  3127. local glassBreakSound=getSound(144884907)
  3128.  
  3129. local woodImpact=getSound(142082171)
  3130.  
  3131. local fleshImpact=getSound(144884872)
  3132. fleshImpact.Pitch=1.7
  3133.  
  3134. if ch:findFirstChild("Tec-99") then
  3135. ch['Tec-99']:Destroy()
  3136. end
  3137.  
  3138. local tube=int("Model",ch)
  3139. tube.Name='Tec-99'
  3140. local hopper=Instance.new('HopperBin',plr.Backpack)
  3141. hopper.Name=tube.Name
  3142. Weld = function(p0,p1,x,y,z,rx,ry,rz,par)--recommend to use this with my weld. use this function only with arm lockers.
  3143. p0.Position = p1.Position
  3144. local w = Instance.new('Motor',par or p0)
  3145. w.Part0 = p1
  3146. w.Part1 = p0
  3147. w.C0 = CFrame.new(x or 0,y or 0,z or 0)*CFrame.Angles(rx or 0,ry or 0,rz or 0)
  3148. w.MaxVelocity = .1
  3149. return w
  3150. end
  3151. function clerp(c1,c2,sp)
  3152. local R1,R2,R3 = c1:toEulerAnglesXYZ()
  3153. local R21,R22,R23 = c2:toEulerAnglesXYZ()
  3154. return CFrame.new(
  3155. c1.X + (c2.X-c1.X)*sp,
  3156. c1.Y + (c2.Y-c1.Y)*sp,
  3157. c1.Z + (c2.Z-c1.Z)*sp)*CFrame.Angles(
  3158. R1 + (R21-R1)*sp,
  3159. R2 + (R22-R2)*sp,
  3160. R3 + (R23-R3)*sp
  3161. )
  3162. end
  3163.  
  3164. tweenTable={}
  3165. Tween = function(Weld, Stop, Step,a)
  3166. ypcall(function()
  3167. local func = function()
  3168. local Start = Weld.C1
  3169. local X1, Y1, Z1 = Start:toEulerAnglesXYZ()
  3170. local Stop = Stop
  3171. local X2, Y2, Z2 = Stop:toEulerAnglesXYZ()
  3172. if not Step then Step=0.1 end
  3173. table.insert(tweenTable,{th=0,Weld=Weld,Step=Step,Start=Start,X1=X1,Y1=Y1,Z1=Z1,Stop=Stop,X2=X2,Y2=Y2,Z2=Z2})
  3174. end
  3175. if a then coroutine.wrap(func)() else func() end
  3176. end)
  3177. end
  3178. weld=function(p0,p1,c0)
  3179. local w=Instance.new("Weld",p0)
  3180. w.Part0=p0
  3181. w.Part1=p1
  3182. w.C0=c0
  3183. return w
  3184. end
  3185. cp=function(parent,color,size,anchored,cancollide)
  3186. local newp=Instance.new("Part",parent)
  3187. newp.TopSurface='SmoothNoOutlines'
  3188. newp.BottomSurface='SmoothNoOutlines'
  3189. newp.FrontSurface='SmoothNoOutlines'
  3190. newp.BackSurface='SmoothNoOutlines'
  3191. newp.RightSurface='SmoothNoOutlines'
  3192. newp.LeftSurface='SmoothNoOutlines'
  3193. newp.FormFactor="Custom"
  3194. newp.BrickColor=bc(color)
  3195. newp.Size=size
  3196. newp.Anchored=anchored
  3197. newp.CanCollide=cancollide
  3198. newp:BreakJoints()
  3199. return newp
  3200. end
  3201.  
  3202. initializeJoints=function()
  3203. rabr = cp(tube,'White',Vector3.new(1,1,1),false,false) rabr.Transparency = 1 rabr.Name='Locker'
  3204. rabr.Position = torso.Position
  3205. rw = Weld(rabr,torso,1.5,.5,0,0,0,0) rw.Parent = tube rw.Name = 'rw'
  3206. w = Instance.new("Weld",tube)
  3207. w.Part0,w.Part1 = ch['Right Arm'],rabr
  3208. w.C1 = CFrame.new(0,-.5,0)
  3209. labr = cp(tube,'White',Vector3.new(1,1,1),false,false) labr.Transparency = 1 labr.Name='Locker'
  3210. labr.Position = torso.Position
  3211. lw = Weld(labr,torso,-1.5,.5,0,0,0,0) lw.Parent = tube lw.Name = 'lw'
  3212. ww = Instance.new("Weld",tube)
  3213. ww.Part0,ww.Part1 = ch['Left Arm'],labr
  3214. ww.C1 = CFrame.new(0,-.5,0)
  3215. end
  3216.  
  3217. initializeJoints()
  3218.  
  3219. --[[ leg locks
  3220. rabl = cp(tube,'White',Vector3.new(1,1,1),false,false) rabl.Transparency = 1 rabl.Name='Locker'
  3221. rabl.Position = torso.Position
  3222. rwl = Weld(rabl,torso,0.5,-1.5,0,0,0,0) rwl.Parent = tube rwl.Name = 'rwl'
  3223. wl = Instance.new("Weld",tube)
  3224. wl.Part0,wl.Part1 = ch['Right Leg'],rabl
  3225. wl.C1 = CFrame.new(0,-.5,0)
  3226. labl = cp(tube,'White',Vector3.new(1,1,1),false,false) labl.Transparency = 1 labl.Name='Locker'
  3227. labl.Position = torso.Position
  3228. lwl = Weld(labl,torso,-0.5,-1.5,0,0,0,0) lwl.Parent = tube lwl.Name = 'lwl'
  3229. wwl = Instance.new("Weld",tube)
  3230. wwl.Part0,wwl.Part1 = ch['Left Leg'],labl
  3231. wwl.C1 = CFrame.new(0,-.5,0)
  3232. ]]
  3233. --weld(ch['HumanoidRootPart'],torso,cfn())
  3234.  
  3235.  
  3236. local counter=Instance.new('ScreenGui',plr.PlayerGui)
  3237. local frame=Instance.new('Frame',counter)
  3238. frame.Size=UDim2.new(0.25,0,0.3,0)
  3239.  
  3240. frame.Position=UDim2.new(0.1,0,0.4,0)
  3241. frame.BackgroundTransparency=1
  3242.  
  3243. local ammocounter=Instance.new('TextLabel',frame)
  3244. ammocounter.Size=UDim2.new(1,0,0.3,0)
  3245. ammocounter.Position=UDim2.new(0,0,0.2,0)
  3246. ammocounter.BackgroundTransparency=1
  3247. ammocounter.TextColor3=BrickColor.new('White').Color
  3248. ammocounter.Font='SourceSansBold'
  3249. ammocounter.FontSize='Size18'
  3250. ammocounter.Text=''
  3251. ammocounter.TextXAlignment='Left'
  3252.  
  3253.  
  3254. local bg = Instance.new("BodyGyro",rootpart)
  3255. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  3256. bg.P = 10000
  3257. bg.D = 100
  3258.  
  3259.  
  3260. cyl=function(prt)
  3261. local c=int("CylinderMesh",prt)
  3262. return c
  3263. end
  3264. blo=function(prt)
  3265. local c=int("BlockMesh",prt)
  3266. return c
  3267. end
  3268.  
  3269. if laser then
  3270. aLaser=cp(tube,'Really red',Vector3.new(0.2,0.2,0.2))
  3271. aLaser.Transparency=1
  3272. cyl(aLaser).Scale=Vector3.new(0.25,1,0.25)
  3273. aLaser.Anchored=true
  3274. end
  3275.  
  3276. local handle=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.3))
  3277. blo(handle).Scale=Vector3.new(1.15,0.9,1)
  3278. local mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  3279.  
  3280. local framepiece1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.9))
  3281. blo(framepiece1).Scale=Vector3.new(1.15,0.5,1)
  3282. weld(handle,framepiece1,cfn(0,0.354,-0.3)*ang(mr(11.5),0,0))
  3283.  
  3284. local barrel=cp(tube,'Medium stone grey',Vector3.new(0.2,0.2,0.2))
  3285. cyl(barrel).Scale=Vector3.new(0.7,1.2,0.7)
  3286. weld(framepiece1,barrel,cfn(0,0.15,-0.1)*ang(mr(-90),0,0))
  3287.  
  3288. local sbarrel=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  3289. cyl(sbarrel).Scale=Vector3.new(0.7,1.5,0.7)
  3290. weld(barrel,sbarrel,cfn(0,0.35,0))
  3291. local hole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  3292. hole.Transparency=1
  3293. weld(sbarrel,hole,cfn(0,0.2,0))
  3294. local flash=int('PointLight',hole)
  3295. flash.Enabled=false
  3296. flash.Range=10
  3297. flash.Color=BrickColor.new('Neon orange').Color
  3298.  
  3299.  
  3300. local slide1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  3301. slide1.CanCollide=false
  3302. blo(slide1).Scale=Vector3.new(0.7,1,1.1)
  3303. slideweld1=weld(framepiece1,slide1,cfn(0,0.15,0.23))
  3304. slide1.Reflectance=slideReflectance
  3305. slide1.Material=slideMaterial
  3306.  
  3307. local slide2=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.4))
  3308. slide2.CanCollide=false
  3309. blo(slide2).Scale=Vector3.new(0.7,1,1.1)
  3310. slideweld2=weld(slide1,slide2,cfn(0,0,-0.666))
  3311. slide2.Reflectance=slideReflectance
  3312. slide2.Material=slideMaterial
  3313.  
  3314. local slideside1=cp(tube,secondaryColor,Vector3.new(0.2,0.2,1.1))
  3315. slideside1.CanCollide=true
  3316. blo(slideside1).Scale=Vector3.new(0.25,1,1)
  3317. weld(slide1,slideside1,cfn(-0.09,0,-0.335))
  3318. slideside1.Reflectance=slideReflectance
  3319. slideside1.Material=slideMaterial
  3320.  
  3321. local slideside2=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  3322. slideside2.CanCollide=true
  3323. blo(slideside2).Scale=Vector3.new(0.25,1,1.1)
  3324. weld(slide1,slideside2,cfn(0.09,0,0))
  3325. slideside2.Reflectance=slideReflectance
  3326. slideside2.Material=slideMaterial
  3327.  
  3328. local slideside3=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.3))
  3329. slideside3.CanCollide=true
  3330. blo(slideside3).Scale=Vector3.new(0.25,0.6,0.78)
  3331. weld(slideside2,slideside3,cfn(0,-0.04,-0.335))
  3332. slideside3.Reflectance=slideReflectance
  3333. slideside3.Material=slideMaterial
  3334.  
  3335. local slideside4=cp(tube,secondaryColor, Vector3.new(0.2,0.2,0.4))
  3336. blo(slideside4).Scale=Vector3.new(0.25,1,1.1)
  3337. weld(slide2,slideside4,cfn(0.09,0,0))
  3338. slideside4.Reflectance=slideReflectance
  3339. slideside4.Material=slideMaterial
  3340.  
  3341. local mgs=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3342. blo(mgs).Scale=Vector3.new(1.15,0.425,0.245)
  3343. weld(handle,mgs,cfn(0,-0.3,0.125))
  3344.  
  3345. --[[Trigger]]--
  3346. local tp1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3347. blo(tp1).Scale=Vector3.new(0.6,0.1,0.8)
  3348. weld(framepiece1,tp1,cfn(0,-0.22,0.13))
  3349.  
  3350. local tp2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3351. blo(tp2).Scale=Vector3.new(0.6,0.1,1.19)
  3352. weld(framepiece1,tp2,cfn(0,-0.14,-0.0265)*ang(mr(45),0,0))
  3353.  
  3354. local trigger1=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  3355. blo(trigger1).Scale=Vector3.new(0.3,0.4,0.16)
  3356. weld(framepiece1,trigger1,cfn(0,-0.07,0.09))
  3357.  
  3358. local trigger2=cp(tube,'Really black',Vector3.new(0.2,0.2,0.2))
  3359. blo(trigger2).Scale=Vector3.new(0.3,0.3,0.16)
  3360. weld(trigger1,trigger2,cfn(0,-0.06,-0.015)*ang(mr(30),0,0))
  3361.  
  3362.  
  3363. --[[Magazine]]--
  3364.  
  3365. local magh=cp(tube,'Really black',Vector3.new(0.2,0.5,0.2))
  3366. blo(magh).Scale=Vector3.new(0.6,1,1)
  3367. local magweld=weld(handle,magh,cfn(0,-0.025,0))
  3368.  
  3369. local bottom=cp(tube,'Really black',Vector3.new(0.2,0.2,0.3))
  3370. blo(bottom).Scale=Vector3.new(1.15,0.385,0.8)
  3371. bottomweld=weld(magh,bottom,cfn(0,-0.28,-0.015))
  3372.  
  3373. if highCapMag then
  3374. magweld:Destroy()
  3375. magh.Size=Vector3.new(0.2,0.7,0.2)
  3376. magweld=weld(handle,magh,cfn(0,-0.125,0))
  3377. bottomweld:Destroy()
  3378. bottomweld=weld(magh,bottom,cfn(0,-0.38,-0.015))
  3379. magCapacity=magCapacity+23
  3380. magAmmo=magAmmo+23
  3381. end
  3382.  
  3383. --[[Sights]]--
  3384. local backsight1=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  3385. blo(backsight1).Scale=Vector3.new(0.3,0.3,0.3)
  3386. weld(slide1,backsight1,cfn(0.06,0.1,0.13))
  3387. local backsight2=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  3388. blo(backsight2).Scale=Vector3.new(0.3,0.3,0.3)
  3389. weld(slide1,backsight2,cfn(-0.06,0.1,0.13))
  3390.  
  3391. local frontsight=cp(tube,'Black',Vector3.new(0.2,0.2,0.2))
  3392. blo(frontsight).Scale=Vector3.new(0.3,0.3,0.3)
  3393. weld(slide1,frontsight,cfn(0,0.1,-0.85))
  3394.  
  3395. local dot1=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  3396. cyl(dot1).Scale=Vector3.new(0.1,0.31,0.1)
  3397. weld(backsight1,dot1,cfn(0,0.014,0)*ang(mr(-90),0,0))
  3398.  
  3399. local dot2=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  3400. cyl(dot2).Scale=Vector3.new(0.1,0.31,0.1)
  3401. weld(backsight2,dot2,cfn(0,0.014,0)*ang(mr(-90),0,0))
  3402.  
  3403. local dot3=cp(tube,'Lime green',Vector3.new(0.2,0.2,0.2))
  3404. cyl(dot3).Scale=Vector3.new(0.1,0.31,0.1)
  3405. weld(frontsight,dot3,cfn(0,0.014,0)*ang(mr(-90),0,0))
  3406.  
  3407. local ba=cp(tube,secondaryColor,Vector3.new(0.2,0.2,0.2))
  3408. blo(ba).Scale=Vector3.new(1.15,0.5,1)
  3409. weld(framepiece1,ba,cfn(0,0,-0.55))
  3410. ba.Reflectance=slideReflectance
  3411. ba.Material=slideMaterial
  3412.  
  3413. local weirdholethatpistolshave=cp(tube,'Really black', Vector3.new(0.2,0.2,0.2))
  3414. cyl(weirdholethatpistolshave).Scale=Vector3.new(0.4,1.01,0.4)
  3415. weld(ba,weirdholethatpistolshave,cfn(0,0,0)*ang(mr(-90),0,0))
  3416.  
  3417. --[[Tactical Rails]]--
  3418.  
  3419. local r1=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3420. blo(r1).Scale=Vector3.new(1.15,0.2,0.25)
  3421. weld(framepiece1,r1,cfn(0,-0.05,-0.17))
  3422.  
  3423. local r2=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3424. blo(r2).Scale=Vector3.new(1.15,0.2,0.25)
  3425. weld(framepiece1,r2,cfn(0,-0.05,-0.27))
  3426.  
  3427. local r3=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.2))
  3428. blo(r3).Scale=Vector3.new(1.15,0.2,0.25)
  3429. weld(framepiece1,r3,cfn(0,-0.05,-0.37))
  3430.  
  3431. if laser then
  3432. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  3433. blo(base).Scale=Vector3.new(1.15,1,1)
  3434. weld(r2,base,cfn(0,-0.05,0))
  3435. basehole=cp(tube,'White',Vector3.new(0.2,0.2,0.2))
  3436. cyl(basehole).Scale=Vector3.new(0.4,0.4,0.4)
  3437. weld(base,basehole,cfn(0,0,-0.13)*ang(mr(-90),0,0))
  3438. end
  3439.  
  3440. if silencer then
  3441. local sil=cp(tube,'Really black',Vector3.new(0.2,0.3,0.2))
  3442. fireSound.SoundId='rbxassetid://153230595'
  3443. fireSound.Pitch=1
  3444. cyl(sil).Scale=Vector3.new(0.94,1.8,0.94)
  3445. weld(hole,sil,cfn(0,0.29,0))
  3446. end
  3447.  
  3448. if grip then
  3449. local base=cp(tube,primaryColor,Vector3.new(0.2,0.2,0.3))
  3450. blo(base).Scale=Vector3.new(1.15,1,1)
  3451. weld(r2,base,cfn(0,-0.05,0))
  3452. local hd=cp(tube,primaryColor,Vector3.new(0.2,0.6,0.2))
  3453. cyl(hd)
  3454. weld(base,hd,cfn(0,-0.3,0))
  3455. crosshairSpread=3
  3456. spreadint=spreadint-0.3
  3457. end
  3458.  
  3459. --[[Test Functions]]--
  3460.  
  3461. local debounce=false
  3462. local out=false
  3463. local bs=false
  3464. cockSlide=function() -- hahaha yes i know
  3465. slideBackSound:Play()
  3466. if magAmmo<1 and out==true and bs==false then
  3467. wait()
  3468. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  3469. else
  3470. for i=1,2 do
  3471. wait()
  3472. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  3473. end
  3474. end
  3475. local ajar=false
  3476. if magAmmo==1 then
  3477. ajar=true
  3478. end
  3479. if magAmmo>0 then
  3480. createShell()
  3481. --magAmmo=magAmmo-1
  3482. ammocounter.Text=''
  3483. for i=1,magAmmo do
  3484. ammocounter.Text=ammocounter.Text .. 'I'
  3485. end
  3486. end
  3487. wait(0.15)
  3488. slideForwardSound:Play()
  3489. for i=1,2 do
  3490. wait()
  3491. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  3492. end
  3493. if ajar==true then
  3494. out=true
  3495. slideweld1.C0=cfn(0,0.15,0.23)
  3496. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  3497. end
  3498. end
  3499.  
  3500. --fx
  3501. local firefx=cp(tube,'Neon orange',Vector3.new(0.7,1.1,0.7))
  3502. firefx.Transparency=1
  3503. local mesh=Instance.new('SpecialMesh',firefx)
  3504. mesh.MeshType='Sphere'
  3505. firefx.Material='Neon'
  3506. weld(hole,firefx,cfn(0,1,0))
  3507.  
  3508. local smokefx=Instance.new('Smoke',hole)
  3509. smokefx.Enabled=false
  3510. barrel.CanCollide=true
  3511.  
  3512.  
  3513.  
  3514.  
  3515. local oc = oc or function(...) return ... end
  3516.  
  3517. function ragJoint(hit,r,d)
  3518. Spawn(oc(function()
  3519. d = d or 0
  3520. local rpar,r0,r1 = r.Parent,r.Part0,r.Part1
  3521. if d > 0 then wait(d) end
  3522. local p = hit:Clone()
  3523. p:BreakJoints()
  3524. p:ClearAllChildren()
  3525. p.FormFactor = "Custom"
  3526. p.Size = p.Size/2
  3527. p.Transparency = 1
  3528. p.CanCollide = true
  3529. p.Name = "Colliduh"
  3530. p.Parent = hit
  3531. local w = Instance.new("Weld",p)
  3532. w.Part0 = hit
  3533. w.Part1 = p
  3534. w.C0 = CFrame.new(0,-p.Size.Y/2,0)
  3535. local rot = Instance.new("Rotate",rpar)
  3536. rot.Name = r.Name
  3537. rot.Part0 = r0
  3538. rot.Part1 = r1
  3539. rot.C0 = r.C0
  3540. rot.C1 = r.C1
  3541. r0.Velocity = Vector3.new()
  3542. r1.Velocity = Vector3.new()
  3543. r:Destroy()
  3544. end))
  3545. end
  3546.  
  3547.  
  3548. createShell=function()
  3549. local shell=cp(tube,'Deep orange',Vector3.new(0.2,0.3,0.2))
  3550. shell.CanCollide=true
  3551. shell.Reflectance=0.3
  3552. cyl(shell)
  3553. shell.CFrame=barrel.CFrame*ang(mr(-90),0,0)
  3554. magAmmo=magAmmo-1
  3555. ammocounter.Text=''
  3556. for i=1,magAmmo do
  3557. ammocounter.Text=ammocounter.Text .. 'I'
  3558. end
  3559. game.Debris:AddItem(shell,3)
  3560. end
  3561.  
  3562. reloadPistol=function()
  3563. local current=magAmmo
  3564. Tween(lw,cfn())
  3565. Tween(rw,cfn()*ang(mr(-102),0,0))
  3566. wait(0.4)
  3567. releaseSound:Play()
  3568. bottom.Transparency=1
  3569. magh.Transparency=1
  3570. local mag1=magh:clone()
  3571. mag1.Transparency=0
  3572. mag1.Weld:Destroy''
  3573. local mag2=bottom:clone()
  3574. mag2.Transparency=0
  3575. mag1:BreakJoints''
  3576. mag2:BreakJoints''
  3577. local bm1=mag1:clone()
  3578. local bm2=mag2:clone()
  3579. mag1.Parent=tube
  3580. mag2.Parent=tube
  3581. mag1.CFrame=magh.CFrame
  3582. weld(mag1,mag2,cfn(0,-0.28,-0.015))
  3583. magAmmo=0
  3584. ammocounter.Text=''
  3585. for i=1,magAmmo do
  3586. ammocounter.Text=ammocounter.Text .. 'I'
  3587. end
  3588. wait()
  3589. mag1.CanCollide=true
  3590. mag2.CanCollide=true
  3591. game.Debris:AddItem(mag1,2)
  3592. game.Debris:AddItem(mag2,2)
  3593. wait(0.1)
  3594. Tween(lw,cfn()*ang(mr(25),0,0))
  3595. bm1.Parent=tube
  3596. bm2.Parent=tube
  3597. weld(bm1,bm2,cfn(0,-0.28,-0.015))
  3598. local fa=weld(ch['Left Arm'],bm1,cfn(0,-1.1,0)*ang(mr(-90),0,0))
  3599. wait(0.1)
  3600. Tween(lw,cfn(0,1.4,0)*ang(mr(-109),mr(60),mr(10)),0.07)
  3601. wait(0.25)
  3602. magazinelockSound:Play()
  3603. wait()
  3604. -- reloadSound:Play()
  3605. fa:Destroy''
  3606. bm1:Destroy''
  3607. bm2:Destroy''
  3608. bottom.Transparency=0
  3609. magh.Transparency=0
  3610. local totalcap=0
  3611. if current<1 then --none in chamber reload
  3612. --slideweld1.C0=cfn(0,0,0.45)
  3613. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  3614. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  3615. wait(0.1)
  3616. spawn(function()
  3617. cockSlide()
  3618. end)
  3619. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  3620. wait(0.3)
  3621. totalcap=magCapacity
  3622. else
  3623. totalcap=magCapacity+1
  3624. end
  3625. magAmmo=totalcap
  3626. out=false
  3627. ammocounter.Text=''
  3628. for i=1,magAmmo do
  3629. ammocounter.Text=ammocounter.Text .. 'I'
  3630. end
  3631. restorePosition()
  3632. end
  3633.  
  3634. firePistol=function()
  3635. switchIco(currentIco+crosshairSpread)
  3636. if not jammed and not out then
  3637. spread=spread+spreadint
  3638. end
  3639. print(spread)
  3640. fireSound.Pitch=math.random(math.random(fireSound.Pitch-0.2,fireSound.Pitch-0.1),math.random(fireSound.Pitch,fireSound.Pitch+0.1))
  3641. if magAmmo>0 and jammed==false then
  3642. local ajar=false
  3643. if magAmmo==1 then
  3644. ajar=true
  3645. end
  3646. user=ch
  3647. local ray = Ray.new(hole.CFrame.p, ((m.Hit.p+Vector3.new(math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35,math.random(-spread,spread)/6.35) )- hole.CFrame.p).unit*300)
  3648. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  3649. if hit then
  3650. if hit.Transparency>0.285 and hit:GetMass()<3000 and hit.Parent.className~='Hat' then
  3651. local temps=glassBreakSound:clone()
  3652. temps.Parent=hit
  3653. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  3654. temps:Play''
  3655. start_fragmentation(position,.25)
  3656. end
  3657. if tostring(hit.Material)=='Enum.Material.Wood' and hit.Transparency<0.05 then
  3658. local temps=woodImpact:clone()
  3659. temps.Volume=1
  3660. temps.Pitch=math.random(math.random(temps.Pitch-0.2,temps.Pitch-0.1),math.random(temps.Pitch,temps.Pitch+0.1))
  3661. temps.Parent=hit
  3662. temps:Play''
  3663. start_fragmentation(position,.15)
  3664. end
  3665. ypcall(function()
  3666. if hit and hit.Parent and hit.Parent:findFirstChild'Humanoid' then
  3667. local temps=fleshImpact:clone()
  3668. temps.Parent=hit
  3669. temps:Play()
  3670. if hit.Name~='Head' then
  3671. if pAmmunition==true then
  3672. hit.Parent.Humanoid:TakeDamage(math.random(30,65))
  3673. else
  3674. hit.Parent.Humanoid:TakeDamage(math.random(10,24))
  3675. end
  3676. local guy=hit.Parent
  3677. if guy.Name~='TheDarkRevenant' then
  3678. for i,v in pairs(guy:GetChildren()) do
  3679. if v.className=='Hat' then
  3680. v.Handle:BreakJoints()
  3681. end
  3682. local r = guy.Torso:FindFirstChild(v.Name:gsub("Arm","Shoulder"):gsub("Leg","Hip"))
  3683. if v:IsA("BasePart") and r then
  3684. ragJoint(v,r,.1)
  3685. elseif v:IsA("Humanoid") then
  3686. spawn(function()
  3687. wait(0.5)
  3688. v.PlatformStand = true
  3689. v.Changed:connect(function()
  3690. v.PlatformStand = true
  3691. end)
  3692. end)
  3693. end
  3694. end
  3695. end
  3696.  
  3697. else
  3698. if hit.Parent.Name~='TheDarkRevenant' then
  3699. hit.Parent:BreakJoints()
  3700. end
  3701. end
  3702. end
  3703.  
  3704. if hit.Parent.className=='Hat' then
  3705. hit.CanCollide=true
  3706. hit:BreakJoints()
  3707. hit.Velocity=m.Hit.p*5
  3708. end
  3709. end)
  3710. end
  3711. if m.Target then
  3712. local p = Instance.new("Part")
  3713. p.formFactor = "Custom"
  3714. p.Size = Vector3.new(0.5,0.5,0.5)
  3715. p.Transparency = 1
  3716. p.CanCollide = false
  3717. p.Locked = true
  3718. p.CFrame = CFrame.new(position.x,position.y,position.z)--mouse.Target.CFrame+(mouse.Hit.p-mouse.Target.Position)
  3719. local w = Instance.new("Weld")
  3720. w.Part0 = mouse.Target
  3721. w.Part1 = p
  3722. w.C0 = mouse.Target.CFrame:inverse()
  3723. w.C1 = p.CFrame:inverse()
  3724. w.Parent = p
  3725. local d = Instance.new("Decal")
  3726. d.Parent = p
  3727. d.Face = mouse.TargetSurface
  3728. d.Texture = 'rbxassetid://' .. tostring(bulletholes[math.random(#bulletholes)]-2)
  3729. p.Parent = tube
  3730. game.Debris:AddItem(p,6)
  3731. end
  3732. if recoil==true then
  3733. cam:SetRoll(math.random(-2,2))
  3734. cam:TiltUnits(0.501)
  3735. end
  3736. local th=cp(tube,"Really black",Vector3.new(1,1,1))
  3737. th.CanCollide=false
  3738. th.Anchored=true
  3739. th.CFrame=CFrame.new(position.x,position.y,position.z)
  3740. local spm=Instance.new('SpecialMesh',th)
  3741. spm.MeshType='Sphere'
  3742. spm.Scale=Vector3.new(0.05,0.05,0.05)
  3743. spawn(function()
  3744. for i=1,5 do
  3745. wait()
  3746. spm.Scale=spm.Scale+Vector3.new(0.16,0.16,0.16)
  3747. th.Transparency=th.Transparency+0.2
  3748. end
  3749. th:Destroy()
  3750. end)
  3751. fireSound:Play()
  3752. spawn(function()
  3753. firefx.Transparency=0
  3754. wait()
  3755. firefx.Transparency=1
  3756. end)
  3757. spawn(function()
  3758. flash.Enabled=true
  3759. for i=1,2 do
  3760. wait()
  3761. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  3762. end
  3763. flash.Enabled=false
  3764. createShell()
  3765. for i=1,2 do
  3766. wait()
  3767. slideweld1.C0=slideweld1.C0*cfn(0,0,-0.22)
  3768. end
  3769. slideweld1.C0=cfn(0,0.15,0.23)
  3770. if ajar==true then
  3771. out=true
  3772. slideweld1.C0=cfn(0,0.15,0.23)
  3773. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  3774. end
  3775. end)
  3776. ammocounter.Text=''
  3777. for i=1,magAmmo do
  3778. ammocounter.Text=ammocounter.Text .. 'I'
  3779. end
  3780. wait()
  3781. Tween(rw,cfn(0,0.7,0)*ang(mr(-100),mr(-30),0),0.62)
  3782. if not grip then
  3783. Tween(lw,cfn(0,0.7,0)*ang(mr(-100),mr(30),0),0.62)
  3784. else
  3785. Tween(lw,cfn(0,1.3,0)*ang(mr(-100),mr(30),0),0.62)
  3786. end
  3787. wait(0.065)
  3788. restorePosition(0.3)
  3789. else
  3790. if magAmmo<1 then
  3791. slideweld1.C0=cfn(0,0.15,0.23)
  3792. slideweld1.C0=slideweld1.C0*cfn(0,0,0.22)
  3793. end
  3794. emptySound:Play()
  3795. end
  3796. if math.random(jamRate)==jamRate and magAmmo>0 then
  3797. jammed=true
  3798. end
  3799. end
  3800.  
  3801. debounced=function()
  3802. if sheathed==false and debounce==false then
  3803. return true
  3804. end
  3805. end
  3806.  
  3807. mouse.Button1Down:connect(function()
  3808. if debounced() then
  3809. if automatic==false then
  3810. debounce=true
  3811. firePistol()
  3812. debounce=false
  3813. else
  3814. heldDown=true
  3815. firePistol()
  3816. end
  3817. end
  3818. end)
  3819.  
  3820. mouse.Button1Up:connect(function()
  3821. heldDown=false
  3822. end)
  3823.  
  3824. sheathGun=function()
  3825. ammocounter.Visible=false
  3826. if laser then
  3827. laserEnabled=false
  3828. aLaser.Transparency=1
  3829. end
  3830. Tween(rw,cfn())
  3831. Tween(lw,cfn())
  3832. wait(0.1)
  3833. mw:Destroy''
  3834. mw=nil
  3835. mw=weld(tor,handle,cfn(1.11,-1.09,0)*ang(mr(-111.5),0,0))
  3836. labr:Destroy()
  3837. rabr:Destroy()
  3838. bg.maxTorque=Vector3.new()
  3839. sheathed=true
  3840. end
  3841.  
  3842. unsheathGun=function()
  3843. ammocounter.Visible=true
  3844. mw:Destroy''
  3845. mw=nil
  3846. initializeJoints()
  3847. mw=weld(ch['Right Arm'],handle,cfn(-0.4,-1,-0.19)*ang(mr(-101.5),0,0)*cfn()*ang(0,mr(-30),mr(-5)))
  3848. restorePosition()
  3849. bg.maxTorque = Vector3.new(math.huge,math.huge,math.huge)
  3850. sheathed=false
  3851. end
  3852.  
  3853. laserEnabled=false
  3854.  
  3855. mouse.KeyDown:connect(function(key)
  3856. if key=='r' and debounced() then
  3857. debounce=true
  3858. reloadPistol()
  3859. debounce=false
  3860. elseif key=='f' and debounced() then
  3861. debounce=true
  3862. bs=true
  3863. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0))
  3864. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(35),0))
  3865. wait(0.1)
  3866. spawn(function()
  3867. cockSlide()
  3868. end)
  3869. Tween(lw,cfn(0,0.7,0)*ang(mr(-115),mr(55),0))
  3870. wait(0.3)
  3871. jammed=false
  3872. restorePosition()
  3873. bs=false
  3874. debounce=false
  3875. elseif key=='l' and debounced() then
  3876. if not laserEnabled then
  3877. laserEnabled=true
  3878. aLaser.Transparency=0.35
  3879. else
  3880. laserEnabled=false
  3881. aLaser.Transparency=1
  3882. end
  3883. end
  3884. end)
  3885.  
  3886. restorePosition=function(speed)
  3887. if not grip then
  3888. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  3889. Tween(lw,cfn(0,0.7,0)*ang(mr(-90),mr(30),0),speed)
  3890. else
  3891. Tween(rw,cfn(0,0.7,0)*ang(mr(-90),mr(-30),0),speed)
  3892. Tween(lw,cfn(0,1.3,0)*ang(mr(-90),mr(30),0),speed)
  3893. end
  3894. end
  3895.  
  3896. hopper.Selected:connect(function()
  3897. unsheathGun()
  3898. end)
  3899.  
  3900. hopper.Deselected:connect(function()
  3901. sheathGun()
  3902. end)
  3903.  
  3904. game:service'RunService'.RenderStepped:connect(function()
  3905. bg.cframe = CFrame.new(rootpart.Position,mouse.Hit.p*Vector3.new(1,0,1)+rootpart.Position*Vector3.new(0,1,0))
  3906. if laserEnabled==true then
  3907. local user=ch
  3908. local ray = Ray.new(hole.CFrame.p, (m.Hit.p - hole.CFrame.p).unit*300)
  3909. local hit, position = game.Workspace:FindPartOnRay(ray, user)
  3910. local distance = (position - basehole.CFrame.p).magnitude
  3911. aLaser.Size=Vector3.new(0.2,distance,0.2)
  3912. aLaser.CFrame=CFrame.new(position, basehole.CFrame.p) * CFrame.new(0, 0, -distance/2) * ang(mr(-90),0,0)
  3913. end
  3914. for _,v in pairs(tweenTable) do
  3915. if v.Weld.C1==v.Stop then
  3916. table.remove(tweenTable,_)
  3917. else
  3918. if v.th<0.9 then
  3919. v.th=v.th+v.Step
  3920. i=v.th
  3921. v.Weld.C1 = CFrame.new( (v.Start.p.X * (1 - i)) + (v.Stop.p.X * i),
  3922. (v.Start.p.Y * (1 - i)) + (v.Stop.p.Y * i),
  3923. (v.Start.p.Z * (1 - i)) + (v.Stop.p.Z * i)) * CFrame.fromEulerAnglesXYZ(
  3924. (v.X1 * (1 - i)) + (v.X2 * i), (v.Y1 * (1 - i)) + (v.Y2 * i),
  3925. (v.Z1 * (1 - i)) + (v.Z2 * i) )
  3926. else
  3927. v.Weld.C1 = v.Stop
  3928. end
  3929. end
  3930. end
  3931. end)
  3932. for i=1,magAmmo do
  3933. ammocounter.Text=ammocounter.Text .. 'I'
  3934. end
  3935.  
  3936. sheathGun()
  3937.  
  3938. spawn(function()
  3939. while wait(0.07) do
  3940. if heldDown==true then
  3941. spawn(function()
  3942. firePistol()
  3943. end)
  3944. end
  3945. end
  3946. end)
  3947. m.TargetFilter=tube
  3948.  
  3949. while wait(0.03) do
  3950. if spread>1 then
  3951. spread=spread-spreadint/4
  3952. end
  3953. if spread<1 then
  3954. spread=1
  3955. end
  3956. if currentIco>2 then
  3957. switchIco(currentIco-1)
  3958. end
  3959. end
  3960.  
  3961. --hl/https://httpget-inumeration.c9.io/mp45.lua
  3962. --local/game.Players.Conmiro:Destroy''
Advertisement
Add Comment
Please, Sign In to add comment
Advertisement
Public Pastes
Advertisement
We use cookies for various purposes including analytics. By continuing to use Pastebin, you agree to our use of cookies as described in the Cookies Policy.  OK, I Understand
Not a member of Pastebin yet?
Sign Up, it unlocks many cool features!